DE2746338A1 - Feuerfeste copolyester mit phosphongruppen - Google Patents
Feuerfeste copolyester mit phosphongruppenInfo
- Publication number
- DE2746338A1 DE2746338A1 DE19772746338 DE2746338A DE2746338A1 DE 2746338 A1 DE2746338 A1 DE 2746338A1 DE 19772746338 DE19772746338 DE 19772746338 DE 2746338 A DE2746338 A DE 2746338A DE 2746338 A1 DE2746338 A1 DE 2746338A1
- Authority
- DE
- Germany
- Prior art keywords
- acidic
- mol
- group
- radical
- aliphatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920001634 Copolyester Polymers 0.000 title claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 26
- 229910052698 phosphorus Inorganic materials 0.000 claims description 24
- 230000002378 acidificating effect Effects 0.000 claims description 23
- 239000011574 phosphorus Substances 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000001931 aliphatic group Chemical group 0.000 claims description 19
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 17
- -1 Ester compounds Chemical class 0.000 claims description 16
- 150000002009 diols Chemical class 0.000 claims description 15
- 239000003153 chemical reaction reagent Substances 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 150000002148 esters Chemical class 0.000 claims description 13
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 12
- 239000012445 acidic reagent Substances 0.000 claims description 10
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 229910052791 calcium Inorganic materials 0.000 claims description 8
- 229910052700 potassium Inorganic materials 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 229910052725 zinc Inorganic materials 0.000 claims description 7
- 230000001476 alcoholic effect Effects 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims description 5
- 239000006085 branching agent Substances 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000000835 fiber Substances 0.000 claims description 4
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims 5
- 101100381997 Danio rerio tbc1d32 gene Proteins 0.000 claims 1
- 101100381999 Mus musculus Tbc1d32 gene Proteins 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 239000011888 foil Substances 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 41
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 14
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 12
- 238000006068 polycondensation reaction Methods 0.000 description 11
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 10
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 10
- 239000001632 sodium acetate Substances 0.000 description 10
- 235000017281 sodium acetate Nutrition 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 239000004753 textile Substances 0.000 description 7
- IEQICHVXWFGDAN-UHFFFAOYSA-N 4-phosphonobenzoic acid Chemical compound OC(=O)C1=CC=C(P(O)(O)=O)C=C1 IEQICHVXWFGDAN-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229940071125 manganese acetate Drugs 0.000 description 6
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 238000002485 combustion reaction Methods 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 239000000981 basic dye Substances 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 2
- 239000001639 calcium acetate Substances 0.000 description 2
- 235000011092 calcium acetate Nutrition 0.000 description 2
- 229960005147 calcium acetate Drugs 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 230000000750 progressive effect Effects 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 2
- CMQUQOHNANGDOR-UHFFFAOYSA-N 2,3-dibromo-4-(2,4-dibromo-5-hydroxyphenyl)phenol Chemical class BrC1=C(Br)C(O)=CC=C1C1=CC(O)=C(Br)C=C1Br CMQUQOHNANGDOR-UHFFFAOYSA-N 0.000 description 1
- 125000004959 2,6-naphthylene group Chemical group [H]C1=C([H])C2=C([H])C([*:1])=C([H])C([H])=C2C([H])=C1[*:2] 0.000 description 1
- NLBSQHGCGGFVJW-UHFFFAOYSA-N 2-carboxyethylphosphonic acid Chemical compound OC(=O)CCP(O)(O)=O NLBSQHGCGGFVJW-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XRSUOJDDEDFSEZ-UHFFFAOYSA-N OC(=O)OP(=O)OC(O)=O Chemical class OC(=O)OP(=O)OC(O)=O XRSUOJDDEDFSEZ-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- OMAAXMJMHFXYFY-UHFFFAOYSA-L calcium trioxidophosphanium Chemical compound [Ca+2].[O-]P([O-])=O OMAAXMJMHFXYFY-UHFFFAOYSA-L 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000009941 weaving Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/68—Polyesters containing atoms other than carbon, hydrogen and oxygen
- C08G63/692—Polyesters containing atoms other than carbon, hydrogen and oxygen containing phosphorus
- C08G63/6924—Polyesters containing atoms other than carbon, hydrogen and oxygen containing phosphorus derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/6926—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Artificial Filaments (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7631319A FR2367786A1 (fr) | 1976-10-15 | 1976-10-15 | Copolyesters ignifuges contenant des groupes arylphosphoniques |
| FR7639701A FR2376172A2 (fr) | 1976-12-29 | 1976-12-29 | Copolyesters ignifuges a groupes phosphoniques aliphatiques |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2746338A1 true DE2746338A1 (de) | 1978-04-20 |
Family
ID=26219675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772746338 Withdrawn DE2746338A1 (de) | 1976-10-15 | 1977-10-14 | Feuerfeste copolyester mit phosphongruppen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4214069A (enExample) |
| JP (1) | JPS5350295A (enExample) |
| AT (1) | AT371505B (enExample) |
| BR (1) | BR7706859A (enExample) |
| CA (1) | CA1096996A (enExample) |
| CH (1) | CH625812A5 (enExample) |
| DE (1) | DE2746338A1 (enExample) |
| ES (1) | ES463233A1 (enExample) |
| GB (1) | GB1590389A (enExample) |
| IT (1) | IT1087961B (enExample) |
| LU (1) | LU78316A1 (enExample) |
| NL (1) | NL7710873A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0016722A1 (de) * | 1979-02-14 | 1980-10-01 | Ciba-Geigy Ag | Stabilisierte flammwidrige Kunststofformmasse und Verfahren zum Stabilisieren von mit organischen Bromverbindungen flammwidrig ausgerüsteten Kunststoffen |
| EP0494113A1 (en) * | 1991-01-04 | 1992-07-08 | Hoechst Celanese Corporation | Flame resistant, low pilling polyester fiber |
| EP0823500A3 (de) * | 1996-08-01 | 1998-10-14 | Zimmer Aktiengesellschaft | POY-Polyesterfaser für Strecktexturierung und Verfahren zu deren Herstellung |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4420587A (en) * | 1981-12-14 | 1983-12-13 | The Dow Chemical Company | Phosphonopolyester resin |
| US4408033A (en) * | 1981-12-14 | 1983-10-04 | The Dow Chemical Company | Polyurethanes prepared from polyisocyanate, polyol and phosphonopolyester oligomers |
| US4412055A (en) * | 1981-12-14 | 1983-10-25 | The Dow Chemical Company | Epoxy resins prepared from epihalohydrins and hydroxyl-containing phosphonopolyester oligomers |
| EP0092868B1 (en) * | 1982-04-22 | 1986-01-22 | ANIC S.p.A. | Flameproof linear polyester, a process for its preparation, and articles formed from said polyester |
| JPH0635687B2 (ja) * | 1985-12-03 | 1994-05-11 | 日本エステル株式会社 | ポリエステル繊維 |
| US5665801A (en) * | 1995-06-20 | 1997-09-09 | Industrial Technology Research Institute | High molecular weight polyester flame retardant and process for preparing the same |
| CN110746457B (zh) * | 2019-11-12 | 2021-10-22 | 四川大学 | 含膦酸盐结构的离子单体、用其催化合成的阻燃抑烟离聚物及它们的制备方法和应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3036044A (en) * | 1958-11-05 | 1962-05-22 | Ici Ltd | Process for the manufacture of linear polyesters and copolyesters containing phosphinate structural components |
| US3052653A (en) * | 1959-12-21 | 1962-09-04 | Du Pont | Metallic phosphonate containing polyester |
| DE2346787C3 (de) * | 1973-09-17 | 1980-05-08 | Hoechst Ag, 6000 Frankfurt | Schwer entflammbare lineare Polyester, Verfahren zu deren Herstellung und deren Verwendung |
| DE2454189C3 (de) * | 1974-11-15 | 1980-08-14 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von schwer entflammbaren linearen Polyestern |
-
1977
- 1977-10-04 GB GB41276/77A patent/GB1590389A/en not_active Expired
- 1977-10-04 NL NL7710873A patent/NL7710873A/xx not_active Application Discontinuation
- 1977-10-12 US US05/841,439 patent/US4214069A/en not_active Expired - Lifetime
- 1977-10-13 BR BR7706859A patent/BR7706859A/pt unknown
- 1977-10-14 IT IT28640/77A patent/IT1087961B/it active
- 1977-10-14 CA CA289,101A patent/CA1096996A/fr not_active Expired
- 1977-10-14 LU LU78316A patent/LU78316A1/xx unknown
- 1977-10-14 JP JP12255777A patent/JPS5350295A/ja active Pending
- 1977-10-14 DE DE19772746338 patent/DE2746338A1/de not_active Withdrawn
- 1977-10-14 ES ES463233A patent/ES463233A1/es not_active Expired
- 1977-10-14 AT AT0738277A patent/AT371505B/de not_active IP Right Cessation
- 1977-10-14 CH CH1258877A patent/CH625812A5/fr not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0016722A1 (de) * | 1979-02-14 | 1980-10-01 | Ciba-Geigy Ag | Stabilisierte flammwidrige Kunststofformmasse und Verfahren zum Stabilisieren von mit organischen Bromverbindungen flammwidrig ausgerüsteten Kunststoffen |
| EP0494113A1 (en) * | 1991-01-04 | 1992-07-08 | Hoechst Celanese Corporation | Flame resistant, low pilling polyester fiber |
| EP0823500A3 (de) * | 1996-08-01 | 1998-10-14 | Zimmer Aktiengesellschaft | POY-Polyesterfaser für Strecktexturierung und Verfahren zu deren Herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| AT371505B (de) | 1983-07-11 |
| JPS5350295A (en) | 1978-05-08 |
| BR7706859A (pt) | 1978-07-04 |
| NL7710873A (nl) | 1978-04-18 |
| LU78316A1 (enExample) | 1978-06-12 |
| CH625812A5 (enExample) | 1981-10-15 |
| ATA738277A (de) | 1982-11-15 |
| IT1087961B (it) | 1985-06-04 |
| CA1096996A (fr) | 1981-03-03 |
| GB1590389A (en) | 1981-06-03 |
| ES463233A1 (es) | 1978-12-16 |
| US4214069A (en) | 1980-07-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2660334C2 (de) | Verwendung von bestimmten Phosphor enthaltenden Verbindungen zum Flammfestmachen von Polyestern | |
| DE2236037C3 (de) | Schwer entflammbare Fäden und Fasern aus Polyester | |
| DE2346787C3 (de) | Schwer entflammbare lineare Polyester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2645711C3 (de) | Halogenhaltige Flammschutzmittel enthaltende Fasern und Fäden aus linearen, thermoplastischen Polyestern | |
| DE2242002C3 (de) | Flammwidrige synthetische lineare Polyester sowie deren Verwendung | |
| DE69229854T2 (de) | Schwer entflammbare pillarme Polyesterfasern | |
| CH375897A (de) | Verfahren zur Herstellung modifizierter, wasserunlöslicher, faserbildender Polyester | |
| DE2746338A1 (de) | Feuerfeste copolyester mit phosphongruppen | |
| EP0574441B1 (de) | Spinnpräparationen für synthetische filamentfasern | |
| DE2600701A1 (de) | Flammwidrige polyester und ihre verwendung | |
| DE2712541A1 (de) | Neue polyesteramide | |
| CH358236A (de) | Verfahren zur Herstellung von makromolekularen Polymethylenterephthalaten | |
| DE4328800A1 (de) | Pillarm und schwer entflammbar modifizierte Polyester, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE1520079A1 (de) | Verfahren zur Herstellung hochpolymerer Polymethylenterephthalate | |
| DE4334492A1 (de) | Pillarme und schwer entflammbare, Phosphor und Silizium enthaltende Polyester-Mischungen, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE2526749C2 (de) | Verfahren zur Herstellung von flammwidrigem Polybutylenterephthalat | |
| DE2728095A1 (de) | Verbesserte fadenbildende polyesterpolymerisate und verfahren zu ihrer herstellung | |
| DE2653851A1 (de) | Flammfeste acrylfasern und verfahren zu ihrer herstellung | |
| DE2328343A1 (de) | Schwer entflammbare faeden und fasern aus polyester | |
| DE2804631A1 (de) | Verformbare copolyester mit verminderter entflammbarkeit | |
| DE1720647C2 (de) | Verfahren zur Herstellung von faserund filmbildenden Polyestern | |
| DE2105928A1 (de) | Lineare Polyatherester, Verfahren zu derer. Herstellung und hieraus ge formte Gegen Stande | |
| AT340570B (de) | Geformte gegenstande, wie faden, fasern, folien und formkorper | |
| DE2441538A1 (de) | Schwerbrennbare terephthalsaeurecopolyester | |
| AT340569B (de) | Geformte gebilde wie fasern, faden, filme, spritzguss-, hohl- und presskorper aus flammwidrigen, synthetischen, linearen, p-haltigen polyestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |