DE279864C - - Google Patents
Info
- Publication number
- DE279864C DE279864C DENDAT279864D DE279864DA DE279864C DE 279864 C DE279864 C DE 279864C DE NDAT279864 D DENDAT279864 D DE NDAT279864D DE 279864D A DE279864D A DE 279864DA DE 279864 C DE279864 C DE 279864C
- Authority
- DE
- Germany
- Prior art keywords
- distilled
- vacuo
- colorless
- forms
- allyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- -1 hydrogen halides Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000007788 liquid Substances 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- QIRNGVVZBINFMX-UHFFFAOYSA-N 2-allylphenol Chemical compound OC1=CC=CC=C1CC=C QIRNGVVZBINFMX-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cosmetics (AREA)
- Fats And Perfumes (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE279864C true DE279864C (Direct) |
Family
ID=535746
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT279864D Active DE279864C (Direct) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE279864C (Direct) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2421812A (en) * | 1939-07-14 | 1947-06-10 | Univ Minnesota | Method of producing chroman compounds |
| US2421811A (en) * | 1939-07-14 | 1947-06-10 | Univ Minnesota | Process for producing chroman compounds |
| US2548704A (en) * | 1949-08-17 | 1951-04-10 | Dow Chemical Co | Substituted 2,3-dihydro-2-methylbenzofurans |
| US2937188A (en) * | 1951-11-15 | 1960-05-17 | Gen Aniline & Film Corp | 2-methyl 2, 3-dihydrobenzofurancarboxylic acids and acid halides |
| FR2634203A1 (fr) * | 1988-07-13 | 1990-01-19 | Inst Rech Controles Techn | Dihydro-2,3-benzofurannes a odeur musquee et parfums et produits parfumes les contenant |
| WO2003010120A1 (de) * | 2001-07-20 | 2003-02-06 | Merck Patent Gmbh | Indanverbindungen mit negativem dielektrischer anisotropie |
-
0
- DE DENDAT279864D patent/DE279864C/de active Active
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2421812A (en) * | 1939-07-14 | 1947-06-10 | Univ Minnesota | Method of producing chroman compounds |
| US2421811A (en) * | 1939-07-14 | 1947-06-10 | Univ Minnesota | Process for producing chroman compounds |
| US2548704A (en) * | 1949-08-17 | 1951-04-10 | Dow Chemical Co | Substituted 2,3-dihydro-2-methylbenzofurans |
| US2937188A (en) * | 1951-11-15 | 1960-05-17 | Gen Aniline & Film Corp | 2-methyl 2, 3-dihydrobenzofurancarboxylic acids and acid halides |
| FR2634203A1 (fr) * | 1988-07-13 | 1990-01-19 | Inst Rech Controles Techn | Dihydro-2,3-benzofurannes a odeur musquee et parfums et produits parfumes les contenant |
| WO2003010120A1 (de) * | 2001-07-20 | 2003-02-06 | Merck Patent Gmbh | Indanverbindungen mit negativem dielektrischer anisotropie |
| US7122228B2 (en) | 2001-07-20 | 2006-10-17 | Merck Patent Gmbh | Compound having negative Δε |
| CN100532340C (zh) * | 2001-07-20 | 2009-08-26 | 默克专利股份有限公司 | 具有负介电各向异性的茚满化合物 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE399149C (de) | Verfahren zur Darstellung von Diaminodiaryldialkylmethanen | |
| DE279864C (Direct) | ||
| DE2944295C2 (de) | Verfahren zur Herstellung von racemischer p-Hydroxy-Mandelsäure | |
| DE3028520A1 (de) | Verfahren zur herstellung von chinolinen, naphtyridinen und anderen stickstoff-bi-heterocyclen | |
| DE2429935A1 (de) | Verfahren zur herstellung von 2,2,6,6tetramethyl-4-oxopiperidin | |
| DE574838C (de) | Verfahren zur Darstellung von cyclischen Glykolen und ihren Derivaten bzw. von Ketonen | |
| DE667544C (de) | Verfahren zur Herstellung von Sulfaminsaeurefluoriden | |
| DE462895C (de) | Verfahren zur Herstellung von Nerol aus Geraniol | |
| US843290A (en) | Acetylene carbonic-acid derivative. | |
| CH627429A5 (de) | Verfahren zur herstellung von aldehyden. | |
| DE1543894C (de) | 2,3-Dimethy 1-5-tert-butylphenol, seine Verwendung und Verfahren zu seiner Herstellung | |
| DE875199C (de) | Verfahren zur Herstellung von Homologen des Oxymethylvinylketons | |
| DE644192C (de) | Verfahren zur Herstellung von ª‡-AEthyl-ª‰-propylacrolein | |
| DE581331C (de) | Verfahren zur Darstellung von im Phenylkern hydroxylierten 1-Phenyl-2-alkylaminopropan-1-olen | |
| DE505404C (de) | Darstellung von Vanillin | |
| DE646123C (de) | Verfahren zur Herstellung vielgliedriger cyclischer Amine | |
| DE881039C (de) | Verfahren zur Herstellung des Pentaerythrit-dichlorhydrin-monoschwefligsaeureesters | |
| DE951811C (de) | Verfahren zur Herstellung von Propiolsaeure | |
| DE511466C (de) | Verfahren zur Darstellung von aminosubstituierten Chinolinverbindungen | |
| DE744821C (de) | Verfahren zur Herstellung von Pyridin | |
| DE2609566C3 (de) | Verfahren zur Herstellung von Methylheptenon | |
| DE453578C (de) | Verfahren zur Darstellung eines Hydrierungsprodukts aus Benzanthron | |
| CH249117A (de) | Verfahren zur Herstellung von p-Chlorphenol-dichlorvinyläther. | |
| DE192035C (Direct) | ||
| CH255308A (de) | Verfahren zur Herstellung von 3,4-Dichlorphenol-dichlorvinyläther. |