ATE35613T1 - Ausstellungsstaender. - Google Patents
Ausstellungsstaender.Info
- Publication number
- ATE35613T1 ATE35613T1 AT85109726T AT85109726T ATE35613T1 AT E35613 T1 ATE35613 T1 AT E35613T1 AT 85109726 T AT85109726 T AT 85109726T AT 85109726 T AT85109726 T AT 85109726T AT E35613 T1 ATE35613 T1 AT E35613T1
- Authority
- AT
- Austria
- Prior art keywords
- carrier
- display stand
- column
- goods
- wedge engagement
- Prior art date
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47B—TABLES; DESKS; OFFICE FURNITURE; CABINETS; DRAWERS; GENERAL DETAILS OF FURNITURE
- A47B57/00—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions
- A47B57/06—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions with means for adjusting the height of the shelves
- A47B57/26—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions with means for adjusting the height of the shelves consisting of clamping means, e.g. with sliding bolts or sliding wedges
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47F—SPECIAL FURNITURE, FITTINGS, OR ACCESSORIES FOR SHOPS, STOREHOUSES, BARS, RESTAURANTS OR THE LIKE; PAYING COUNTERS
- A47F5/00—Show stands, hangers, or shelves characterised by their constructional features
- A47F5/04—Stands with a central pillar, e.g. tree type
- A47F5/06—Stands with a central pillar, e.g. tree type adjustable
Landscapes
- Display Racks (AREA)
- Liquid Crystal (AREA)
- Road Signs Or Road Markings (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843428554 DE3428554A1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsstaender |
| EP85109726A EP0171721B1 (de) | 1984-08-02 | 1985-08-02 | Ausstellungsständer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE35613T1 true ATE35613T1 (de) | 1988-07-15 |
Family
ID=6242230
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT85109726T ATE35613T1 (de) | 1984-08-02 | 1985-08-02 | Ausstellungsstaender. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4678089A (enExample) |
| EP (1) | EP0171721B1 (enExample) |
| JP (1) | JPS6134957U (enExample) |
| AT (1) | ATE35613T1 (enExample) |
| DE (3) | DE3428554A1 (enExample) |
| ES (1) | ES288385Y (enExample) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4865283A (en) * | 1987-04-03 | 1989-09-12 | Parker Robert J | Merchandising display stand |
| DE8800320U1 (de) * | 1988-01-14 | 1988-03-10 | Horst GmbH Druck + Verpackung, 6450 Hanau | Warendisplayständer |
| DE3913658A1 (de) * | 1988-05-27 | 1989-12-07 | Kratz Soehne N | Staender fuer kfz-raeder |
| NO882716L (no) * | 1988-06-20 | 1989-12-21 | Isco Ind Sales Co | Anordning ved pall. |
| US4921190A (en) * | 1989-01-30 | 1990-05-01 | Mark Philip Promotions, Inc. | Display construction |
| DE3939632A1 (de) * | 1989-11-30 | 1991-06-06 | Karl Dr Goltz | Zerlegbarer, stufenartiger tisch, deren platten drehbar sind |
| USD328205S (en) | 1990-02-22 | 1992-07-28 | Dyment Limited | Display rack |
| US5183167A (en) * | 1991-09-06 | 1993-02-02 | Cheng W H | Adjustable multi-desk rack |
| US5292015A (en) * | 1992-03-11 | 1994-03-08 | Harbor Industries, Inc. | Display stand |
| AT19U3 (de) * | 1994-06-16 | 1995-02-27 | Transcom Stabilimento Transcom | Aufbewahrungsständer |
| US5497972A (en) * | 1994-10-26 | 1996-03-12 | Hms Mfg. Co. | Stand for artificial Christmas tree or the like |
| SE502655C2 (sv) * | 1994-11-28 | 1995-12-04 | Satellit System Ab | Varubärare anbringbar på en väsentligen vertikal stång |
| US6123206A (en) * | 1996-01-16 | 2000-09-26 | Zaremba; George Julian | Removable display attachment with wedgelike retainers for vertical rigid cylindrical supports |
| USD387226S (en) * | 1996-02-20 | 1997-12-09 | Shahriar Dardashti | Storage and display stand |
| US5595312A (en) * | 1996-03-11 | 1997-01-21 | Dardashti; Shahriar | Easily assembled and adjustable storage and display tower assembly |
| US5908121A (en) * | 1996-03-11 | 1999-06-01 | Dardashti; Shahriar | Adjustable display assembly |
| USD403175S (en) | 1996-08-06 | 1998-12-29 | Shahriar Dardashti | Storage and display stand |
| US5680941A (en) * | 1996-08-08 | 1997-10-28 | Arrow Art Finishers, Inc. | Wrap-around externally shelved display stand |
| USD415632S (en) * | 1996-10-16 | 1999-10-26 | Shahriar Dardashti | Storage and display stand |
| USD406204S (en) * | 1997-01-21 | 1999-03-02 | Shahriar Dardashti | Storage and display stand |
| USD404936S (en) * | 1997-07-16 | 1999-02-02 | Shahriar Dardashti | Storage and display stand |
| USD406205S (en) * | 1997-07-16 | 1999-03-02 | Shahriar Dardashti | Storage and display stand |
| USD407582S (en) | 1997-07-16 | 1999-04-06 | Shahriar Dardashti | Storage and display stand |
| US5894944A (en) * | 1997-08-06 | 1999-04-20 | Swift; Lawrence F. | Tray |
| US5996511A (en) * | 1998-02-09 | 1999-12-07 | Swoger; Gary J. | Tray device for attachment to a vertical pole |
| DE29802821U1 (de) * | 1998-02-18 | 1998-04-09 | Instore-Marketing GmbH, 65779 Kelkheim | Warengestell mit höhenverstellbarem Fachboden |
| FR2786377B1 (fr) * | 1998-11-30 | 2001-02-23 | Roll | Dispositif pour fixer une etagere sur un montant |
| US6318572B1 (en) * | 2000-07-20 | 2001-11-20 | Yung Lin Lai | Multifunctional knockdown rack structure |
| DE10051928A1 (de) * | 2000-10-19 | 2002-05-02 | Vauth Sagel Gmbh & Co | Tragsäule eines Eckschrankkarussells |
| US6575316B2 (en) * | 2001-10-26 | 2003-06-10 | Colin Ross Taiwan, Inc. | Bathroom column hanging holder assembly |
| USD480581S1 (en) | 2002-08-14 | 2003-10-14 | Fas Industries, Inc. | Rotatable shelf assembly |
| CA2437326C (en) * | 2002-08-30 | 2007-04-10 | Fas Industries, Inc. | Shelf with retaining wall |
| GB2394401A (en) * | 2002-10-26 | 2004-04-28 | Julie Davidson | Storage rack for artists materials |
| US7021556B2 (en) * | 2003-10-31 | 2006-04-04 | Sephra Fountains, Llc | Fountain that flows with fluidic material |
| US7743698B2 (en) | 2003-10-31 | 2010-06-29 | Sephra L.P. | Fountain that flows with fluidic material |
| US20060081720A1 (en) * | 2004-09-17 | 2006-04-20 | Michel Esnault | Multi-tier chocolate fountain apparatus |
| US20080111002A1 (en) * | 2006-11-09 | 2008-05-15 | Muir Richard B | Sleeve for supporting a cylinder of a chocolate fountain |
| EP1935285A1 (de) * | 2006-12-23 | 2008-06-25 | Wolfgang Männer | Vorrichtung zum Abstellen, Ablegen und/oder Anhängen von Gegenständen an einen Mast, einen Pfahl, einer Stütze, einem Geländer oder dergleichen |
| WO2009149329A2 (en) * | 2008-06-05 | 2009-12-10 | Lala Lips Llc | Cosmetic organizer display |
| US8016113B2 (en) * | 2008-09-16 | 2011-09-13 | Plastic Systems, Inc. | Storage system with improved pole securement system |
| USD605353S1 (en) * | 2009-02-11 | 2009-12-01 | Test Rite Products Corp. | Cosmetic station |
| US20100229733A1 (en) * | 2009-03-16 | 2010-09-16 | Stephen Huber Castillo | Multi Level Cooking Device |
| JP5010008B2 (ja) * | 2010-04-14 | 2012-08-29 | 信一 小屋野 | 陳列棚 |
| US20120175325A1 (en) * | 2011-01-11 | 2012-07-12 | Del Grippo Jill C | Apparatus for housing, storing and organizing sponges and method of manufacutring same |
| US8777024B2 (en) | 2011-08-03 | 2014-07-15 | Teri Kramer | Portable organizer |
| US8919581B2 (en) * | 2012-07-12 | 2014-12-30 | US Display Group, Inc. | Merchandise display stand with locking shelves |
| DE102012022407A1 (de) * | 2012-11-16 | 2014-05-22 | Casimir Kast Verpackung und Display GmbH | Regal zur Warenpräsentation |
| US10405651B1 (en) | 2014-02-07 | 2019-09-10 | Teri Kramer | Portable paper organizer |
| US9585476B2 (en) * | 2015-04-28 | 2017-03-07 | Joseph T. Swisher | Multifunction workstation |
| US10213041B1 (en) * | 2016-09-13 | 2019-02-26 | Brian Fonseca | Modular holiday tree device |
| US10273070B2 (en) | 2017-05-19 | 2019-04-30 | Paper Systems, Inc. | Collapsible container |
| JP6185207B1 (ja) * | 2017-06-01 | 2017-08-23 | イー.メリット有限会社 | 物品収容スタンド |
| DE102018102370A1 (de) * | 2018-02-02 | 2019-08-08 | Stefan Wetzel | Verkaufsständer |
| US10835057B1 (en) * | 2019-04-29 | 2020-11-17 | Gpk Enterprises | Confectionary display apparatus |
| WO2024147857A2 (en) * | 2023-01-04 | 2024-07-11 | Daz Innovation Inc | Insect infiltration protection apparatus for pole mounted bird feeder |
| USD1006506S1 (en) * | 2023-09-01 | 2023-12-05 | Zhiqiang Zhan | Rotatable shelf |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE135665C (enExample) * | ||||
| US1581463A (en) * | 1924-02-14 | 1926-04-20 | Walter C Moors | Clothes-drying rack |
| GB294782A (en) * | 1927-08-19 | 1928-08-02 | Arthur Walter Taylor | Improvements in display racks for garments and other articles or objects |
| US2447924A (en) * | 1946-03-04 | 1948-08-24 | John A Vitale | Costumer |
| FR1235512A (fr) * | 1959-05-28 | 1960-07-08 | Meubles d'étalage | |
| FR1307004A (fr) * | 1961-09-13 | 1962-10-19 | Piédestal d'étalage | |
| US3236389A (en) * | 1964-12-14 | 1966-02-22 | Robert M Murdock | Layer cake separator |
| FR1513292A (fr) * | 1965-09-23 | 1968-02-16 | Rosa Innocenti Guerri | Corbeille ou panier pour parasols de plage et similaires |
| GB1129594A (en) * | 1966-02-01 | 1968-10-09 | George William Maris | An improved multi-shelf unit |
| US3675598A (en) * | 1970-11-04 | 1972-07-11 | William Hodges & Co Inc | Adjustable shelving |
| FR2224013A5 (en) * | 1973-04-02 | 1974-10-25 | Alby Albert | Locking device for shelf fixing to a column - uses elastic ring in central aperture of shelf engaging column |
| US4057665A (en) * | 1976-04-21 | 1977-11-08 | Szulewski John W | Artificial tree structure |
| US4126963A (en) * | 1977-03-31 | 1978-11-28 | Alvis Harold Dunbar | Tree stand for supporting and watering a live tree |
| US4159096A (en) * | 1977-05-12 | 1979-06-26 | General Foam Plastics Corp. | Super stable, simply assembleable tree stand |
| US4261138A (en) * | 1978-10-27 | 1981-04-14 | St George Syms John G | Christmas tree holder |
-
1984
- 1984-08-02 DE DE19843428554 patent/DE3428554A1/de active Granted
- 1984-08-02 DE DE8423037U patent/DE8423037U1/de not_active Expired
-
1985
- 1985-06-27 US US06/749,309 patent/US4678089A/en not_active Expired - Fee Related
- 1985-07-26 ES ES1985288385U patent/ES288385Y/es not_active Expired
- 1985-08-01 JP JP1985117286U patent/JPS6134957U/ja active Pending
- 1985-08-02 AT AT85109726T patent/ATE35613T1/de not_active IP Right Cessation
- 1985-08-02 EP EP85109726A patent/EP0171721B1/de not_active Expired
- 1985-08-02 DE DE8585109726T patent/DE3563679D1/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES288385Y (es) | 1987-02-01 |
| EP0171721A1 (de) | 1986-02-19 |
| ES288385U (es) | 1986-06-01 |
| DE3563679D1 (en) | 1988-08-18 |
| JPS6134957U (ja) | 1986-03-04 |
| DE8423037U1 (de) | 1987-10-01 |
| DE3428554A1 (de) | 1986-02-13 |
| US4678089A (en) | 1987-07-07 |
| EP0171721B1 (de) | 1988-07-13 |
| DE3428554C2 (enExample) | 1992-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATE35613T1 (de) | Ausstellungsstaender. | |
| DE3772585D1 (de) | Getraenkepraesentierstaender. | |
| DK555887D0 (da) | Audiometer med interaktiv grafisk display til boern | |
| IT1230718B (it) | Fluorurazione diretta di fluoro b sultoni ai corrispondenti fluorossi fluorosulfonil fluorocomposti. | |
| GB8520605D0 (en) | Collapsible display stand | |
| NO951850D0 (no) | Salgsstativ for flasker | |
| IT1144251B (it) | Struttura di sostegno per sedie tavole ed affini | |
| PT83424A (pt) | Mostrador dinamico iluminado multicolor | |
| FR2632503B1 (fr) | Support presentoir de bouteilles | |
| GB2186851B (en) | Collapsible caravan support stand | |
| GB2189987B (en) | Support stand | |
| NO892854D0 (no) | Fortelt til campingvogn. | |
| BR6702875U (pt) | Carrinho padrao de supermercado com display | |
| KR910000185U (ko) | 간이용 물품 진열대 | |
| NO874663D0 (no) | Reklamestativ. | |
| KR860011412U (ko) | 물품 진열대 | |
| IE862196L (en) | Collapsible display stand | |
| CS284487A1 (en) | Low-alcoholic saturated beverage on the base of natural wine | |
| FI870213A7 (fi) | Tukijalusta. | |
| AU561247A3 (en) | Flat foldable display stand | |
| GB8600814D0 (en) | Collapsible support stand | |
| IT210164Z2 (it) | Astuccio-contenitore per esposizione, vendita ed utilizzo di carta-modelli. | |
| AU96671S (en) | Display stand | |
| AU96874S (en) | Display stand | |
| ES1002213Y (es) | Atril simplificado de sobremesa |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| REN | Ceased due to non-payment of the annual fee |