DE3331259C2 - - Google Patents
Info
- Publication number
- DE3331259C2 DE3331259C2 DE3331259A DE3331259A DE3331259C2 DE 3331259 C2 DE3331259 C2 DE 3331259C2 DE 3331259 A DE3331259 A DE 3331259A DE 3331259 A DE3331259 A DE 3331259A DE 3331259 C2 DE3331259 C2 DE 3331259C2
- Authority
- DE
- Germany
- Prior art keywords
- recording material
- group
- phenyl
- material according
- disubstituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 53
- -1 N, N-disubstituted hydrazine Chemical class 0.000 claims description 44
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 38
- 239000000243 solution Substances 0.000 claims description 29
- 239000000463 material Substances 0.000 claims description 20
- 235000010288 sodium nitrite Nutrition 0.000 claims description 19
- 235000011054 acetic acid Nutrition 0.000 claims description 17
- 238000007034 nitrosation reaction Methods 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 13
- 230000009935 nitrosation Effects 0.000 claims description 13
- 150000007857 hydrazones Chemical class 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 8
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 235000019253 formic acid Nutrition 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 235000019260 propionic acid Nutrition 0.000 claims description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-phenyl-beta-naphthalene amine Natural products C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- 238000000034 method Methods 0.000 description 17
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 230000009467 reduction Effects 0.000 description 11
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical compound C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 description 10
- 150000002832 nitroso derivatives Chemical class 0.000 description 10
- 230000000052 comparative effect Effects 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- UJCPPXOIDSEILU-UHFFFAOYSA-N 1-naphthalen-1-yl-1-phenylhydrazine Chemical compound C=1C=CC2=CC=CC=C2C=1N(N)C1=CC=CC=C1 UJCPPXOIDSEILU-UHFFFAOYSA-N 0.000 description 6
- USHBDFLVDKKZKS-UHFFFAOYSA-N 1-naphthalen-2-yl-1-phenylhydrazine Chemical compound C=1C=C2C=CC=CC2=CC=1N(N)C1=CC=CC=C1 USHBDFLVDKKZKS-UHFFFAOYSA-N 0.000 description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 238000006482 condensation reaction Methods 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- MNFZZNNFORDXSV-UHFFFAOYSA-N 4-(diethylamino)benzaldehyde Chemical compound CCN(CC)C1=CC=C(C=O)C=C1 MNFZZNNFORDXSV-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000007810 chemical reaction solvent Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- CBECDWUDYQOTSW-UHFFFAOYSA-N 2-ethylbut-3-enal Chemical compound CCC(C=C)C=O CBECDWUDYQOTSW-UHFFFAOYSA-N 0.000 description 1
- YGBCLRRWZQSURU-UHFFFAOYSA-N 4-[(diphenylhydrazinylidene)methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 YGBCLRRWZQSURU-UHFFFAOYSA-N 0.000 description 1
- WQMFOUHFQAPSST-UHFFFAOYSA-N 4-[(diphenylhydrazinylidene)methyl]-n,n-dipropylaniline Chemical compound C1=CC(N(CCC)CCC)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 WQMFOUHFQAPSST-UHFFFAOYSA-N 0.000 description 1
- XZENYRSOQDPPAN-UHFFFAOYSA-N 4-[[benzyl(phenyl)hydrazinylidene]methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=NN(C=1C=CC=CC=1)CC1=CC=CC=C1 XZENYRSOQDPPAN-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- QGJXVBICNCIWEL-UHFFFAOYSA-N 9-ethylcarbazole-3-carbaldehyde Chemical compound O=CC1=CC=C2N(CC)C3=CC=CC=C3C2=C1 QGJXVBICNCIWEL-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- TUCVSIRQWDGUHY-UHFFFAOYSA-N n,n-diethyl-4-[[methyl(phenyl)hydrazinylidene]methyl]aniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=NN(C)C1=CC=CC=C1 TUCVSIRQWDGUHY-UHFFFAOYSA-N 0.000 description 1
- WRDZMZGYHVUYRU-UHFFFAOYSA-N n-[(4-methoxyphenyl)methyl]aniline Chemical compound C1=CC(OC)=CC=C1CNC1=CC=CC=C1 WRDZMZGYHVUYRU-UHFFFAOYSA-N 0.000 description 1
- JGOAZQAXRONCCI-SDNWHVSQSA-N n-[(e)-benzylideneamino]aniline Chemical compound C=1C=CC=CC=1N\N=C\C1=CC=CC=C1 JGOAZQAXRONCCI-SDNWHVSQSA-N 0.000 description 1
- DFZYUQVGKJPKDG-UHFFFAOYSA-N n-[[4-(dibenzylamino)phenyl]methylideneamino]-n-phenylnaphthalen-1-amine Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=NN(C=2C=CC=CC=2)C=2C3=CC=CC=C3C=CC=2)=CC=1)CC1=CC=CC=C1 DFZYUQVGKJPKDG-UHFFFAOYSA-N 0.000 description 1
- XGMBOFUUONEKCF-UHFFFAOYSA-N n-[[4-(dibenzylamino)phenyl]methylideneamino]-n-phenylnaphthalen-2-amine Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=NN(C=2C=CC=CC=2)C=2C=C3C=CC=CC3=CC=2)=CC=1)CC1=CC=CC=C1 XGMBOFUUONEKCF-UHFFFAOYSA-N 0.000 description 1
- SUJMFQYAKKPLSH-UHFFFAOYSA-N n-[[4-(diethylamino)phenyl]methylideneamino]-n-phenylnaphthalen-1-amine Chemical compound C1=CC(N(CC)CC)=CC=C1C=NN(C=1C2=CC=CC=C2C=CC=1)C1=CC=CC=C1 SUJMFQYAKKPLSH-UHFFFAOYSA-N 0.000 description 1
- ZZGRENZOWHLIKV-UHFFFAOYSA-N n-[[4-(dimethylamino)phenyl]methylideneamino]-n-phenylnaphthalen-1-amine Chemical compound C1=CC(N(C)C)=CC=C1C=NN(C=1C2=CC=CC=C2C=CC=1)C1=CC=CC=C1 ZZGRENZOWHLIKV-UHFFFAOYSA-N 0.000 description 1
- FOONXNDONADQKN-UHFFFAOYSA-N n-[[4-(dimethylamino)phenyl]methylideneamino]-n-phenylnaphthalen-2-amine Chemical compound C1=CC(N(C)C)=CC=C1C=NN(C=1C=C2C=CC=CC2=CC=1)C1=CC=CC=C1 FOONXNDONADQKN-UHFFFAOYSA-N 0.000 description 1
- GTWJETSWSUWSEJ-UHFFFAOYSA-N n-benzylaniline Chemical compound C=1C=CC=CC=1CNC1=CC=CC=C1 GTWJETSWSUWSEJ-UHFFFAOYSA-N 0.000 description 1
- VMVGVGMRBKYIGN-UHFFFAOYSA-N n-naphthalen-1-ylnaphthalen-1-amine Chemical compound C1=CC=C2C(NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 VMVGVGMRBKYIGN-UHFFFAOYSA-N 0.000 description 1
- UNJZLNFHHINVOB-UHFFFAOYSA-N n-naphthalen-1-ylnaphthalen-2-amine Chemical compound C1=CC=C2C(NC=3C=C4C=CC=CC4=CC=3)=CC=CC2=C1 UNJZLNFHHINVOB-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XRWSIBVXSYPWLH-UHFFFAOYSA-N n-phenyl-n-[(4-pyrrolidin-1-ylphenyl)methylideneamino]aniline Chemical compound C1CCCN1C(C=C1)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 XRWSIBVXSYPWLH-UHFFFAOYSA-N 0.000 description 1
- JTHNLKXLWOXOQK-UHFFFAOYSA-N n-propyl vinyl ketone Natural products CCCC(=O)C=C JTHNLKXLWOXOQK-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C249/00—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C249/16—Preparation of compounds containing nitrogen atoms doubly-bound to a carbon skeleton of hydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
- C07D209/86—Carbazoles; Hydrogenated carbazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the ring system
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/0612—Acyclic or carbocyclic compounds containing nitrogen
- G03G5/0616—Hydrazines; Hydrazones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Photoreceptors In Electrophotography (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP57150023A JPS5939860A (ja) | 1982-08-31 | 1982-08-31 | ヒドラゾン化合物の製造法 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3331259A1 DE3331259A1 (de) | 1984-03-01 |
| DE3331259C2 true DE3331259C2 (forum.php) | 1987-07-23 |
Family
ID=15487797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833331259 Granted DE3331259A1 (de) | 1982-08-31 | 1983-08-30 | Verfahren zum synthetisieren eines n,n-disubstituierten hydrazons |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4990625A (forum.php) |
| JP (1) | JPS5939860A (forum.php) |
| DE (1) | DE3331259A1 (forum.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4025723A1 (de) * | 1989-08-15 | 1991-02-21 | Mitsubishi Paper Mills Ltd | Elektrophotographischer photorezeptor |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6330850A (ja) * | 1986-07-24 | 1988-02-09 | Canon Inc | 電子写真感光体 |
| JPS63137739A (ja) * | 1986-11-29 | 1988-06-09 | Toshiba Corp | ウランの濃縮装置 |
| CN1976896A (zh) * | 2004-06-29 | 2007-06-06 | 保土谷化学工业株式会社 | 腙化合物的制造方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2754326A (en) * | 1952-10-21 | 1956-07-10 | Du Pont | Nu-nitroso-nu-alkyl amides of aromatic dicarboxylic acids |
| US3359316A (en) * | 1958-02-24 | 1967-12-19 | Colgate Palmolive Co | Nu-nitroso-nu-phenylalkyl-amines |
| US2945062A (en) * | 1958-08-04 | 1960-07-12 | Dow Chemical Co | N-lower-alkyl-n-nitroso-3, 5-dinitro-o-toluamides |
| JPS4837247A (forum.php) * | 1971-09-17 | 1973-06-01 | ||
| GB1592851A (en) * | 1976-10-05 | 1981-07-08 | Shell Int Research | Aryl hydrazones and their preparation and use as fungicides |
| JPS5546760A (en) * | 1978-09-29 | 1980-04-02 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS55157550A (en) * | 1979-05-25 | 1980-12-08 | Ricoh Co Ltd | Novel hydrazone compound and its preparation |
| JPS56163613A (en) * | 1980-05-21 | 1981-12-16 | Matsushita Electric Industrial Co Ltd | Toaster |
| JPS5865261A (ja) * | 1981-10-13 | 1983-04-18 | Canon Inc | ヒドラゾン化合物の合成法 |
-
1982
- 1982-08-31 JP JP57150023A patent/JPS5939860A/ja active Pending
-
1983
- 1983-08-30 DE DE19833331259 patent/DE3331259A1/de active Granted
-
1989
- 1989-12-05 US US07/445,930 patent/US4990625A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4025723A1 (de) * | 1989-08-15 | 1991-02-21 | Mitsubishi Paper Mills Ltd | Elektrophotographischer photorezeptor |
Also Published As
| Publication number | Publication date |
|---|---|
| US4990625A (en) | 1991-02-05 |
| JPS5939860A (ja) | 1984-03-05 |
| DE3331259A1 (de) | 1984-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69327405T2 (de) | Verbindungen zur Herstellung eines photographischen Magentakupplers | |
| DE906934C (de) | Verfahren zur Reinigung von 1-Oxyaryl-2-carbonsaeureamiden | |
| DE3441041A1 (de) | Verfahren zur herstellung von squarainzusammensetzungen | |
| DE3331259C2 (forum.php) | ||
| DE2301495B2 (de) | Grün-gelbe kationische Farbstoffe und Verfahren zu ihrer Herstellung | |
| DE2518587A1 (de) | Verfahren zur herstellung basischer oxazinfarbstoffe | |
| DE3004700C2 (de) | Verfahren zur Herstellung von Tryptaminderivaten | |
| DE69005566T2 (de) | Herstellung von para-phenylendiaminen. | |
| DE2400489B2 (de) | Salze aus D- oder L-N-Methylephedrin und Enamin-Derivaten von a -Aminomonocarbonsäuren, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1545724B2 (de) | Verfahren zur herstellung von 5-phenyl-2,3-dihydro-1h-1,4-benzodiazepin-2-onverbindungen | |
| DE3917113A1 (de) | Verfahren zur selektiven herstellung von n(pfeil hoch)4(pfeil hoch)-substituierten 1,4-diamino-2-nitrobenzolen | |
| DE69728703T2 (de) | Verfahren zur Herstellung von 1,1-disubstituierten-1H-Benz[e]indol Derivaten und Hydroxyl-substituierte 1,1-disubstituierte-1H-Benz[e]indol Derivate | |
| DE2438077A1 (de) | Verfahren zur herstellung von propanolaminderivaten und nach dem verfahren hergestellte propanolaminderivate | |
| CH432542A (de) | Verfahren zur Herstellung neuer Hydrazide | |
| DE1568622A1 (de) | Verfahren zur Herstellung neuartiger Phenolderivate | |
| DE1272299B (de) | Verfahren zur Herstellung von in 1-Stellung substituierten 3-Acyl-amino-2-pyrazolin-5-onen, 3-Ureido-2-pyrazolin-5-onen und 3-Thio-ureido-2-pyrazolin-5-onen | |
| DE69532563T2 (de) | 3-substituierte 3-Oxo-2-(5,5-dimethylhydantoin-3-yl)-propionsäureamide und deren Herstellungsverfahren | |
| DE2755749A1 (de) | 4,5-disubstituierte imidazol-2-thione und ihre salze sowie verfahren zu iher herstellung | |
| EP0031089B1 (de) | Verfahren zur Herstellung von N,N'-Diarylalkylendiaminen oder N,N',N"-Triaryldialkylen-triaminen | |
| DE69606662T2 (de) | Dianilinoglutacondialdehyd-Verbindungen und Verfahren zu ihrer Herstellung | |
| DE2220383C3 (de) | Methin-Farbstoffe und ihre Verwendung in ihrer Leukoform mit einem Lichtoxydationsmittel zur Herstellung von Farblichtbildern | |
| DE2119724A1 (de) | Verfahren zur Herstellung einer halogensubstituierten Benzoesäure | |
| DE3820595A1 (de) | Organische salze enthaltend zwei bis vier cyclische oder acyclische amidinreste und ihre verwendung als basenvorlaeufer, insbesondere in waermeentwickelbarem aufzeichnungsmaterial | |
| DE1545724C3 (de) | Verfahren zur Herstellung von S-Phenyl^-dihydro-lH-M-benzodiazepin-2-onverb'indungen | |
| DE2819462C2 (forum.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8125 | Change of the main classification |
Ipc: G03G 5/06 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |