DE3428554A1 - Ausstellungsstaender - Google Patents
AusstellungsstaenderInfo
- Publication number
- DE3428554A1 DE3428554A1 DE19843428554 DE3428554A DE3428554A1 DE 3428554 A1 DE3428554 A1 DE 3428554A1 DE 19843428554 DE19843428554 DE 19843428554 DE 3428554 A DE3428554 A DE 3428554A DE 3428554 A1 DE3428554 A1 DE 3428554A1
- Authority
- DE
- Germany
- Prior art keywords
- support column
- exhibition stand
- goods carrier
- exhibition
- stand
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000969 carrier Substances 0.000 claims description 8
- 230000000295 complement effect Effects 0.000 claims description 2
- 230000000149 penetrating effect Effects 0.000 claims description 2
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 abstract 1
- 238000006073 displacement reaction Methods 0.000 description 2
- 238000010276 construction Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47B—TABLES; DESKS; OFFICE FURNITURE; CABINETS; DRAWERS; GENERAL DETAILS OF FURNITURE
- A47B57/00—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions
- A47B57/06—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions with means for adjusting the height of the shelves
- A47B57/26—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions with means for adjusting the height of the shelves consisting of clamping means, e.g. with sliding bolts or sliding wedges
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47F—SPECIAL FURNITURE, FITTINGS, OR ACCESSORIES FOR SHOPS, STOREHOUSES, BARS, RESTAURANTS OR THE LIKE; PAYING COUNTERS
- A47F5/00—Show stands, hangers, or shelves characterised by their constructional features
- A47F5/04—Stands with a central pillar, e.g. tree type
- A47F5/06—Stands with a central pillar, e.g. tree type adjustable
Landscapes
- Display Racks (AREA)
- Liquid Crystal (AREA)
- Road Signs Or Road Markings (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Peptides Or Proteins (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843428554 DE3428554A1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsstaender |
| DE8423037U DE8423037U1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsständer |
| US06/749,309 US4678089A (en) | 1984-08-02 | 1985-06-27 | Display stand |
| ES1985288385U ES288385Y (es) | 1984-08-02 | 1985-07-26 | Soporte de exposicion |
| JP1985117286U JPS6134957U (ja) | 1984-08-02 | 1985-08-01 | 陳列スタンド |
| AT85109726T ATE35613T1 (de) | 1984-08-02 | 1985-08-02 | Ausstellungsstaender. |
| DE8585109726T DE3563679D1 (en) | 1984-08-02 | 1985-08-02 | Display stand |
| EP85109726A EP0171721B1 (de) | 1984-08-02 | 1985-08-02 | Ausstellungsständer |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843428554 DE3428554A1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsstaender |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3428554A1 true DE3428554A1 (de) | 1986-02-13 |
| DE3428554C2 DE3428554C2 (enExample) | 1992-10-08 |
Family
ID=6242230
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843428554 Granted DE3428554A1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsstaender |
| DE8423037U Expired DE8423037U1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsständer |
| DE8585109726T Expired DE3563679D1 (en) | 1984-08-02 | 1985-08-02 | Display stand |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8423037U Expired DE8423037U1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsständer |
| DE8585109726T Expired DE3563679D1 (en) | 1984-08-02 | 1985-08-02 | Display stand |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4678089A (enExample) |
| EP (1) | EP0171721B1 (enExample) |
| JP (1) | JPS6134957U (enExample) |
| AT (1) | ATE35613T1 (enExample) |
| DE (3) | DE3428554A1 (enExample) |
| ES (1) | ES288385Y (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3939632A1 (de) * | 1989-11-30 | 1991-06-06 | Karl Dr Goltz | Zerlegbarer, stufenartiger tisch, deren platten drehbar sind |
| AT19U3 (de) * | 1994-06-16 | 1995-02-27 | Transcom Stabilimento Transcom | Aufbewahrungsständer |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4865283A (en) * | 1987-04-03 | 1989-09-12 | Parker Robert J | Merchandising display stand |
| DE8800320U1 (de) * | 1988-01-14 | 1988-03-10 | Horst GmbH Druck + Verpackung, 6450 Hanau | Warendisplayständer |
| DE3913658A1 (de) * | 1988-05-27 | 1989-12-07 | Kratz Soehne N | Staender fuer kfz-raeder |
| NO882716L (no) * | 1988-06-20 | 1989-12-21 | Isco Ind Sales Co | Anordning ved pall. |
| US4921190A (en) * | 1989-01-30 | 1990-05-01 | Mark Philip Promotions, Inc. | Display construction |
| USD328205S (en) | 1990-02-22 | 1992-07-28 | Dyment Limited | Display rack |
| US5183167A (en) * | 1991-09-06 | 1993-02-02 | Cheng W H | Adjustable multi-desk rack |
| US5292015A (en) * | 1992-03-11 | 1994-03-08 | Harbor Industries, Inc. | Display stand |
| US5497972A (en) * | 1994-10-26 | 1996-03-12 | Hms Mfg. Co. | Stand for artificial Christmas tree or the like |
| SE502655C2 (sv) * | 1994-11-28 | 1995-12-04 | Satellit System Ab | Varubärare anbringbar på en väsentligen vertikal stång |
| US6123206A (en) * | 1996-01-16 | 2000-09-26 | Zaremba; George Julian | Removable display attachment with wedgelike retainers for vertical rigid cylindrical supports |
| USD387226S (en) * | 1996-02-20 | 1997-12-09 | Shahriar Dardashti | Storage and display stand |
| US5595312A (en) * | 1996-03-11 | 1997-01-21 | Dardashti; Shahriar | Easily assembled and adjustable storage and display tower assembly |
| US5908121A (en) * | 1996-03-11 | 1999-06-01 | Dardashti; Shahriar | Adjustable display assembly |
| USD403175S (en) | 1996-08-06 | 1998-12-29 | Shahriar Dardashti | Storage and display stand |
| US5680941A (en) * | 1996-08-08 | 1997-10-28 | Arrow Art Finishers, Inc. | Wrap-around externally shelved display stand |
| USD415632S (en) * | 1996-10-16 | 1999-10-26 | Shahriar Dardashti | Storage and display stand |
| USD406204S (en) * | 1997-01-21 | 1999-03-02 | Shahriar Dardashti | Storage and display stand |
| USD404936S (en) * | 1997-07-16 | 1999-02-02 | Shahriar Dardashti | Storage and display stand |
| USD406205S (en) * | 1997-07-16 | 1999-03-02 | Shahriar Dardashti | Storage and display stand |
| USD407582S (en) | 1997-07-16 | 1999-04-06 | Shahriar Dardashti | Storage and display stand |
| US5894944A (en) * | 1997-08-06 | 1999-04-20 | Swift; Lawrence F. | Tray |
| US5996511A (en) * | 1998-02-09 | 1999-12-07 | Swoger; Gary J. | Tray device for attachment to a vertical pole |
| DE29802821U1 (de) * | 1998-02-18 | 1998-04-09 | Instore-Marketing GmbH, 65779 Kelkheim | Warengestell mit höhenverstellbarem Fachboden |
| FR2786377B1 (fr) * | 1998-11-30 | 2001-02-23 | Roll | Dispositif pour fixer une etagere sur un montant |
| US6318572B1 (en) * | 2000-07-20 | 2001-11-20 | Yung Lin Lai | Multifunctional knockdown rack structure |
| DE10051928A1 (de) * | 2000-10-19 | 2002-05-02 | Vauth Sagel Gmbh & Co | Tragsäule eines Eckschrankkarussells |
| US6575316B2 (en) * | 2001-10-26 | 2003-06-10 | Colin Ross Taiwan, Inc. | Bathroom column hanging holder assembly |
| USD480581S1 (en) | 2002-08-14 | 2003-10-14 | Fas Industries, Inc. | Rotatable shelf assembly |
| CA2437326C (en) * | 2002-08-30 | 2007-04-10 | Fas Industries, Inc. | Shelf with retaining wall |
| GB2394401A (en) * | 2002-10-26 | 2004-04-28 | Julie Davidson | Storage rack for artists materials |
| US7021556B2 (en) * | 2003-10-31 | 2006-04-04 | Sephra Fountains, Llc | Fountain that flows with fluidic material |
| US7743698B2 (en) | 2003-10-31 | 2010-06-29 | Sephra L.P. | Fountain that flows with fluidic material |
| US20060081720A1 (en) * | 2004-09-17 | 2006-04-20 | Michel Esnault | Multi-tier chocolate fountain apparatus |
| US20080111002A1 (en) * | 2006-11-09 | 2008-05-15 | Muir Richard B | Sleeve for supporting a cylinder of a chocolate fountain |
| EP1935285A1 (de) * | 2006-12-23 | 2008-06-25 | Wolfgang Männer | Vorrichtung zum Abstellen, Ablegen und/oder Anhängen von Gegenständen an einen Mast, einen Pfahl, einer Stütze, einem Geländer oder dergleichen |
| WO2009149329A2 (en) * | 2008-06-05 | 2009-12-10 | Lala Lips Llc | Cosmetic organizer display |
| US8016113B2 (en) * | 2008-09-16 | 2011-09-13 | Plastic Systems, Inc. | Storage system with improved pole securement system |
| USD605353S1 (en) * | 2009-02-11 | 2009-12-01 | Test Rite Products Corp. | Cosmetic station |
| US20100229733A1 (en) * | 2009-03-16 | 2010-09-16 | Stephen Huber Castillo | Multi Level Cooking Device |
| JP5010008B2 (ja) * | 2010-04-14 | 2012-08-29 | 信一 小屋野 | 陳列棚 |
| US20120175325A1 (en) * | 2011-01-11 | 2012-07-12 | Del Grippo Jill C | Apparatus for housing, storing and organizing sponges and method of manufacutring same |
| US8777024B2 (en) | 2011-08-03 | 2014-07-15 | Teri Kramer | Portable organizer |
| US8919581B2 (en) * | 2012-07-12 | 2014-12-30 | US Display Group, Inc. | Merchandise display stand with locking shelves |
| DE102012022407A1 (de) * | 2012-11-16 | 2014-05-22 | Casimir Kast Verpackung und Display GmbH | Regal zur Warenpräsentation |
| US10405651B1 (en) | 2014-02-07 | 2019-09-10 | Teri Kramer | Portable paper organizer |
| US9585476B2 (en) * | 2015-04-28 | 2017-03-07 | Joseph T. Swisher | Multifunction workstation |
| US10213041B1 (en) * | 2016-09-13 | 2019-02-26 | Brian Fonseca | Modular holiday tree device |
| US10273070B2 (en) | 2017-05-19 | 2019-04-30 | Paper Systems, Inc. | Collapsible container |
| JP6185207B1 (ja) * | 2017-06-01 | 2017-08-23 | イー.メリット有限会社 | 物品収容スタンド |
| DE102018102370A1 (de) * | 2018-02-02 | 2019-08-08 | Stefan Wetzel | Verkaufsständer |
| US10835057B1 (en) * | 2019-04-29 | 2020-11-17 | Gpk Enterprises | Confectionary display apparatus |
| WO2024147857A2 (en) * | 2023-01-04 | 2024-07-11 | Daz Innovation Inc | Insect infiltration protection apparatus for pole mounted bird feeder |
| USD1006506S1 (en) * | 2023-09-01 | 2023-12-05 | Zhiqiang Zhan | Rotatable shelf |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1307004A (fr) * | 1961-09-13 | 1962-10-19 | Piédestal d'étalage | |
| GB1129594A (en) * | 1966-02-01 | 1968-10-09 | George William Maris | An improved multi-shelf unit |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE135665C (enExample) * | ||||
| US1581463A (en) * | 1924-02-14 | 1926-04-20 | Walter C Moors | Clothes-drying rack |
| GB294782A (en) * | 1927-08-19 | 1928-08-02 | Arthur Walter Taylor | Improvements in display racks for garments and other articles or objects |
| US2447924A (en) * | 1946-03-04 | 1948-08-24 | John A Vitale | Costumer |
| FR1235512A (fr) * | 1959-05-28 | 1960-07-08 | Meubles d'étalage | |
| US3236389A (en) * | 1964-12-14 | 1966-02-22 | Robert M Murdock | Layer cake separator |
| FR1513292A (fr) * | 1965-09-23 | 1968-02-16 | Rosa Innocenti Guerri | Corbeille ou panier pour parasols de plage et similaires |
| US3675598A (en) * | 1970-11-04 | 1972-07-11 | William Hodges & Co Inc | Adjustable shelving |
| FR2224013A5 (en) * | 1973-04-02 | 1974-10-25 | Alby Albert | Locking device for shelf fixing to a column - uses elastic ring in central aperture of shelf engaging column |
| US4057665A (en) * | 1976-04-21 | 1977-11-08 | Szulewski John W | Artificial tree structure |
| US4126963A (en) * | 1977-03-31 | 1978-11-28 | Alvis Harold Dunbar | Tree stand for supporting and watering a live tree |
| US4159096A (en) * | 1977-05-12 | 1979-06-26 | General Foam Plastics Corp. | Super stable, simply assembleable tree stand |
| US4261138A (en) * | 1978-10-27 | 1981-04-14 | St George Syms John G | Christmas tree holder |
-
1984
- 1984-08-02 DE DE19843428554 patent/DE3428554A1/de active Granted
- 1984-08-02 DE DE8423037U patent/DE8423037U1/de not_active Expired
-
1985
- 1985-06-27 US US06/749,309 patent/US4678089A/en not_active Expired - Fee Related
- 1985-07-26 ES ES1985288385U patent/ES288385Y/es not_active Expired
- 1985-08-01 JP JP1985117286U patent/JPS6134957U/ja active Pending
- 1985-08-02 AT AT85109726T patent/ATE35613T1/de not_active IP Right Cessation
- 1985-08-02 EP EP85109726A patent/EP0171721B1/de not_active Expired
- 1985-08-02 DE DE8585109726T patent/DE3563679D1/de not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1307004A (fr) * | 1961-09-13 | 1962-10-19 | Piédestal d'étalage | |
| GB1129594A (en) * | 1966-02-01 | 1968-10-09 | George William Maris | An improved multi-shelf unit |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3939632A1 (de) * | 1989-11-30 | 1991-06-06 | Karl Dr Goltz | Zerlegbarer, stufenartiger tisch, deren platten drehbar sind |
| AT19U3 (de) * | 1994-06-16 | 1995-02-27 | Transcom Stabilimento Transcom | Aufbewahrungsständer |
Also Published As
| Publication number | Publication date |
|---|---|
| ES288385Y (es) | 1987-02-01 |
| ATE35613T1 (de) | 1988-07-15 |
| EP0171721A1 (de) | 1986-02-19 |
| ES288385U (es) | 1986-06-01 |
| DE3563679D1 (en) | 1988-08-18 |
| JPS6134957U (ja) | 1986-03-04 |
| DE8423037U1 (de) | 1987-10-01 |
| US4678089A (en) | 1987-07-07 |
| EP0171721B1 (de) | 1988-07-13 |
| DE3428554C2 (enExample) | 1992-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3428554A1 (de) | Ausstellungsstaender | |
| DE8618327U1 (de) | Tisch, insbesondere Büroschreibtisch | |
| EP0638257B1 (de) | Haltevorrichtung für Stangen, Rohre oder dergleichen | |
| EP0019243B1 (de) | Stativ für Projektionsleinwände | |
| EP1193822A2 (de) | Sammelschienenträger | |
| DE19859473B4 (de) | Geräteständer | |
| DE29622051U1 (de) | Vorrichtung zum Befestigen von Kraftfahrzeug-Fußmatten | |
| DE602004008152T2 (de) | System für das elastische Halten eines Behälters in Bezug auf einen Mischkopf eines Mischers | |
| DE4114991C2 (enExample) | ||
| DE3641163C2 (enExample) | ||
| AT384717B (de) | Tischplatte fuer einen sonnenschirm | |
| DE102019116811A1 (de) | Aufhängungsvorrichtung für Hängesitze und Hängematten | |
| DE3726451A1 (de) | Kinderwagengestell | |
| DE3415850A1 (de) | Tragsockel fuer ein bildschirmgeraet z.b. ein fernsehgeraet | |
| DE3805232C2 (enExample) | ||
| DE7618061U1 (de) | Verbindungsstueck zum loesbaren verbinden von wenigstens zwei elementen eines beleuchtungskoerpers | |
| EP0633558B1 (de) | Schulterstütze | |
| DE19650679A1 (de) | Tisch | |
| DE9407981U1 (de) | Vorrichtung zum Stützen von Pflanzen | |
| DE4111496C2 (enExample) | ||
| DE9112138U1 (de) | Vorrichtung zur Befestigung von Installationselementen | |
| AT17884U1 (de) | Schirmhalterung | |
| DE3527781A1 (de) | Sicherungseinrichtung fuer rundstaebe | |
| DE8410364U1 (de) | Bausatz fuer ein gestell zur auflage und darbietung von gegenstaenden | |
| DE9111918U1 (de) | Angelgerät |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |