DE3114627C2 - - Google Patents
Info
- Publication number
- DE3114627C2 DE3114627C2 DE3114627A DE3114627A DE3114627C2 DE 3114627 C2 DE3114627 C2 DE 3114627C2 DE 3114627 A DE3114627 A DE 3114627A DE 3114627 A DE3114627 A DE 3114627A DE 3114627 C2 DE3114627 C2 DE 3114627C2
- Authority
- DE
- Germany
- Prior art keywords
- electrically conductive
- metal oxide
- recording material
- particles
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 77
- 239000002245 particle Substances 0.000 claims description 71
- 239000000463 material Substances 0.000 claims description 57
- 239000000839 emulsion Substances 0.000 claims description 45
- -1 silver halide Chemical class 0.000 claims description 42
- 150000004706 metal oxides Chemical class 0.000 claims description 38
- 229910044991 metal oxide Inorganic materials 0.000 claims description 37
- 229910052709 silver Inorganic materials 0.000 claims description 37
- 239000004332 silver Substances 0.000 claims description 37
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 30
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 24
- 239000011230 binding agent Substances 0.000 claims description 17
- 125000005842 heteroatom Chemical group 0.000 claims description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 10
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 8
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 6
- 239000010419 fine particle Substances 0.000 claims description 6
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Chemical compound O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Inorganic materials [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims description 5
- 229910052593 corundum Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 239000000377 silicon dioxide Substances 0.000 claims description 5
- 229910001845 yogo sapphire Inorganic materials 0.000 claims description 5
- 229910052681 coesite Inorganic materials 0.000 claims description 4
- 229910052906 cristobalite Inorganic materials 0.000 claims description 4
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(III) oxide Inorganic materials [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052758 niobium Inorganic materials 0.000 claims description 4
- 235000012239 silicon dioxide Nutrition 0.000 claims description 4
- 229910052682 stishovite Inorganic materials 0.000 claims description 4
- 229910052905 tridymite Inorganic materials 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 2
- 230000006735 deficit Effects 0.000 claims description 2
- 229910052738 indium Inorganic materials 0.000 claims description 2
- 229910052715 tantalum Inorganic materials 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 239000010410 layer Substances 0.000 description 61
- 239000000243 solution Substances 0.000 description 36
- 238000000034 method Methods 0.000 description 25
- 229920000159 gelatin Polymers 0.000 description 21
- 235000019322 gelatine Nutrition 0.000 description 21
- 108010010803 Gelatin Proteins 0.000 description 20
- 239000008273 gelatin Substances 0.000 description 20
- 235000011852 gelatine desserts Nutrition 0.000 description 20
- 239000000843 powder Substances 0.000 description 20
- 238000000149 argon plasma sintering Methods 0.000 description 17
- 230000003068 static effect Effects 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 239000012799 electrically-conductive coating Substances 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 12
- 239000011787 zinc oxide Substances 0.000 description 12
- 230000035945 sensitivity Effects 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 10
- 239000000084 colloidal system Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000004094 surface-active agent Substances 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 238000011282 treatment Methods 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 8
- 238000000576 coating method Methods 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 238000005259 measurement Methods 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 7
- 238000000926 separation method Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000011161 development Methods 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 229920002799 BoPET Polymers 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- 239000003973 paint Substances 0.000 description 5
- 238000005245 sintering Methods 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical group O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 4
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 4
- 239000004020 conductor Substances 0.000 description 4
- 230000006866 deterioration Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000049 pigment Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 206010021143 Hypoxia Diseases 0.000 description 3
- 206010070834 Sensitisation Diseases 0.000 description 3
- 239000012790 adhesive layer Substances 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 229910000410 antimony oxide Inorganic materials 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000011247 coating layer Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- 239000005020 polyethylene terephthalate Substances 0.000 description 3
- 239000011241 protective layer Substances 0.000 description 3
- 230000008313 sensitization Effects 0.000 description 3
- 230000001235 sensitizing effect Effects 0.000 description 3
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Inorganic materials [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 3
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 3
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 2
- 102000009027 Albumins Human genes 0.000 description 2
- 108010088751 Albumins Proteins 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229920000881 Modified starch Polymers 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 239000002216 antistatic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- DAMJCWMGELCIMI-UHFFFAOYSA-N benzyl n-(2-oxopyrrolidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CCNC1=O DAMJCWMGELCIMI-UHFFFAOYSA-N 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 150000001719 carbohydrate derivatives Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 229910003437 indium oxide Inorganic materials 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 235000019426 modified starch Nutrition 0.000 description 2
- 239000010955 niobium Substances 0.000 description 2
- 229920000191 poly(N-vinyl pyrrolidone) Polymers 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000000661 sodium alginate Substances 0.000 description 2
- 235000010413 sodium alginate Nutrition 0.000 description 2
- 229940005550 sodium alginate Drugs 0.000 description 2
- UBXAKNTVXQMEAG-UHFFFAOYSA-L strontium sulfate Chemical compound [Sr+2].[O-]S([O-])(=O)=O UBXAKNTVXQMEAG-UHFFFAOYSA-L 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 1
- LUMLZKVIXLWTCI-NSCUHMNNSA-N (e)-2,3-dichloro-4-oxobut-2-enoic acid Chemical compound OC(=O)C(\Cl)=C(/Cl)C=O LUMLZKVIXLWTCI-NSCUHMNNSA-N 0.000 description 1
- JAEZSIYNWDWMMN-UHFFFAOYSA-N 1,1,3-trimethylthiourea Chemical compound CNC(=S)N(C)C JAEZSIYNWDWMMN-UHFFFAOYSA-N 0.000 description 1
- IKTSMPLPCJREOD-UHFFFAOYSA-N 1,3,5-tris(ethenylsulfonyl)-1,3,5-triazinane Chemical compound C=CS(=O)(=O)N1CN(S(=O)(=O)C=C)CN(S(=O)(=O)C=C)C1 IKTSMPLPCJREOD-UHFFFAOYSA-N 0.000 description 1
- YLVACWCCJCZITJ-UHFFFAOYSA-N 1,4-dioxane-2,3-diol Chemical compound OC1OCCOC1O YLVACWCCJCZITJ-UHFFFAOYSA-N 0.000 description 1
- NLVJVJFOGROFQT-UHFFFAOYSA-N 1,5-bis(ethenylsulfonyl)pentan-2-ol Chemical compound C=CS(=O)(=O)CC(O)CCCS(=O)(=O)C=C NLVJVJFOGROFQT-UHFFFAOYSA-N 0.000 description 1
- KAMCBFNNGGVPPW-UHFFFAOYSA-N 1-(ethenylsulfonylmethoxymethylsulfonyl)ethene Chemical compound C=CS(=O)(=O)COCS(=O)(=O)C=C KAMCBFNNGGVPPW-UHFFFAOYSA-N 0.000 description 1
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 1
- FYBFGAFWCBMEDG-UHFFFAOYSA-N 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one Chemical compound C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)C=C)C1 FYBFGAFWCBMEDG-UHFFFAOYSA-N 0.000 description 1
- JKAPWXKZLYJQJJ-UHFFFAOYSA-N 2,4-dichloro-6-methoxy-1,3,5-triazine Chemical compound COC1=NC(Cl)=NC(Cl)=N1 JKAPWXKZLYJQJJ-UHFFFAOYSA-N 0.000 description 1
- AXCGIKGRPLMUDF-UHFFFAOYSA-N 2,6-dichloro-1h-1,3,5-triazin-4-one;sodium Chemical compound [Na].OC1=NC(Cl)=NC(Cl)=N1 AXCGIKGRPLMUDF-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 1
- SAPGIBGZGRMCFZ-UHFFFAOYSA-N 3-[(2,5-dioxopyrrol-3-yl)methyl]pyrrole-2,5-dione Chemical compound O=C1NC(=O)C(CC=2C(NC(=O)C=2)=O)=C1 SAPGIBGZGRMCFZ-UHFFFAOYSA-N 0.000 description 1
- LFJVLQBHHRHLPF-UHFFFAOYSA-N 5-methyl-1,4-dioxane-2,3-diol Chemical compound CC1COC(O)C(O)O1 LFJVLQBHHRHLPF-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical class C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- GJBXZVQBXVFJGY-UHFFFAOYSA-N CN1CSC2=C1C=CC=C2.OC=2N1N=CN=C1N=C(C2)C Chemical compound CN1CSC2=C1C=CC=C2.OC=2N1N=CN=C1N=C(C2)C GJBXZVQBXVFJGY-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920008347 Cellulose acetate propionate Polymers 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 229910001111 Fine metal Inorganic materials 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- PCSMJKASWLYICJ-UHFFFAOYSA-N Succinic aldehyde Chemical compound O=CCCC=O PCSMJKASWLYICJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910004160 TaO2 Inorganic materials 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- IEIREBQISNYNTN-UHFFFAOYSA-K [Ag](I)(Br)Cl Chemical compound [Ag](I)(Br)Cl IEIREBQISNYNTN-UHFFFAOYSA-K 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 description 1
- USDJGQLNFPZEON-UHFFFAOYSA-N [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol Chemical compound OCNC1=NC(NCO)=NC(NCO)=N1 USDJGQLNFPZEON-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229940023476 agar Drugs 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 1
- JRLDUDBQNVFTCA-UHFFFAOYSA-N antimony(3+);trinitrate Chemical compound [Sb+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O JRLDUDBQNVFTCA-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000011001 backwashing Methods 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 229910052923 celestite Inorganic materials 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006265 cellulose acetate-butyrate film Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 229920001940 conductive polymer Polymers 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 229920005994 diacetyl cellulose Polymers 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- NQKXFODBPINZFK-UHFFFAOYSA-N dioxotantalum Chemical compound O=[Ta]=O NQKXFODBPINZFK-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000006224 matting agent Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- ZAKLKBFCSHJIRI-UHFFFAOYSA-N mucochloric acid Natural products OC1OC(=O)C(Cl)=C1Cl ZAKLKBFCSHJIRI-UHFFFAOYSA-N 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- YHBDIEWMOMLKOO-UHFFFAOYSA-I pentachloroniobium Chemical compound Cl[Nb](Cl)(Cl)(Cl)Cl YHBDIEWMOMLKOO-UHFFFAOYSA-I 0.000 description 1
- 150000003008 phosphonic acid esters Chemical class 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 125000002270 phosphoric acid ester group Chemical group 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920006289 polycarbonate film Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229960002796 polystyrene sulfonate Drugs 0.000 description 1
- 239000011970 polystyrene sulfonate Substances 0.000 description 1
- 229920001447 polyvinyl benzene Polymers 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229930182490 saponin Natural products 0.000 description 1
- 150000007949 saponins Chemical class 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- IZWPGJFSBABFGL-GMFCBQQYSA-M sodium;2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS([O-])(=O)=O IZWPGJFSBABFGL-GMFCBQQYSA-M 0.000 description 1
- SYWDUFAVIVYDMX-UHFFFAOYSA-M sodium;4,6-dichloro-1,3,5-triazin-2-olate Chemical compound [Na+].[O-]C1=NC(Cl)=NC(Cl)=N1 SYWDUFAVIVYDMX-UHFFFAOYSA-M 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical class OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 239000002345 surface coating layer Substances 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- SYRHIZPPCHMRIT-UHFFFAOYSA-N tin(4+) Chemical compound [Sn+4] SYRHIZPPCHMRIT-UHFFFAOYSA-N 0.000 description 1
- KHMOASUYFVRATF-UHFFFAOYSA-J tin(4+);tetrachloride;pentahydrate Chemical compound O.O.O.O.O.Cl[Sn](Cl)(Cl)Cl KHMOASUYFVRATF-UHFFFAOYSA-J 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- IUCJMVBFZDHPDX-UHFFFAOYSA-N tretamine Chemical compound C1CN1C1=NC(N2CC2)=NC(N2CC2)=N1 IUCJMVBFZDHPDX-UHFFFAOYSA-N 0.000 description 1
- ZNOKGRXACCSDPY-UHFFFAOYSA-N tungsten(VI) oxide Inorganic materials O=[W](=O)=O ZNOKGRXACCSDPY-UHFFFAOYSA-N 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 229910001935 vanadium oxide Inorganic materials 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 229920006163 vinyl copolymer Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/06—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein with non-macromolecular additives
- G03C1/38—Dispersants; Agents facilitating spreading
- G03C1/385—Dispersants; Agents facilitating spreading containing fluorine
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/76—Photosensitive materials characterised by the base or auxiliary layers
- G03C1/85—Photosensitive materials characterised by the base or auxiliary layers characterised by antistatic additives or coatings
- G03C1/853—Inorganic compounds, e.g. metals
Landscapes
- Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- General Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4766380A JPS56143430A (en) | 1980-04-11 | 1980-04-11 | Photographic sensitive material with improved antistatic property |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3114627A1 DE3114627A1 (de) | 1982-02-04 |
| DE3114627C2 true DE3114627C2 (enExample) | 1989-05-24 |
Family
ID=12781493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813114627 Granted DE3114627A1 (de) | 1980-04-11 | 1981-04-10 | Lichtempfindliche materialien mit verbesserten antistatischen eigenschaften |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4495276A (enExample) |
| JP (1) | JPS56143430A (enExample) |
| DE (1) | DE3114627A1 (enExample) |
| GB (1) | GB2075208B (enExample) |
Families Citing this family (95)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57118242A (en) * | 1981-01-14 | 1982-07-23 | Fuji Photo Film Co Ltd | Photographic sensitive material |
| JPS59177542A (ja) * | 1983-03-29 | 1984-10-08 | Fuji Photo Film Co Ltd | ハロゲン化銀写真印画材料 |
| JPS61145544A (ja) * | 1984-12-19 | 1986-07-03 | Fuji Photo Film Co Ltd | 写真材料 |
| DE3501074A1 (de) * | 1985-01-15 | 1986-07-17 | Agfa-Gevaert Ag, 5090 Leverkusen | Fotografisches aufzeichnungsmaterial und verfahren zur herstellung fotografischer bilder |
| JPS61209445A (ja) * | 1985-03-08 | 1986-09-17 | Fuji Photo Film Co Ltd | 写真要素 |
| US5204177A (en) * | 1986-03-06 | 1993-04-20 | Catalysts & Chemicals Industries, Co., Ltd. | Process for preparing conductive fine particles and conductive coating materials containing said particles |
| EP0250154A3 (en) * | 1986-06-18 | 1989-07-12 | Minnesota Mining And Manufacturing Company | Photographic element on a polymeric substrate with novel subbing layer |
| US4999276A (en) * | 1988-06-29 | 1991-03-12 | Fuji Photo Film Co., Ltd. | Silver halide photographic materials |
| US5238801A (en) * | 1988-10-19 | 1993-08-24 | Fuji Photo Film Co., Ltd. | Process of treating a silver halide photographic element |
| US5026622A (en) * | 1988-10-31 | 1991-06-25 | Konica Corporation | Silver halide photographic light-sensitive material restrained from producing pin-holes |
| US5308687A (en) * | 1989-05-09 | 1994-05-03 | Eastman Kodak Company | Fiber element containing tin oxide heteropolycondensates with enhanced electrical conductivity |
| US5006451A (en) * | 1989-08-10 | 1991-04-09 | Eastman Kodak Company | Photographic support material comprising an antistatic layer and a barrier layer |
| JP2877854B2 (ja) * | 1989-10-03 | 1999-04-05 | 三菱化学株式会社 | 帯電防止性表面を有する硬化樹脂層の形成方法 |
| US5290634A (en) * | 1990-02-05 | 1994-03-01 | Mitsubishi Paper Mills Limited | Antistatic film |
| JP2704168B2 (ja) * | 1990-07-02 | 1998-01-26 | 富士写真フイルム株式会社 | ハロゲン化銀写真感光材料 |
| EP0495314B1 (en) * | 1991-01-08 | 1999-03-10 | Konica Corporation | Processing of a photographic material having antistatic properties |
| US5221555A (en) * | 1991-12-12 | 1993-06-22 | Felix Schoeller, Jr. Gmbh & Co. Kg | Reverse side coating of photographic support materials |
| DE4101475A1 (de) * | 1991-01-19 | 1992-07-23 | Schoeller F Jun Gmbh Co Kg | Beschichtungsmasse fuer die rueckseite fotografischer traegermaterialien und verfahren zu ihrer herstellung |
| JPH04328741A (ja) * | 1991-04-30 | 1992-11-17 | Konica Corp | 磁気記録が可能なハロゲン化銀写真感光材料 |
| US5213887A (en) * | 1991-09-03 | 1993-05-25 | Minnesota Mining And Manufacturing Company | Antistatic coatings |
| FR2691918B1 (fr) * | 1992-06-09 | 1994-07-22 | Kodak Pathe | Preparation de poudres conductrices d'oxydes metalliques. |
| JP2611093B2 (ja) * | 1992-07-07 | 1997-05-21 | ホーヤ株式会社 | 硬化膜を有する光学部材 |
| JPH0635131A (ja) * | 1992-07-22 | 1994-02-10 | Fuji Photo Film Co Ltd | 画像形成方法 |
| US5378577A (en) * | 1992-10-30 | 1995-01-03 | Eastman Kodak Company | Photographic light-sensitive elements |
| US5288598A (en) * | 1992-10-30 | 1994-02-22 | Eastman Kodak Company | Photographic light-sensitive elements |
| US5300411A (en) * | 1992-10-30 | 1994-04-05 | Eastman Kodak Company | Photographic light-sensitive elements |
| US5344751A (en) * | 1993-05-28 | 1994-09-06 | Minnesota Mining And Manufacturing Company | Antistatic coatings |
| US5236818A (en) * | 1992-11-02 | 1993-08-17 | Minnesota Mining And Manufacturing Company | Antistatic coatings |
| JPH06250336A (ja) * | 1993-02-25 | 1994-09-09 | Konica Corp | 帯電防止されたハロゲン化銀写真感光材料 |
| US5340676A (en) * | 1993-03-18 | 1994-08-23 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing water-insoluble polymer particles |
| US5459021A (en) * | 1993-07-15 | 1995-10-17 | Konica Corporation | Silver halide photographic light-sensitive material |
| US5427900A (en) * | 1993-12-22 | 1995-06-27 | Eastman Kodak Company | Photographic element having a transparent magnetic recording layer |
| US5457013A (en) * | 1994-04-22 | 1995-10-10 | Eastman Kodak Company | Imaging element comprising a transparent magnetic layer and an electrically-conductive layer containing particles of a metal antimonate |
| US5368995A (en) * | 1994-04-22 | 1994-11-29 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing particles of a metal antimonate |
| US5518867A (en) * | 1994-05-12 | 1996-05-21 | Eastman Kodak Company | Electron beam recording process utilizing an electron beam recording film with low visual and ultraviolet density |
| US5434037A (en) * | 1994-06-01 | 1995-07-18 | Eastman Kodak Company | Photographic element having a transparent magnetic recording layer |
| US5466567A (en) * | 1994-10-28 | 1995-11-14 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing conductive fine particles, a film-forming hydrophilic colloid and pre-crosslinked gelatin particles |
| EP0741668B1 (en) * | 1994-10-31 | 2000-09-20 | Kodak-Pathe | New polymeric conductive alumino-silicate material, element comprising said material, and process for preparing it |
| US5484694A (en) * | 1994-11-21 | 1996-01-16 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing antimony-doped tin oxide particles |
| US5529884A (en) | 1994-12-09 | 1996-06-25 | Eastman Kodak Company | Backing layer for laser ablative imaging |
| US5955255A (en) | 1995-10-20 | 1999-09-21 | Eastman Kodak Company | Sound recording film |
| US5771764A (en) * | 1995-11-13 | 1998-06-30 | Eastman Kodak Company | Use of cutting tools for photographic manufacturing operations |
| EP0774686B1 (en) * | 1995-11-14 | 1999-07-21 | Eastman Kodak Company | High-contrast photographic elements protected against halation |
| US5650265A (en) * | 1995-12-22 | 1997-07-22 | Eastman Kodak Company | Silver halide light-sensitive element |
| US5723272A (en) * | 1995-12-22 | 1998-03-03 | Eastman Kodak Company | Silver halide light-sensitive element |
| US5576162A (en) | 1996-01-18 | 1996-11-19 | Eastman Kodak Company | Imaging element having an electrically-conductive layer |
| US5912109A (en) | 1996-02-12 | 1999-06-15 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing conductive fine particles and water-insoluble polymer particles of specified shear modulus |
| US5674654A (en) * | 1996-09-19 | 1997-10-07 | Eastman Kodak Company | Imaging element containing an electrically-conductive polymer blend |
| US5719016A (en) * | 1996-11-12 | 1998-02-17 | Eastman Kodak Company | Imaging elements comprising an electrically conductive layer containing acicular metal-containing particles |
| FR2756293B1 (fr) * | 1996-11-26 | 1998-12-31 | Kodak Pathe | Composite organique/inorganique et produit photographique contenant un tel composite |
| US5700623A (en) * | 1997-01-21 | 1997-12-23 | Eastman Kodak Company | Thermally stable photographic bar code label containing an antistatic layer |
| US5747232A (en) * | 1997-02-27 | 1998-05-05 | Eastman Kodak Company | Motion imaging film comprising a carbon black-containing backing and a process surviving conductive subbing layer |
| FR2760754B1 (fr) * | 1997-03-12 | 2003-06-06 | Kodak Pathe | Composition antistatique et produit photographique contenant une couche de cette composition |
| US5849472A (en) * | 1997-03-13 | 1998-12-15 | Eastman Kodak Company | Imaging element comprising an improved electrically-conductive layer |
| US5981126A (en) * | 1997-09-29 | 1999-11-09 | Eastman Kodak Company | Clay containing electrically-conductive layer for imaging elements |
| US5866287A (en) * | 1997-11-13 | 1999-02-02 | Eastman Kodak Company | Imaging element comprising and electrically-conductive layer containing metal antimonate and non-conductive metal-containing colloidal particles |
| US5827630A (en) * | 1997-11-13 | 1998-10-27 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing metal antimonate and non-conductive metal-containing colloidal particles and a transparent magnetic recording layer |
| US5976776A (en) * | 1997-12-01 | 1999-11-02 | Eastman Kodak Company | Antistatic compositions for imaging elements |
| US5955250A (en) * | 1997-12-16 | 1999-09-21 | Eastman Kodak Company | Electrically-conductive overcoat layer for photographic elements |
| US5888712A (en) * | 1997-12-16 | 1999-03-30 | Eastman Kodak Company | Electrically-conductive overcoat for photographic elements |
| US6117628A (en) * | 1998-02-27 | 2000-09-12 | Eastman Kodak Company | Imaging element comprising an electrically-conductive backing layer containing metal-containing particles |
| US6114079A (en) * | 1998-04-01 | 2000-09-05 | Eastman Kodak Company | Electrically-conductive layer for imaging element containing composite metal-containing particles |
| US6001549A (en) * | 1998-05-27 | 1999-12-14 | Eastman Kodak Company | Electrically conductive layer comprising microgel particles |
| US6124083A (en) * | 1998-10-15 | 2000-09-26 | Eastman Kodak Company | Antistatic layer with electrically conducting polymer for imaging element |
| US6096491A (en) * | 1998-10-15 | 2000-08-01 | Eastman Kodak Company | Antistatic layer for imaging element |
| US6190846B1 (en) | 1998-10-15 | 2001-02-20 | Eastman Kodak Company | Abrasion resistant antistatic with electrically conducting polymer for imaging element |
| US6060230A (en) * | 1998-12-18 | 2000-05-09 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing metal-containing particles and clay particles and a transparent magnetic recording layer |
| US6168911B1 (en) | 1998-12-18 | 2001-01-02 | Eastman Kodak Company | Formulations for preparing metal oxide-based pigment-binder transparent electrically conductive layers |
| US6025119A (en) * | 1998-12-18 | 2000-02-15 | Eastman Kodak Company | Antistatic layer for imaging element |
| JP2000347336A (ja) * | 1999-01-08 | 2000-12-15 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料 |
| US6077655A (en) * | 1999-03-25 | 2000-06-20 | Eastman Kodak Company | Antistatic layer for imaging element containing electrically conductive polymer and modified gelatin |
| US6187522B1 (en) | 1999-03-25 | 2001-02-13 | Eastman Kodak Company | Scratch resistant antistatic layer for imaging elements |
| US6140030A (en) * | 1999-05-06 | 2000-10-31 | Eastman Kodak Company | Photographic element containing two electrically-conductive agents |
| US6207361B1 (en) | 1999-12-27 | 2001-03-27 | Eastman Kodak Company | Photographic film with base containing polymeric antistatic material |
| ES2339914T3 (es) * | 1999-12-28 | 2010-05-27 | Sony Corporation | Sistema y metodo de transacciones comerciales de imagenes. |
| EP1133157A3 (en) * | 1999-12-28 | 2004-10-27 | Sony Corporation | Image commercial transactions system and method, image transfer system and method, image distribution system and method, display device and method |
| US20070220173A1 (en) * | 1999-12-28 | 2007-09-20 | Sony Corporation | Image commercial transactions system and method |
| US6785739B1 (en) | 2000-02-23 | 2004-08-31 | Eastman Kodak Company | Data storage and retrieval playback apparatus for a still image receiver |
| US6465140B1 (en) | 2001-05-11 | 2002-10-15 | Eastman Kodak Company | Method of adjusting conductivity after processing of photographs |
| US6728479B2 (en) * | 2001-06-11 | 2004-04-27 | Aoyagi (H.K.) Ltd. | Panel-type heating element and method for the manufacture thereof |
| US20030141487A1 (en) * | 2001-12-26 | 2003-07-31 | Eastman Kodak Company | Composition containing electronically conductive polymer particles |
| US7051429B2 (en) * | 2003-04-11 | 2006-05-30 | Eastman Kodak Company | Method for forming a medium having data storage and communication capabilities |
| US7109986B2 (en) * | 2003-11-19 | 2006-09-19 | Eastman Kodak Company | Illumination apparatus |
| US7145464B2 (en) * | 2003-11-19 | 2006-12-05 | Eastman Kodak Company | Data collection device |
| US7009494B2 (en) * | 2003-11-21 | 2006-03-07 | Eastman Kodak Company | Media holder having communication capabilities |
| JP4369876B2 (ja) | 2004-03-23 | 2009-11-25 | 富士フイルム株式会社 | ハロゲン化銀感光材料および熱現像感光材料 |
| US20060057512A1 (en) | 2004-09-14 | 2006-03-16 | Fuji Photo Film Co., Ltd. | Photothermographic material |
| US20060199000A1 (en) * | 2005-03-03 | 2006-09-07 | Naoyuki Ishii | Electrophotographic recording material |
| US7557875B2 (en) * | 2005-03-22 | 2009-07-07 | Industrial Technology Research Institute | High performance flexible display with improved mechanical properties having electrically modulated material mixed with binder material in a ratio between 6:1 and 0.5:1 |
| US7564528B2 (en) * | 2005-05-20 | 2009-07-21 | Industrial Technology Research Institute | Conductive layer to reduce drive voltage in displays |
| US7732007B2 (en) * | 2005-12-19 | 2010-06-08 | Eastman Kodak Company | Method of making a polarizer plate |
| US20070141244A1 (en) * | 2005-12-19 | 2007-06-21 | Eastman Kodak Company | Method of making a polarizer plate |
| JP5054330B2 (ja) * | 2006-06-21 | 2012-10-24 | 三井金属鉱業株式会社 | 導電性粒子及びその導電性粒子で構成された導電性粉体とその製造方法並びに該導電性粉体を用いて得られる導電性インク |
| US8258078B2 (en) | 2009-08-27 | 2012-09-04 | Eastman Kodak Company | Image receiver elements |
| KR101840347B1 (ko) * | 2016-10-26 | 2018-03-20 | 동우 화인켐 주식회사 | 자발광 감광성 수지 조성물, 이를 이용하여 제조된 컬러필터 및 화상 표시 장치 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR867327A (fr) * | 1939-07-07 | 1941-10-13 | Kodak Pathe | Films photographiques antistatiques perfectionnés |
| US3245833A (en) * | 1964-04-20 | 1966-04-12 | Eastman Kodak Co | Electrically conductive coatings |
| US3503743A (en) * | 1966-05-26 | 1970-03-31 | Diagravure Film Mfg Corp | Protection of hydrophilic films,layers,and products thereof |
| GB1177149A (en) * | 1966-11-14 | 1970-01-07 | Eastman Kodak Co | Element Treated to reduce the Accumulation of Static Electric Charges thereon |
| US3525621A (en) * | 1968-02-12 | 1970-08-25 | Eastman Kodak Co | Antistatic photographic elements |
| GB1300825A (en) * | 1969-03-31 | 1972-12-20 | Fuji Photo Film Co Ltd | Improvements in multi-layer photographic materials |
| US3874879A (en) * | 1972-05-22 | 1975-04-01 | Eastman Kodak Co | Article with oxidation protected adhesive and anti-static layer |
| US3857729A (en) * | 1972-09-21 | 1974-12-31 | H Burwasser | Indicia receiving matte sheet materials having an outermost antistatic layer |
| GB1464051A (en) * | 1974-04-30 | 1977-02-09 | Fuji Photo Film Co Ltd | Photographic recording elements |
-
1980
- 1980-04-11 JP JP4766380A patent/JPS56143430A/ja active Pending
-
1981
- 1981-04-10 DE DE19813114627 patent/DE3114627A1/de active Granted
- 1981-04-10 GB GB8111286A patent/GB2075208B/en not_active Expired
- 1981-04-13 US US06/253,499 patent/US4495276A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE3114627A1 (de) | 1982-02-04 |
| GB2075208A (en) | 1981-11-11 |
| GB2075208B (en) | 1984-04-18 |
| JPS56143430A (en) | 1981-11-09 |
| US4495276A (en) | 1985-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3114627C2 (enExample) | ||
| DE3150514C2 (enExample) | ||
| DE69500453T2 (de) | Bildaufzeichnungselement, das eine elektrisch leitfähige Schicht mit Teilchen eines Metallantimonats enthält | |
| DE69416437T2 (de) | Bildherstellungselement enthaltend eine wasserunlösliche Polymerteilchen enthaltende elektrisch leitende Schicht | |
| DE69730544T2 (de) | Bildaufzeichnungselement mit einer elektrisch leitfähigen Schicht | |
| DE3114626A1 (de) | Elektrisch leitender traeger fuer ein lichtempfindliches elektrophotographisches medium | |
| DE69509043T2 (de) | Träger für ein photographisches oder wärmeverarbeitbares Bildaufzeichnungselement, der eine elektrisch leitfähige Schicht mit antimondotierten Zinnoxidteilchen enthält | |
| DE69602904T2 (de) | Photographisches Element verwendbar als Kinofilm | |
| DE69718117T2 (de) | Bilderzeugungselement mit einer elektrisch leitenden Polymermischung | |
| DE69825956T2 (de) | Bildaufzeichnungselement mit einer elektrisch leitfähigen Schicht | |
| DE69026071T2 (de) | Blatt- oder bahnförmiges Material mit antistatischen Eigenschaften | |
| DE68911965T2 (de) | Mit einer antistatischen Schicht versehenes Blatt oder Band. | |
| DE3200623A1 (de) | Photographisches empfindliches material | |
| DE3782963T2 (de) | Photographisches silberhalogenidmaterial mit antistatischen eigenschaften. | |
| DE3411715C2 (enExample) | ||
| DE69822582T2 (de) | Ton enthaltende, elektrisch leitfähige schicht für bildaufzeichnungselemente | |
| DE69818620T2 (de) | Elektrisch leitfähige Deckschicht für photographische Elemente | |
| DE3132109A1 (de) | Photographisches lichtempfindliches material | |
| DE3411681C2 (enExample) | ||
| JPH08211556A (ja) | 導電層含有画像形成要素 | |
| DE69018628T2 (de) | Verfahren zur Herstellung von lösungsmittelfesten Polymerperlen. | |
| DE69228021T2 (de) | Photographisches Silberhalogenidmaterial | |
| DE69319786T2 (de) | Lichtempfindliches photographisches Silberhalogenidmaterial | |
| DE69507732T2 (de) | Photographischer Filmträger | |
| EP0395956A2 (de) | Fotografisches Aufzeichnungsmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |