DE3022594A1 - Spielzeug fuer wasserspiele - Google Patents
Spielzeug fuer wasserspieleInfo
- Publication number
- DE3022594A1 DE3022594A1 DE19803022594 DE3022594A DE3022594A1 DE 3022594 A1 DE3022594 A1 DE 3022594A1 DE 19803022594 DE19803022594 DE 19803022594 DE 3022594 A DE3022594 A DE 3022594A DE 3022594 A1 DE3022594 A1 DE 3022594A1
- Authority
- DE
- Germany
- Prior art keywords
- chamber
- housing
- water
- toy according
- outlet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 78
- 230000000694 effects Effects 0.000 claims description 13
- 230000008878 coupling Effects 0.000 claims description 8
- 238000010168 coupling process Methods 0.000 claims description 8
- 238000005859 coupling reaction Methods 0.000 claims description 8
- 238000005452 bending Methods 0.000 claims description 2
- 230000000149 penetrating effect Effects 0.000 claims 1
- 241000254173 Coleoptera Species 0.000 description 5
- POIUWJQBRNEFGX-XAMSXPGMSA-N cathelicidin Chemical compound C([C@@H](C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(C)C)C1=CC=CC=C1 POIUWJQBRNEFGX-XAMSXPGMSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- 241000270666 Testudines Species 0.000 description 4
- 238000004026 adhesive bonding Methods 0.000 description 4
- 238000000889 atomisation Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 238000002663 nebulization Methods 0.000 description 3
- 238000003466 welding Methods 0.000 description 3
- 241000238366 Cephalopoda Species 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000003595 mist Substances 0.000 description 2
- 239000006199 nebulizer Substances 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 241000238413 Octopus Species 0.000 description 1
- 241000270295 Serpentes Species 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000008400 supply water Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B05—SPRAYING OR ATOMISING IN GENERAL; APPLYING FLUENT MATERIALS TO SURFACES, IN GENERAL
- B05B—SPRAYING APPARATUS; ATOMISING APPARATUS; NOZZLES
- B05B3/00—Spraying or sprinkling apparatus with moving outlet elements or moving deflecting elements
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H23/00—Toy boats; Floating toys; Other aquatic toy devices
- A63H23/10—Other water toys, floating toys, or like buoyant toys
Landscapes
- Toys (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/058,069 US4235378A (en) | 1979-07-16 | 1979-07-16 | Water play toy |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3022594A1 true DE3022594A1 (de) | 1981-02-05 |
Family
ID=22014470
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803022594 Withdrawn DE3022594A1 (de) | 1979-07-16 | 1980-06-16 | Spielzeug fuer wasserspiele |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4235378A (enExample) |
| JP (1) | JPS5618890A (enExample) |
| AR (1) | AR225313A1 (enExample) |
| AU (1) | AU5923280A (enExample) |
| BE (1) | BE884345A (enExample) |
| BR (1) | BR8004383A (enExample) |
| CA (1) | CA1131025A (enExample) |
| DE (1) | DE3022594A1 (enExample) |
| DK (1) | DK293080A (enExample) |
| FI (1) | FI801797A7 (enExample) |
| FR (1) | FR2461510A1 (enExample) |
| GB (1) | GB2053011B (enExample) |
| IS (1) | IS1058B6 (enExample) |
| IT (2) | IT1166469B (enExample) |
| NL (1) | NL8003763A (enExample) |
| NO (1) | NO801609L (enExample) |
| NZ (1) | NZ194029A (enExample) |
| SE (1) | SE8005153L (enExample) |
| ZA (1) | ZA803300B (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD268279S (en) | 1981-02-02 | 1983-03-15 | Wham-O-Mfg. Co. | Play sprinkler or the like |
| USD265578S (en) | 1981-04-20 | 1982-07-27 | Wham-O Mfg. Co. | Children's play sprinkler |
| IL74688A0 (en) * | 1985-03-22 | 1985-06-30 | Mordechai Uzrad | Flexible tube sprinkler |
| US4655722A (en) * | 1985-09-04 | 1987-04-07 | Kid Biz, Inc. | Water spouting inflatable bop bag |
| US4787875A (en) * | 1985-09-04 | 1988-11-29 | Kid Biz, Inc. | Water sprouting inflatable bop bag |
| IN172221B (enExample) * | 1987-07-31 | 1993-05-08 | Silkbell Ltd | |
| USD318711S (en) | 1989-04-17 | 1991-07-30 | Dowell Carlos E | Lawn sprinkler |
| US5338044A (en) * | 1992-04-30 | 1994-08-16 | Vtech Industries, Inc. | Water toy |
| US5261603A (en) * | 1992-07-23 | 1993-11-16 | Azrak-Hamway International, Inc. | Animal-like water sprayer |
| US5928053A (en) * | 1996-04-19 | 1999-07-27 | Henderson; Darryl G. | Amusement device and method for propelling water from a body of water |
| US5806768A (en) * | 1996-09-27 | 1998-09-15 | Engel; Robert W. | Inflatable water toy |
| GB2322810B (en) * | 1997-03-07 | 2000-06-14 | Kingkraft Limited | A toy operated by water |
| US6012960A (en) * | 1998-08-13 | 2000-01-11 | Mattel, Inc. | Sprinkler toy handle pump |
| US6050501A (en) * | 1998-08-14 | 2000-04-18 | Kidpower, Inc. | Recreational water sprinkler |
| US6250565B1 (en) | 2000-01-10 | 2001-06-26 | Mattel, Inc. | Flamingo sprinkler |
| US20050145162A1 (en) * | 2002-01-17 | 2005-07-07 | Stanley Marcus | Repellent apparatus and method |
| WO2004033057A1 (en) * | 2002-10-10 | 2004-04-22 | Schoonmaker Michael C | Water toy |
| DE112010001782T5 (de) * | 2009-04-27 | 2012-10-04 | Mattel, Inc. | Schwimmfähiges Spielzeug |
| US8500510B2 (en) | 2009-04-27 | 2013-08-06 | Mattel, Inc. | Floating toy |
| KR20120106956A (ko) | 2009-11-18 | 2012-09-27 | 레키드 벤카이저 엘엘씨 | 초음파 표면 처리 장치 및 방법 |
| US20110250820A1 (en) * | 2010-04-08 | 2011-10-13 | Martin Jeffery G | Two-piece bath squirting toy |
| WO2011137436A2 (en) | 2010-04-30 | 2011-11-03 | Mattel, Inc. | Floating toy |
| US20150345808A1 (en) * | 2014-05-28 | 2015-12-03 | Janiece R. HNILICA-MAXWELL | Decorative Dryer Vent |
| WO2016038618A1 (en) | 2014-09-10 | 2016-03-17 | Global Marketing Enterprise (Gme) Ltd. | Water toy |
| GB2534255B (en) * | 2015-09-02 | 2017-02-01 | O'brien Bruce | Pogo stick |
| USD801476S1 (en) * | 2016-03-24 | 2017-10-31 | Intex Marketing Ltd. | Caterpillar water sprayer |
| US20240065227A1 (en) * | 2022-08-24 | 2024-02-29 | Alexander Venturoso | Dog Exercise and Entertainment Toy |
| US12446548B2 (en) * | 2022-08-24 | 2025-10-21 | Alexander Venturoso | Dog exercise and entertainment toy |
| CN116672731A (zh) * | 2023-06-19 | 2023-09-01 | 深圳市凌拓万科技有限公司 | 一种戏水玩具 |
| US12280318B1 (en) * | 2023-12-14 | 2025-04-22 | Furui Zhong | Water toy |
| CN223055085U (zh) * | 2024-06-19 | 2025-07-04 | 深圳市凌拓万科技有限公司 | 一种戏水玩具 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US374960A (en) * | 1887-12-20 | Adelbert g | ||
| US1918874A (en) * | 1931-03-04 | 1933-07-18 | Shannahan Eleanor | Aquatic toy |
| US2030605A (en) * | 1935-03-12 | 1936-02-11 | Ninian R Moore | Lawn sprinkler |
| US2634545A (en) * | 1951-03-30 | 1953-04-14 | Philip L Gertz | Liquid actuated figure |
| GB753004A (en) * | 1954-12-03 | 1956-07-18 | John Alfred Bowen | Improvements in or relating to liquid sprinkling devices |
| US2757960A (en) * | 1955-05-17 | 1956-08-07 | Merrel E Hatcher | Lawn sprinkler |
| US2930531A (en) * | 1955-08-29 | 1960-03-29 | Jr Merritt T Kennedy | Wriggler type fluid distributor |
| US2954932A (en) * | 1957-10-08 | 1960-10-04 | Albano Alphonso Frank | Aerial sprinkler |
| US3079727A (en) * | 1962-06-01 | 1963-03-05 | Wham O Mfg Co | Jet-propelled toy |
| US3570764A (en) * | 1969-04-11 | 1971-03-16 | Cdm Co Ltd | Fountain apparatus |
| FR2301305A1 (fr) * | 1975-02-21 | 1976-09-17 | Previtali Gerard | Dispositif d'arrosage constituant un element attractif |
-
1979
- 1979-07-16 US US06/058,069 patent/US4235378A/en not_active Expired - Lifetime
-
1980
- 1980-05-29 IS IS2560A patent/IS1058B6/is unknown
- 1980-05-30 NO NO801609A patent/NO801609L/no unknown
- 1980-06-03 ZA ZA00803300A patent/ZA803300B/xx unknown
- 1980-06-04 FI FI801797A patent/FI801797A7/fi not_active Application Discontinuation
- 1980-06-11 AU AU59232/80A patent/AU5923280A/en not_active Abandoned
- 1980-06-12 NZ NZ194029A patent/NZ194029A/xx unknown
- 1980-06-16 DE DE19803022594 patent/DE3022594A1/de not_active Withdrawn
- 1980-06-23 CA CA354,560A patent/CA1131025A/en not_active Expired
- 1980-06-27 NL NL8003763A patent/NL8003763A/nl not_active Application Discontinuation
- 1980-06-30 AR AR281586A patent/AR225313A1/es active
- 1980-07-07 DK DK293080A patent/DK293080A/da not_active Application Discontinuation
- 1980-07-11 FR FR8015467A patent/FR2461510A1/fr active Granted
- 1980-07-14 JP JP9517080A patent/JPS5618890A/ja active Pending
- 1980-07-14 SE SE8005153A patent/SE8005153L/ not_active Application Discontinuation
- 1980-07-15 BR BR8004383A patent/BR8004383A/pt unknown
- 1980-07-15 IT IT68121/80A patent/IT1166469B/it active
- 1980-07-15 GB GB8023128A patent/GB2053011B/en not_active Expired
- 1980-07-15 IT IT8053389U patent/IT8053389V0/it unknown
- 1980-07-16 BE BE0/201432A patent/BE884345A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1166469B (it) | 1987-05-06 |
| AR225313A1 (es) | 1982-03-15 |
| GB2053011A (en) | 1981-02-04 |
| IS1058B6 (is) | 1981-08-25 |
| IT8053389V0 (it) | 1980-07-15 |
| US4235378A (en) | 1980-11-25 |
| ZA803300B (en) | 1981-06-24 |
| NZ194029A (en) | 1982-05-25 |
| CA1131025A (en) | 1982-09-07 |
| JPS5618890A (en) | 1981-02-23 |
| SE8005153L (sv) | 1981-01-17 |
| NO801609L (no) | 1981-01-19 |
| FI801797A7 (fi) | 1981-01-01 |
| NL8003763A (nl) | 1981-01-20 |
| AU5923280A (en) | 1981-03-05 |
| BR8004383A (pt) | 1981-01-27 |
| IS2560A7 (is) | 1981-01-17 |
| GB2053011B (en) | 1983-04-07 |
| IT8068121A0 (it) | 1980-07-15 |
| DK293080A (da) | 1981-01-17 |
| BE884345A (fr) | 1981-01-16 |
| FR2461510B1 (enExample) | 1984-12-14 |
| FR2461510A1 (fr) | 1981-02-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3022594A1 (de) | Spielzeug fuer wasserspiele | |
| US5480336A (en) | Water toy construction kit | |
| DE2815631A1 (de) | Wasserbetriebenes spielzeug mit emporhebbarem oberen teil | |
| DE60105031T2 (de) | Sprühkopf | |
| DE2629170A1 (de) | Aus einzelteilen zusammensetzbare puppe | |
| DE69915582T2 (de) | Brause mit Düsen für Wassersprühstrahlen | |
| TWI278279B (en) | Sprinkler system, method for producing the sprinkler system, affusion, method for producing the affusion, and method for cooling by fine brume | |
| DE2326924A1 (de) | Feuerloeschbrause zur wahlweisen abgabe von wasser oder schaum | |
| US5462284A (en) | Amusement outdoor water spray | |
| DE202007004726U1 (de) | Mehrfach konfigurierbarer Duschkopf | |
| DE603971C (de) | Seifenschaumerzeuger | |
| DE936492C (de) | Feuerloesch-Strahlrohr | |
| DE1147380B (de) | Vorrichtung zur Herstellung von Kunststoffen | |
| DE909919C (de) | Brausekopf, insbesondere fuer sanitaere Zwecke | |
| DE470570C (de) | Fluessigkeitszerstaeuber mit ringfoermiger und strahlenfoermiger Druckluftzufuehrung gegen den austretenden Fluessigkeitsstrom | |
| DE19911791A1 (de) | Springbrunnen | |
| DE896301C (de) | Rohrfoermiger Luftschaumerzeuger fuer Feuerloeschzwecke | |
| AT366588B (de) | Menschenaehnliche spielzeugfigur | |
| DE29723484U1 (de) | Schraubfiguren-Systeme | |
| DE883397C (de) | Luftschaumerzeuger | |
| DE920226C (de) | Luftschaumerzeuger fuer Feuerloeschzwecke | |
| DE4040737A1 (de) | Puppenskelett fuer textilpuppen | |
| DE69527090T2 (de) | Beregnungsvorrichtung | |
| DE488925C (de) | Mischvorrichtung fuer Mineralwasserapparate | |
| DE2229472C3 (de) | Wasserspender |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |