DE2709535A1 - Katalysatoren fuer die polymerisation von olefinen, deren herstellung und anwendung - Google Patents
Katalysatoren fuer die polymerisation von olefinen, deren herstellung und anwendungInfo
- Publication number
- DE2709535A1 DE2709535A1 DE19772709535 DE2709535A DE2709535A1 DE 2709535 A1 DE2709535 A1 DE 2709535A1 DE 19772709535 DE19772709535 DE 19772709535 DE 2709535 A DE2709535 A DE 2709535A DE 2709535 A1 DE2709535 A1 DE 2709535A1
- Authority
- DE
- Germany
- Prior art keywords
- chromium compound
- catalyst
- organic chromium
- organic
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000003054 catalyst Substances 0.000 title claims description 176
- 238000006116 polymerization reaction Methods 0.000 title claims description 25
- 150000001336 alkenes Chemical class 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 7
- 238000000034 method Methods 0.000 claims description 69
- 150000001845 chromium compounds Chemical class 0.000 claims description 63
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 47
- 239000011651 chromium Substances 0.000 claims description 44
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 42
- 229920000642 polymer Polymers 0.000 claims description 42
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 35
- 229910052804 chromium Inorganic materials 0.000 claims description 35
- 239000000203 mixture Substances 0.000 claims description 34
- 125000004432 carbon atom Chemical group C* 0.000 claims description 28
- 239000007789 gas Substances 0.000 claims description 28
- 230000001590 oxidative effect Effects 0.000 claims description 28
- 230000004913 activation Effects 0.000 claims description 25
- 239000012876 carrier material Substances 0.000 claims description 24
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 18
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 claims description 17
- 238000010438 heat treatment Methods 0.000 claims description 17
- 239000000377 silicon dioxide Substances 0.000 claims description 16
- -1 bis (cyclopentadienyl) chromium (II) Chemical compound 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 239000012298 atmosphere Substances 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 11
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 11
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 8
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical compound CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 claims description 8
- 235000012239 silicon dioxide Nutrition 0.000 claims description 8
- PMJNEQWWZRSFCE-UHFFFAOYSA-N 3-ethoxy-3-oxo-2-(thiophen-2-ylmethyl)propanoic acid Chemical compound CCOC(=O)C(C(O)=O)CC1=CC=CS1 PMJNEQWWZRSFCE-UHFFFAOYSA-N 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- XEHUIDSUOAGHBW-UHFFFAOYSA-N chromium;pentane-2,4-dione Chemical compound [Cr].CC(=O)CC(C)=O.CC(=O)CC(C)=O.CC(=O)CC(C)=O XEHUIDSUOAGHBW-UHFFFAOYSA-N 0.000 claims description 7
- 230000003197 catalytic effect Effects 0.000 claims description 6
- TYYBBNOTQFVVKN-UHFFFAOYSA-N chromium(2+);cyclopenta-1,3-diene Chemical compound [Cr+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 TYYBBNOTQFVVKN-UHFFFAOYSA-N 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 238000005470 impregnation Methods 0.000 claims description 6
- 239000011261 inert gas Substances 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 6
- AQLZCGLPNYEIDH-UHFFFAOYSA-N C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)O[Cr](=O)(=O)O[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)O[Cr](=O)(=O)O[Si](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 AQLZCGLPNYEIDH-UHFFFAOYSA-N 0.000 claims description 5
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 238000001354 calcination Methods 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 150000002430 hydrocarbons Chemical group 0.000 claims description 5
- 239000000395 magnesium oxide Substances 0.000 claims description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 5
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 5
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 5
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 claims description 5
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 claims description 5
- 229910003452 thorium oxide Inorganic materials 0.000 claims description 5
- 239000010936 titanium Substances 0.000 claims description 5
- 239000004408 titanium dioxide Substances 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 4
- 125000004450 alkenylene group Chemical group 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 229910052786 argon Inorganic materials 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000000732 arylene group Chemical group 0.000 claims description 4
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 claims description 4
- 239000001307 helium Substances 0.000 claims description 4
- 229910052734 helium Inorganic materials 0.000 claims description 4
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 4
- 239000012535 impurity Substances 0.000 claims description 4
- 229910052754 neon Inorganic materials 0.000 claims description 4
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 claims description 4
- 239000013110 organic ligand Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 3
- 238000007353 oxidative pyrolysis Methods 0.000 claims description 3
- 244000025254 Cannabis sativa Species 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- 239000013522 chelant Substances 0.000 claims 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 3
- 239000003039 volatile agent Substances 0.000 claims 3
- 125000004429 atom Chemical group 0.000 claims 2
- 230000008021 deposition Effects 0.000 claims 2
- 238000010304 firing Methods 0.000 claims 2
- 230000003213 activating effect Effects 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 claims 1
- 125000002346 iodo group Chemical group I* 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 17
- 239000005977 Ethylene Substances 0.000 description 17
- 238000001994 activation Methods 0.000 description 16
- 230000000694 effects Effects 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 10
- 238000001816 cooling Methods 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 229960001866 silicon dioxide Drugs 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 229910007926 ZrCl Inorganic materials 0.000 description 5
- 239000012190 activator Substances 0.000 description 5
- 230000006872 improvement Effects 0.000 description 5
- 239000001282 iso-butane Substances 0.000 description 5
- 229960003753 nitric oxide Drugs 0.000 description 5
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 4
- 229910002092 carbon dioxide Inorganic materials 0.000 description 4
- 239000001569 carbon dioxide Substances 0.000 description 4
- 229910002091 carbon monoxide Inorganic materials 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000007385 chemical modification Methods 0.000 description 3
- 229940117975 chromium trioxide Drugs 0.000 description 3
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000007725 thermal activation Methods 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- GMBFQFVXPJMZAR-UHFFFAOYSA-N O=[Cr](=O)(OC(c1ccccc1)(c1ccccc1)c1ccccc1)OC(c1ccccc1)(c1ccccc1)c1ccccc1 Chemical compound O=[Cr](=O)(OC(c1ccccc1)(c1ccccc1)c1ccccc1)OC(c1ccccc1)(c1ccccc1)c1ccccc1 GMBFQFVXPJMZAR-UHFFFAOYSA-N 0.000 description 2
- 241000158147 Sator Species 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- XRDUAHDCSNOCJM-UHFFFAOYSA-N chromium(4+);2-methanidyl-2-methylpropane Chemical compound [Cr+4].CC(C)(C)[CH2-].CC(C)(C)[CH2-].CC(C)(C)[CH2-].CC(C)(C)[CH2-] XRDUAHDCSNOCJM-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000002826 coolant Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- CQBWEBXPMRPCSI-UHFFFAOYSA-M O[Cr](O[SiH3])(=O)=O Chemical compound O[Cr](O[SiH3])(=O)=O CQBWEBXPMRPCSI-UHFFFAOYSA-M 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 206010000210 abortion Diseases 0.000 description 1
- 231100000176 abortion Toxicity 0.000 description 1
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 238000004378 air conditioning Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000011021 bench scale process Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- HVURSIGIEONDKB-UHFFFAOYSA-N benzene;chromium Chemical compound [Cr].C1=CC=CC=C1.C1=CC=CC=C1 HVURSIGIEONDKB-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- UZEDIBTVIIJELN-UHFFFAOYSA-N chromium(2+) Chemical compound [Cr+2] UZEDIBTVIIJELN-UHFFFAOYSA-N 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-M diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)([O-])OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-M 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 238000005246 galvanizing Methods 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 229910001026 inconel Inorganic materials 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- LXPCOISGJFXEJE-UHFFFAOYSA-N oxifentorex Chemical compound C=1C=CC=CC=1C[N+](C)([O-])C(C)CC1=CC=CC=C1 LXPCOISGJFXEJE-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 230000037048 polymerization activity Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008844 regulatory mechanism Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000003878 thermal aging Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- LZTRCELOJRDYMQ-UHFFFAOYSA-N triphenylmethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C1=CC=CC=C1 LZTRCELOJRDYMQ-UHFFFAOYSA-N 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S502/00—Catalyst, solid sorbent, or support therefor: product or process of making
- Y10S502/506—Method of making inorganic composition utilizing organic compound, except formic, acetic, or oxalic acid or salt thereof
- Y10S502/513—Alcohol, phenol, or ether or metallate thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/664,030 US4053437A (en) | 1976-03-04 | 1976-03-04 | Polyolefin catalyst and method for its preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2709535A1 true DE2709535A1 (de) | 1977-09-08 |
| DE2709535C2 DE2709535C2 (enExample) | 1987-07-23 |
Family
ID=24664224
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772709535 Granted DE2709535A1 (de) | 1976-03-04 | 1977-03-04 | Katalysatoren fuer die polymerisation von olefinen, deren herstellung und anwendung |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4053437A (enExample) |
| BE (1) | BE859545A (enExample) |
| DE (1) | DE2709535A1 (enExample) |
| FI (1) | FI63039C (enExample) |
| FR (1) | FR2342996A1 (enExample) |
| GB (1) | GB1530103A (enExample) |
| NO (1) | NO152752C (enExample) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4128500A (en) * | 1976-04-07 | 1978-12-05 | Hwang Yu Tang | Polymerization catalyst and method |
| US4096093A (en) * | 1976-06-24 | 1978-06-20 | Chemplex Company | Polymerization catalyst and method |
| US4100105A (en) * | 1977-01-21 | 1978-07-11 | Union Carbide Corporation | Titanium-modified silyl chromate catalysts for ethylene polymerization |
| USRE31443E (en) * | 1977-12-05 | 1983-11-15 | Phillips Petroleum Company | Treatment of silica |
| USRE31390E (en) * | 1977-12-05 | 1983-09-20 | Phillips Petroleum Company | Treatment of silica |
| US4284527A (en) * | 1978-06-19 | 1981-08-18 | Chemplex Company | Polymerization catalyst |
| US4303770A (en) * | 1979-10-24 | 1981-12-01 | Chemplex Company | Method of making polymers and copolymers of 1-olefins |
| US4368301A (en) * | 1979-12-14 | 1983-01-11 | Phillips Petroleum Company | Solubilized chromium salt in polymerization catalyst |
| US4397766A (en) * | 1979-12-14 | 1983-08-09 | Phillips Petroleum Company | Solubilized chromium salt in particulate support |
| US4333860A (en) * | 1979-12-14 | 1982-06-08 | Phillips Petroleum Company | Solubilized chromium salt in polymerization catalyst |
| US4381382A (en) * | 1981-06-01 | 1983-04-26 | The Dow Chemical Company | Polymerization of olefins from catalysts prepared from organo zirconium-chromium compounds |
| US4361685A (en) * | 1981-06-01 | 1982-11-30 | The Dow Chemical Company | Polymerization of olefins in the presence of catalyst prepared from organo zirconium-chromium mixtures |
| US4376065A (en) * | 1981-06-01 | 1983-03-08 | The Dow Chemical Company | Organo zirconium-chromium compound, catalyst prepared therefrom and polymerization of olefins therewith |
| US4399056A (en) * | 1981-06-01 | 1983-08-16 | The Dow Chemical Company | Organo zirconium-chromium mixtures, catalyst prepared therefrom and polymerization of olefins therewith |
| US4436883A (en) | 1982-01-20 | 1984-03-13 | Phillips Petroleum Company | Polymerization using a support formed by heating silica gel in inert atmosphere |
| US5093300A (en) * | 1983-04-04 | 1992-03-03 | Solvay & Cie (Societe Anonyme) | Method for activating a chromium-containing catalyst supported on a silica-containing base |
| US5200478A (en) * | 1983-04-04 | 1993-04-06 | Solvay S.A. | Method for activating supported chromium oxide catalysts and olefin polymerization process carried out therewith |
| US4827073A (en) * | 1988-01-22 | 1989-05-02 | Mobil Oil Corporation | Process for manufacturing olefinic oligomers having lubricating properties |
| GB8919925D0 (en) * | 1989-09-04 | 1989-10-18 | Bp Chem Int Ltd | Chromium-containing complex polymerisation catalyst |
| GB8919924D0 (en) * | 1989-09-04 | 1989-10-18 | Bp Chem Int Ltd | Chromium-containing complex polymerisation catalyst |
| FI87892C (fi) * | 1991-07-16 | 1993-03-10 | Neste Oy | Foerfarande foer framstaellning av heterogena katalysatorer med oenskad metallhalt |
| US5290748A (en) * | 1990-01-16 | 1994-03-01 | Neste Oy | Polymerization catalyst for olefines |
| BE1005444A3 (fr) * | 1991-10-14 | 1993-07-27 | Solvay | Procede de preparation de catalyseurs de polymerisation des olefines, catalyseurs obtenus selon ce procede et procede pour polymeriser les olefines en presence de ces catalyseurs. |
| BE1005795A3 (fr) * | 1992-05-13 | 1994-02-01 | Solvay | Procede de polymerisation d'olefines et (co)polymeres a blocs derives d'au moins une olefine. |
| US6696388B2 (en) * | 2000-01-24 | 2004-02-24 | E. I. Du Pont De Nemours And Company | Gel catalysts and process for preparing thereof |
| US20040092391A1 (en) * | 2002-11-08 | 2004-05-13 | Andrzej Rokicki | Fluid bed catalyst for dehydrogenation of hydrocarbons |
| US20050075243A1 (en) * | 2003-10-07 | 2005-04-07 | Sud-Chemie, Inc. | Catalyst for dehydrogenation of hydrocarbons |
| US8101541B2 (en) * | 2008-07-14 | 2012-01-24 | Sud-Chemie Inc. | Catalyst for dehydrogenation of hydrocarbons |
| RU2557661C2 (ru) * | 2009-11-10 | 2015-07-27 | Инеос Коммершиал Сервисиз Юк Лимитед | Способ полимеризации олефинов |
| EP2447289A1 (en) | 2010-11-01 | 2012-05-02 | Ineos Commercial Services UK Limited | Process for the activation of a supported chromium oxide based catalyst |
| US9266976B2 (en) * | 2010-11-30 | 2016-02-23 | Basell Polyolefine Gmbh | Method for activation of chromium containing catalyst precursor for polymerization and the resulting polymerization catalyst |
| JP5803774B2 (ja) * | 2012-03-29 | 2015-11-04 | 日本ポリエチレン株式会社 | エチレン重合用クロム触媒の製造方法 |
| US11149098B2 (en) * | 2018-09-25 | 2021-10-19 | Chevron Phillips Chemical Company Lp | Rapid activation process and activation treatments for chromium catalysts for producing high melt index polyethylenes |
| WO2024229004A1 (en) | 2023-05-02 | 2024-11-07 | Chevron Phillips Chemical Company Lp | Methods of chromium catalyst activation to reduce gels and improve melt index potential |
| US12421331B2 (en) | 2023-11-09 | 2025-09-23 | Chevron Phillips Chemical Company Lp | Systems and methods for chromium catalyst activation |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7308128A (enExample) * | 1972-06-12 | 1973-12-14 | ||
| US3806500A (en) * | 1972-07-21 | 1974-04-23 | Union Carbide Corp | Polymerization with thermally aged catalyst |
| US3844975A (en) * | 1972-11-10 | 1974-10-29 | Union Carbide Corp | Thermally aged hydride based polymerization catalyst |
| DE2502940A1 (de) * | 1974-01-24 | 1975-08-07 | Nat Petro Chem | Chrom- und phoshorhaltige katalysatorzusammensetzung |
| DE2526618A1 (de) * | 1974-06-13 | 1976-01-02 | Chemplex Co | Katalysator fuer die polymerisation und copolymerisation von olefinischen verbindungen |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2846425A (en) * | 1954-06-01 | 1958-08-05 | Phillips Petroleum Co | Stabilized catalyst and improved polymerization process |
| US2951816A (en) * | 1956-03-26 | 1960-09-06 | Phillips Petroleum Co | Polymerization catalyst and production thereof |
| NL286866A (enExample) * | 1961-12-29 | |||
| NL135065C (enExample) * | 1965-05-14 | |||
| US3541072A (en) * | 1968-02-08 | 1970-11-17 | Phillips Petroleum Co | Catalyst treatment |
| US3875132A (en) * | 1971-12-30 | 1975-04-01 | Hercules Inc | Tetraalkylchromium compounds and use as olefin polymerization catalysts |
| US3752795A (en) * | 1972-03-24 | 1973-08-14 | Standard Oil Co | Polymerization of olefins with a chomyl bis(triorganotitanate catalyst |
| US4041224A (en) * | 1975-11-19 | 1977-08-09 | Chemplex Company | Catalyst, method and polymerization processes |
-
1976
- 1976-03-04 US US05/664,030 patent/US4053437A/en not_active Expired - Lifetime
-
1977
- 1977-02-08 GB GB5128/77A patent/GB1530103A/en not_active Expired
- 1977-02-16 NO NO770502A patent/NO152752C/no unknown
- 1977-02-28 FI FI770637A patent/FI63039C/fi not_active IP Right Cessation
- 1977-03-02 FR FR7706094A patent/FR2342996A1/fr active Granted
- 1977-03-04 DE DE19772709535 patent/DE2709535A1/de active Granted
- 1977-05-16 US US05/797,123 patent/US4147849A/en not_active Expired - Lifetime
- 1977-10-10 BE BE181593A patent/BE859545A/xx not_active IP Right Cessation
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7308128A (enExample) * | 1972-06-12 | 1973-12-14 | ||
| US3806500A (en) * | 1972-07-21 | 1974-04-23 | Union Carbide Corp | Polymerization with thermally aged catalyst |
| US3844975A (en) * | 1972-11-10 | 1974-10-29 | Union Carbide Corp | Thermally aged hydride based polymerization catalyst |
| DE2502940A1 (de) * | 1974-01-24 | 1975-08-07 | Nat Petro Chem | Chrom- und phoshorhaltige katalysatorzusammensetzung |
| DE2526618A1 (de) * | 1974-06-13 | 1976-01-02 | Chemplex Co | Katalysator fuer die polymerisation und copolymerisation von olefinischen verbindungen |
Also Published As
| Publication number | Publication date |
|---|---|
| US4147849A (en) | 1979-04-03 |
| NO152752B (no) | 1985-08-05 |
| FR2342996B1 (enExample) | 1981-01-09 |
| FI63039B (fi) | 1982-12-31 |
| BE859545A (fr) | 1978-02-01 |
| NO770502L (no) | 1977-09-06 |
| NO152752C (no) | 1985-11-13 |
| FI63039C (fi) | 1983-04-11 |
| DE2709535C2 (enExample) | 1987-07-23 |
| FI770637A7 (enExample) | 1977-09-05 |
| US4053437A (en) | 1977-10-11 |
| FR2342996A1 (fr) | 1977-09-30 |
| GB1530103A (en) | 1978-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2709535A1 (de) | Katalysatoren fuer die polymerisation von olefinen, deren herstellung und anwendung | |
| DE2526618C2 (de) | Katalysator für die Polymerisation von Äthylen oder Propylen bzw. für die Copolymerisation von Äthylen mit einem α-Olefin mit 3 bis 20 Kohlenstoffatomen | |
| DE2822783C2 (enExample) | ||
| DE2336227C3 (de) | Katalysator für die Äthylenpolymerisation und Verfahren zur Herstellung von Äthylenhomo- oder -mischpolymerisaten | |
| DE2942829C2 (enExample) | ||
| DE2626097C2 (enExample) | ||
| DE2146685B2 (de) | Verfahren zur Polymerisation von Äthylen und Katalysator zur Durchführung dieses Verfahrens | |
| DE3213633A1 (de) | Feste olefin-polymerisations- und -copolymerisations-katalysatoren, deren herstellung und mit ihnen durchgefuehrte polymerisationsverfahren | |
| DE3228065A1 (de) | Feste olefin-polymerisations- und copolymerisations-katalysatorsysteme, deren herstellung und mit ihnen durchgefuehrte polymerisationsverfahren | |
| DE69204949T2 (de) | Katalysator zur Olefinpolymerisation. | |
| DE2653379A1 (de) | Uebergangsmetallverbindung, verfahren zur herstellung derselben und ihre anwendeng beim polymerisationsverfahren | |
| DE2630585B2 (de) | Katalysatoren für die Polymerisation von a -Olefinen, mit 2 bis 6 Kohlenstoffatomen und deren Verwendung für die Polymerisation von a -Olefinen mit 2 bis 6 Kohlenstoffatomen | |
| DE2724974A1 (de) | Katalysatorkomponente, verfahren zu ihrer herstellung und die sie enthaltenden katalysatoren | |
| DE2721058A1 (de) | Verfahren zum herstellen von homo- und copolymerisaten von alpha-monoolefinen | |
| DE2543181C2 (de) | Verfahren zur Polymerisation von Äthylen oder zu dessen Copolymerisation mit C↓3↓- bis C↓1↓↓0↓-α-Monoolefinen | |
| DE2654940A1 (de) | Polymerisationsverfahren | |
| DE2504597A1 (de) | Katalysatorsystem zur polymerisation von olefinen, verfahren zu seiner herstellung und seine verwendung | |
| DE2603919A1 (de) | Verfahren zum herstellen von homo- und copolymerisaten von alpha-monoolefinen | |
| DE2531899A1 (de) | Verfahren zur herstellung von polyolefinen | |
| DE2633109C2 (enExample) | ||
| DE2713877C2 (de) | Verfahren zur Herstellung von Äthylenhomo- oder Mischpolymerisaten und dabei verwendeter Polymerisationskatalysator | |
| DE2713897A1 (de) | Katalysatoren fuer die olefinpolymerisation, deren herstellung und verwendung | |
| DE2759512C2 (de) | Titanhaltiger Katalysator und dessen Verwendung in Kombination mit einer aluminiumorganischen Verbindung zur Polymerisation von α-Olefinen | |
| DE2040353C3 (de) | Verfahren zur Herstellung katalytisch aktiver organischer Übergangsmetallverbindungen und deren Verwendung als Polymerisationskatalysatoren für Olefine | |
| DE2722386A1 (de) | Verfahren zur herstellung von katalysatoren fuer die polymerisation von olefinen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |