DE4007667C1 - - Google Patents
Info
- Publication number
- DE4007667C1 DE4007667C1 DE4007667A DE4007667A DE4007667C1 DE 4007667 C1 DE4007667 C1 DE 4007667C1 DE 4007667 A DE4007667 A DE 4007667A DE 4007667 A DE4007667 A DE 4007667A DE 4007667 C1 DE4007667 C1 DE 4007667C1
- Authority
- DE
- Germany
- Prior art keywords
- ski
- sole
- holding device
- boot
- support bearing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 238000006073 displacement reaction Methods 0.000 description 3
- 238000013461 design Methods 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- 238000012549 training Methods 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63C—SKATES; SKIS; ROLLER SKATES; DESIGN OR LAYOUT OF COURTS, RINKS OR THE LIKE
- A63C9/00—Ski bindings
- A63C9/20—Non-self-releasing bindings with special sole edge holders instead of toe-straps
Landscapes
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
- Polishing Bodies And Polishing Tools (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4007667A DE4007667C1 (enExample) | 1990-03-10 | 1990-03-10 | |
| EP91103461A EP0446780B1 (de) | 1990-03-10 | 1991-03-07 | Vordere Sohlenhaltevorrichtung |
| AT91103461T ATE97827T1 (de) | 1990-03-10 | 1991-03-07 | Vordere sohlenhaltevorrichtung. |
| CA002037880A CA2037880C (en) | 1990-03-10 | 1991-03-08 | Front sole holding device |
| CS91614A CS61491A2 (en) | 1990-03-10 | 1991-03-08 | Fore holder of ski-binding |
| US07/666,239 US5249820A (en) | 1990-03-10 | 1991-03-08 | Front sole holding device |
| JP3070588A JPH05300962A (ja) | 1990-03-10 | 1991-03-11 | スキー靴の前部ソール支持装置 |
| US08/042,724 US5364118A (en) | 1990-03-10 | 1993-04-05 | Front sole holding device |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4007667A DE4007667C1 (enExample) | 1990-03-10 | 1990-03-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4007667C1 true DE4007667C1 (enExample) | 1991-06-20 |
Family
ID=6401905
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4007667A Expired - Fee Related DE4007667C1 (enExample) | 1990-03-10 | 1990-03-10 |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US5249820A (enExample) |
| EP (1) | EP0446780B1 (enExample) |
| JP (1) | JPH05300962A (enExample) |
| AT (1) | ATE97827T1 (enExample) |
| CA (1) | CA2037880C (enExample) |
| CS (1) | CS61491A2 (enExample) |
| DE (1) | DE4007667C1 (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4234356A1 (de) * | 1992-10-12 | 1994-04-14 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4234348A1 (de) * | 1992-10-12 | 1994-04-14 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4234353A1 (de) * | 1992-10-12 | 1994-04-14 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4241145A1 (de) * | 1992-12-07 | 1994-06-09 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| EP0785004A2 (de) | 1996-01-17 | 1997-07-23 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE102012201816A1 (de) * | 2012-02-07 | 2013-08-08 | Fritz Barthel | Vordereinheit für eine Gleitbrettbindung |
| DE102012207959A1 (de) * | 2012-05-11 | 2013-11-14 | Fritz Barthel | Vordereinheit einer Gleitbrettbindung und Gleitbrettbindung |
| EP2687275A1 (fr) * | 2012-07-19 | 2014-01-22 | Salomon S.A.S. | Dispositifs de retenue avant d'une planche de glisse |
| EP3207964A1 (de) * | 2016-02-19 | 2017-08-23 | MARKER Deutschland GmbH | Vorderbacken mit sicherungsbügel |
| EP3851174A1 (de) * | 2020-01-16 | 2021-07-21 | Fritschi AG - Swiss Bindings | Fronteinheit für eine skibindung |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5649722A (en) * | 1995-01-30 | 1997-07-22 | Champlin; Jon F. | Convertible snowboard/skis |
| US6105994A (en) | 1997-04-09 | 2000-08-22 | Parris; James E. | Step-in binding having safety release mechanism for Telemark ski |
| US6644683B1 (en) * | 1998-07-22 | 2003-11-11 | Rottefella As | Ski binding, especially for cross-country skis |
| US7104564B2 (en) | 2000-08-10 | 2006-09-12 | Martin Ralph M | Backwards release ski binding |
| JP3846202B2 (ja) * | 2001-02-02 | 2006-11-15 | ソニー株式会社 | 半導体不揮発性記憶装置 |
| US7306255B2 (en) * | 2005-11-12 | 2007-12-11 | Black Diamond Equipment, Ltd. | Binding system |
| US7306256B2 (en) * | 2005-11-12 | 2007-12-11 | Black Diamond Equipment, Ltd. | Binding system |
| US7318597B2 (en) * | 2005-11-12 | 2008-01-15 | Black Diamond Equipment, Ltd. | Binding system |
| DE202009019178U1 (de) * | 2008-02-29 | 2017-09-05 | G3 Genuine Guide Gear Inc. | Ferseneinheit für Tourenskibindung |
| CH705579A2 (de) * | 2011-09-29 | 2013-04-15 | Fritschi Ag Swiss Bindings | Frontautomat. |
| AT514518B1 (de) | 2013-07-09 | 2018-05-15 | G3 Genuine Guide Gear Inc | Skibindungsferseneinheit |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2231058A1 (de) * | 1972-05-19 | 1973-12-06 | Alfred Haefliger | Verstellbare zusatzeinrichtung an skischuhen fuer die abfahrt und das tourenfahren |
| US4392666A (en) * | 1981-03-13 | 1983-07-12 | Alpine Research, Inc. | Integral ski binding |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3003777A (en) * | 1951-07-13 | 1961-10-10 | Anderson C Hilding | Ski binding |
| US2764418A (en) * | 1954-02-18 | 1956-09-25 | Shimizu Giichi | Ankle and heel binder mechanism for skis |
| US3944237A (en) * | 1974-03-25 | 1976-03-16 | James Reed Morris, IV | Ski binding |
| US3908971A (en) * | 1974-08-02 | 1975-09-30 | Steven F Engel | Ski binding |
| DE7428363U (de) * | 1974-08-21 | 1975-01-09 | Iser Iser H | Fersenbindung für Langlaufski |
| DE2702963C2 (de) * | 1977-01-25 | 1983-12-01 | Manfred 8011 Kirchheim Schmid | Kombinierte Touren- und Abfahrts- Skisicherheitsbindung |
| SE7801366L (sv) * | 1977-02-23 | 1978-08-24 | Gorlach Hans | Skidbindning |
| US4273354A (en) * | 1979-02-21 | 1981-06-16 | George Frederick W | Convertible ski boot and binding equipment |
| EP0035613A1 (en) * | 1980-03-07 | 1981-09-16 | Howard Ford | A ski binding as well as a ski and a ski boot provided with such a ski binding |
| FR2567409A1 (fr) * | 1984-02-06 | 1986-01-17 | Cavazza Gilbert | Fixation polyvalente pour ski de descente et de randonnee |
| DE3437725C2 (de) * | 1984-02-22 | 1986-04-03 | Heinrich Wunder GmbH & Co KG, 8060 Dachau | Vordere Sohlenhaltevorrichtung |
| NO155643C (no) * | 1984-06-01 | 1987-05-06 | Witco As | Anordning til befestigelse av en stoevel paa en ski, spesielt langrenns- eller turski. |
| AT386538B (de) * | 1986-03-27 | 1988-09-12 | Tyrolia Freizeitgeraete | Sicherheitsskibindung |
-
1990
- 1990-03-10 DE DE4007667A patent/DE4007667C1/de not_active Expired - Fee Related
-
1991
- 1991-03-07 AT AT91103461T patent/ATE97827T1/de not_active IP Right Cessation
- 1991-03-07 EP EP91103461A patent/EP0446780B1/de not_active Expired - Lifetime
- 1991-03-08 CS CS91614A patent/CS61491A2/cs unknown
- 1991-03-08 US US07/666,239 patent/US5249820A/en not_active Expired - Fee Related
- 1991-03-08 CA CA002037880A patent/CA2037880C/en not_active Expired - Fee Related
- 1991-03-11 JP JP3070588A patent/JPH05300962A/ja active Pending
-
1993
- 1993-04-05 US US08/042,724 patent/US5364118A/en not_active Expired - Fee Related
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2231058A1 (de) * | 1972-05-19 | 1973-12-06 | Alfred Haefliger | Verstellbare zusatzeinrichtung an skischuhen fuer die abfahrt und das tourenfahren |
| US4392666A (en) * | 1981-03-13 | 1983-07-12 | Alpine Research, Inc. | Integral ski binding |
Cited By (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0605758A1 (de) * | 1992-10-12 | 1994-07-13 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4234348A1 (de) * | 1992-10-12 | 1994-04-14 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4234353A1 (de) * | 1992-10-12 | 1994-04-14 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| EP0592859A1 (de) * | 1992-10-12 | 1994-04-20 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| EP0592860A1 (de) * | 1992-10-12 | 1994-04-20 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4234356A1 (de) * | 1992-10-12 | 1994-04-14 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE4241145A1 (de) * | 1992-12-07 | 1994-06-09 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| EP0785004A2 (de) | 1996-01-17 | 1997-07-23 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| DE19601545A1 (de) * | 1996-01-17 | 1997-07-24 | Simon Burger | Vordere Sohlenhaltevorrichtung an einer Skibindung |
| US8894087B2 (en) | 2012-02-07 | 2014-11-25 | Fritz Barthel | Front unit for a sliding board binding |
| DE102012201816A1 (de) * | 2012-02-07 | 2013-08-08 | Fritz Barthel | Vordereinheit für eine Gleitbrettbindung |
| DE102012201816B4 (de) | 2012-02-07 | 2022-10-20 | Fritz Barthel | Vordereinheit für eine Gleitbrettbindung mit ersten und zweiten Eingriffsmitteln |
| EP2626116B1 (de) * | 2012-02-07 | 2016-09-14 | Fritz Barthel | Vordereinheit für eine Gleitbrettbindung |
| DE102012207959A1 (de) * | 2012-05-11 | 2013-11-14 | Fritz Barthel | Vordereinheit einer Gleitbrettbindung und Gleitbrettbindung |
| DE102012207959B4 (de) * | 2012-05-11 | 2020-11-12 | Fritz Barthel | Vordereinheit einer Gleitbrettbindung und Gleitbrettbindung |
| EP2662121A3 (de) * | 2012-05-11 | 2013-12-04 | Fritz Barthel | Vordereinheit einer Gleitbrettbindung und Gleitbrettbindung |
| FR2993470A1 (fr) * | 2012-07-19 | 2014-01-24 | Salomon Sas | Dispositifs de retenue avant d'une planche de glisse |
| US9039031B2 (en) | 2012-07-19 | 2015-05-26 | Salomon S.A.S. | Front retaining devices for a gliding board |
| EP2687275A1 (fr) * | 2012-07-19 | 2014-01-22 | Salomon S.A.S. | Dispositifs de retenue avant d'une planche de glisse |
| EP3207964A1 (de) * | 2016-02-19 | 2017-08-23 | MARKER Deutschland GmbH | Vorderbacken mit sicherungsbügel |
| EP3851174A1 (de) * | 2020-01-16 | 2021-07-21 | Fritschi AG - Swiss Bindings | Fronteinheit für eine skibindung |
Also Published As
| Publication number | Publication date |
|---|---|
| US5364118A (en) | 1994-11-15 |
| US5249820A (en) | 1993-10-05 |
| CA2037880A1 (en) | 1991-09-11 |
| EP0446780A3 (en) | 1991-11-13 |
| EP0446780A2 (de) | 1991-09-18 |
| EP0446780B1 (de) | 1993-12-01 |
| CA2037880C (en) | 1995-10-31 |
| ATE97827T1 (de) | 1993-12-15 |
| CS61491A2 (en) | 1991-10-15 |
| JPH05300962A (ja) | 1993-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4007667C1 (enExample) | ||
| EP0668090B1 (de) | Bindung für Tourenski und Snowboard | |
| EP0265459B1 (de) | Skibindung für langlaufskis | |
| CH624016A5 (enExample) | ||
| DE3825004A1 (de) | Bindungsgekoppelte skistiefelschaftentriegelung | |
| DE3530095A1 (de) | Langlaufskibindung | |
| DE3437725C2 (de) | Vordere Sohlenhaltevorrichtung | |
| DE2531466A1 (de) | Skibremsvorrichtung | |
| DE19602667C1 (de) | Snowboardbindung | |
| DE2521726A1 (de) | Fersenbindung fuer langlauf-schistiefel | |
| DE2706111A1 (de) | Sicherheitsbindung | |
| EP0016750A1 (de) | Langlaufskischuh und Langlaufski | |
| DE19703955C2 (de) | Tourenbindung | |
| DE4424737C1 (de) | Snowboardbindung | |
| DE2528578A1 (de) | Sicherheitsbindung fuer skischuhe | |
| DE2639780A1 (de) | An einem ski oder an einer skibindung montierbare vorrichtung, wie sicherheitsbindung oder skibremse | |
| DE2806937C2 (de) | Wahlweise für Abfahrt und für Touren umstellbare Auslöseskibindung | |
| DE19642766A1 (de) | Snowboard-Bindung | |
| EP1795236A1 (de) | Skibindung | |
| AT405372B (de) | Snowboardbindung | |
| WO1997038764A1 (de) | Snowboardbindung | |
| EP0113415B1 (de) | Auslösende Langlaufbindung | |
| EP0176951B1 (de) | Skibindung-Skischuh-Kombination für einen Langlauf-oder Tourenski | |
| DE2304466C3 (de) | Skibindung | |
| EP0278245A2 (de) | Schischuh - Stichwort: Höhenverstellbare Sattelplatte im Fersenachillessehnenbereich |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8100 | Publication of patent without earlier publication of application | ||
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: SILVRETTA - SHERPAS SPORTARTIKEL GMBH, 85757 KARLS |
|
| 8327 | Change in the person/name/address of the patent owner |
Owner name: OBERALP SPA, BOZEN, IT |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: ZMYJ, E., DIPL.-ING. DIPL.-WIRTSCH.-ING., PAT.-ANW., 81669 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |