DE2618410A1 - Vorrichtung zur unter gasabscheidung erfolgenden elektrolyse - Google Patents
Vorrichtung zur unter gasabscheidung erfolgenden elektrolyseInfo
- Publication number
- DE2618410A1 DE2618410A1 DE19762618410 DE2618410A DE2618410A1 DE 2618410 A1 DE2618410 A1 DE 2618410A1 DE 19762618410 DE19762618410 DE 19762618410 DE 2618410 A DE2618410 A DE 2618410A DE 2618410 A1 DE2618410 A1 DE 2618410A1
- Authority
- DE
- Germany
- Prior art keywords
- electrode
- layer
- oxide
- electrolysis
- electrolyte
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000005868 electrolysis reaction Methods 0.000 title claims description 59
- 238000000926 separation method Methods 0.000 title claims description 12
- 239000011148 porous material Substances 0.000 claims description 48
- 239000003792 electrolyte Substances 0.000 claims description 35
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 15
- 239000011780 sodium chloride Substances 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Inorganic materials [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 7
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000000395 magnesium oxide Substances 0.000 claims description 4
- 239000001103 potassium chloride Substances 0.000 claims description 4
- 235000011164 potassium chloride Nutrition 0.000 claims description 4
- 239000000243 solution Substances 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- 239000006104 solid solution Substances 0.000 claims description 3
- 229910010413 TiO 2 Inorganic materials 0.000 claims description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 2
- 238000005470 impregnation Methods 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 2
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 claims description 2
- 238000005192 partition Methods 0.000 claims description 2
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 claims description 2
- 229910003452 thorium oxide Inorganic materials 0.000 claims description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 2
- 238000009827 uniform distribution Methods 0.000 claims description 2
- 229910001928 zirconium oxide Inorganic materials 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 230000035515 penetration Effects 0.000 claims 1
- 239000007789 gas Substances 0.000 description 32
- 239000007788 liquid Substances 0.000 description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 230000009970 fire resistant effect Effects 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 230000010287 polarization Effects 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 230000001788 irregular Effects 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- -1 polytetrafluoroethylene Polymers 0.000 description 2
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 2
- 239000004810 polytetrafluoroethylene Substances 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000002001 electrolyte material Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH536575A CH597371A5 (https=) | 1975-04-25 | 1975-04-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2618410A1 true DE2618410A1 (de) | 1976-11-04 |
Family
ID=4292337
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762618410 Withdrawn DE2618410A1 (de) | 1975-04-25 | 1976-04-23 | Vorrichtung zur unter gasabscheidung erfolgenden elektrolyse |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4086155A (https=) |
| JP (1) | JPS51130684A (https=) |
| CH (1) | CH597371A5 (https=) |
| DE (1) | DE2618410A1 (https=) |
| FR (1) | FR2308701A1 (https=) |
| IT (1) | IT1060236B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999057773A1 (de) * | 1998-04-30 | 1999-11-11 | Emitec Gesellschaft Für Emissionstechnologie Mbh | Elektrode mit für ein fluid durchgängigen poren und brennstoffzelle |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2420773A1 (fr) * | 1978-03-23 | 1979-10-19 | France Etat | Reflecteur acoustique immerge et procede de fabrication |
| US4340459A (en) * | 1978-09-05 | 1982-07-20 | The Dow Chemical Company | Electrolytic cell with oxygen-depolarized cathodes |
| US4341606A (en) * | 1978-09-05 | 1982-07-27 | The Dow Chemical Co. | Method of operating electrolytic cells having massive dual porosity gas electrodes |
| US4260469A (en) * | 1978-09-05 | 1981-04-07 | The Dow Chemical Company | Massive dual porosity gas electrodes |
| US4294893A (en) * | 1979-05-21 | 1981-10-13 | Centro Ricerche Fiat S.P.A. | Graphite-resin composite electrode structure, and a process for its manufacture |
| DE2928911A1 (de) * | 1979-06-29 | 1981-01-29 | Bbc Brown Boveri & Cie | Elektrode fuer die wasserelektrolyse |
| JPS5723076A (en) * | 1980-07-18 | 1982-02-06 | Asahi Glass Co Ltd | Preparation of alkali hydroxide and chlorine |
| JPS5940231B2 (ja) * | 1979-11-27 | 1984-09-28 | 旭硝子株式会社 | 水酸化アルカリの製造方法 |
| US4430177A (en) | 1979-12-11 | 1984-02-07 | The Dow Chemical Company | Electrolytic process using oxygen-depolarized cathodes |
| US4295951A (en) * | 1980-05-14 | 1981-10-20 | Hooker Chemicals & Plastics Corp. | Film-coated cathodes for halate cells |
| US4548693A (en) * | 1981-02-25 | 1985-10-22 | Olin Corporation | Reticulate electrode for electrolytic cells |
| US4468312A (en) * | 1981-02-25 | 1984-08-28 | Olin Corporation | Reticulate electrode for electrolytic cells |
| US4435267A (en) * | 1982-10-08 | 1984-03-06 | Exxon Research And Engineering Co. | Gas percolation barrier for gas fed electrode |
| US5437940A (en) * | 1986-10-14 | 1995-08-01 | Westinghouse Electric Corporation | High power energy compression device |
| BR9007455A (pt) * | 1989-06-23 | 1992-06-16 | Heraeus Elektrochemie | Celula de eletrolise para processos eletroliticos geradores de gas |
| DE4039018A1 (de) * | 1990-12-04 | 1992-06-11 | Arnold Gallien | Elektrolysezelle fuer gasentwickelnde bzw. gasverzehrende elektrolytische prozesse sowie verfahren zur herstellung der elektrolysezelle |
| DE4119836A1 (de) * | 1991-06-12 | 1992-12-17 | Arnold Gallien | Elektrolysezelle fuer gasentwickelnde bzw. gasverzehrende elektrolytische prozesse sowie verfahren zum betreiben der elektrolysezelle |
| DE4119839C2 (de) * | 1991-06-12 | 1994-04-07 | Arnold Gallien | Elektrolysezelle, insbesondere für gasentwickelnde und gasverzehrende elektrolytische Prozesse |
| DE4120679C2 (de) * | 1991-06-22 | 1995-11-09 | Grimma Masch Anlagen Gmbh | Elektrolyseverfahren und Elektrolysezelle für gasentwickelnde oder gasverbrauchende elektrolytische Prozesse |
| US5538608A (en) * | 1993-09-25 | 1996-07-23 | Tanaka Kikinzoku Kogyo K.K. | Bubble collection type gas electrode |
| NL1019454C2 (nl) * | 2001-11-30 | 2003-06-03 | Tno | Werkwijze en inrichting voor het uitvoeren van elektrochemische reacties. |
| US20050129160A1 (en) * | 2003-12-12 | 2005-06-16 | Robert Indech | Apparatus and method for facilitating nuclear fusion |
| WO2008132818A1 (ja) * | 2007-04-20 | 2008-11-06 | Mitsui Chemicals, Inc. | 電気分解装置、それに用いる電極および電気分解方法 |
| WO2013185169A1 (en) | 2012-06-12 | 2013-12-19 | Monash University | Gas permeable electrode and method of manufacture |
| AU2012382382A1 (en) | 2012-06-12 | 2015-01-15 | Aquahydrex Pty Ltd | Breathable electrode and method for use in water splitting |
| US20150292094A1 (en) * | 2012-06-12 | 2015-10-15 | University Of Wollongong | Gas permeable electrodes and electrochemical cells |
| KR20160040614A (ko) | 2013-07-31 | 2016-04-14 | 아쿠아하이드렉스 프로프라이어터리 리미티드 | 기체 확산 전극(들)을 가지는 전기-합성 또는 전기-에너지 전지 |
| US10573904B2 (en) | 2015-07-16 | 2020-02-25 | Sumitomo Electric Industries, Ltd. | Fuel cell |
| CA3127358A1 (en) | 2019-02-01 | 2020-08-06 | Aquahydrex, Inc. | Electrochemical system with confined electrolyte |
| JP2020079450A (ja) * | 2020-02-26 | 2020-05-28 | 株式会社東芝 | 電解槽及び水素製造装置 |
| WO2021194341A1 (en) | 2020-03-26 | 2021-09-30 | Stichting Ispt | Electrolyser |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1241812B (de) * | 1958-07-19 | 1967-06-08 | Siemens Ag | Ventil-Elektrode |
| CH394326A (de) * | 1961-12-14 | 1965-06-30 | Siemens Ag | Gasdiffusionselektrode mit gerichteter Porosität und Verfahren zu ihrer Herstellung |
| US3506561A (en) * | 1964-11-16 | 1970-04-14 | Mobil Oil Corp | Method for making electrodes |
| US3410783A (en) * | 1966-02-02 | 1968-11-12 | Allis Chalmers Mfg Co | Electrochemical cell for separation of gaseous mixtures |
| US3485744A (en) * | 1966-11-21 | 1969-12-23 | Westinghouse Electric Corp | Zirconium electrode for electro-chemical machining |
| US3778307A (en) * | 1967-02-10 | 1973-12-11 | Chemnor Corp | Electrode and coating therefor |
| US3607687A (en) * | 1969-07-29 | 1971-09-21 | Kimberly Clark Co | Process for producing peroxides |
| FR2087342A5 (https=) * | 1970-05-15 | 1971-12-31 | Progil | |
| US3926769A (en) * | 1973-05-18 | 1975-12-16 | Dow Chemical Co | Diaphragm cell chlorine production |
| JPS5137877A (en) * | 1974-09-27 | 1976-03-30 | Asahi Chemical Ind | Denkaiyodenkyoku oyobi sonoseizoho |
| US3975557A (en) * | 1975-01-02 | 1976-08-17 | The Dow Chemical Company | Producing an electrode |
-
1975
- 1975-04-25 CH CH536575A patent/CH597371A5/xx not_active IP Right Cessation
-
1976
- 1976-04-21 US US05/678,745 patent/US4086155A/en not_active Expired - Lifetime
- 1976-04-22 IT IT22568/76A patent/IT1060236B/it active
- 1976-04-22 FR FR7611921A patent/FR2308701A1/fr active Granted
- 1976-04-23 DE DE19762618410 patent/DE2618410A1/de not_active Withdrawn
- 1976-04-26 JP JP51046681A patent/JPS51130684A/ja active Pending
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999057773A1 (de) * | 1998-04-30 | 1999-11-11 | Emitec Gesellschaft Für Emissionstechnologie Mbh | Elektrode mit für ein fluid durchgängigen poren und brennstoffzelle |
| US6376118B1 (en) | 1998-04-30 | 2002-04-23 | Emitec Gesellschaft Emmissionstechnologie Mbh | Fuel cell having an electrode with gas-permeable pores |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2308701A1 (fr) | 1976-11-19 |
| JPS51130684A (en) | 1976-11-13 |
| CH597371A5 (https=) | 1978-03-31 |
| FR2308701B1 (https=) | 1979-01-19 |
| US4086155A (en) | 1978-04-25 |
| IT1060236B (it) | 1982-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2618410A1 (de) | Vorrichtung zur unter gasabscheidung erfolgenden elektrolyse | |
| DE3785794T2 (de) | Elektroden fuer elektrochemische zellen mit festoxidelektrolyt. | |
| DE112004002382B4 (de) | Brennstoffzellen-Herstellungsverfahren und Brennstoffzelle | |
| DE2818971C2 (de) | Vorrichtung und Verfahren zur elektrochemischen Gewinnung von Alkalimetall aus einem elektrisch dissoziierbaren Salz desselben und dessen Verwendung | |
| DE2736883A1 (de) | Elektrolytspeicherschicht fuer brennstoffzellen | |
| DE2650325A1 (de) | Anodentrennelement | |
| EP1343215A1 (de) | Strukturierter Körper für eine in Brennstoffzellen verwendete Anode | |
| DE1596223C3 (de) | Gasdichter alkalischer Kadmium-Nickel- oder Kadmium-Silber-Akkumulator, bei dem zwischen Scheider und negativer Elektrode eine elektrisch leitfähige poröse Schicht angeordnet ist | |
| DE2627142C3 (de) | Elektrochemische Zelle | |
| DE2652152A1 (de) | Elektrode fuer elektrolytische reaktionen und verfahren zu deren herstellung | |
| DE1092215B (de) | Kathode und Zelle zur Gewinnung von Aluminium aus Aluminiumoxyd durch Schmelzflusselektrolyse | |
| DE3247665C2 (https=) | ||
| DE2840240A1 (de) | Elektrische umwandlungsvorrichtung mit keramikelektrode | |
| DE112023000760T5 (de) | Elektrochemische zelle | |
| DE3538043A1 (de) | Elektrochemische zelle mit elektrolytumlauf, verfahren zum herstellen einer gasdepolarisierten katode und elektrolyseverfahren | |
| DE1771420A1 (de) | Aufladbares Brennstoffelement | |
| DE2213347A1 (de) | Zinkelektrode für galvanische Elemente und Verfahren zu ihrer Herstellung | |
| DE1421372A1 (de) | Elektrolysezellengeruest | |
| DE1283312B (de) | Gasdichter Nickel-Cadmium-Akkumulator | |
| DE1210426C2 (de) | Verfahren zur elektrolytischen Herstellung von Phosphin | |
| DE19512755C2 (de) | Poröse Kathode mit bimodaler Porenverteilung und Verfahren zu deren Herstellung | |
| DE2735096C3 (de) | Verfahren zur Stromerzeugung und galvanisches Element zur Durchführung des Verfahrens | |
| DE2947454C2 (de) | Verfahren zur Trennung der bei einer Schmelzflußelektrolyse entwickelten Gase und Schmelzflußelektrolysevorrichtung | |
| DE102014225612A1 (de) | Verfahren zur Regeneration der Elektrolytlösung eines Redox-Flow-Akkumulators | |
| AT208606B (de) | Fester Stromleiter und Verfahren zu seiner Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |