JPS6134957U - 陳列スタンド - Google Patents
陳列スタンドInfo
- Publication number
- JPS6134957U JPS6134957U JP1985117286U JP11728685U JPS6134957U JP S6134957 U JPS6134957 U JP S6134957U JP 1985117286 U JP1985117286 U JP 1985117286U JP 11728685 U JP11728685 U JP 11728685U JP S6134957 U JPS6134957 U JP S6134957U
- Authority
- JP
- Japan
- Prior art keywords
- display stand
- column
- utility
- model registration
- fixed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000002265 prevention Effects 0.000 claims description 2
- 230000000295 complement effect Effects 0.000 claims 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 abstract 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47B—TABLES; DESKS; OFFICE FURNITURE; CABINETS; DRAWERS; GENERAL DETAILS OF FURNITURE
- A47B57/00—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions
- A47B57/06—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions with means for adjusting the height of the shelves
- A47B57/26—Cabinets, racks or shelf units, characterised by features for adjusting shelves or partitions with means for adjusting the height of the shelves consisting of clamping means, e.g. with sliding bolts or sliding wedges
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47F—SPECIAL FURNITURE, FITTINGS, OR ACCESSORIES FOR SHOPS, STOREHOUSES, BARS, RESTAURANTS OR THE LIKE; PAYING COUNTERS
- A47F5/00—Show stands, hangers, or shelves characterised by their constructional features
- A47F5/04—Stands with a central pillar, e.g. tree type
- A47F5/06—Stands with a central pillar, e.g. tree type adjustable
Landscapes
- Display Racks (AREA)
- Liquid Crystal (AREA)
- Road Signs Or Road Markings (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843428554 DE3428554A1 (de) | 1984-08-02 | 1984-08-02 | Ausstellungsstaender |
| DE3428554.7 | 1984-08-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPS6134957U true JPS6134957U (ja) | 1986-03-04 |
Family
ID=6242230
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP1985117286U Pending JPS6134957U (ja) | 1984-08-02 | 1985-08-01 | 陳列スタンド |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4678089A (enExample) |
| EP (1) | EP0171721B1 (enExample) |
| JP (1) | JPS6134957U (enExample) |
| AT (1) | ATE35613T1 (enExample) |
| DE (3) | DE3428554A1 (enExample) |
| ES (1) | ES288385Y (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2011218067A (ja) * | 2010-04-14 | 2011-11-04 | Shinichi Koyano | 陳列棚 |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4865283A (en) * | 1987-04-03 | 1989-09-12 | Parker Robert J | Merchandising display stand |
| DE8800320U1 (de) * | 1988-01-14 | 1988-03-10 | Horst GmbH Druck + Verpackung, 6450 Hanau | Warendisplayständer |
| DE3913658A1 (de) * | 1988-05-27 | 1989-12-07 | Kratz Soehne N | Staender fuer kfz-raeder |
| NO882716L (no) * | 1988-06-20 | 1989-12-21 | Isco Ind Sales Co | Anordning ved pall. |
| US4921190A (en) * | 1989-01-30 | 1990-05-01 | Mark Philip Promotions, Inc. | Display construction |
| DE3939632A1 (de) * | 1989-11-30 | 1991-06-06 | Karl Dr Goltz | Zerlegbarer, stufenartiger tisch, deren platten drehbar sind |
| USD328205S (en) | 1990-02-22 | 1992-07-28 | Dyment Limited | Display rack |
| US5183167A (en) * | 1991-09-06 | 1993-02-02 | Cheng W H | Adjustable multi-desk rack |
| US5292015A (en) * | 1992-03-11 | 1994-03-08 | Harbor Industries, Inc. | Display stand |
| AT19U3 (de) * | 1994-06-16 | 1995-02-27 | Transcom Stabilimento Transcom | Aufbewahrungsständer |
| US5497972A (en) * | 1994-10-26 | 1996-03-12 | Hms Mfg. Co. | Stand for artificial Christmas tree or the like |
| SE502655C2 (sv) * | 1994-11-28 | 1995-12-04 | Satellit System Ab | Varubärare anbringbar på en väsentligen vertikal stång |
| US6123206A (en) * | 1996-01-16 | 2000-09-26 | Zaremba; George Julian | Removable display attachment with wedgelike retainers for vertical rigid cylindrical supports |
| USD387226S (en) * | 1996-02-20 | 1997-12-09 | Shahriar Dardashti | Storage and display stand |
| US5595312A (en) * | 1996-03-11 | 1997-01-21 | Dardashti; Shahriar | Easily assembled and adjustable storage and display tower assembly |
| US5908121A (en) * | 1996-03-11 | 1999-06-01 | Dardashti; Shahriar | Adjustable display assembly |
| USD403175S (en) | 1996-08-06 | 1998-12-29 | Shahriar Dardashti | Storage and display stand |
| US5680941A (en) * | 1996-08-08 | 1997-10-28 | Arrow Art Finishers, Inc. | Wrap-around externally shelved display stand |
| USD415632S (en) * | 1996-10-16 | 1999-10-26 | Shahriar Dardashti | Storage and display stand |
| USD406204S (en) * | 1997-01-21 | 1999-03-02 | Shahriar Dardashti | Storage and display stand |
| USD404936S (en) * | 1997-07-16 | 1999-02-02 | Shahriar Dardashti | Storage and display stand |
| USD406205S (en) * | 1997-07-16 | 1999-03-02 | Shahriar Dardashti | Storage and display stand |
| USD407582S (en) | 1997-07-16 | 1999-04-06 | Shahriar Dardashti | Storage and display stand |
| US5894944A (en) * | 1997-08-06 | 1999-04-20 | Swift; Lawrence F. | Tray |
| US5996511A (en) * | 1998-02-09 | 1999-12-07 | Swoger; Gary J. | Tray device for attachment to a vertical pole |
| DE29802821U1 (de) * | 1998-02-18 | 1998-04-09 | Instore-Marketing GmbH, 65779 Kelkheim | Warengestell mit höhenverstellbarem Fachboden |
| FR2786377B1 (fr) * | 1998-11-30 | 2001-02-23 | Roll | Dispositif pour fixer une etagere sur un montant |
| US6318572B1 (en) * | 2000-07-20 | 2001-11-20 | Yung Lin Lai | Multifunctional knockdown rack structure |
| DE10051928A1 (de) * | 2000-10-19 | 2002-05-02 | Vauth Sagel Gmbh & Co | Tragsäule eines Eckschrankkarussells |
| US6575316B2 (en) * | 2001-10-26 | 2003-06-10 | Colin Ross Taiwan, Inc. | Bathroom column hanging holder assembly |
| USD480581S1 (en) | 2002-08-14 | 2003-10-14 | Fas Industries, Inc. | Rotatable shelf assembly |
| CA2437326C (en) * | 2002-08-30 | 2007-04-10 | Fas Industries, Inc. | Shelf with retaining wall |
| GB2394401A (en) * | 2002-10-26 | 2004-04-28 | Julie Davidson | Storage rack for artists materials |
| US7021556B2 (en) * | 2003-10-31 | 2006-04-04 | Sephra Fountains, Llc | Fountain that flows with fluidic material |
| US7743698B2 (en) | 2003-10-31 | 2010-06-29 | Sephra L.P. | Fountain that flows with fluidic material |
| US20060081720A1 (en) * | 2004-09-17 | 2006-04-20 | Michel Esnault | Multi-tier chocolate fountain apparatus |
| US20080111002A1 (en) * | 2006-11-09 | 2008-05-15 | Muir Richard B | Sleeve for supporting a cylinder of a chocolate fountain |
| EP1935285A1 (de) * | 2006-12-23 | 2008-06-25 | Wolfgang Männer | Vorrichtung zum Abstellen, Ablegen und/oder Anhängen von Gegenständen an einen Mast, einen Pfahl, einer Stütze, einem Geländer oder dergleichen |
| WO2009149329A2 (en) * | 2008-06-05 | 2009-12-10 | Lala Lips Llc | Cosmetic organizer display |
| US8016113B2 (en) * | 2008-09-16 | 2011-09-13 | Plastic Systems, Inc. | Storage system with improved pole securement system |
| USD605353S1 (en) * | 2009-02-11 | 2009-12-01 | Test Rite Products Corp. | Cosmetic station |
| US20100229733A1 (en) * | 2009-03-16 | 2010-09-16 | Stephen Huber Castillo | Multi Level Cooking Device |
| US20120175325A1 (en) * | 2011-01-11 | 2012-07-12 | Del Grippo Jill C | Apparatus for housing, storing and organizing sponges and method of manufacutring same |
| US8777024B2 (en) | 2011-08-03 | 2014-07-15 | Teri Kramer | Portable organizer |
| US8919581B2 (en) * | 2012-07-12 | 2014-12-30 | US Display Group, Inc. | Merchandise display stand with locking shelves |
| DE102012022407A1 (de) * | 2012-11-16 | 2014-05-22 | Casimir Kast Verpackung und Display GmbH | Regal zur Warenpräsentation |
| US10405651B1 (en) | 2014-02-07 | 2019-09-10 | Teri Kramer | Portable paper organizer |
| US9585476B2 (en) * | 2015-04-28 | 2017-03-07 | Joseph T. Swisher | Multifunction workstation |
| US10213041B1 (en) * | 2016-09-13 | 2019-02-26 | Brian Fonseca | Modular holiday tree device |
| US10273070B2 (en) | 2017-05-19 | 2019-04-30 | Paper Systems, Inc. | Collapsible container |
| JP6185207B1 (ja) * | 2017-06-01 | 2017-08-23 | イー.メリット有限会社 | 物品収容スタンド |
| DE102018102370A1 (de) * | 2018-02-02 | 2019-08-08 | Stefan Wetzel | Verkaufsständer |
| US10835057B1 (en) * | 2019-04-29 | 2020-11-17 | Gpk Enterprises | Confectionary display apparatus |
| WO2024147857A2 (en) * | 2023-01-04 | 2024-07-11 | Daz Innovation Inc | Insect infiltration protection apparatus for pole mounted bird feeder |
| USD1006506S1 (en) * | 2023-09-01 | 2023-12-05 | Zhiqiang Zhan | Rotatable shelf |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE135665C (enExample) * | ||||
| US1581463A (en) * | 1924-02-14 | 1926-04-20 | Walter C Moors | Clothes-drying rack |
| GB294782A (en) * | 1927-08-19 | 1928-08-02 | Arthur Walter Taylor | Improvements in display racks for garments and other articles or objects |
| US2447924A (en) * | 1946-03-04 | 1948-08-24 | John A Vitale | Costumer |
| FR1235512A (fr) * | 1959-05-28 | 1960-07-08 | Meubles d'étalage | |
| FR1307004A (fr) * | 1961-09-13 | 1962-10-19 | Piédestal d'étalage | |
| US3236389A (en) * | 1964-12-14 | 1966-02-22 | Robert M Murdock | Layer cake separator |
| FR1513292A (fr) * | 1965-09-23 | 1968-02-16 | Rosa Innocenti Guerri | Corbeille ou panier pour parasols de plage et similaires |
| GB1129594A (en) * | 1966-02-01 | 1968-10-09 | George William Maris | An improved multi-shelf unit |
| US3675598A (en) * | 1970-11-04 | 1972-07-11 | William Hodges & Co Inc | Adjustable shelving |
| FR2224013A5 (en) * | 1973-04-02 | 1974-10-25 | Alby Albert | Locking device for shelf fixing to a column - uses elastic ring in central aperture of shelf engaging column |
| US4057665A (en) * | 1976-04-21 | 1977-11-08 | Szulewski John W | Artificial tree structure |
| US4126963A (en) * | 1977-03-31 | 1978-11-28 | Alvis Harold Dunbar | Tree stand for supporting and watering a live tree |
| US4159096A (en) * | 1977-05-12 | 1979-06-26 | General Foam Plastics Corp. | Super stable, simply assembleable tree stand |
| US4261138A (en) * | 1978-10-27 | 1981-04-14 | St George Syms John G | Christmas tree holder |
-
1984
- 1984-08-02 DE DE19843428554 patent/DE3428554A1/de active Granted
- 1984-08-02 DE DE8423037U patent/DE8423037U1/de not_active Expired
-
1985
- 1985-06-27 US US06/749,309 patent/US4678089A/en not_active Expired - Fee Related
- 1985-07-26 ES ES1985288385U patent/ES288385Y/es not_active Expired
- 1985-08-01 JP JP1985117286U patent/JPS6134957U/ja active Pending
- 1985-08-02 AT AT85109726T patent/ATE35613T1/de not_active IP Right Cessation
- 1985-08-02 EP EP85109726A patent/EP0171721B1/de not_active Expired
- 1985-08-02 DE DE8585109726T patent/DE3563679D1/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2011218067A (ja) * | 2010-04-14 | 2011-11-04 | Shinichi Koyano | 陳列棚 |
Also Published As
| Publication number | Publication date |
|---|---|
| ES288385Y (es) | 1987-02-01 |
| ATE35613T1 (de) | 1988-07-15 |
| EP0171721A1 (de) | 1986-02-19 |
| ES288385U (es) | 1986-06-01 |
| DE3563679D1 (en) | 1988-08-18 |
| DE8423037U1 (de) | 1987-10-01 |
| DE3428554A1 (de) | 1986-02-13 |
| US4678089A (en) | 1987-07-07 |
| EP0171721B1 (de) | 1988-07-13 |
| DE3428554C2 (enExample) | 1992-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6134957U (ja) | 陳列スタンド | |
| JPS6324598U (enExample) | ||
| USD271831S (en) | Support bracket for a flower pot or similar article | |
| USD269567S (en) | Musical instrument stand or similar article | |
| JPH0511815Y2 (enExample) | ||
| JPH02123852U (enExample) | ||
| JPS5934380Y2 (ja) | スタンド | |
| JPH0227817Y2 (enExample) | ||
| JPH0326427Y2 (enExample) | ||
| JPS6280945U (enExample) | ||
| JPS6236649U (enExample) | ||
| JPH0513768Y2 (enExample) | ||
| JPH01134308U (enExample) | ||
| JPH0622885Y2 (ja) | 物品の支持装置 | |
| JPS62161878U (enExample) | ||
| JPS63117350U (enExample) | ||
| JPS63105422U (enExample) | ||
| JPH02109639U (enExample) | ||
| JPH02150106U (enExample) | ||
| JPS6368851U (enExample) | ||
| JPS6218909U (enExample) | ||
| JPH0227508U (enExample) | ||
| JPS62179980U (enExample) | ||
| JPH01147292U (enExample) | ||
| JPH02135811U (enExample) |