DE3311361C2 - Strickmaschine zur Herstellung von Maschenware - Google Patents
Strickmaschine zur Herstellung von MaschenwareInfo
- Publication number
- DE3311361C2 DE3311361C2 DE3311361A DE3311361A DE3311361C2 DE 3311361 C2 DE3311361 C2 DE 3311361C2 DE 3311361 A DE3311361 A DE 3311361A DE 3311361 A DE3311361 A DE 3311361A DE 3311361 C2 DE3311361 C2 DE 3311361C2
- Authority
- DE
- Germany
- Prior art keywords
- needle
- needles
- sinkers
- lock
- knitting machine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000009940 knitting Methods 0.000 title claims abstract description 24
- 239000004744 fabric Substances 0.000 title claims 3
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 238000006073 displacement reaction Methods 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims 2
- 238000000034 method Methods 0.000 claims 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims 2
- WMFYOYKPJLRMJI-UHFFFAOYSA-N Lercanidipine hydrochloride Chemical compound Cl.COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)CN(C)CCC(C=2C=CC=CC=2)C=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 WMFYOYKPJLRMJI-UHFFFAOYSA-N 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 229910052697 platinum Inorganic materials 0.000 claims 1
- 206010041232 sneezing Diseases 0.000 claims 1
- 206010061224 Limb discomfort Diseases 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D04—BRAIDING; LACE-MAKING; KNITTING; TRIMMINGS; NON-WOVEN FABRICS
- D04B—KNITTING
- D04B15/00—Details of, or auxiliary devices incorporated in, weft knitting machines, restricted to machines of this kind
- D04B15/06—Sinkers
-
- D—TEXTILES; PAPER
- D04—BRAIDING; LACE-MAKING; KNITTING; TRIMMINGS; NON-WOVEN FABRICS
- D04B—KNITTING
- D04B15/00—Details of, or auxiliary devices incorporated in, weft knitting machines, restricted to machines of this kind
- D04B15/14—Needle cylinders
-
- D—TEXTILES; PAPER
- D04—BRAIDING; LACE-MAKING; KNITTING; TRIMMINGS; NON-WOVEN FABRICS
- D04B—KNITTING
- D04B15/00—Details of, or auxiliary devices incorporated in, weft knitting machines, restricted to machines of this kind
- D04B15/32—Cam systems or assemblies for operating knitting instruments
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Knitting Machines (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3311361A DE3311361C2 (de) | 1983-03-29 | 1983-03-29 | Strickmaschine zur Herstellung von Maschenware |
| GB08405445A GB2137233B (en) | 1983-03-29 | 1984-03-01 | Knitting machine |
| DD84261234A DD215594A5 (de) | 1983-03-29 | 1984-03-26 | Strickmaschine zur herstellung von maschenware |
| US06/594,771 US4584851A (en) | 1983-03-29 | 1984-03-26 | Knitting machine for producing mesh products |
| JP59056408A JPS59187651A (ja) | 1983-03-29 | 1984-03-26 | 編物製造用編機 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3311361A DE3311361C2 (de) | 1983-03-29 | 1983-03-29 | Strickmaschine zur Herstellung von Maschenware |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3311361A1 DE3311361A1 (de) | 1984-10-04 |
| DE3311361C2 true DE3311361C2 (de) | 1986-07-24 |
Family
ID=6194959
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3311361A Expired DE3311361C2 (de) | 1983-03-29 | 1983-03-29 | Strickmaschine zur Herstellung von Maschenware |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4584851A (show.php) |
| JP (1) | JPS59187651A (show.php) |
| DD (1) | DD215594A5 (show.php) |
| DE (1) | DE3311361C2 (show.php) |
| GB (1) | GB2137233B (show.php) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1650336A1 (de) | 2004-10-06 | 2006-04-26 | SIPRA Patententwicklungs- und Beteiligungsgesellschaft mbH | Rundstrickmaschine mit einer Entstaubungseinrichtung |
| DE10015730B4 (de) * | 2000-03-29 | 2012-09-13 | Sipra Patententwicklungs- Und Beteiligungsgesellschaft Mbh | Platine für eine insbesondere nach der Relativtechnik arbeitende Strickmaschine und mit einer derartigen Platine ausgerüstete Strickmaschine |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3330530C1 (de) * | 1983-08-24 | 1985-03-28 | Memminger Gmbh, 7290 Freudenstadt | Strickmaschine mit wenigstens einem Nadeltraeger |
| DE3433301C2 (de) * | 1984-09-11 | 1987-04-23 | Degussa Ag, 6000 Frankfurt | Verfahren zur verbrauchsabhängigen Totalverdampfung von flüssigem Stickoxid |
| DE3433290C2 (de) * | 1984-09-11 | 1986-09-18 | SIPRA Patententwicklungs- und Beteiligungsgesellschaft mbH, 7470 Albstadt | Strickmaschine |
| DD234453A1 (de) * | 1985-02-06 | 1986-04-02 | Textima Veb K | Vielsystemige rundstrickmaschine, insbesondere rechts-/links-grossrundstrickmaschine |
| DD235283A1 (de) * | 1985-03-12 | 1986-04-30 | Textima Veb K | Vielsystemige rundstrickmaschine, insbesondere r/l-grossrundstrickmaschine |
| DE3510054C1 (de) * | 1985-03-20 | 1986-10-09 | Memminger Gmbh, 7290 Freudenstadt | Strickmaschine mit wenigstens einem Nadeltraeger |
| DD238632A1 (de) * | 1985-06-26 | 1986-08-27 | Textima Veb K | Mustervorrichtung fuer rundstrickmaschinen, insbesondere r/l-grossrundstrickmaschinen |
| DD240036A1 (de) * | 1985-08-06 | 1986-10-15 | Textima Veb K | Vielsystemige rundstrickmaschine, insbesondere r/l-grossrundstrickmaschine zur herstellung von bindefadenfuttergestricken |
| DE3532856C1 (de) * | 1985-09-14 | 1986-12-18 | SIPRA Patententwicklungs- und Beteiligungsgesellschaft mbH, 7470 Albstadt | Rundstrickmaschine mit Nadeln und Einschliessplatinen |
| DE3540685C1 (de) * | 1985-11-16 | 1986-10-09 | SIPRA Patententwicklungs- und Beteiligungsgesellschaft mbH, 7470 Albstadt | Strickmaschine |
| DE3634784C1 (de) * | 1986-10-11 | 1988-02-04 | Sipra Patent Beteiligung | Mehrsystemige Rundstrickmaschine |
| DE4007253A1 (de) * | 1990-03-08 | 1991-09-12 | Sipra Patent Beteiligung | Strickmaschine |
| DE19822861C2 (de) * | 1998-05-22 | 2001-05-17 | Sipra Patent Beteiligung | Platine für eine Rundstrickmaschine und dafür geeignete Auswähleinrichtung |
| RU2219294C2 (ru) * | 1999-11-15 | 2003-12-20 | МАТЕК С.п.А. | Исполнительный механизм иглы в вязальных машинах для чулочных и подобных им изделий |
| DE10316702A1 (de) * | 2003-04-08 | 2004-10-28 | Sipra Patententwicklungs- Und Beteiligungsgesellschaft Mbh | Verfahren und Strickmaschine zur Herstellung von Strickwaren, insbesondere aus hartem, unelastischem Fadenmaterial |
| DE102004032270A1 (de) * | 2004-06-30 | 2006-01-19 | Sipra Patententwicklungs- Und Beteiligungsgesellschaft Mbh | Strickmaschine mit wenigstens einem Ringelapparat |
| EP1971711A1 (en) * | 2005-12-29 | 2008-09-24 | Leopoldo Bertagnoli | Method for making knitted fabric and related weft knitting machine |
| CN105088507A (zh) * | 2014-05-06 | 2015-11-25 | 徐央 | 圆编织机的编织机构 |
| EP3124663B1 (en) | 2015-07-30 | 2019-10-16 | Groz-Beckert KG | Loop-forming method and device |
| PT3124664T (pt) | 2015-07-30 | 2020-03-23 | Groz Beckert Kg | Método e dispositivo para a formação de laço |
| PT3690095T (pt) | 2019-01-31 | 2022-06-27 | Groz Beckert Kg | Agulha de máquina de tricotar e sistema de tricotagem |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1952928A (en) * | 1929-12-21 | 1934-03-27 | Hemphill Co | Knitting machine and method |
| US2069155A (en) * | 1929-12-21 | 1937-01-26 | Hemphill Co | Knitting machine |
| US2135187A (en) * | 1937-02-09 | 1938-11-01 | Hemphill Co | Needle bed for knitting machines |
| US3614877A (en) * | 1969-03-14 | 1971-10-26 | Monarch International Ltd | Compound stitch cam for knitting machines |
| DE2025144A1 (en) * | 1969-05-23 | 1970-12-23 | High-speed knitting machine | |
| DE2047401A1 (en) * | 1970-09-26 | 1972-03-30 | Bauder, Rolf, Dipl Ing , 7411 Reut hngen Betzingen, Schach, Wolfgang, Dipl Ing, 7410 Reutlingen | Circular knitting machine - for knitting pile fabrics |
| DD98120A5 (show.php) * | 1971-09-02 | 1973-06-05 | ||
| DE2408924C2 (de) * | 1974-02-25 | 1983-12-29 | Alfred 7031 Bondorf Buck | Vorrichtung zum Herstellen von Maschenwaren |
| DE2642079A1 (de) * | 1976-09-18 | 1978-03-23 | Harry Apprich | Lageranordnung fuer schieber am nadelzylinder einer strickmaschine |
| GB1577481A (en) * | 1976-11-01 | 1980-10-22 | Philip M | Circular knitting machines |
| IT1104303B (it) * | 1978-12-21 | 1985-10-21 | Conti Gianni | Macchina da maglieria con aghisenza paletta cooperanti con elementi ad uncino esterni |
| DE2909963C2 (de) * | 1979-03-14 | 1983-02-03 | Ulrich 7470 Albstadt Hofmann | Verfahren zur maschinellen Maschenbildung |
| DE3108041C2 (de) * | 1981-03-03 | 1985-01-31 | Alfred 7031 Bondorf Buck | Strickmaschine |
| DE3246512C2 (de) * | 1982-12-16 | 1985-02-21 | Memminger Gmbh, 7290 Freudenstadt | Strickmaschine |
| DE3321385A1 (de) * | 1983-06-14 | 1984-12-20 | Terrot Strickmaschinen GmbH, 7000 Stuttgart | Maschenbildende maschine |
-
1983
- 1983-03-29 DE DE3311361A patent/DE3311361C2/de not_active Expired
-
1984
- 1984-03-01 GB GB08405445A patent/GB2137233B/en not_active Expired
- 1984-03-26 JP JP59056408A patent/JPS59187651A/ja active Granted
- 1984-03-26 US US06/594,771 patent/US4584851A/en not_active Expired - Lifetime
- 1984-03-26 DD DD84261234A patent/DD215594A5/de unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10015730B4 (de) * | 2000-03-29 | 2012-09-13 | Sipra Patententwicklungs- Und Beteiligungsgesellschaft Mbh | Platine für eine insbesondere nach der Relativtechnik arbeitende Strickmaschine und mit einer derartigen Platine ausgerüstete Strickmaschine |
| EP1650336A1 (de) | 2004-10-06 | 2006-04-26 | SIPRA Patententwicklungs- und Beteiligungsgesellschaft mbH | Rundstrickmaschine mit einer Entstaubungseinrichtung |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3311361A1 (de) | 1984-10-04 |
| GB2137233A (en) | 1984-10-03 |
| JPS6257732B2 (show.php) | 1987-12-02 |
| GB8405445D0 (en) | 1984-04-04 |
| JPS59187651A (ja) | 1984-10-24 |
| GB2137233B (en) | 1986-02-26 |
| DD215594A5 (de) | 1984-11-14 |
| US4584851A (en) | 1986-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3311361C2 (de) | Strickmaschine zur Herstellung von Maschenware | |
| EP0059919B1 (de) | Strickmaschine | |
| EP0424717B1 (de) | Flachstrickmaschine | |
| DE3532856C1 (de) | Rundstrickmaschine mit Nadeln und Einschliessplatinen | |
| DD298139A5 (de) | Strickmaschine | |
| EP0531789B1 (de) | Rundstrickmaschine zur Herstellung von Plüschwaren | |
| EP0302286B1 (de) | Rundstrickmaschine mit Schiebernadeln | |
| DE3237732A1 (de) | Flachstrickmaschine mit nadelauswahleinrichtung | |
| DE3540685C1 (de) | Strickmaschine | |
| EP0857802B1 (de) | Flachstrickmaschine | |
| DE3433290C2 (de) | Strickmaschine | |
| EP1801277B1 (de) | Vorrichtung zur Erzeugung eines Abstandsgestricks | |
| EP0532871B1 (de) | Zweibettige Flachstrickmaschine mit Nadeln und Platinen | |
| DE4240037C2 (de) | Schloßanordnung für eine Strickmaschine | |
| EP2302118A1 (de) | Verfahren und Strickmaschine zur Herstellung von Strickwaren mit Ringelmustern | |
| DE3348030C2 (de) | Strickmaschine zur Herstellung von Maschenware | |
| DE3928986C2 (de) | Strickmaschine | |
| DE102018117309A1 (de) | Rundstrickmaschine mit Wirkfunktion | |
| DE3507004C2 (show.php) | ||
| DE2632891A1 (de) | Schloss fuer rundstrickmaschinen | |
| DE4115198C2 (de) | Einrichtung an mit Schiebernadeln ausgerüsteten Rundstrickmaschinen und Schiebernadel für Rundstrickmaschinen | |
| DE870155C (de) | Flache Kulierwirkmaschine | |
| DD256337A1 (de) | Rundstrickmaschine, insbesondere r/l-grossrundstrickmaschine | |
| DE1635869B2 (de) | Mustervorrichtung für Rundstrickmaschinen | |
| DE1685144C3 (de) | Schiffchenstickmaschine mit einer Einrichtung zum Faden- oder Farbwechsel bzw. Rapportwechsel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8110 | Request for examination paragraph 44 | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3348030 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3348030 |
|
| D2 | Grant after examination | ||
| AH | Division in |
Ref country code: DE Ref document number: 3348030 Format of ref document f/p: P |
|
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings |