DE2817033C2 - Reaktivfarbstoffe - Google Patents
ReaktivfarbstoffeInfo
- Publication number
- DE2817033C2 DE2817033C2 DE2817033A DE2817033A DE2817033C2 DE 2817033 C2 DE2817033 C2 DE 2817033C2 DE 2817033 A DE2817033 A DE 2817033A DE 2817033 A DE2817033 A DE 2817033A DE 2817033 C2 DE2817033 C2 DE 2817033C2
- Authority
- DE
- Germany
- Prior art keywords
- yellow
- methyl
- same
- methoxy
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000985 reactive dye Substances 0.000 title claims description 3
- 239000000460 chlorine Substances 0.000 claims description 87
- -1 methoxy, ethoxy, phenoxy, chlorophenoxy, benzoyl Chemical group 0.000 claims description 61
- 239000000975 dye Substances 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 16
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 239000004952 Polyamide Substances 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229920002647 polyamide Polymers 0.000 claims description 4
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 238000004043 dyeing Methods 0.000 claims description 3
- 239000010985 leather Substances 0.000 claims description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 7
- 239000000835 fiber Substances 0.000 claims 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 35
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 14
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 9
- 150000002431 hydrogen Chemical class 0.000 description 7
- 230000008878 coupling Effects 0.000 description 6
- 238000010168 coupling process Methods 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- AISVTCZVWRPIRY-UHFFFAOYSA-N 1-(2,5-dimethylphenyl)-5-oxo-4h-pyrazole-3-carboxylic acid Chemical compound CC1=CC=C(C)C(N2C(CC(=N2)C(O)=O)=O)=C1 AISVTCZVWRPIRY-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- STWIFEBQSZQOPA-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-5-oxo-4h-pyrazole-3-carboxylic acid Chemical compound O=C1CC(C(=O)O)=NN1C1=CC=C(Cl)C=C1Cl STWIFEBQSZQOPA-UHFFFAOYSA-N 0.000 description 1
- GIKMWFAAEIACRF-UHFFFAOYSA-N 2,4,5-trichloropyrimidine Chemical group ClC1=NC=C(Cl)C(Cl)=N1 GIKMWFAAEIACRF-UHFFFAOYSA-N 0.000 description 1
- LYBDHGMSPQBSNW-UHFFFAOYSA-N 2,4,5-trifluoropyrimidine Chemical compound FC1=NC=C(F)C(F)=N1 LYBDHGMSPQBSNW-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- UWGRSNRXFVTTAY-UHFFFAOYSA-N 3,4,5-trifluoropyridazine Chemical compound FC1=CN=NC(F)=C1F UWGRSNRXFVTTAY-UHFFFAOYSA-N 0.000 description 1
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 1
- XZSZSTCLQANXKU-UHFFFAOYSA-N 5-chloro-2,4-difluoropyrimidine Chemical compound FC1=NC=C(Cl)C(F)=N1 XZSZSTCLQANXKU-UHFFFAOYSA-N 0.000 description 1
- JAEBRIOOHLIKRB-UHFFFAOYSA-N 5-chloro-4-methyl-2-methylsulfonylpyrimidine Chemical compound CC1=NC(S(C)(=O)=O)=NC=C1Cl JAEBRIOOHLIKRB-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- AJFXNBUVIBKWBT-UHFFFAOYSA-N disodium;boric acid;hydrogen borate Chemical compound [Na+].[Na+].OB(O)O.OB(O)O.OB(O)O.OB([O-])[O-] AJFXNBUVIBKWBT-UHFFFAOYSA-N 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical class C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical class C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 150000003252 quinoxalines Chemical class 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B69/00—Dyes not provided for by a single group of this subclass
- C09B69/007—Dyestuffs containing phosphonic or phosphinic acid groups and derivatives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Luminescent Compositions (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2817033A DE2817033C2 (de) | 1978-04-19 | 1978-04-19 | Reaktivfarbstoffe |
| FR7906695A FR2432540A1 (fr) | 1978-04-19 | 1979-03-16 | Colorants reactifs |
| IT21161/79A IT1112958B (it) | 1978-04-19 | 1979-03-20 | Coloranti reattivi |
| JP4550979A JPS54139934A (en) | 1978-04-19 | 1979-04-16 | Reactive dye |
| CH361079A CH637677A5 (de) | 1978-04-19 | 1979-04-17 | Reaktivfarbstoffe. |
| BE0/194642A BE875625A (fr) | 1978-04-19 | 1979-04-17 | Colorants reactifs |
| GB7913394A GB2020681B (en) | 1978-04-19 | 1979-04-18 | Reactive dyes |
| US06/190,179 US4544738A (en) | 1978-04-19 | 1980-09-24 | Reactive pyrazole group containing monoazo dye |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2817033A DE2817033C2 (de) | 1978-04-19 | 1978-04-19 | Reaktivfarbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2817033A1 DE2817033A1 (de) | 1979-10-25 |
| DE2817033C2 true DE2817033C2 (de) | 1983-03-24 |
Family
ID=6037442
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2817033A Expired DE2817033C2 (de) | 1978-04-19 | 1978-04-19 | Reaktivfarbstoffe |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4544738A (enExample) |
| JP (1) | JPS54139934A (enExample) |
| BE (1) | BE875625A (enExample) |
| CH (1) | CH637677A5 (enExample) |
| DE (1) | DE2817033C2 (enExample) |
| FR (1) | FR2432540A1 (enExample) |
| GB (1) | GB2020681B (enExample) |
| IT (1) | IT1112958B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4348318A (en) * | 1978-11-30 | 1982-09-07 | Ciba-Geigy Corporation | Azo-dyes, their preparation and use |
| DE3023920A1 (de) * | 1980-06-26 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von azo-reaktivfarbstoffen |
| CH663028A5 (de) * | 1985-04-03 | 1987-11-13 | Ciba Geigy Ag | Monoazofarbstoffe und deren herstellung. |
| US5030701A (en) * | 1987-12-31 | 1991-07-09 | Minnesota Mining And Manufacturing Company | Fluorine- and chromophore-containing polymer |
| US4909806A (en) * | 1987-12-31 | 1990-03-20 | Minnesota Mining And Manufacturing Company | Fluorine- and chromophore-containing polymer |
Family Cites Families (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US149837A (en) * | 1874-04-21 | Improvement in solar compasses | ||
| US156115A (en) * | 1874-10-20 | Improvement in hay-wagons | ||
| US2795576A (en) * | 1953-08-10 | 1957-06-11 | Ciba Ltd | New monoazo-dyestuffs |
| FR1160909A (fr) * | 1955-11-25 | 1958-08-13 | Ici Ltd | Nouveaux colorants monoazoïques |
| DE1066302B (de) * | 1955-11-25 | 1959-10-01 | Imperial Chemical Industries Limited, London | Verfahren zur Herstellung von Monoazofarbstoffe^ |
| CH348493A (de) * | 1956-07-05 | 1960-08-31 | Ciba Geigy | Verfahren zur Herstellung neuer Azofarbstoffe |
| US2945021A (en) * | 1956-09-14 | 1960-07-12 | Ciba Ltd | Monoazo and disazo triazine dyes |
| CH349014A (de) * | 1956-10-29 | 1960-09-30 | Ciba Geigy | Verfahren zur Herstellung neuer Azofarbstoffe |
| CH384747A (de) * | 1957-05-07 | 1965-02-26 | Ciba Geigy | Verfahren zur Herstellung neuer Farbstoffe |
| FR1246743A (fr) * | 1957-11-20 | 1960-11-25 | Sandoz Ag | Colorants cyanuriques hydrosolubles, leur procédé de fabrication et leurs applications |
| FR1223655A (fr) * | 1958-02-12 | 1960-06-20 | Ici Ltd | Nouveaux colorants azoïques |
| CH366611A (de) * | 1958-05-23 | 1963-01-15 | Geigy Ag J R | Verfahren zur Herstellung von Azofarbstoffen |
| GB948160A (en) * | 1960-08-04 | 1964-01-29 | Ici Ltd | New monoazo dyestuffs |
| FR1296942A (fr) * | 1961-08-04 | 1962-06-22 | Ici Ltd | Nouveaux colorants monoazoïques réactifs |
| GB984802A (en) * | 1962-01-10 | 1965-03-03 | Ici Ltd | New azo dyestuffs containing unsaturated carboxylic acid amide groups |
| DE1252824B (de) * | 1963-03-01 | 1967-10-26 | J. R. Geigy A.G., Basel (Schweiz) | Verfahren zur Herstellung von reaktiven Farbstoffen |
| DE1230152B (de) * | 1963-05-14 | 1966-12-08 | Hoechst Ag | Verfahren zur Herstellung von Azofarbstoffen |
| CH477529A (de) * | 1964-06-29 | 1969-08-31 | Ciba Geigy | Verfahren zur Herstellung neuer Azofarbstoffe |
| DE1283989B (de) * | 1964-08-06 | 1968-11-28 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen und deren Metallkomplexverbindungen |
| DE1276844B (de) * | 1964-11-06 | 1968-09-05 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
| CH1371667A4 (de) * | 1966-10-12 | 1970-08-31 | Mitsubishi Chem Ind | Reaktivfarbstoffhaltige Klotz- oder Färbeflotte bzw. Druckpaste für Textilmaterialien |
| DE1644215B2 (de) * | 1967-05-27 | 1976-07-01 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche monoazofarbstoffe, ein verfahren zu ihrer herstellung und ihre verwendung |
| DE1795086C3 (de) * | 1968-08-07 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Cellulosefasern, Wolle, Seide, Polyamidfasern und Leder |
| BE757027A (fr) * | 1969-10-06 | 1971-04-05 | Agripat Sa | Fixage electrolytique de colorants reactifs |
| DE2009421C3 (de) * | 1970-02-28 | 1979-09-27 | Hoechst Ag, 6000 Frankfurt | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamid-, Polyurethan- und/oder nativen oder regenerierten Cellulosefasermaterialien |
| JPS4873582A (enExample) * | 1972-01-11 | 1973-10-04 | ||
| US3993440A (en) * | 1972-01-30 | 1976-11-23 | Imperial Chemical Industries Limited | Coloration with azo carboxy pyrazolone |
| US4145340A (en) * | 1973-01-30 | 1979-03-20 | Imperial Chemical Industries Limited | Water-soluble reactive monoazo dye containing a nonylphenoxy, chlorotriazine group |
| GB1455995A (en) * | 1973-01-30 | 1976-11-17 | Ici Ltd | Colouration process |
| JPS502725A (enExample) * | 1973-05-11 | 1975-01-13 | ||
| JPS5064317A (enExample) * | 1973-10-08 | 1975-05-31 |
-
1978
- 1978-04-19 DE DE2817033A patent/DE2817033C2/de not_active Expired
-
1979
- 1979-03-16 FR FR7906695A patent/FR2432540A1/fr active Granted
- 1979-03-20 IT IT21161/79A patent/IT1112958B/it active
- 1979-04-16 JP JP4550979A patent/JPS54139934A/ja active Granted
- 1979-04-17 BE BE0/194642A patent/BE875625A/xx not_active IP Right Cessation
- 1979-04-17 CH CH361079A patent/CH637677A5/de not_active IP Right Cessation
- 1979-04-18 GB GB7913394A patent/GB2020681B/en not_active Expired
-
1980
- 1980-09-24 US US06/190,179 patent/US4544738A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1112958B (it) | 1986-01-20 |
| BE875625A (fr) | 1979-10-17 |
| CH637677A5 (de) | 1983-08-15 |
| GB2020681B (en) | 1982-11-10 |
| DE2817033A1 (de) | 1979-10-25 |
| JPS54139934A (en) | 1979-10-30 |
| IT7921161A0 (it) | 1979-03-20 |
| FR2432540A1 (fr) | 1980-02-29 |
| FR2432540B1 (enExample) | 1984-04-27 |
| JPS6325027B2 (enExample) | 1988-05-24 |
| US4544738A (en) | 1985-10-01 |
| GB2020681A (en) | 1979-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0511523B1 (de) | Azofarbstoffe mit mehreren reaktiven Ankergruppen | |
| DE2842640A1 (de) | Reaktivfarbstoffe | |
| DE2748929C2 (de) | Wasserlösliche Farbstoffe, Verfahren zu ihrer Herstellung, deren Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Fasermaterialien | |
| DE2817033C2 (de) | Reaktivfarbstoffe | |
| EP0154816B1 (de) | Sulfonsäuregruppenhaltige Azoverbindungen | |
| EP0071168B1 (de) | Wasserlösliche Disazoverbindungen und neue Bis-(aminophenoxy)-äthan-Verbindungen mit faserreaktiven Gruppen als Tetrazokomponenten, Verfahren zur Herstellung dieser Verbindungen und Verwendung der Disazoverbindungen als Farbstoffe | |
| EP0387579B1 (de) | Verdoppelte Reaktivfarbstoffe | |
| EP0568816A1 (de) | Symmetrische Azofarbstoffe | |
| EP0019785A2 (de) | Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose oder Polypeptiden | |
| EP0387589B1 (de) | Reaktivfarbstoffe, die drei reaktive Gruppen aufweisen | |
| EP0076922B1 (de) | Wasserlösliche Disazoverbindungen und deren neue Kupplungskomponenten, Verfahren zu ihrer Herstellung und Verwendung der Disazoverbindungen als Farbstoffe | |
| EP0292904A2 (de) | Wasserlösliche Naphthyl-azo-pyrazolon-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0520241A2 (de) | Verfahren zur Herstellung von Reaktivfarbstoffen und neue Reaktivfarbstoffe | |
| EP0125650B1 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Substraten | |
| DE2800147C2 (de) | Reaktivfarbstoffe | |
| EP0455054B1 (de) | Polyazoreaktivfarbstoffe | |
| DE1644254C3 (de) | Schwermetallhaltige wasserlösliche faserreaktive und -nichtreaktive Formazanazofarbstoffe, deren Herstellung und Verwendung | |
| DE2161553C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide und Materialien aus Polyamid- oder Polyurethanfasern oder negativen oder regenerierten Cellulosefasern | |
| DE2161698C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamidfasern, Polyurethanfasern, nativen oder regenerierten Cellulosefasern | |
| DE2047025C3 (de) | Wasserlösliche 1 zu 1-Kupferkomplex-Disazofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung zum Färben oder Bedrucken von nativen oder regenerierten Cellulosefaser«, Leder, Wolle, Seide, Polyamid- oder Polyurethanfasern | |
| DE964975C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| EP0431411B1 (de) | Azoreaktivfarbstoffe | |
| DE3335987A1 (de) | Reaktivfarbstoffe | |
| DE2816937C2 (de) | Verwendung von Reaktivfarbstoffen zum Färben von cellulosehaltigem Textilmaterial oder Leder | |
| DE1794298A1 (de) | Disulfimidgruppenhaltige Reaktivfarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |