DE2450086C3 - Verfahren zur Herstellung von Resorcinen aus δ -Ketocarbonsäuren oder ihren Lactonen - Google Patents
Verfahren zur Herstellung von Resorcinen aus δ -Ketocarbonsäuren oder ihren LactonenInfo
- Publication number
- DE2450086C3 DE2450086C3 DE2450086A DE2450086A DE2450086C3 DE 2450086 C3 DE2450086 C3 DE 2450086C3 DE 2450086 A DE2450086 A DE 2450086A DE 2450086 A DE2450086 A DE 2450086A DE 2450086 C3 DE2450086 C3 DE 2450086C3
- Authority
- DE
- Germany
- Prior art keywords
- weight
- catalyst
- acid
- resorcinol
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 10
- 150000007513 acids Chemical class 0.000 title description 7
- 150000002596 lactones Chemical class 0.000 title description 4
- 238000002360 preparation method Methods 0.000 title description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 description 28
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 27
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- MGTZCLMLSSAXLD-UHFFFAOYSA-N 5-oxohexanoic acid Chemical compound CC(=O)CCCC(O)=O MGTZCLMLSSAXLD-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- OILAIQUEIWYQPH-UHFFFAOYSA-N cyclohexane-1,2-dione Chemical class O=C1CCCCC1=O OILAIQUEIWYQPH-UHFFFAOYSA-N 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 6
- -1 Cyclododecyl Chemical group 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000006356 dehydrogenation reaction Methods 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229910001868 water Inorganic materials 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 101150003085 Pdcl gene Proteins 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 239000012159 carrier gas Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052596 spinel Inorganic materials 0.000 description 2
- 239000011029 spinel Substances 0.000 description 2
- 229910052566 spinel group Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VGBAYGFELCUXBS-UHFFFAOYSA-N 1,4-dioxane-2-carboxylic acid Chemical compound OC(=O)C1COCCO1 VGBAYGFELCUXBS-UHFFFAOYSA-N 0.000 description 1
- DGXAGETVRDOQFP-UHFFFAOYSA-N 2,6-dihydroxybenzaldehyde Chemical compound OC1=CC=CC(O)=C1C=O DGXAGETVRDOQFP-UHFFFAOYSA-N 0.000 description 1
- AWFAJMHWCSGTSU-UHFFFAOYSA-N 3-methyl-5-oxohexanoic acid Chemical compound CC(=O)CC(C)CC(O)=O AWFAJMHWCSGTSU-UHFFFAOYSA-N 0.000 description 1
- DXRHILRVPALASN-UHFFFAOYSA-N 4-acetyldecanoic acid Chemical compound CCCCCCC(C(C)=O)CCC(O)=O DXRHILRVPALASN-UHFFFAOYSA-N 0.000 description 1
- SMBCWMTWMXZVCO-UHFFFAOYSA-N 4-acetylheptanoic acid Chemical compound CCCC(C(C)=O)CCC(O)=O SMBCWMTWMXZVCO-UHFFFAOYSA-N 0.000 description 1
- ATZUKYPZQBNCLS-UHFFFAOYSA-N 4-methyl-5-oxoheptanoic acid Chemical compound CCC(=O)C(C)CCC(O)=O ATZUKYPZQBNCLS-UHFFFAOYSA-N 0.000 description 1
- IOLZRTYKQAFXFB-UHFFFAOYSA-N 4-n-valeryl butyric acid Chemical compound CCCCC(=O)CCCC(O)=O IOLZRTYKQAFXFB-UHFFFAOYSA-N 0.000 description 1
- PHADZMIQVBXNAW-UHFFFAOYSA-N 4-propionyl butyric acid Chemical compound CCC(=O)CCCC(O)=O PHADZMIQVBXNAW-UHFFFAOYSA-N 0.000 description 1
- DOSOPEZOHKMQPJ-UHFFFAOYSA-N 6-methyl-3,4-dihydropyran-2-one Chemical compound CC1=CCCC(=O)O1 DOSOPEZOHKMQPJ-UHFFFAOYSA-N 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910000611 Zinc aluminium Inorganic materials 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- HXFVOUUOTHJFPX-UHFFFAOYSA-N alumane;zinc Chemical compound [AlH3].[Zn] HXFVOUUOTHJFPX-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- ILRRQNADMUWWFW-UHFFFAOYSA-K aluminium phosphate Chemical compound O1[Al]2OP1(=O)O2 ILRRQNADMUWWFW-UHFFFAOYSA-K 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- YZYDPPZYDIRSJT-UHFFFAOYSA-K boron phosphate Chemical compound [B+3].[O-]P([O-])([O-])=O YZYDPPZYDIRSJT-UHFFFAOYSA-K 0.000 description 1
- 229910000149 boron phosphate Inorganic materials 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical group CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D315/00—Heterocyclic compounds containing rings having one oxygen atom as the only ring hetero atom according to more than one of groups C07D303/00 - C07D313/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/455—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation with carboxylic acids or their derivatives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2450086A DE2450086C3 (de) | 1974-10-22 | 1974-10-22 | Verfahren zur Herstellung von Resorcinen aus δ -Ketocarbonsäuren oder ihren Lactonen |
| CH1353975A CH598168A5 (https=) | 1974-10-22 | 1975-10-17 | |
| NL7512222A NL7512222A (nl) | 1974-10-22 | 1975-10-17 | Werkwijze voor het bereiden van resorcinolen uit delta-ketocarbonzuren of hun lactonen. |
| ZA00756604A ZA756604B (en) | 1974-10-22 | 1975-10-20 | Preparing resorcinols from delta-ketocarboylic acids or from their lactones |
| IT28458/75A IT1043497B (it) | 1974-10-22 | 1975-10-20 | Preparazione di resorcine da acidi delta chetocarbossilicioppure lo ro lattoni |
| US05/624,290 US4018833A (en) | 1974-10-22 | 1975-10-20 | Preparing resorcinols from δ-ketocarboxylic acids or from their lactones |
| GB42916/75A GB1521707A (en) | 1974-10-22 | 1975-10-20 | Process for preparing resorcinols |
| JP50125988A JPS5953250B2 (ja) | 1974-10-22 | 1975-10-21 | δ−ケトカルボン酸又はそのラクトンからのレゾルシン類の製法 |
| CA238,090A CA1069938A (en) | 1974-10-22 | 1975-10-21 | PREPARING RESORCINOLS FROM .delta.-KETOCARBOXYLIC ACIDS OR FROM THEIR LACTONES |
| BR7506872*A BR7506872A (pt) | 1974-10-22 | 1975-10-21 | Processo para obtencao de resorcinois |
| BE161148A BE834752A (fr) | 1974-10-22 | 1975-10-22 | Preparation de resorcinols a partir d'acides delta-ceiocarboxyliques ou de leurs laciones |
| FR7532284A FR2288724A1 (fr) | 1974-10-22 | 1975-10-22 | Preparation de resorcinols a partir d'acides d-cetocarboxyliques ou de leurs lactones |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2450086A DE2450086C3 (de) | 1974-10-22 | 1974-10-22 | Verfahren zur Herstellung von Resorcinen aus δ -Ketocarbonsäuren oder ihren Lactonen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2450086A1 DE2450086A1 (de) | 1976-04-29 |
| DE2450086B2 DE2450086B2 (de) | 1980-12-04 |
| DE2450086C3 true DE2450086C3 (de) | 1981-10-08 |
Family
ID=5928832
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2450086A Expired DE2450086C3 (de) | 1974-10-22 | 1974-10-22 | Verfahren zur Herstellung von Resorcinen aus δ -Ketocarbonsäuren oder ihren Lactonen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4018833A (https=) |
| JP (1) | JPS5953250B2 (https=) |
| BE (1) | BE834752A (https=) |
| BR (1) | BR7506872A (https=) |
| CA (1) | CA1069938A (https=) |
| CH (1) | CH598168A5 (https=) |
| DE (1) | DE2450086C3 (https=) |
| FR (1) | FR2288724A1 (https=) |
| GB (1) | GB1521707A (https=) |
| IT (1) | IT1043497B (https=) |
| NL (1) | NL7512222A (https=) |
| ZA (1) | ZA756604B (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7612281A (nl) * | 1976-11-05 | 1978-05-09 | Stamicarbon | Werkwijze voor de bereiding van resorcinol en alkylgesubstitueerde derivaten hiervan. |
| DE2825073A1 (de) * | 1978-06-08 | 1979-12-20 | Hoechst Ag | Verfahren zur herstellung von resorcinen aus delta-ketocarbonsaeureestern |
| NL7905024A (nl) * | 1979-06-28 | 1980-12-30 | Stamicarbon | Werkwijze voor de bereiding van, eventueel alkyl- -gesubstitueerd, resorcinol en daarbij te gebruiken katalysator. |
| EP0065708A3 (de) * | 1981-05-21 | 1983-01-26 | Lonza Ag | Verfahren zur Herstellung von Dimedon |
| US4399310A (en) * | 1981-09-18 | 1983-08-16 | Koppers Company, Inc. | Preparation of 1,3-cyclic diones by vapor phase cyclization of delta-keto carboxylic acid esters utilizing carrier condensable under ambient conditions |
| US4431848A (en) * | 1982-04-26 | 1984-02-14 | Koppers Company, Inc. | Preparation of resorcinol and substituted resorcinols by liquid-phase dehydrogenation of 1,3-cyclic diones derived by vapor-phase cyclization of delta-keto carboxylic acid esters |
| DE3314372A1 (de) * | 1983-04-20 | 1984-10-25 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von substituierten phenolen |
| US5233095A (en) * | 1986-03-18 | 1993-08-03 | Catalytica, Inc. | Process for manufacture of resorcinol |
| US4861921A (en) * | 1986-03-18 | 1989-08-29 | Catalytica Associates | Process for manufacture of resorcinol |
| JPH07107003B2 (ja) * | 1986-10-16 | 1995-11-15 | 三菱瓦斯化学株式会社 | 2,3,5−トリメチルハイドロキノンの製造方法 |
| US5120884A (en) * | 1991-02-14 | 1992-06-09 | The Dow Chemical Company | Preparation of hydroxy arylcyclobutenes |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2261751C3 (de) * | 1972-12-16 | 1981-12-24 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Cyclohexandionen-(1,3) |
| NL174940C (nl) * | 1973-03-14 | 1984-09-03 | Stamicarbon | Werkwijze voor de bereiding van cyclohexaan-1,3-dion en alkylgesubstitueerde derivaten hiervan. |
| NL174939C (nl) * | 1973-03-14 | 1984-09-03 | Stamicarbon | Werkwijze voor de bereiding van resorcinol en alkylgesubstitueerde derivaten hiervan. |
| US3931322A (en) * | 1974-01-25 | 1976-01-06 | Hoffmann-La Roche Inc. | Synthesis of 2-alkyl-cyclopentan-1,3-diones |
-
1974
- 1974-10-22 DE DE2450086A patent/DE2450086C3/de not_active Expired
-
1975
- 1975-10-17 NL NL7512222A patent/NL7512222A/xx not_active Application Discontinuation
- 1975-10-17 CH CH1353975A patent/CH598168A5/xx not_active IP Right Cessation
- 1975-10-20 ZA ZA00756604A patent/ZA756604B/xx unknown
- 1975-10-20 US US05/624,290 patent/US4018833A/en not_active Expired - Lifetime
- 1975-10-20 GB GB42916/75A patent/GB1521707A/en not_active Expired
- 1975-10-20 IT IT28458/75A patent/IT1043497B/it active
- 1975-10-21 JP JP50125988A patent/JPS5953250B2/ja not_active Expired
- 1975-10-21 CA CA238,090A patent/CA1069938A/en not_active Expired
- 1975-10-21 BR BR7506872*A patent/BR7506872A/pt unknown
- 1975-10-22 FR FR7532284A patent/FR2288724A1/fr active Granted
- 1975-10-22 BE BE161148A patent/BE834752A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1043497B (it) | 1980-02-20 |
| JPS5953250B2 (ja) | 1984-12-24 |
| BR7506872A (pt) | 1976-08-17 |
| DE2450086A1 (de) | 1976-04-29 |
| JPS5165724A (en) | 1976-06-07 |
| DE2450086B2 (de) | 1980-12-04 |
| GB1521707A (en) | 1978-08-16 |
| CA1069938A (en) | 1980-01-15 |
| US4018833A (en) | 1977-04-19 |
| FR2288724A1 (fr) | 1976-05-21 |
| CH598168A5 (https=) | 1978-04-28 |
| ZA756604B (en) | 1976-09-29 |
| BE834752A (fr) | 1976-04-22 |
| FR2288724B1 (https=) | 1979-01-05 |
| NL7512222A (nl) | 1976-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2450086C3 (de) | Verfahren zur Herstellung von Resorcinen aus δ -Ketocarbonsäuren oder ihren Lactonen | |
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| DE2533920C2 (de) | Verfahren zur Herstellung von Resorcinen | |
| DE2605107B2 (de) | Verfahren zur Herstellung von Diolen durch katalytische Hydrierung entsprechenden Dikarbonsäure | |
| DE2448677C3 (de) | Verfahren zur Herstellung von Cyclohexan-13-dionen bzw. 6-Alkyl-3, 4-dihydro-2-pyranonen | |
| DE2411530C2 (de) | (3-Methyl-2-butenyl)-(3-methyl-1,3-butadienyl)-äther, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE3030463C2 (de) | Verfahren zur Herstellung einer aromatischen Polycarbonsäure | |
| DE2155495A1 (de) | Verfahren zur herstellung von benzylidenverbindungen | |
| DE2517859C3 (de) | Verfahren zur Herstellung von 2-Methyl-1-buten-4-al | |
| DE3048690A1 (de) | Katalysator zur dehydrierung von sauerstoffhaltigen derivaten der cyclohexanreihe zu den entsprechenden cyclischen ketonen und/oder phenolen und verfahren zur dehydrierung von sauerstoffhaltigen derivaten der cyclohexanreihe zu den entsprechenden cyclischen ketonen und/oder phenolen unter verwendung des genannten katalysators | |
| DE2144920B2 (de) | Verfahren zur herstellung von p- toluylsaeure und monomethylterphthalat | |
| DE2150132C3 (de) | Verfahren zur Herstellung gesättigter, aliphatischer Monocarbonsäuren mit 5 bis 14 C-Atomen | |
| EP0130533B1 (de) | Verfahren zur Herstellung eines Glyoxylsäureesters | |
| DE2616583A1 (de) | Verfahren zum acylieren nicht- hydroxylierter aromatischer verbindungen | |
| DE2437983C3 (de) | Verfahren zur Herstellung von Resorcinen | |
| DE2804417C2 (de) | Verfahren zur Herstellung von Anthrachinon | |
| DE1468516B2 (de) | Verfahren zur herstellung von acryl- oder methacrylsaeuremethylbzw. aethylestern | |
| DE2844638C2 (de) | Verfahren zur Herstellung von Di-n- propylessigsäure | |
| DE2737511A1 (de) | Verfahren zur herstellung von ketonen | |
| DE2248525A1 (de) | Verfahren zur decarboxylierung von ortho- oder para-hydroxyarylcarbonsaeuren | |
| DE2513779B2 (de) | Verfahren zur Herstellung von substituierten Dibenzofuranen bzw. Fluorenonen | |
| DE19639569A1 (de) | Verfahren zur Herstellung von beta-Isophoron durch Isomerisierung von alpha-Isophoron (I) | |
| DE3701304A1 (de) | Verfahren zur oxidehydrierung von polyglykolmonoethern zu den entsprechenden aldehyden | |
| AT353775B (de) | Verfahren zur herstellung von hydrochinon- dimethylaether | |
| DE2930222A1 (de) | Verfahren zur herstellung von aromatischen hydroxy- und alkoxyaldehyden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |