DE3723118C2 - Nitrocellulose-Treibstoffgemisch - Google Patents
Nitrocellulose-TreibstoffgemischInfo
- Publication number
- DE3723118C2 DE3723118C2 DE3723118A DE3723118A DE3723118C2 DE 3723118 C2 DE3723118 C2 DE 3723118C2 DE 3723118 A DE3723118 A DE 3723118A DE 3723118 A DE3723118 A DE 3723118A DE 3723118 C2 DE3723118 C2 DE 3723118C2
- Authority
- DE
- Germany
- Prior art keywords
- fuel mixture
- lead
- mixture according
- fuel
- zinc oxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000446 fuel Substances 0.000 title claims description 58
- 239000000203 mixture Substances 0.000 title claims description 39
- 229920001220 nitrocellulos Polymers 0.000 title claims description 15
- 239000000020 Nitrocellulose Substances 0.000 title claims description 14
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 48
- 239000003607 modifier Substances 0.000 claims description 24
- 239000011787 zinc oxide Substances 0.000 claims description 24
- 238000002485 combustion reaction Methods 0.000 claims description 22
- CNVULGHYDPMIHD-UHFFFAOYSA-L bis[(2-hydroxybenzoyl)oxy]lead Chemical compound [Pb+2].OC1=CC=CC=C1C([O-])=O.OC1=CC=CC=C1C([O-])=O CNVULGHYDPMIHD-UHFFFAOYSA-L 0.000 claims description 7
- 239000000843 powder Substances 0.000 claims description 6
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 claims description 6
- POCJOGNVFHPZNS-ZJUUUORDSA-N (6S,7R)-2-azaspiro[5.5]undecan-7-ol Chemical compound O[C@@H]1CCCC[C@]11CNCCC1 POCJOGNVFHPZNS-ZJUUUORDSA-N 0.000 claims description 4
- 239000005749 Copper compound Substances 0.000 claims description 4
- BSPUVYFGURDFHE-UHFFFAOYSA-N Nitramine Natural products CC1C(O)CCC2CCCNC12 BSPUVYFGURDFHE-UHFFFAOYSA-N 0.000 claims description 4
- 150000001880 copper compounds Chemical class 0.000 claims description 4
- CMRVDFLZXRTMTH-UHFFFAOYSA-L copper;2-carboxyphenolate Chemical compound [Cu+2].OC1=CC=CC=C1C([O-])=O.OC1=CC=CC=C1C([O-])=O CMRVDFLZXRTMTH-UHFFFAOYSA-L 0.000 claims description 4
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 claims description 4
- POCJOGNVFHPZNS-UHFFFAOYSA-N isonitramine Natural products OC1CCCCC11CNCCC1 POCJOGNVFHPZNS-UHFFFAOYSA-N 0.000 claims description 4
- 150000002611 lead compounds Chemical class 0.000 claims description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 claims description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 4
- UQLDLKMNUJERMK-UHFFFAOYSA-L di(octadecanoyloxy)lead Chemical compound [Pb+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O UQLDLKMNUJERMK-UHFFFAOYSA-L 0.000 claims description 3
- 235000013773 glyceryl triacetate Nutrition 0.000 claims description 3
- 239000001087 glyceryl triacetate Substances 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 239000004014 plasticizer Substances 0.000 claims description 3
- 229920001610 polycaprolactone Polymers 0.000 claims description 3
- 239000004632 polycaprolactone Substances 0.000 claims description 3
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910010271 silicon carbide Inorganic materials 0.000 claims description 3
- 229960002622 triacetin Drugs 0.000 claims description 3
- RUKISNQKOIKZGT-UHFFFAOYSA-N 2-nitrodiphenylamine Chemical compound [O-][N+](=O)C1=CC=CC=C1NC1=CC=CC=C1 RUKISNQKOIKZGT-UHFFFAOYSA-N 0.000 claims description 2
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 claims description 2
- 239000005751 Copper oxide Substances 0.000 claims description 2
- ZIJKGAXBCRWEOL-SAXBRCJISA-N Sucrose octaacetate Chemical compound CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@]1(COC(C)=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 ZIJKGAXBCRWEOL-SAXBRCJISA-N 0.000 claims description 2
- HOQPTLCRWVZIQZ-UHFFFAOYSA-H bis[[2-(5-hydroxy-4,7-dioxo-1,3,2$l^{2}-dioxaplumbepan-5-yl)acetyl]oxy]lead Chemical compound [Pb+2].[Pb+2].[Pb+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HOQPTLCRWVZIQZ-UHFFFAOYSA-H 0.000 claims description 2
- 239000004204 candelilla wax Substances 0.000 claims description 2
- 229940073532 candelilla wax Drugs 0.000 claims description 2
- 235000013868 candelilla wax Nutrition 0.000 claims description 2
- 229910000431 copper oxide Inorganic materials 0.000 claims description 2
- UCPROVVOIQFRKZ-UHFFFAOYSA-L copper;2-carboxy-5-hydroxyphenolate Chemical compound [Cu+2].OC1=CC=C(C([O-])=O)C(O)=C1.OC1=CC=C(C([O-])=O)C(O)=C1 UCPROVVOIQFRKZ-UHFFFAOYSA-L 0.000 claims description 2
- IUJAMGNYPWYUPM-UHFFFAOYSA-N hentriacontane Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC IUJAMGNYPWYUPM-UHFFFAOYSA-N 0.000 claims description 2
- YJOMWQQKPKLUBO-UHFFFAOYSA-L lead(2+);phthalate Chemical compound [Pb+2].[O-]C(=O)C1=CC=CC=C1C([O-])=O YJOMWQQKPKLUBO-UHFFFAOYSA-L 0.000 claims description 2
- XIFJZJPMHNUGRA-UHFFFAOYSA-N n-methyl-4-nitroaniline Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1 XIFJZJPMHNUGRA-UHFFFAOYSA-N 0.000 claims description 2
- 235000010333 potassium nitrate Nutrition 0.000 claims description 2
- 239000004323 potassium nitrate Substances 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 239000000314 lubricant Substances 0.000 claims 1
- 239000004071 soot Substances 0.000 claims 1
- YQUVCSBJEUQKSH-UHFFFAOYSA-N 3,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C(O)=C1 YQUVCSBJEUQKSH-UHFFFAOYSA-N 0.000 description 7
- 230000000052 comparative effect Effects 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- YEOCHZFPBYUXMC-UHFFFAOYSA-L copper benzoate Chemical compound [Cu+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 YEOCHZFPBYUXMC-UHFFFAOYSA-L 0.000 description 2
- 239000002360 explosive Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000010304 firing Methods 0.000 description 2
- 239000001023 inorganic pigment Substances 0.000 description 2
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical compound C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 2
- 239000002760 rocket fuel Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- UHBVTTDRNVAOJD-UHFFFAOYSA-N 1-nitropropane-1,2,3-triol Chemical class OCC(O)C(O)[N+]([O-])=O UHBVTTDRNVAOJD-UHFFFAOYSA-N 0.000 description 1
- JXSRRBVHLUJJFC-UHFFFAOYSA-N 7-amino-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile Chemical compound N1=CC(C#N)=C(N)N2N=C(SC)N=C21 JXSRRBVHLUJJFC-UHFFFAOYSA-N 0.000 description 1
- -1 B. copper salicylate Chemical class 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000530268 Lycaena heteronea Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000000006 Nitroglycerin Substances 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 235000013405 beer Nutrition 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000002828 fuel tank Substances 0.000 description 1
- 229960003711 glyceryl trinitrate Drugs 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B25/00—Compositions containing a nitrated organic compound
- C06B25/18—Compositions containing a nitrated organic compound the compound being nitrocellulose present as 10% or more by weight of the total composition
- C06B25/24—Compositions containing a nitrated organic compound the compound being nitrocellulose present as 10% or more by weight of the total composition with nitroglycerine
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B23/00—Compositions characterised by non-explosive or non-thermic constituents
- C06B23/007—Ballistic modifiers, burning rate catalysts, burning rate depressing agents, e.g. for gas generating
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Medicinal Preparation (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Air Bags (AREA)
- Lubricants (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8617239 | 1986-07-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3723118A1 DE3723118A1 (de) | 1992-07-30 |
| DE3723118C2 true DE3723118C2 (de) | 2002-06-13 |
Family
ID=10601091
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3723118A Expired - Lifetime DE3723118C2 (de) | 1986-07-15 | 1987-07-13 | Nitrocellulose-Treibstoffgemisch |
Country Status (9)
| Country | Link |
|---|---|
| AU (1) | AU632281B2 (OSRAM) |
| CA (1) | CA1326137C (OSRAM) |
| DE (1) | DE3723118C2 (OSRAM) |
| FR (1) | FR2669626A1 (OSRAM) |
| GB (1) | GB2246348B (OSRAM) |
| IT (1) | IT1235642B (OSRAM) |
| NL (1) | NL194727C (OSRAM) |
| NO (1) | NO173183C (OSRAM) |
| SE (1) | SE467540B (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2727401B1 (fr) * | 1994-11-29 | 1996-12-27 | Poudres & Explosifs Ste Nale | Compositions modificatrices de proprietes balistiques et propergols contenant de telles compositions |
| WO1998002712A1 (en) * | 1997-05-07 | 1998-01-22 | Farnell Patricia L | Munitions using infrared flare weapon systems |
| RU2121470C1 (ru) * | 1997-08-18 | 1998-11-10 | Федеральный центр двойных технологий "Союз" | Баллиститное топливо |
| RU2167137C2 (ru) * | 1999-06-29 | 2001-05-20 | Научно-исследовательский институт полимерных материалов | Баллиститное топливо |
| RU2197454C2 (ru) * | 2000-05-24 | 2003-01-27 | Казанский государственный технологический университет | Взрывчатый состав |
| RU2272803C1 (ru) * | 2004-10-14 | 2006-03-27 | Федеральное государственное унитарное предприятие (ФГУП) "Пермский завод им. С.М. Кирова" | Твердое ракетное топливо для изделий народнохозяйственного назначения |
| RU2281276C1 (ru) * | 2004-12-10 | 2006-08-10 | Государственное образовательное учреждение высшего профессионального образования "Пермский государственный технический университет" | Твердое ракетное топливо баллиститного типа |
| RU2311400C1 (ru) * | 2006-02-13 | 2007-11-27 | Федеральное казенное предприятие "Пермский пороховой завод" (ФКП "Пермский пороховой завод") | Твердое ракетное топливо для изделий народно-хозяйственного назначения |
| RU2380346C2 (ru) * | 2008-04-14 | 2010-01-27 | Федеральное государственное унитарное предприятие "Научно-исследовательский институт полимерных материалов" | Твердое ракетное топливо баллиститного типа |
| RU2636087C1 (ru) * | 2016-08-09 | 2017-11-20 | Акционерное общество "Научно-исследовательский институт полимерных материалов" | Двухосновное твердое топливо |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3138499A (en) * | 1964-06-23 | Pressure | ||
| US3506505A (en) * | 1967-12-01 | 1970-04-14 | Herzog Johanna | Nitrocellulose base propellant coated with graphite,plasticizer,and inorganic pigment |
| DE3015904A1 (de) * | 1979-04-24 | 1980-11-06 | Bofors Ab | Verfahren zur herstellung eines gepressten zweibasigen raketentreibstoffs |
| DE3316676A1 (de) * | 1982-05-07 | 1983-12-08 | Nippon Oil and Fats Co., Ltd., Tokyo | Treibstoffzusammensetzungen |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1905289A (en) * | 1929-08-31 | 1933-04-25 | Du Pont | Explosive |
| FR955436A (OSRAM) * | 1946-11-29 | 1950-01-14 | ||
| US3689331A (en) * | 1964-02-28 | 1972-09-05 | Us Army | Nitrocellulose base compositions and method for making same |
| US3639183A (en) * | 1965-04-16 | 1972-02-01 | Us Navy | Gas generator compositions |
| GB1277192A (en) * | 1965-12-30 | 1972-06-07 | Us Gov Sec Army | Improvements in and relating to nitrocellulose base propellant compositions |
| DE1571218A1 (de) * | 1966-07-23 | 1970-11-26 | Dynamit Nobel Ag | Oberflaechenbehandlung von Treibladungspulver |
| NO119830B (OSRAM) * | 1969-07-19 | 1970-07-06 | Raufoss Ammunisjonsfabrikker | |
| US4243444A (en) * | 1970-09-11 | 1981-01-06 | The United States Of America As Represented By The Secretary Of The Army | Ballistic modifiers, synthesis . . . propellants |
| US4659402A (en) * | 1977-12-14 | 1987-04-21 | Hercules Incorporated | Cross-linked double base propellant having improved low temperature mechanical properties |
| GB2152920B (en) * | 1983-08-12 | 1987-06-24 | Secr Defence | Propellant composition |
-
1987
- 1987-06-11 GB GB8713679A patent/GB2246348B/en not_active Expired - Lifetime
- 1987-07-01 NO NO872742A patent/NO173183C/no not_active IP Right Cessation
- 1987-07-03 NL NL8701562A patent/NL194727C/nl not_active IP Right Cessation
- 1987-07-03 FR FR8709451A patent/FR2669626A1/fr active Granted
- 1987-07-06 SE SE8702783A patent/SE467540B/sv not_active IP Right Cessation
- 1987-07-07 IT IT8721199A patent/IT1235642B/it active
- 1987-07-13 CA CA000541858A patent/CA1326137C/en not_active Expired - Fee Related
- 1987-07-13 DE DE3723118A patent/DE3723118C2/de not_active Expired - Lifetime
- 1987-07-15 AU AU76381/87A patent/AU632281B2/en not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3138499A (en) * | 1964-06-23 | Pressure | ||
| US3506505A (en) * | 1967-12-01 | 1970-04-14 | Herzog Johanna | Nitrocellulose base propellant coated with graphite,plasticizer,and inorganic pigment |
| DE3015904A1 (de) * | 1979-04-24 | 1980-11-06 | Bofors Ab | Verfahren zur herstellung eines gepressten zweibasigen raketentreibstoffs |
| DE3316676A1 (de) * | 1982-05-07 | 1983-12-08 | Nippon Oil and Fats Co., Ltd., Tokyo | Treibstoffzusammensetzungen |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2246348B (en) | 1993-03-03 |
| NO173183B (no) | 1993-08-02 |
| GB2246348A (en) | 1992-01-29 |
| IT1235642B (it) | 1992-09-14 |
| FR2669626B1 (OSRAM) | 1994-08-19 |
| SE467540B (sv) | 1992-08-03 |
| AU632281B2 (en) | 1992-12-24 |
| DE3723118A1 (de) | 1992-07-30 |
| GB8713679D0 (en) | 1991-10-16 |
| NL194727C (nl) | 2003-01-07 |
| FR2669626A1 (fr) | 1992-05-29 |
| SE8702783L (sv) | 1992-03-05 |
| NO872742L (no) | 1991-11-28 |
| NL8701562A (nl) | 1992-05-06 |
| SE8702783D0 (sv) | 1987-07-06 |
| CA1326137C (en) | 1994-01-18 |
| NO173183C (no) | 1993-11-10 |
| NL194727B (nl) | 2002-09-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3835854C2 (OSRAM) | ||
| DE2427480C3 (de) | Feste Treibstoffzusammensetzung | |
| DE2245510B2 (de) | Explosive Treibmasse | |
| DE3723118C2 (de) | Nitrocellulose-Treibstoffgemisch | |
| US4701228A (en) | Process for the manufacture of a double-base propellent composition with low flame-glare emission | |
| WO1998034891A1 (de) | Treibladungspulver für rohrwaffen | |
| DE3316676C2 (de) | Treibstoffzusammensetzung | |
| DE3113010A1 (de) | "doppelbasige festtreibstoffe mit verbessertem abbrandverhalten" | |
| DE2900020C2 (de) | Verfahren zur Herstellung eines mehrbasigen Treibladungspulvers | |
| DE4307731C2 (de) | Treibladungspulver für Waffen | |
| DE2263860C3 (de) | Feststoff-Projektiltreibladung | |
| DE3513622C2 (de) | Verwendung eines Kupfer (II)-Komplexes einer unverzweigten, aliphatischen Monocarbonsäure als ballistisches Modifizierungsmittel | |
| US5254186A (en) | Nitrocellulose propellant composition | |
| US3951704A (en) | Double-base propellants with combustion modifier | |
| US4025370A (en) | Double base propellant containing azobisformamide | |
| DE69906978T2 (de) | Hochenergetische treibstoffe für geschossmunition | |
| DE3033519A1 (de) | Rauchloses, vernetztes zweikomponenten-treibmittel und verfahren zu seiner herstellung | |
| DE2448615C3 (de) | Feste Treibmittel und ihre Verwendung | |
| DE3811840A1 (de) | Alterungsbestaendiges einbasiges pulver, verfahren zu seiner herstellung und seine verwendung in gasgeneratoren | |
| DE2047754C1 (de) | Teibmittel hoher Brenngeschwindigkeit mit verbessertem Druckexponenten | |
| DE3215477C1 (de) | Zweibasige Propergolblöcke mit erhöhtem Nitramingehalt und Gießverfahren zu ihrer Herstellung | |
| DE2623991B3 (de) | Doppelbasistreibmittelladung | |
| EP0012827B1 (de) | Sprenggelatine und Herstellung von diese enthaltenden Sprengstoffen | |
| DE2040625C (de) | Feuchtigkeitsbeständiges Zund pulver auf der Basis poröser Nitro Zellulose und Verfahren zu seiner Herstellung | |
| DE2556121A1 (de) | Ternaeres pulver fuer grosskalibrige waffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: ROYAL ORDNANCE PLC., EUXTON CHORLEY, LANCASHIRE, G |
|
| 8128 | New person/name/address of the agent |
Representative=s name: TIEDTKE, H., DIPL.-ING. BUEHLING, G., DIPL.-CHEM. |
|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C06D 5/06 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |