DE2849618A1 - Behandlung von pigmenten mit aminen - Google Patents
Behandlung von pigmenten mit aminenInfo
- Publication number
- DE2849618A1 DE2849618A1 DE19782849618 DE2849618A DE2849618A1 DE 2849618 A1 DE2849618 A1 DE 2849618A1 DE 19782849618 DE19782849618 DE 19782849618 DE 2849618 A DE2849618 A DE 2849618A DE 2849618 A1 DE2849618 A1 DE 2849618A1
- Authority
- DE
- Germany
- Prior art keywords
- amine
- pigment
- acid
- aniline
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000049 pigment Substances 0.000 title claims description 56
- 150000001412 amines Chemical class 0.000 title claims description 42
- 238000011282 treatment Methods 0.000 title claims description 14
- 238000000034 method Methods 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 10
- 239000000843 powder Substances 0.000 claims description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- 230000008878 coupling Effects 0.000 claims description 9
- 238000010168 coupling process Methods 0.000 claims description 9
- 238000005859 coupling reaction Methods 0.000 claims description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 4
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 claims description 3
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001448 anilines Chemical class 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 230000008018 melting Effects 0.000 claims description 2
- 238000002844 melting Methods 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 10
- 239000007788 liquid Substances 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 4
- 239000003973 paint Substances 0.000 description 4
- -1 N-cyclohexyl-M-hydroxyethylaniline Chemical compound 0.000 description 3
- 150000004982 aromatic amines Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 2
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000000976 ink Substances 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- AASABFUMCBTXRL-UHFFFAOYSA-N n-ethyl-4-methylaniline Chemical compound CCNC1=CC=C(C)C=C1 AASABFUMCBTXRL-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- QAYVHDDEMLNVMO-UHFFFAOYSA-N 2,5-dichlorobenzene-1,4-diamine Chemical compound NC1=CC(Cl)=C(N)C=C1Cl QAYVHDDEMLNVMO-UHFFFAOYSA-N 0.000 description 1
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 1
- CPCPKQUNFFHAIZ-UHFFFAOYSA-N 2-chloro-5-methylbenzene-1,4-diamine Chemical compound CC1=CC(N)=C(Cl)C=C1N CPCPKQUNFFHAIZ-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- XTTIQGSLJBWVIV-UHFFFAOYSA-N 2-methyl-4-nitroaniline Chemical compound CC1=CC([N+]([O-])=O)=CC=C1N XTTIQGSLJBWVIV-UHFFFAOYSA-N 0.000 description 1
- NJBCRXCAPCODGX-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-amine Chemical compound CC(C)CNCC(C)C NJBCRXCAPCODGX-UHFFFAOYSA-N 0.000 description 1
- DLURHXYXQYMPLT-UHFFFAOYSA-N 2-nitro-p-toluidine Chemical compound CC1=CC=C(N)C([N+]([O-])=O)=C1 DLURHXYXQYMPLT-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- HUWXDEQWWKGHRV-UHFFFAOYSA-N 3,3'-Dichlorobenzidine Chemical compound C1=C(Cl)C(N)=CC=C1C1=CC=C(N)C(Cl)=C1 HUWXDEQWWKGHRV-UHFFFAOYSA-N 0.000 description 1
- NUIURNJTPRWVAP-UHFFFAOYSA-N 3,3'-Dimethylbenzidine Chemical compound C1=C(N)C(C)=CC(C=2C=C(C)C(N)=CC=2)=C1 NUIURNJTPRWVAP-UHFFFAOYSA-N 0.000 description 1
- DMGFVJVLVZOSOE-UHFFFAOYSA-N 3-amino-4-chlorobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC=C1Cl DMGFVJVLVZOSOE-UHFFFAOYSA-N 0.000 description 1
- XKXPBJBODVHDAW-UHFFFAOYSA-N 4-(4-amino-2-chlorophenyl)-3-chloroaniline Chemical compound ClC1=CC(N)=CC=C1C1=CC=C(N)C=C1Cl XKXPBJBODVHDAW-UHFFFAOYSA-N 0.000 description 1
- ZWUBBMDHSZDNTA-UHFFFAOYSA-N 4-Chloro-meta-phenylenediamine Chemical compound NC1=CC=C(Cl)C(N)=C1 ZWUBBMDHSZDNTA-UHFFFAOYSA-N 0.000 description 1
- YGUFQYGSBVXPMC-UHFFFAOYSA-N 4-chloro-2,5-dimethoxyaniline Chemical compound COC1=CC(Cl)=C(OC)C=C1N YGUFQYGSBVXPMC-UHFFFAOYSA-N 0.000 description 1
- WOXLPNAOCCIZGP-UHFFFAOYSA-N 4-chloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=CC=C1N WOXLPNAOCCIZGP-UHFFFAOYSA-N 0.000 description 1
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 description 1
- ISFYBUAVOZFROB-UHFFFAOYSA-N 4-ethoxy-2-nitroaniline Chemical compound CCOC1=CC=C(N)C([N+]([O-])=O)=C1 ISFYBUAVOZFROB-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- QOMNJPSRBRDQSU-UHFFFAOYSA-N 5-aminobenzimidazol-2-one Chemical compound C1=C(N)C=CC2=NC(=O)N=C21 QOMNJPSRBRDQSU-UHFFFAOYSA-N 0.000 description 1
- OLCMNCWEUMBNIS-UHFFFAOYSA-N 5-chloro-2,4-dimethoxyaniline Chemical compound COC1=CC(OC)=C(Cl)C=C1N OLCMNCWEUMBNIS-UHFFFAOYSA-N 0.000 description 1
- MJXYFLJHTUSJGU-UHFFFAOYSA-N 7-amino-4-methyl-1h-quinolin-2-one Chemical compound NC1=CC=C2C(C)=CC(=O)NC2=C1 MJXYFLJHTUSJGU-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 125000002339 acetoacetyl group Chemical group O=C([*])C([H])([H])C(=O)C([H])([H])[H] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- JRBPAEWTRLWTQC-UHFFFAOYSA-N dodecylamine Chemical compound CCCCCCCCCCCCN JRBPAEWTRLWTQC-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229940083761 high-ceiling diuretics pyrazolone derivative Drugs 0.000 description 1
- 238000011221 initial treatment Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 229940102398 methyl anthranilate Drugs 0.000 description 1
- GUAWMXYQZKVRCW-UHFFFAOYSA-N n,2-dimethylaniline Chemical compound CNC1=CC=CC=C1C GUAWMXYQZKVRCW-UHFFFAOYSA-N 0.000 description 1
- UUSGZWZUYJHBJS-UHFFFAOYSA-N n-butyl-3-methylaniline Chemical compound CCCCNC1=CC=CC(C)=C1 UUSGZWZUYJHBJS-UHFFFAOYSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- TXTHKGMZDDTZFD-UHFFFAOYSA-N n-cyclohexylaniline Chemical compound C1CCCCC1NC1=CC=CC=C1 TXTHKGMZDDTZFD-UHFFFAOYSA-N 0.000 description 1
- GCULWAWIZUGXTO-UHFFFAOYSA-N n-octylaniline Chemical compound CCCCCCCCNC1=CC=CC=C1 GCULWAWIZUGXTO-UHFFFAOYSA-N 0.000 description 1
- CDZOGLJOFWFVOZ-UHFFFAOYSA-N n-propylaniline Chemical compound CCCNC1=CC=CC=C1 CDZOGLJOFWFVOZ-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B67/00—Influencing the physical, e.g. the dyeing or printing properties of dyestuffs without chemical reactions, e.g. by treating with solvents grinding or grinding assistants, coating of pigments or dyes; Process features in the making of dyestuff preparations; Dyestuff preparations of a special physical nature, e.g. tablets, films
- C09B67/0001—Post-treatment of organic pigments or dyes
- C09B67/002—Influencing the physical properties by treatment with an amine
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- Paints Or Removers (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4806377 | 1977-11-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2849618A1 true DE2849618A1 (de) | 1979-05-23 |
| DE2849618C2 DE2849618C2 (enExample) | 1988-04-21 |
Family
ID=10447222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782849618 Granted DE2849618A1 (de) | 1977-11-18 | 1978-11-15 | Behandlung von pigmenten mit aminen |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5478728A (enExample) |
| CA (1) | CA1118961A (enExample) |
| CH (1) | CH637155A5 (enExample) |
| DE (1) | DE2849618A1 (enExample) |
| DK (1) | DK153328C (enExample) |
| FR (1) | FR2409293A1 (enExample) |
| NL (1) | NL7810923A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6456895U (enExample) * | 1987-10-02 | 1989-04-10 |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1266721B (de) * | 1963-07-12 | 1968-04-25 | Geigy Ag J R | Verfahren zum gleichzeitigen Entwaessern und Reinigen von Azopigmenten |
| US3671281A (en) * | 1970-09-16 | 1972-06-20 | Gaf Corp | Pyrazolone red pigment and process therefor |
| GB1406797A (en) * | 1973-01-19 | 1975-09-17 | Hoechst Ag | Disazo pigment and process for preparing it |
| GB1455653A (en) * | 1973-01-19 | 1976-11-17 | Hoechst Ag | Disazo pigment |
| GB1456331A (en) * | 1973-01-19 | 1976-11-24 | Hoechst Ag | Disazo pigment |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR960876A (enExample) * | 1950-04-27 | |||
| DE1469740A1 (de) * | 1965-10-08 | 1969-01-02 | Hoechst Ag | Verfahren zur Behandlung eines Azopigmentes |
| FR1538270A (fr) * | 1966-10-01 | 1968-08-30 | Bayer Ag | Préparations pigmentaires |
| DK119437B (da) * | 1968-06-27 | 1971-01-04 | Koege Kemisk Vaerk | Vanduopløselige diazoforbindelser til anvendelse ved pigmentering af trykfarver. |
| DE2302517C3 (de) * | 1973-01-19 | 1982-03-18 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Reinigung von Azopigmenten |
| DE2316536C3 (de) * | 1973-04-03 | 1981-08-20 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von farbstarken und leicht verteilbaren Perylen- 3,4,9,10-tetracarbonsäurediimiden |
| CH627775A5 (de) * | 1977-02-03 | 1982-01-29 | Ciba Geigy Ag | Verfahren zur umwandlung eines pigments oder dispersionsfarbstoffs in eine andere modifikation. |
| NL7802831A (nl) * | 1977-03-18 | 1978-09-20 | Ciba Geigy | Pigmentpreparaten. |
-
1978
- 1978-10-26 CH CH1108078A patent/CH637155A5/de not_active IP Right Cessation
- 1978-10-31 CA CA000315196A patent/CA1118961A/en not_active Expired
- 1978-11-02 NL NL7810923A patent/NL7810923A/xx not_active Application Discontinuation
- 1978-11-15 DE DE19782849618 patent/DE2849618A1/de active Granted
- 1978-11-16 FR FR7832347A patent/FR2409293A1/fr active Granted
- 1978-11-17 DK DK514178A patent/DK153328C/da not_active IP Right Cessation
- 1978-11-18 JP JP14276978A patent/JPS5478728A/ja active Granted
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1266721B (de) * | 1963-07-12 | 1968-04-25 | Geigy Ag J R | Verfahren zum gleichzeitigen Entwaessern und Reinigen von Azopigmenten |
| US3671281A (en) * | 1970-09-16 | 1972-06-20 | Gaf Corp | Pyrazolone red pigment and process therefor |
| GB1406797A (en) * | 1973-01-19 | 1975-09-17 | Hoechst Ag | Disazo pigment and process for preparing it |
| GB1455653A (en) * | 1973-01-19 | 1976-11-17 | Hoechst Ag | Disazo pigment |
| GB1456331A (en) * | 1973-01-19 | 1976-11-24 | Hoechst Ag | Disazo pigment |
Non-Patent Citations (1)
| Title |
|---|
| Zusätzlich wurde ein Versuchsbericht, eingegangen am 12.01.87, zur Einsicht für jedermann bereitgehalten |
Also Published As
| Publication number | Publication date |
|---|---|
| DK153328C (da) | 1988-12-27 |
| DK153328B (da) | 1988-07-04 |
| FR2409293B1 (enExample) | 1982-10-01 |
| NL7810923A (nl) | 1979-05-22 |
| CA1118961A (en) | 1982-03-02 |
| DE2849618C2 (enExample) | 1988-04-21 |
| CH637155A5 (en) | 1983-07-15 |
| JPS5478728A (en) | 1979-06-23 |
| JPS6256189B2 (enExample) | 1987-11-24 |
| DK514178A (da) | 1979-05-19 |
| FR2409293A1 (fr) | 1979-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2135468B2 (de) | Pigmentzusammensetzung, Verfahren zu deren Herstellung und deren Verwendung | |
| DE3106906A1 (de) | Pigment-zusammensetzungen | |
| DE1469782A1 (de) | Verfahren zur Herstellung leicht dispergierbarer Pigmente | |
| DE1143176B (de) | Verfahren zur Herstellung farbstarker und kornweicher hochhalogenierter Phthalocyaninpigmente | |
| DE2707071C2 (de) | Verfahren zur Herstellung eines Kupferphthalocyaninpigments in Alpha- oder Betaform | |
| CH620238A5 (enExample) | ||
| DE69620693T2 (de) | Pigmentszusammensetzungen | |
| DE69213830T2 (de) | Herstellung von Pigmenten | |
| DE3031444C3 (de) | Verfahren zur herstellung der beta-kristallform des dioxazin-violett-pigments | |
| CH629185A5 (de) | Verfahren zur herstellung des monoalkalimetallsalzes von 8-amino-1-naphthol-3,6-disulfonsaeure. | |
| DE2849618C2 (enExample) | ||
| DE1927453A1 (de) | Verfahren zur Herstellung von Azopigmenten | |
| DE2405855A1 (de) | Farbstoff und verfahren zur herstellung desselben | |
| DE2811539A1 (de) | Verfahren zur konditionierung eines phthalocyaninpigments | |
| DE2811294A1 (de) | Verfahren zur herstellung nicht- staeubender, leicht dispergierbarer pigment- oder farbstoffgranulate | |
| DE1179908B (de) | Verfahren zur Herstellung von Azopigmenten mit verbesserter Fliessarbeit | |
| DE930648C (de) | Phthalocyaninpigment und Verfahren zu dessen Herstellung | |
| DE2312301C3 (de) | Leichtverteilbare Pigmentzubereitungen | |
| DE2058299A1 (de) | Verfahren zur Herstellung von Azoverbindungen | |
| DE2017873C3 (de) | Blaue Diazofarbstoffe | |
| DE2846803A1 (de) | Verfahren zur herstellung von azinfarbstoffen mit verbesserten anwendungseigenschaften, nach diesem verfahren hergestellte azinfarbstoffe und ihre verwendung | |
| DE1064176B (de) | Verfahren zur Herstellung von reinem Kupferphthalocyanin | |
| AT66210B (de) | Verfahren zur Darstellung von grünen beizenziehenden Farbstoffen. | |
| DE293741C (enExample) | ||
| DE114264C (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: ASSMANN, E., DIPL.-CHEM. DR.RER.NAT. ZUMSTEIN, F., |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |