DE2458968C2 - Flammhemmende Polycarbonatzusammensetzung - Google Patents
Flammhemmende PolycarbonatzusammensetzungInfo
- Publication number
- DE2458968C2 DE2458968C2 DE2458968A DE2458968A DE2458968C2 DE 2458968 C2 DE2458968 C2 DE 2458968C2 DE 2458968 A DE2458968 A DE 2458968A DE 2458968 A DE2458968 A DE 2458968A DE 2458968 C2 DE2458968 C2 DE 2458968C2
- Authority
- DE
- Germany
- Prior art keywords
- integer
- radical
- composition according
- weight
- polycarbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 49
- 239000004417 polycarbonate Substances 0.000 title claims description 49
- 239000000203 mixture Substances 0.000 title claims description 44
- 239000003063 flame retardant Substances 0.000 title claims description 27
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title claims description 22
- 239000000654 additive Substances 0.000 claims description 45
- -1 alkaline earth metal sulfonates Chemical class 0.000 claims description 33
- 125000003118 aryl group Chemical group 0.000 claims description 30
- 230000000996 additive effect Effects 0.000 claims description 28
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 16
- 239000011734 sodium Substances 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 15
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 10
- 229910052708 sodium Inorganic materials 0.000 claims description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 6
- 229940106691 bisphenol a Drugs 0.000 claims description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000002070 alkenylidene group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000001118 alkylidene group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- ULOZDEVJRTYKFE-UHFFFAOYSA-N diphenyl oxalate Chemical compound C=1C=CC=CC=1OC(=O)C(=O)OC1=CC=CC=C1 ULOZDEVJRTYKFE-UHFFFAOYSA-N 0.000 claims description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims 2
- 125000000732 arylene group Chemical group 0.000 claims 2
- 238000012360 testing method Methods 0.000 description 18
- 229910052751 metal Inorganic materials 0.000 description 10
- 239000002184 metal Substances 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 150000002989 phenols Chemical class 0.000 description 7
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Chemical class 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 150000003460 sulfonic acids Chemical class 0.000 description 4
- LEDKKDPOPIKMSZ-UHFFFAOYSA-M 2,4,5-trichlorobenzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl LEDKKDPOPIKMSZ-UHFFFAOYSA-M 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical class [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 229910052788 barium Chemical class 0.000 description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical class [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Chemical class 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 238000006277 sulfonation reaction Methods 0.000 description 3
- 125000000542 sulfonic acid group Chemical group 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical class [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical class [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical class [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YCICLRBTJMLLGG-UHFFFAOYSA-L (2-chlorophenyl) phosphate Chemical compound [O-]P([O-])(=O)OC1=CC=CC=C1Cl YCICLRBTJMLLGG-UHFFFAOYSA-L 0.000 description 1
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical class CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- BUNNXPBXKIHAAQ-UHFFFAOYSA-N (4-chlorophenyl) hydrogen sulfate Chemical compound OS(=O)(=O)OC1=CC=C(Cl)C=C1 BUNNXPBXKIHAAQ-UHFFFAOYSA-N 0.000 description 1
- DJHWAIPYZDRNMH-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2-bromophenyl)benzene Chemical group BrC1=CC=CC=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br DJHWAIPYZDRNMH-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- XOEFRRUVOMXRCB-UHFFFAOYSA-L C1(=CC=CC=C1)C1(C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)P([O-])(=O)[O-].[Na+].[Na+] Chemical compound C1(=CC=CC=C1)C1(C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)P([O-])(=O)[O-].[Na+].[Na+] XOEFRRUVOMXRCB-UHFFFAOYSA-L 0.000 description 1
- ITVPOQVZDACQFR-YPKPFQOOSA-N C=1C=CC=CC=1OC(=O)C(/Br)=C(/Br)C(=O)OC1=CC=CC=C1 Chemical compound C=1C=CC=CC=1OC(=O)C(/Br)=C(/Br)C(=O)OC1=CC=CC=C1 ITVPOQVZDACQFR-YPKPFQOOSA-N 0.000 description 1
- IQIRHVNHXJTQQF-UHFFFAOYSA-M ClC1=C(C(=C(C(=C1C1=C(C(=O)[O-])C=CC=C1)Cl)Cl)Cl)Cl.[Na+] Chemical compound ClC1=C(C(=C(C(=C1C1=C(C(=O)[O-])C=CC=C1)Cl)Cl)Cl)Cl.[Na+] IQIRHVNHXJTQQF-UHFFFAOYSA-M 0.000 description 1
- MXLOOONOVOVPCC-UHFFFAOYSA-N ClC1=CC=C(C=C1)OC(CCC(=O)OC1=CC=C(C=C1)Cl)=O.[Na].[Na] Chemical compound ClC1=CC=C(C=C1)OC(CCC(=O)OC1=CC=C(C=C1)Cl)=O.[Na].[Na] MXLOOONOVOVPCC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SSQNAPWMQSPZRM-UHFFFAOYSA-N benzene-1,4-diol;sodium Chemical compound [Na].OC1=CC=C(O)C=C1 SSQNAPWMQSPZRM-UHFFFAOYSA-N 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical class [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical class [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-L dioxido-oxo-phenyl-$l^{5}-phosphane Chemical compound [O-]P([O-])(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-L 0.000 description 1
- ZUGPRXZCSHTXTE-UHFFFAOYSA-N diphenyl sulfate Chemical compound C=1C=CC=CC=1OS(=O)(=O)OC1=CC=CC=C1 ZUGPRXZCSHTXTE-UHFFFAOYSA-N 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920003205 poly(diphenylsiloxane) Polymers 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 150000003071 polychlorinated biphenyls Chemical group 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G64/00—Macromolecular compounds obtained by reactions forming a carbonic ester link in the main chain of the macromolecule
- C08G64/04—Aromatic polycarbonates
- C08G64/06—Aromatic polycarbonates not containing aliphatic unsaturation
- C08G64/08—Aromatic polycarbonates not containing aliphatic unsaturation containing atoms other than carbon, hydrogen or oxygen
- C08G64/081—Aromatic polycarbonates not containing aliphatic unsaturation containing atoms other than carbon, hydrogen or oxygen containing sulfur
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/429,126 US3978024A (en) | 1973-12-28 | 1973-12-28 | Flame retardant polycarbonate composition |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2458968A1 DE2458968A1 (de) | 1975-07-10 |
| DE2458968C2 true DE2458968C2 (de) | 1986-09-18 |
Family
ID=23701919
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2458968A Expired DE2458968C2 (de) | 1973-12-28 | 1974-12-13 | Flammhemmende Polycarbonatzusammensetzung |
Country Status (9)
| Country | Link |
|---|---|
| US (3) | US3978024A (enExample) |
| JP (1) | JPS5733304B2 (enExample) |
| BR (1) | BR7410914D0 (enExample) |
| CA (1) | CA1055193A (enExample) |
| DE (1) | DE2458968C2 (enExample) |
| FR (1) | FR2256213B1 (enExample) |
| GB (2) | GB1495959A (enExample) |
| IT (1) | IT1027805B (enExample) |
| NL (1) | NL174654C (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3978024A (en) * | 1973-12-28 | 1976-08-31 | General Electric Company | Flame retardant polycarbonate composition |
| US4001175A (en) * | 1975-10-29 | 1977-01-04 | General Electric Company | Flame retardant polycarbonate composition |
| US4093589A (en) * | 1977-02-03 | 1978-06-06 | General Electric Company | Non-opaque flame retardant polycarbonate composition |
| US4174359A (en) * | 1977-09-06 | 1979-11-13 | Mobay Chemical Corporation | Flame retardant polycarbonate polyblends |
| US4222910A (en) * | 1977-11-10 | 1980-09-16 | Teijin Chemicals, Ltd. | Fire-retardant polycarbonate composition |
| GB2019422B (en) * | 1978-04-20 | 1982-07-14 | Gen Electric | Flame retardant crystalline polycarbonate compositions |
| JPS55500687A (enExample) * | 1978-06-22 | 1980-09-25 | ||
| US4195156A (en) * | 1978-10-13 | 1980-03-25 | The Dow Chemical Company | Flame retardant copolycarbonates |
| DE2903100A1 (de) * | 1979-01-27 | 1980-07-31 | Gen Electric | Flammhemmende thermoplastische zusammensetzungen |
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4515937A (en) * | 1980-09-09 | 1985-05-07 | Mobay Chemical Corporation | Flame resistant sulfur-bearing copolycarbonate |
| US4535108A (en) * | 1981-02-25 | 1985-08-13 | General Electric Company | Flame retardant polycarbonate |
| US4371650A (en) * | 1981-03-26 | 1983-02-01 | General Electric Company | Flame retardant polycarbonates |
| US4506046A (en) * | 1983-05-27 | 1985-03-19 | General Electric Company | Flame retardant polycarbonate compositions |
| US4440890A (en) * | 1983-06-21 | 1984-04-03 | Union Carbide Corporation | Flame retardant poly(aryl ketone) |
| DE3334822A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Neue flammschutzmittel, ihre herstellung und ihre verwendung zur flammfestausruestung von polycarbonaten |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| EP0213466A3 (en) * | 1985-08-22 | 1987-10-07 | General Electric Company | Method for preparing sulfonated polycarbonates and their use as flame retardants |
| US4902737A (en) * | 1986-12-23 | 1990-02-20 | General Electric Company | Resin blends exhibiting improved impact properties |
| US5037889A (en) * | 1986-12-23 | 1991-08-06 | General Electric Company | Resin blends exhibiting improved impact properties |
| US5140056A (en) * | 1987-10-30 | 1992-08-18 | Bayer Aktiengesellschaft | Alkali or alkaline earth salts of sulfosuccinic acid esters as internal antistatic agents, take-off and winding aids for transparent polycarconate films |
| US5162405A (en) * | 1987-12-24 | 1992-11-10 | Elf Atochem North America, Inc. | Single-functional and mixtures of multi-functional oligomeric performance additive compositions and their uses |
| US5013777A (en) * | 1987-12-24 | 1991-05-07 | Atochem North America, Inc. | Novel single-functional and mixtures of multi-functional oligomeric performance additive compositions and their uses |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| US5276182A (en) * | 1990-07-09 | 1994-01-04 | The Dow Chemical Company | Process for preparing polyurea oligomers |
| DE4130331A1 (de) * | 1991-09-12 | 1993-03-18 | Bayer Ag | Flammwidrige polycarbonatformmassen |
| US5460807A (en) * | 1992-08-19 | 1995-10-24 | Merrell Dow Pharmaceuticals Inc. | Antiproliferative oligomers |
| EP0615533A1 (en) * | 1992-10-07 | 1994-09-21 | General Electric Company | Flame resistant thermoplastic blends having reduced drippage |
| US5384119A (en) * | 1993-08-12 | 1995-01-24 | Merrell Dow Pharmaceuticals Inc. | Method of preventing neutrophil mediated connective tissue damage |
| DE4328384A1 (de) * | 1993-08-24 | 1995-03-02 | Bayer Ag | Stabilisierte, flammwidrige Polycarbonatformmassen |
| IL112174A (en) * | 1994-01-03 | 1999-05-09 | Merrell Dow Pharma | Oligomers of polythioureas pharmaceutical compositions containing them and a process for their preparation |
| US5494997A (en) | 1994-08-01 | 1996-02-27 | General Electric Company | Preparation of by the bischloroformate process of soft segment polycarbonate |
| JP4288445B2 (ja) * | 2000-10-23 | 2009-07-01 | 信越化学工業株式会社 | 新規オニウム塩及びレジスト材料用光酸発生剤並びにレジスト材料及びパターン形成方法 |
| US6518340B1 (en) | 2001-08-07 | 2003-02-11 | General Electric Company | Polycarbonate resin compositions and articles therefrom |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| CA2560245C (en) * | 2004-03-23 | 2013-01-29 | Sony Corporation | Flame retarder, flame retardant resin composition and method of producing the flame retarder |
| US20080167440A1 (en) * | 2007-01-10 | 2008-07-10 | Pickel Deanna L | Use of copolymerizable sulfonate salts to promote char formation in polyesters and copolyesters |
| JP2009084513A (ja) * | 2007-10-02 | 2009-04-23 | Fuji Xerox Co Ltd | 難燃性化合物、難燃性粒子、樹脂組成物及び樹脂成形体 |
| KR20120089680A (ko) | 2009-10-19 | 2012-08-13 | 테이진 카세이 가부시키가이샤 | 방향족 폴리카보네이트 수지 조성물 |
| EP2497800A4 (en) | 2009-11-05 | 2013-09-04 | Teijin Chemicals Ltd | EXTRUSION-CREATED ARTICLES WITH AN AROMATIC POLYCARBONATE RESIN COMPOSITION |
| CN115403607B (zh) * | 2022-09-02 | 2023-07-28 | 铨盛聚碳科技股份有限公司 | 一种新型有机硅磺酸盐阻燃剂及其制备方法 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2141893A (en) * | 1935-08-17 | 1938-12-27 | Gen Aniline Works Inc | Trifluoromethyl-aryl-sulphonic acids and a process of preparing them |
| US2283236A (en) * | 1939-06-23 | 1942-05-19 | United Gas Improvement Co | Sulphonated derivatives of polymerized methylstyrene |
| DE962489C (de) * | 1954-02-10 | 1957-04-25 | Dehydag Gmbh | Sparbeizmittel zum Schutze von Metallen bei der Behandlung mit sauren Mitteln |
| NL99360C (enExample) * | 1956-05-21 | 1900-01-01 | ||
| US3043800A (en) * | 1956-06-02 | 1962-07-10 | Bayer Ag | High molecular weight linear alkalisoluble polycarbonates and process for their manufacture |
| US3062781A (en) * | 1958-07-02 | 1962-11-06 | Bayer Ag | Process for the production of polycarbonates |
| BE591169A (enExample) * | 1959-05-25 | |||
| US3166606A (en) * | 1960-12-28 | 1965-01-19 | Union Carbide Corp | Polycarbonate resins having improved flow properties |
| US3236808A (en) * | 1961-01-03 | 1966-02-22 | Borg Warner | Polysulfonate copolymers |
| US3374210A (en) * | 1965-09-20 | 1968-03-19 | Grefco | Sulfonated aromatic resins |
| FR1494897A (enExample) * | 1966-08-02 | 1967-09-15 | ||
| US3475372A (en) * | 1966-08-18 | 1969-10-28 | Mobay Chemical Corp | Flame resistant polycarbonates |
| US3528947A (en) * | 1968-01-03 | 1970-09-15 | Eastman Kodak Co | Dyeable polyesters containing units of an alkali metal salts of an aromatic sulfonic acid or ester thereof |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| US3576617A (en) * | 1969-11-25 | 1971-04-27 | Eugene P Di Bella | Method of promoting the growth of plants |
| US3686362A (en) * | 1970-05-22 | 1972-08-22 | Unlroyal Inc | Flame resistant composition of abs, polyarylene polysulfone and bromo-aryl compound |
| BE789458A (fr) * | 1971-09-29 | 1973-03-29 | Bayer Ag | Masses de moulage thermoplastiques ignifuges et corps moules a haute resilience |
| DE2149311A1 (de) * | 1971-10-02 | 1973-04-05 | Bayer Ag | Flammwidrige polycarbonate |
| BE790919R (fr) * | 1971-11-03 | 1973-05-03 | Bayer Ag | Polycarbonates thermoplastiques a poids moleculaire eleve de phenols |
| US3978024A (en) * | 1973-12-28 | 1976-08-31 | General Electric Company | Flame retardant polycarbonate composition |
-
1973
- 1973-12-28 US US05/429,126 patent/US3978024A/en not_active Expired - Lifetime
-
1974
- 1974-11-05 CA CA213,019A patent/CA1055193A/en not_active Expired
- 1974-12-13 DE DE2458968A patent/DE2458968C2/de not_active Expired
- 1974-12-16 GB GB54248/74A patent/GB1495959A/en not_active Expired
- 1974-12-16 GB GB14080/77A patent/GB1495960A/en not_active Expired
- 1974-12-18 JP JP14624574A patent/JPS5733304B2/ja not_active Expired
- 1974-12-19 IT IT30727/74A patent/IT1027805B/it active
- 1974-12-20 NL NLAANVRAGE7416660,A patent/NL174654C/xx not_active IP Right Cessation
- 1974-12-27 FR FR7443091A patent/FR2256213B1/fr not_active Expired
- 1974-12-27 BR BR10914/74A patent/BR7410914D0/pt unknown
-
1975
- 1975-10-29 US US05/626,935 patent/US4073768A/en not_active Expired - Lifetime
-
1976
- 1976-07-14 US US05/705,025 patent/US4093590A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4073768A (en) | 1978-02-14 |
| NL174654B (nl) | 1984-02-16 |
| GB1495959A (en) | 1977-12-21 |
| JPS5733304B2 (enExample) | 1982-07-16 |
| GB1495960A (en) | 1977-12-21 |
| FR2256213B1 (enExample) | 1981-05-22 |
| NL174654C (nl) | 1984-07-16 |
| DE2458968A1 (de) | 1975-07-10 |
| AU7570774A (en) | 1976-05-27 |
| CA1055193A (en) | 1979-05-22 |
| US3978024A (en) | 1976-08-31 |
| BR7410914D0 (pt) | 1975-09-02 |
| NL7416660A (nl) | 1975-07-01 |
| FR2256213A1 (enExample) | 1975-07-25 |
| IT1027805B (it) | 1978-12-20 |
| JPS5098544A (enExample) | 1975-08-05 |
| US4093590A (en) | 1978-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2458968C2 (de) | Flammhemmende Polycarbonatzusammensetzung | |
| DE2461063C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461077C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461146C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2458527C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2460937C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2460786C2 (de) | Flammhemmende aromatische Polycarbonatzusammensetzung | |
| DE2461144A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2461145A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2535261A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460787A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2848859C2 (de) | Feuerhemmende Polycarbonat-Formmasse | |
| DE2921325A1 (de) | Flammabweisende aromatische polycarbonatmassen | |
| DE2535262A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2948439A1 (de) | Durchscheinende, flammhemmende polycarbonatzusammensetzung | |
| DE2829256A1 (de) | Polycarbonate mit uv-licht-vernetzbaren doppelbindungen enthaltenden endgruppen | |
| DE2631755A1 (de) | Neue, flammhemmende polycarbonat- zusammensetzungen | |
| DE2148598A1 (de) | Flammfeste thermoplastische formmassen und formkoerper mit hoher schlagzaehigkeit | |
| DE2460788A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE3002792A1 (de) | Flammhemmende zusammensetzung aus polyphenylenether, polystyrolharz und polyphosphonat | |
| DE2460935A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460945A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2460946A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| DE2744018A1 (de) | Verbesserte, nicht opake, flammhemmende polycarbonat-zusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8330 | Complete disclaimer |