DE2463203C2 - - Google Patents
Info
- Publication number
- DE2463203C2 DE2463203C2 DE2463203A DE2463203A DE2463203C2 DE 2463203 C2 DE2463203 C2 DE 2463203C2 DE 2463203 A DE2463203 A DE 2463203A DE 2463203 A DE2463203 A DE 2463203A DE 2463203 C2 DE2463203 C2 DE 2463203C2
- Authority
- DE
- Germany
- Prior art keywords
- steroid
- hydroxy
- solution
- added
- reduction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 18
- -1 Amine salt Chemical class 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 229910052744 lithium Inorganic materials 0.000 claims description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 8
- 229910021529 ammonia Inorganic materials 0.000 claims description 8
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 7
- 230000002829 reductive effect Effects 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 239000011591 potassium Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 3
- WPCGHPRVQQXAMT-FDRPCONVSA-N (1s,3r,8s,9s,10r,13r,14s,17r)-17-[(2r)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthrene-1,3-diol Chemical compound C1C=C2C[C@@H](O)C[C@H](O)[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@@H](CCCC(C)(C)O)C)[C@@]1(C)CC2 WPCGHPRVQQXAMT-FDRPCONVSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 40
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 18
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000006722 reduction reaction Methods 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 150000003431 steroids Chemical class 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 9
- 238000010828 elution Methods 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 235000019270 ammonium chloride Nutrition 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 6
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- UXFVRWPSABSGRQ-AFWJMSMISA-N (1s,3r,8s,9s,10r,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthrene-1,3-diol Chemical compound C1C=C2C[C@@H](O)C[C@H](O)[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 UXFVRWPSABSGRQ-AFWJMSMISA-N 0.000 description 5
- OFHCOWSQAMBJIW-AVJTYSNKSA-N alfacalcidol Chemical class C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C OFHCOWSQAMBJIW-AVJTYSNKSA-N 0.000 description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000004593 Epoxy Substances 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 229940088594 vitamin Drugs 0.000 description 4
- 229930003231 vitamin Natural products 0.000 description 4
- 239000011782 vitamin Substances 0.000 description 4
- 235000013343 vitamin Nutrition 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- HTCJGXGLMIWOCW-UHFFFAOYSA-N 1alpha-hydroxycholesterol Natural products C1C=C2CC(O)CC(O)C2(C)C2C1C1CCC(C(C)CCC(=C)C(C)C)C1(C)CC2 HTCJGXGLMIWOCW-UHFFFAOYSA-N 0.000 description 3
- HOSZMOQCLZCHTD-MOXRGVOBSA-N 1α,2α-epoxycholesta-4,6-dien-3-one Chemical compound C1=CC2=CC(=O)[C@@H]3O[C@@H]3[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HOSZMOQCLZCHTD-MOXRGVOBSA-N 0.000 description 3
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001838 cholestanes Chemical class 0.000 description 3
- 235000012000 cholesterol Nutrition 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000007269 dehydrobromination reaction Methods 0.000 description 3
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- NIJCHQWGAFQPFT-GYKMGIIDSA-N (8s,9s,10r,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one Chemical compound C1=CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 NIJCHQWGAFQPFT-GYKMGIIDSA-N 0.000 description 2
- ISNKSXRJJVWFIL-UHFFFAOYSA-N (sulfonylamino)amine Chemical compound NN=S(=O)=O ISNKSXRJJVWFIL-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- ZGLHBRQAEXKACO-XJRQOBMKSA-N 1alpha,25-dihydroxyvitamin D2 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@@H](\C=C\[C@H](C)C(C)(C)O)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C ZGLHBRQAEXKACO-XJRQOBMKSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 229930003316 Vitamin D Natural products 0.000 description 2
- 206010047626 Vitamin D Deficiency Diseases 0.000 description 2
- QYSXJUFSXHHAJI-XFEUOLMDSA-N Vitamin D3 Natural products C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C/C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-XFEUOLMDSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- XIIAYQZJNBULGD-LDHZKLTISA-N cholestane Chemical class C1CC2CCCC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 XIIAYQZJNBULGD-LDHZKLTISA-N 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 2
- 235000019166 vitamin D Nutrition 0.000 description 2
- 239000011710 vitamin D Substances 0.000 description 2
- 229940046008 vitamin d Drugs 0.000 description 2
- 150000003722 vitamin derivatives Chemical class 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- UXFVRWPSABSGRQ-BRAIFALHSA-N (3r,8s,9s,10r,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthrene-1,3-diol Chemical compound C1C=C2C[C@@H](O)CC(O)[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 UXFVRWPSABSGRQ-BRAIFALHSA-N 0.000 description 1
- XIIAYQZJNBULGD-UHFFFAOYSA-N (5alpha)-cholestane Natural products C1CC2CCCCC2(C)C2C1C1CCC(C(C)CCCC(C)C)C1(C)CC2 XIIAYQZJNBULGD-UHFFFAOYSA-N 0.000 description 1
- HIRJUBYXEOKIMY-REEZCCHISA-N (8s,9s,10r,13r,14s,17r)-17-[(2r)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one Chemical compound C1=CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@@H](CCCC(C)(C)O)C)[C@@]1(C)CC2 HIRJUBYXEOKIMY-REEZCCHISA-N 0.000 description 1
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 1
- MARXMDRWROUXMD-UHFFFAOYSA-N 2-bromoisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Br)C(=O)C2=C1 MARXMDRWROUXMD-UHFFFAOYSA-N 0.000 description 1
- INBGSXNNRGWLJU-ZHHJOTBYSA-N 25-hydroxycholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@@H](CCCC(C)(C)O)C)[C@@]1(C)CC2 INBGSXNNRGWLJU-ZHHJOTBYSA-N 0.000 description 1
- INBGSXNNRGWLJU-UHFFFAOYSA-N 25epsilon-Hydroxycholesterin Natural products C1C=C2CC(O)CCC2(C)C2C1C1CCC(C(CCCC(C)(C)O)C)C1(C)CC2 INBGSXNNRGWLJU-UHFFFAOYSA-N 0.000 description 1
- ICGLPKIVTVWCFT-UHFFFAOYSA-N 4-methylbenzenesulfonohydrazide Chemical compound CC1=CC=C(S(=O)(=O)NN)C=C1 ICGLPKIVTVWCFT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PJEIBQWLLDBCCO-FDUUVPPLSA-N Cholesta-5,7-diene-1,3-diol Chemical compound C1[C@@H](O)C[C@H](O)[C@]2(C)[C@@H](CC[C@@]3([C@@H]([C@H](C)CCCC(C)C)CC[C@H]33)C)C3=CC=C21 PJEIBQWLLDBCCO-FDUUVPPLSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- 206010020915 Hypervitaminosis Diseases 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229930182558 Sterol Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 1
- GPEHQHXBPDGGDP-UHFFFAOYSA-N acetonitrile;propan-2-one Chemical compound CC#N.CC(C)=O GPEHQHXBPDGGDP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 229950001336 bromamide Drugs 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 235000020964 calcitriol Nutrition 0.000 description 1
- 239000011612 calcitriol Substances 0.000 description 1
- GMRQFYUYWCNGIN-NKMMMXOESA-N calcitriol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@@H](CCCC(C)(C)O)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C GMRQFYUYWCNGIN-NKMMMXOESA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- HKXBNHCUPKIYDM-CGMHZMFXSA-N doxercalciferol Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)/C=C/[C@H](C)C(C)C)=C\C=C1\C[C@@H](O)C[C@H](O)C1=C HKXBNHCUPKIYDM-CGMHZMFXSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 229930185107 quinolinone Natural products 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 150000003432 sterols Chemical class 0.000 description 1
- 235000003702 sterols Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003710 vitamin D derivatives Chemical class 0.000 description 1
- MECHNRXZTMCUDQ-RKHKHRCZSA-N vitamin D2 Chemical compound C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)/C=C/[C@H](C)C(C)C)=C\C=C1\C[C@@H](O)CCC1=C MECHNRXZTMCUDQ-RKHKHRCZSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C401/00—Irradiation products of cholesterol or its derivatives; Vitamin D derivatives, 9,10-seco cyclopenta[a]phenanthrene or analogues obtained by chemical preparation without irradiation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Steroid Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Feed For Specific Animals (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US32246273A | 1973-01-10 | 1973-01-10 | |
| US362339A US3901928A (en) | 1973-01-10 | 1973-05-21 | 1' ,3' -dihydroxy steroid-5-enes method of preparing same and their use for preparing 1' -hydroxy-25-hydrogen vitamin d compounds |
| KR7401148A KR790000218B1 (en) | 1973-01-10 | 1974-01-09 | Process for preparation of 1 , 3 -dihy droxy steroid-5-enes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2463203C2 true DE2463203C2 (enExample) | 1987-06-04 |
Family
ID=27348128
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2400931A Granted DE2400931A1 (de) | 1973-01-10 | 1974-01-09 | Derivate des vitamin d und verfahren zu ihrer herstellung |
| DE2463203A Expired DE2463203C2 (enExample) | 1973-01-10 | 1974-01-09 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2400931A Granted DE2400931A1 (de) | 1973-01-10 | 1974-01-09 | Derivate des vitamin d und verfahren zu ihrer herstellung |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3901928A (enExample) |
| JP (4) | JPS5745740B2 (enExample) |
| AR (1) | AR213608A1 (enExample) |
| BE (1) | BE809578A (enExample) |
| CA (1) | CA1055011A (enExample) |
| CH (1) | CH603571A5 (enExample) |
| DE (2) | DE2400931A1 (enExample) |
| DK (1) | DK158786C (enExample) |
| ES (1) | ES422140A1 (enExample) |
| FR (1) | FR2213053B1 (enExample) |
| GB (1) | GB1463985A (enExample) |
| HK (1) | HK98589A (enExample) |
| IE (1) | IE40496B1 (enExample) |
| LU (1) | LU69133A1 (enExample) |
| MY (1) | MY104375A (enExample) |
| NL (1) | NL187010C (enExample) |
| PH (1) | PH14419A (enExample) |
| SE (1) | SE419981B (enExample) |
| SG (1) | SG68389G (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA74158B (en) * | 1973-01-10 | 1975-03-26 | Res Inst Medicine Chem | Chemical process |
| US4022891A (en) * | 1974-06-18 | 1977-05-10 | Teijin Limited | Novel 1α,24-dihydroxycholecalciferol compositions, novel precursors thereof, and processes for preparing them |
| US4004003A (en) * | 1974-08-28 | 1977-01-18 | The Upjohn Company | 25-Hydroxycalciferol compounds for treatment of steroid-induced osteoporosis |
| US3993675A (en) * | 1975-02-24 | 1976-11-23 | Hoffmann-La Roche Inc. | Process for the preparation of 1α,25-dihydroxycholecalciferol |
| JPS5265262A (en) * | 1975-11-27 | 1977-05-30 | Teijin Ltd | Synthesis of 1alpha acyloxy-provitamine d compounds |
| JPS5265261A (en) * | 1975-11-27 | 1977-05-30 | Teijin Ltd | Synthesis of 1alpha-hyaroxy-provitamine d compounds |
| CH626336A5 (en) * | 1976-03-08 | 1981-11-13 | Hoffmann La Roche | Process for the preparation of cholecalciferol derivatives |
| US4021423A (en) * | 1976-03-08 | 1977-05-03 | Hoffmann-La Roche Inc. | Syntheses of 24R,25- and 24S,25-dihydroxycholecalciferol |
| GB1583749A (en) * | 1976-06-03 | 1981-02-04 | Res Inst Medicine Chem | Vitamin d derivatives |
| US4046760A (en) * | 1976-07-01 | 1977-09-06 | Merck & Co., Inc. | Process for preparing 1-α-hydroxy cholesterol derivatives |
| IT1088094B (it) * | 1976-10-14 | 1985-06-04 | Hoffmann La Roche | Derivati del pregnano |
| US4098801A (en) * | 1977-01-26 | 1978-07-04 | Hoffmann-La Roche Inc. | Synthesis of 1α-hydroxylated derivatives of cholesterol |
| CH638215A5 (de) * | 1977-02-04 | 1983-09-15 | Hoffmann La Roche | Oxadiazolopyrimidin-derivate. |
| US4157984A (en) * | 1977-06-08 | 1979-06-12 | Z-L Limited | Antioxidants, antioxidant compositions and methods of preparing and using same |
| US4218489A (en) * | 1977-06-08 | 1980-08-19 | Z-L Limited Partnership | Antioxidants, antioxidant compositions and methods of preparing and using same |
| JPS5452717A (en) * | 1977-09-29 | 1979-04-25 | Chugai Pharmaceut Co Ltd | Stable oily pharmaceuticals containing 1alpha-hydroxyvitamin d |
| US4195027A (en) * | 1978-01-16 | 1980-03-25 | Wisconsin Alumni Research Foundation | Process for preparing 1α-hydroxylated compounds |
| US4260549A (en) * | 1979-05-21 | 1981-04-07 | Wisconsin Alumni Research Foundation | Process for preparing 1α-hydroxylated compounds |
| US4199518A (en) * | 1978-03-30 | 1980-04-22 | Diamond Shamrock Corporation | 1α,3β-Dihydroxy-steroid-5-enes from 1α,2α-epoxy-steroid-4,6-dien-3-ones |
| JPS557215A (en) * | 1978-06-30 | 1980-01-19 | Teijin Ltd | Preparation of active vitamin d3 or its oh-protected derivative and/or its corresponding previtamin d3 or its oh-protected derivative |
| LU80545A1 (de) * | 1978-11-17 | 1980-06-05 | Hoffmann La Roche | Verfahren zur herstellung von 1a,3s-dihydroxy->5-steroiden |
| US4284577A (en) * | 1979-02-16 | 1981-08-18 | Sachiko Yamada | Novel vitamin D3 derivative and process for preparing the same |
| FR2457282A1 (fr) * | 1979-05-23 | 1980-12-19 | Roussel Uclaf | Nouveau derive du 1a,25 dihydroxy cholecalciferol, son procede de preparation et son application comme medicament |
| EP0028484B1 (en) * | 1979-10-23 | 1985-08-14 | Teijin Limited | Process for the preparation of active-type vitamin d3 compounds and of the cholesta-5,7-diene precursors, and products so obtained |
| DE3270978D1 (en) * | 1981-07-17 | 1986-06-12 | Duphar Int Res | Method of preparing 1-alpha-hydroxyvitamin d and 1-alpha-hydroxy-previtamin d compounds, and adduct of a previtamin d or tachysterol compound with a suitable dienophile |
| JPS5856646A (ja) * | 1981-09-26 | 1983-04-04 | Tatsuo Suda | 産卵めんどりの初産促進方法、初産促進剤及びそのための飼料組成物 |
| CA1272953A (en) | 1984-10-08 | 1990-08-21 | Yuji Makino | Pharmaceutical composition for external use containing active-type vitamin d.sub.3 |
| JPS61189229A (ja) * | 1985-02-18 | 1986-08-22 | Tokai Kapuseru Kk | 安定な1α−ヒドロキシビタミンD類製剤 |
| JPH0749435B2 (ja) * | 1988-07-04 | 1995-05-31 | 帝人株式会社 | 1α,3β,24−トリヒドロキシ−△▲上5▼−ステロイド類の製造方法 |
| JP2525478B2 (ja) * | 1989-03-01 | 1996-08-21 | 帝人株式会社 | 安定性の改良された活性型ビタミンd▲下3▼類固型製剤 |
| AU666529B2 (en) * | 1992-04-24 | 1996-02-15 | Wisconsin Alumni Research Foundation | Method of treating osteoporosis with 1 alpha, 24 (R)-dihydroxy-22 (E)-dehydro-vitamin D3 |
| KR960013798B1 (ko) * | 1992-04-24 | 1996-10-10 | 재단법인 한국전자통신연구소 | 평면 도파로형 공간 스위치 |
| US5194431A (en) | 1992-07-08 | 1993-03-16 | Wisconsin Alumni Research Foundation | 24-cyclopropane vitamin D derivatives |
| US7148211B2 (en) * | 2002-09-18 | 2006-12-12 | Genzyme Corporation | Formulation for lipophilic agents |
| EP1719513A4 (en) * | 2004-02-18 | 2009-05-13 | Mercian Corp | METHOD FOR THE PREVENTION, MEDICATION AND / OR TREATMENT OF HYPOKALZEMIA IN PETS |
| CN115785182B (zh) * | 2022-11-29 | 2024-06-21 | 浙江工业大学 | 一种1α-羟基胆固醇的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3697559A (en) * | 1971-02-25 | 1972-10-10 | Wisconsin Alumni Res Found | 1,25-dihydroxycholecalciferol |
| US3741996A (en) * | 1971-12-02 | 1973-06-26 | Wisconsin Alumni Res Found | 1{60 -hydroxycholecalciferol |
-
1973
- 1973-05-21 US US362339A patent/US3901928A/en not_active Expired - Lifetime
-
1974
- 1974-01-09 ES ES422140A patent/ES422140A1/es not_active Expired
- 1974-01-09 DE DE2400931A patent/DE2400931A1/de active Granted
- 1974-01-09 SE SE7400279A patent/SE419981B/xx not_active IP Right Cessation
- 1974-01-09 NL NLAANVRAGE7400282,A patent/NL187010C/xx not_active IP Right Cessation
- 1974-01-09 DK DK009474A patent/DK158786C/da active
- 1974-01-09 JP JP49005853A patent/JPS5745740B2/ja not_active Expired
- 1974-01-09 LU LU69133A patent/LU69133A1/xx unknown
- 1974-01-09 PH PH15398A patent/PH14419A/en unknown
- 1974-01-09 FR FR7400670A patent/FR2213053B1/fr not_active Expired
- 1974-01-09 AR AR251874A patent/AR213608A1/es active
- 1974-01-09 CA CA189,779A patent/CA1055011A/en not_active Expired
- 1974-01-09 BE BE139675A patent/BE809578A/xx not_active IP Right Cessation
- 1974-01-09 CH CH24374A patent/CH603571A5/xx not_active IP Right Cessation
- 1974-01-09 DE DE2463203A patent/DE2463203C2/de not_active Expired
- 1974-01-09 IE IE53/74A patent/IE40496B1/xx unknown
- 1974-01-10 GB GB125774A patent/GB1463985A/en not_active Expired
- 1974-08-30 JP JP49099837A patent/JPS581116B2/ja not_active Expired
- 1974-08-30 JP JP49099836A patent/JPS50100216A/ja active Pending
-
1976
- 1976-02-21 JP JP51017502A patent/JPS5854160B2/ja not_active Expired
-
1988
- 1988-12-30 MY MYPI88001592A patent/MY104375A/en unknown
-
1989
- 1989-10-05 SG SG683/89A patent/SG68389G/en unknown
- 1989-12-14 HK HK985/89A patent/HK98589A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| J. FRIED u. J.A. EDWARDS, Organic Reactions in Steroid Chemistry, Vol. 1, 1972, S.32 u. 38 * |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5854160B2 (ja) | 1983-12-02 |
| ES422140A1 (es) | 1976-08-01 |
| GB1463985A (en) | 1977-02-09 |
| JPS4995956A (enExample) | 1974-09-11 |
| BE809578A (fr) | 1974-07-09 |
| DE2400931C2 (enExample) | 1987-10-29 |
| JPS50100045A (enExample) | 1975-08-08 |
| SE419981B (sv) | 1981-09-07 |
| AU6434974A (en) | 1975-07-10 |
| DK158786C (da) | 1990-11-26 |
| IE40496B1 (en) | 1979-06-20 |
| JPS5745740B2 (enExample) | 1982-09-29 |
| FR2213053B1 (enExample) | 1976-12-10 |
| NL187010B (nl) | 1990-12-03 |
| JPS581116B2 (ja) | 1983-01-10 |
| LU69133A1 (enExample) | 1974-04-02 |
| AR213608A1 (es) | 1979-02-28 |
| DE2400931A1 (de) | 1974-07-25 |
| JPS50100216A (enExample) | 1975-08-08 |
| MY104375A (en) | 1994-03-31 |
| IE40496L (en) | 1974-07-10 |
| CH603571A5 (enExample) | 1978-08-31 |
| HK98589A (en) | 1989-12-22 |
| NL187010C (nl) | 1993-12-16 |
| NL7400282A (enExample) | 1974-07-12 |
| PH14419A (en) | 1981-07-10 |
| JPS51110554A (enExample) | 1976-09-30 |
| CA1055011A (en) | 1979-05-22 |
| FR2213053A1 (enExample) | 1974-08-02 |
| DK158786B (da) | 1990-07-16 |
| SG68389G (en) | 1990-01-26 |
| US3901928A (en) | 1975-08-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2463203C2 (enExample) | ||
| DE2035738A1 (de) | Neue Androstandenvate und Verfahren zu ihrer Herstellung | |
| DE3005736A1 (de) | Vitamin d tief 3 -derivate, verfahren zu ihrer herstellung und ihre verwendung als arzneistoffe | |
| EP0572489B1 (de) | Ausgangsverbindungen zur herstellung von calcitriol sowie dessen abkömmlingen, verfahren zur herstellung dieser ausgangsverbindungen sowie zwischenprodukte für dieses verfahren | |
| DE2535308C2 (de) | 1α, 2α-Dihydroxycholecalciferol, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE3321826A1 (de) | 13(alpha)-alkylgonane, deren herstellung und diese enthaltende pharmazeutische praeparate | |
| DE3153427C2 (enExample) | ||
| DE69215125T2 (de) | Kardioaktive Steroide | |
| DE69005709T2 (de) | Adduktaldehyd und seine Anwendung in der Herstellung von Vitamin-D-Derivaten. | |
| DE4239946C2 (de) | Estranderivate mit einer 14alpha,15alpha-Methylengruppe und Verfahren zu ihrer Herstellung | |
| DE2617295C2 (de) | Verfahren zur Herstellung von Spiroverbindungen der Steroidreihe | |
| DE68919887T2 (de) | Verfahren zur Herstellung von 1-alpha,25-dihydroxy-vitamin D2 und dessen 24-Epimer. | |
| DE69327050T2 (de) | Reinigung von 5-7-dien-steroiden von einem steringemisch | |
| CH498819A (de) | Verfahren zur Herstellung von Steroidketonen mit 17- oder 17a-Halogenalkinylgruppen | |
| DE3426771C2 (de) | 13alpha-Methylgonane, deren Herstellung und Verwendung | |
| WO1993021204A1 (en) | Method for preparing cholesta-5,7-diene-3-beta,25-diol and analogs thereof | |
| EP0308365A1 (de) | 7Alpha-Substituierte 3-Oxo-17alpha-pregn-4-en-21.17-carbolactone, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1668665C (de) | Verfahren zur Herstellung von 13-Alky 1-gona-1,3,5( 10)-trienen. Ausscheidung aus: 1443123 | |
| DE1793659C3 (de) | Gonan-Derivate | |
| DE2754759A1 (de) | 3alpha-hydroxy-5beta-cholest-24-en- verbindungen und verfahren zu ihrer herstellung | |
| Kinnear et al. | Insect moulting hormones: the synthesis of ecdysone analogues from a bile acid | |
| DE3712586C2 (enExample) | ||
| DE1468900C (de) | Verfahren zur Entbromierung von 9 alpha Brom 1 lbeta hydroxy bzw 1 lbeta fluor steroiden oder 5alpha Brom 6beta hydroxy steroiden | |
| CH495343A (de) | Verfahren zur Herstellung von 13,14-Dehydro-Steroiden | |
| DE1568134C3 (de) | 17 alpha -Alka-1', 3-dlinylsteroide und averfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| Q172 | Divided out of (supplement): |
Ref country code: DE Ref document number: 2400931 |
|
| 8110 | Request for examination paragraph 44 | ||
| AC | Divided out of |
Ref country code: DE Ref document number: 2400931 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8380 | Miscellaneous part iii |
Free format text: SEITE 2, ZEILE 7 "ABWESENHEIT" AENDERN IN "ANWESENHEIT" |
|
| AC | Divided out of |
Ref country code: DE Ref document number: 2400931 Format of ref document f/p: P |
|
| 8364 | No opposition during term of opposition |