DE246668A - - Google Patents
Info
- Publication number
- DE246668A DE246668A DE246668A DE 246668 A DE246668 A DE 246668A DE 246668 A DE246668 A DE 246668A
- Authority
- DE
- Germany
- Prior art keywords
- nitro
- group
- dyes
- diazotized
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 9
- -1 nitroamino Chemical group 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 5
- 229920000742 Cotton Polymers 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 3
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 2
- 229950009041 edaravone Drugs 0.000 description 2
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009967 direct dyeing Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- UPBIVMVNDOALIE-UHFFFAOYSA-N n-(3-amino-2-methylphenyl)benzamide Chemical compound CC1=C(N)C=CC=C1NC(=O)C1=CC=CC=C1 UPBIVMVNDOALIE-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- MAZKAODOCXYDCM-UHFFFAOYSA-N tetrazone Chemical group N\N=N\N MAZKAODOCXYDCM-UHFFFAOYSA-N 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE246668A (cg-RX-API-DMAC10.html) | ||
| AT58409B (de) | Verfahren zur Darstellung von direkt ziehenden Baumwollfarbstoffen. | |
| DE904886C (de) | Verfahren zur Herstellung ueberfaerbeechter Faerbungen auf Acetylcellulose sowie linearen Polyamiden und Polyurethanen | |
| DE374991C (de) | Verfahren zur Darstellung von substantiven Farbstoffen | |
| DE762445C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE858440C (de) | Verfahren zur Herstellung von Trisazofarbstoffen | |
| DE494414C (de) | Verfahren zur Herstellung von unloeslichen Azofarbstoffen auf der pflanzlichen Faser | |
| DE732021C (de) | Verfahren zur Herstellung von Azofarbstoffen auf tierischen Fasern und natuerlichen oder kuenstlichen Cellulosefasern, auf Mischungen von tierischen Fasern mit Cellulosefasern sowie auf Bahnen aus regenerierter Cellulose | |
| DE1644222C (de) | Orangenfarbige bis scharlachrote Mono azoreaktivfarbstoffe und Verfahren zu deren Herstellung | |
| DE2431873A1 (de) | Azoverbindungen | |
| DE844772C (de) | Verfahren zur Herstellung von Trisazofarbstoffen | |
| DE744018C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE644070C (de) | Verfahren zur Herstellung von Eisfarben nach dem Druck- oder Klotzverfahren | |
| DE240163C (cg-RX-API-DMAC10.html) | ||
| DE722908C (de) | Verfahren zur Herstellung von Tetrakisazofarbstoffen | |
| AT55201B (de) | Verfahren zur Darstellung von Azofarbstoffen. | |
| DE693023C (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| DE572516C (de) | Verfahren zum Faerben von pflanzlichen Fasern | |
| DE441053C (de) | Verfahren zum Faerben von pflanzlicher Faser | |
| DE915968C (de) | Verfahren zur Herstellung neuer Monoazofarbstoffe | |
| DE270669C (cg-RX-API-DMAC10.html) | ||
| DE1444638C3 (de) | Metallhaltige Azofarbstoffe, Verfahren zu deren Hersteilung und ihre Verwendung | |
| DE762865C (de) | Verfahren zur Herstellung von Trisazofarbstoffen | |
| DE282889C (cg-RX-API-DMAC10.html) | ||
| DE493811C (de) | Verfahren zur Herstellung von Azofarbstoffen |