DE2433067B2 - Alpha- eckige klammer auf 4-(4' trifluormethylphenoxy)-phenoxy eckige klammer zu -propionsaeuren und deren derivate, verfahren zu ihrer herstellung und diese enthaltende herbizide mittel - Google Patents
Alpha- eckige klammer auf 4-(4' trifluormethylphenoxy)-phenoxy eckige klammer zu -propionsaeuren und deren derivate, verfahren zu ihrer herstellung und diese enthaltende herbizide mittelInfo
- Publication number
- DE2433067B2 DE2433067B2 DE19742433067 DE2433067A DE2433067B2 DE 2433067 B2 DE2433067 B2 DE 2433067B2 DE 19742433067 DE19742433067 DE 19742433067 DE 2433067 A DE2433067 A DE 2433067A DE 2433067 B2 DE2433067 B2 DE 2433067B2
- Authority
- DE
- Germany
- Prior art keywords
- phenoxy
- square brackets
- acid
- derivatives
- weeds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000004672 propanoic acids Chemical class 0.000 title claims 2
- 239000004009 herbicide Substances 0.000 title description 10
- -1 4- (4 'TRIFLUORMETHYLPHENOXY) -PHENOXY Chemical class 0.000 title description 7
- 238000000034 method Methods 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
- 235000019260 propionic acid Nutrition 0.000 claims description 4
- 241000196324 Embryophyta Species 0.000 description 31
- 239000000126 substance Substances 0.000 description 31
- 239000004480 active ingredient Substances 0.000 description 21
- 238000002360 preparation method Methods 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 241001148683 Zostera marina Species 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 12
- 230000000694 effects Effects 0.000 description 11
- 125000001309 chloro group Chemical group Cl* 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 235000007320 Avena fatua Nutrition 0.000 description 8
- 244000075850 Avena orientalis Species 0.000 description 8
- 244000062793 Sorghum vulgare Species 0.000 description 8
- 235000019713 millet Nutrition 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 241000209504 Poaceae Species 0.000 description 7
- 240000001592 Amaranthus caudatus Species 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 240000007594 Oryza sativa Species 0.000 description 6
- 235000007164 Oryza sativa Nutrition 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 230000002363 herbicidal effect Effects 0.000 description 6
- 235000009566 rice Nutrition 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 5
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- UMKANAFDOQQUKE-UHFFFAOYSA-N Nitralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(C)(=O)=O)C=C1[N+]([O-])=O UMKANAFDOQQUKE-UHFFFAOYSA-N 0.000 description 5
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 5
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 241000743985 Alopecurus Species 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241000192043 Echinochloa Species 0.000 description 4
- 241000508725 Elymus repens Species 0.000 description 4
- 235000010469 Glycine max Nutrition 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- 244000299507 Gossypium hirsutum Species 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000005625 Tri-allate Substances 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 230000006378 damage Effects 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 244000105624 Arachis hypogaea Species 0.000 description 3
- 235000005781 Avena Nutrition 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000287828 Gallus gallus Species 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 241000209082 Lolium Species 0.000 description 3
- 235000005775 Setaria Nutrition 0.000 description 3
- 241000232088 Setaria <nematode> Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 244000098338 Triticum aestivum Species 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 235000005489 dwarf bean Nutrition 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000003337 fertilizer Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 235000020232 peanut Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 235000017060 Arachis glabrata Nutrition 0.000 description 2
- 235000010777 Arachis hypogaea Nutrition 0.000 description 2
- 235000018262 Arachis monticola Nutrition 0.000 description 2
- 240000002791 Brassica napus Species 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- YJKIALIXRCSISK-UHFFFAOYSA-N Chlorfenprop-methyl Chemical group COC(=O)C(Cl)CC1=CC=C(Cl)C=C1 YJKIALIXRCSISK-UHFFFAOYSA-N 0.000 description 2
- 241000251730 Chondrichthyes Species 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 2
- 244000052363 Cynodon dactylon Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 241000209510 Liliopsida Species 0.000 description 2
- 235000004431 Linum usitatissimum Nutrition 0.000 description 2
- 240000006240 Linum usitatissimum Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 240000004658 Medicago sativa Species 0.000 description 2
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 2
- 244000061176 Nicotiana tabacum Species 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- 240000004713 Pisum sativum Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 235000009337 Spinacia oleracea Nutrition 0.000 description 2
- 244000300264 Spinacia oleracea Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000015724 Trifolium pratense Nutrition 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 235000002096 Vicia faba var. equina Nutrition 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000003931 anilides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 230000000254 damaging effect Effects 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 244000013123 dwarf bean Species 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003630 growth substance Substances 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 235000013526 red clover Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- JACPTQMMZGZAOL-KHPPLWFESA-N 2-[methyl-[(z)-octadec-9-enyl]amino]ethanesulfonic acid Chemical compound CCCCCCCC\C=C/CCCCCCCCN(C)CCS(O)(=O)=O JACPTQMMZGZAOL-KHPPLWFESA-N 0.000 description 1
- CZGAOXFRUAWGJI-UHFFFAOYSA-N 2-phenoxy-2-[4-(trifluoromethyl)phenoxy]propanoic acid Chemical class C=1C=C(C(F)(F)F)C=CC=1OC(C(O)=O)(C)OC1=CC=CC=C1 CZGAOXFRUAWGJI-UHFFFAOYSA-N 0.000 description 1
- KDTZBYPBMTXCSO-UHFFFAOYSA-N 2-phenoxyphenol Chemical class OC1=CC=CC=C1OC1=CC=CC=C1 KDTZBYPBMTXCSO-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- ZSBDGXGICLIJGD-UHFFFAOYSA-N 4-phenoxyphenol Chemical class C1=CC(O)=CC=C1OC1=CC=CC=C1 ZSBDGXGICLIJGD-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 240000007087 Apium graveolens Species 0.000 description 1
- 235000015849 Apium graveolens Dulce Group Nutrition 0.000 description 1
- 235000010591 Appio Nutrition 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 244000241235 Citrullus lanatus Species 0.000 description 1
- 235000012828 Citrullus lanatus var citroides Nutrition 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 241000371652 Curvularia clavata Species 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 241000320641 Disakisperma dubium Species 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 244000025670 Eleusine indica Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical class CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- 241001148659 Panicum dichotomiflorum Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical compound [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229940111131 antiinflammatory and antirheumatic product propionic acid derivative Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 238000003967 crop rotation Methods 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 235000021374 legumes Nutrition 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- ZTHRQJQJODGZHV-UHFFFAOYSA-N n-phenylpropanamide Chemical compound CCC(=O)NC1=CC=CC=C1 ZTHRQJQJODGZHV-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 150000005599 propionic acid derivatives Chemical class 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- IZWPGJFSBABFGL-GMFCBQQYSA-M sodium;2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS([O-])(=O)=O IZWPGJFSBABFGL-GMFCBQQYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (36)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742433067 DE2433067B2 (de) | 1974-07-10 | 1974-07-10 | Alpha- eckige klammer auf 4-(4' trifluormethylphenoxy)-phenoxy eckige klammer zu -propionsaeuren und deren derivate, verfahren zu ihrer herstellung und diese enthaltende herbizide mittel |
| ZA00754053A ZA754053B (en) | 1974-07-10 | 1975-06-25 | Herbicidal compositions |
| EG75360A EG11750A (en) | 1974-07-10 | 1975-06-25 | (4-trifluoromethyl-phenoxy)-phenoxy-propionic acids derivatives and their use as herbicides |
| RO7582720A RO68991A (ro) | 1974-07-10 | 1975-07-01 | Procedeu de obtinere a unor derivati de acid 4-fenoxi-fenoxialcancarboxilic |
| SU7502149601A SU578856A3 (ru) | 1974-07-10 | 1975-07-03 | Способ борьбы с сорной растительностью |
| IL47640A IL47640A (en) | 1974-07-10 | 1975-07-03 | Alpha(4(4'-trifluoromethyl-phenoxy)-phenoxy)propionic acid derivatives and herbicidal compositions containing same |
| NL7508016A NL7508016A (nl) | 1974-07-10 | 1975-07-04 | Werkwijze voor het bereiden van herbicide middelen alsmede voor hun toepassing. |
| ES439172A ES439172A1 (es) | 1974-07-10 | 1975-07-04 | Procedimiento para la obtencion de agentes herbicidas. |
| TR18262A TR18262A (tr) | 1974-07-10 | 1975-07-04 | Zararli bitki oeldueruecue maddeler |
| BG030473A BG24937A3 (en) | 1974-07-10 | 1975-07-05 | Herbicide means |
| CH884475A CH614601A5 (enExample) | 1974-07-10 | 1975-07-07 | |
| AT520275A AT348288B (de) | 1974-07-10 | 1975-07-07 | Herbizide mittel |
| GB28690/75A GB1519334A (en) | 1974-07-10 | 1975-07-08 | Propionic acid derivatives processes for their preparation and herbicidal compositions containing them |
| DD187159A DD121592A5 (enExample) | 1974-07-10 | 1975-07-08 | |
| SE7507833A SE7507833L (sv) | 1974-07-10 | 1975-07-08 | Herbicida medel. |
| US05/594,031 US4332960A (en) | 1974-07-10 | 1975-07-08 | Herbicidal compositions |
| LU72924A LU72924A1 (enExample) | 1974-07-10 | 1975-07-08 | |
| MW40/75A MW4075A1 (en) | 1974-07-10 | 1975-07-08 | Herbicidal compositions |
| IT25205/75A IT1039818B (it) | 1974-07-10 | 1975-07-08 | Erbicidi |
| BR5508/75D BR7504296A (pt) | 1974-07-10 | 1975-07-08 | Compostos,processo para sua preparacao,composicoes herbicidas,aplicacao dos ditos compostos,e processo para combater ervas daninhas |
| IE1528/75A IE42046B1 (en) | 1974-07-10 | 1975-07-09 | Propionic acid derivatives, processes for their preparation and herbicidal compositions containing them |
| ZM85/75A ZM8575A1 (en) | 1974-07-10 | 1975-07-09 | Herbicidal compositions |
| AU82869/75A AU495360B2 (en) | 1974-07-10 | 1975-07-09 | Herbicidal compositions |
| JP50083632A JPS6035321B2 (ja) | 1974-07-10 | 1975-07-09 | 除草剤およびその製造方法 |
| FR7521511A FR2277811A1 (fr) | 1974-07-10 | 1975-07-09 | Derives d'acides aryloxy-propioniques et produits herbicides qui en contiennent |
| YU01743/75A YU174375A (en) | 1974-07-10 | 1975-07-09 | Process for preparing (4-trifluoromethyl-phenoxy)-phenoxypropionic acid and derivatives thereof |
| NO752466A NO143939B (no) | 1974-07-10 | 1975-07-09 | Alfa-(4-(4`-trifluormetylfenoksy)-fenoksy)-propionsyrer og derivater herav for anvendelse som herbicider |
| HU75HO1818A HU176531B (en) | 1974-07-10 | 1975-07-09 | Herbicide coposition containing /4-trifluoromethyl-phenoxy/-phenoxy-propionic acid and a derivative thereof and process for preparing the active substance |
| CA000231130A CA1150294A (en) | 1974-07-10 | 1975-07-09 | Herbicidal trifluoromethylphenoxyphenoxy propionic acid derivatives |
| DK310575A DK310575A (da) | 1974-07-10 | 1975-07-09 | 4-trifluormethyl-phenoxy-phenoxypropionsyreforbindelser samt deres fremstilling og anvendelse |
| BE158168A BE831218A (fr) | 1974-07-10 | 1975-07-10 | Derives d'acides aryloxy-propioniques et produits herbicides qui en contiennent |
| AR259508A AR219048A1 (es) | 1974-07-10 | 1975-07-10 | Productos utiles como herbicidas constituidos por acidos 4-(4'-trifluormetil-fenoxi eventualmente 2'-halogeno substituido)-fenoxipropionicos y derivados funcionales de estos,procedimientos para prepararlos y composiciones que los contienen |
| CS7500004917A CS186289B2 (en) | 1974-07-10 | 1975-07-10 | Herbicidal agent and mode of manufacture of active substance |
| OA55556A OA05056A (fr) | 1974-07-10 | 1975-07-10 | Dérivés d'acides aryloxy-propioniques et produits herbicides qui en contiennent. |
| CU34303A CU34303A (es) | 1974-07-10 | 1975-07-12 | Nuevos derivados de ácido propionico fenoxifenoxi |
| SE7801047A SE7801047L (sv) | 1974-07-10 | 1978-01-27 | Anvendning av (4-trifluormetyl-fenoxi)-fenoxi-propionsyror och deras funktionella derivat for bekempande av ogres |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742433067 DE2433067B2 (de) | 1974-07-10 | 1974-07-10 | Alpha- eckige klammer auf 4-(4' trifluormethylphenoxy)-phenoxy eckige klammer zu -propionsaeuren und deren derivate, verfahren zu ihrer herstellung und diese enthaltende herbizide mittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2433067A1 DE2433067A1 (de) | 1976-01-29 |
| DE2433067B2 true DE2433067B2 (de) | 1977-11-24 |
| DE2433067C3 DE2433067C3 (enExample) | 1978-07-13 |
Family
ID=5920140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742433067 Granted DE2433067B2 (de) | 1974-07-10 | 1974-07-10 | Alpha- eckige klammer auf 4-(4' trifluormethylphenoxy)-phenoxy eckige klammer zu -propionsaeuren und deren derivate, verfahren zu ihrer herstellung und diese enthaltende herbizide mittel |
Country Status (34)
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2854542A1 (de) * | 1978-12-16 | 1980-06-19 | Hoechst Ag | Verfahren zur herstellung von optisch aktiven d-(phenoxi- bzw. benzyl)- phenoxipropionsaeuren und ihren alkalisalzen |
| DE2854492A1 (de) * | 1978-12-16 | 1980-06-19 | Hoechst Ag | Verfahren zur herstellung von (phenoxi, bzw. benzyl)-phenoxipropionsaeuren und ihren alkalisalzen |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4205978A (en) * | 1975-11-20 | 1980-06-03 | Ishihara Sangyo Kaisha, Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxyalkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
| DE2609461C2 (de) * | 1976-03-08 | 1984-11-22 | Hoechst Ag, 6230 Frankfurt | α-4-(Trifluormethylphenoxy)-phenoxy-propionsäuren und ihre Derivate, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel |
| DE2617804C2 (de) * | 1976-04-23 | 1985-01-24 | Hoechst Ag, 6230 Frankfurt | 2-(4-Phenoxy phenoxy)-propionsäurederivate und ihre Verwendung als Herbizide |
| CH624087A5 (en) * | 1976-08-25 | 1981-07-15 | Hoechst Ag | Process for the preparation of phenoxyphenoxypropionic acid derivatives |
| DE2658496A1 (de) | 1976-12-23 | 1978-06-29 | Hoechst Ag | Verfahren zur herstellung von diphenylaethern |
| CH626318A5 (enExample) * | 1977-03-08 | 1981-11-13 | Ciba Geigy Ag | |
| UA6300A1 (uk) * | 1977-07-21 | 1994-12-29 | Ісіхара Сангіо Кайся Лтд | Гербіцидний склад |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| US4200587A (en) | 1977-11-28 | 1980-04-29 | Hoffmann-La Roche Inc. | 2-[P-(p-Substituted phenoxy)phenoxy]propionyl oximes |
| US4192669A (en) * | 1977-12-22 | 1980-03-11 | E. I. Du Pont De Nemours And Company | Herbicidal ethers |
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| EP0003059B1 (de) * | 1978-01-10 | 1981-01-07 | Ciba-Geigy Ag | Herbizid wirksame 4-(p-Phenoxy-phenoxy)-alpha-propionsäure-alkoxyalkylamide, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel und deren Verwendung |
| DE2961917D1 (en) | 1978-01-18 | 1982-03-11 | Ciba Geigy Ag | Herbicidal active unsaturated esters of 4- (3',5'-dihalogenpyridyl-(2')-oxy)-alpha-phenoxy propionic acids, process for their preparation, herbicidal compositions containing them and their use |
| EP0003648A3 (en) * | 1978-02-15 | 1979-09-05 | Imperial Chemical Industries Plc | 4-aryloxy-substituted phenoxypropionamide derivatives useful as herbicides, compositions containing them, and processes for making them |
| DE2967486D1 (en) * | 1978-03-01 | 1985-08-29 | Ici Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| DE2961736D1 (en) | 1978-03-17 | 1982-02-25 | Ciba Geigy Ag | Derivatives of phenoxy-alkanecarboxylic acids, their preparation, weed-killing products containing them and their use |
| US4309210A (en) * | 1978-12-01 | 1982-01-05 | Ciba-Geigy Corporation | Preemergence method of selectively controlling weeds in crops of cereals and composition therefor |
| US4284566A (en) * | 1979-01-04 | 1981-08-18 | Ciba-Geigy Corporation | Herbicidal α-[4-trifluoromethylphenoxy)-propionic acid γ-butyrolactone ester and thioester |
| FR2446812A1 (fr) * | 1979-01-16 | 1980-08-14 | Produits Ind Cie Fse | Phenoxy- et thiophenoxynitriles et leurs applications en tant qu'herbicides |
| DK220582A (da) * | 1981-05-26 | 1982-11-27 | Hoffmann La Roche | Propionsyreamider |
| JPS5832890A (ja) * | 1981-08-21 | 1983-02-25 | Sumitomo Chem Co Ltd | ホスホン酸エステル誘導体、その製造方法およびそれを有効成分とする除草剤 |
| US4447259A (en) * | 1981-12-18 | 1984-05-08 | Hokko Chemical Industry Co., Ltd. | 2-(Substituted phenoxy)propionic acid derivatives and their uses for herbicidal purposes |
| US4460399A (en) * | 1982-01-26 | 1984-07-17 | Chevron Research Company | Diphenoxy ether formamide plant-growth regulator |
| US4808750A (en) * | 1983-09-01 | 1989-02-28 | The Dow Chemical Company | Fluorophenoxyphenoxypropionates and derivatives thereof |
| US4550192A (en) * | 1983-09-01 | 1985-10-29 | The Dow Chemical Company | Fluorophenoxyphenoxypropionates and derivatives thereof |
| US4888050A (en) * | 1983-11-10 | 1989-12-19 | The Dow Chemical Company | Fluorophenoxy compounds, herbicidal compositions and methods |
| US4640703A (en) * | 1983-12-06 | 1987-02-03 | Ciba-Geigy Corporation | 2-phenoxypropionic acid cyanamides as herbicides |
| CN1008820B (zh) * | 1985-05-10 | 1990-07-18 | 施林工业产权保护股份公司 | 17α-乙炔基-17β-羟基-18-甲基-4,15-雌甾二烯-3-酮的制备方法 |
| US4589907A (en) * | 1985-09-17 | 1986-05-20 | Stauffer Chemical Company | Amidomethyl ester herbicides |
| US4786731A (en) * | 1987-08-05 | 1988-11-22 | The Dow Chemical Company | Resolution of enantiomers of 2-(phenyl or phenoxy/propionic acids using optically active alkanolamines |
| US4786732A (en) * | 1987-08-05 | 1988-11-22 | The Dow Chemical Company | Resolution of enantiomers of 2-(4-aryloxyphenoxy) propionic acids by liquid chromatography with a chiral eluent |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| US5012017A (en) * | 1988-08-18 | 1991-04-30 | Dowelanco | Phenoxyphenoxypropionates, intermediates thereof and methods of preparation |
| DE3902439A1 (de) * | 1989-01-27 | 1990-08-02 | Basf Ag | Pflanzenschuetzende mittel auf basis von 1-aryl- bzw. 1-hetarylimidazolcarbonsaeureestern |
| DE3907938A1 (de) * | 1989-03-11 | 1990-09-13 | Basf Ag | 2,3-substituierte 1,8-naphthyridine, verfahren zu ihrer herstellung und ihre verwendung als antidots |
| DE4318092C1 (de) * | 1993-06-01 | 1995-01-12 | Basf Ag | Verfahren zur Herstellung von (R)- oder (S)-2-(4-Alkanoylphenoxy)- und (R)- oder (S)-2-(4-Aroylphenoxy)-propionsäureestern |
| EP1836894A1 (de) | 2006-03-25 | 2007-09-26 | Bayer CropScience GmbH | Neue Sulfonamid-haltige feste Formulungen |
| DE102007013362A1 (de) | 2007-03-16 | 2008-09-18 | Bayer Cropscience Ag | Penetrationsförderer für herbizide Wirkstoffe |
| EP1844654A1 (de) | 2006-03-29 | 2007-10-17 | Bayer CropScience GmbH | Penetrationsförderer für agrochemische Wirkstoffe |
| WO2011076731A1 (de) | 2009-12-23 | 2011-06-30 | Bayer Cropscience Ag | Flüssige formulierung von 2-iodo-n-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamid |
| US20130316901A1 (en) | 2011-02-15 | 2013-11-28 | Bayer Intellectual Property Gmbh | Synergistic combinations containing a dithino-tetracarboxamide fungicide and a herbicide, safener or plant growth regulator |
| DE102011080007A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Conazole- und Triazol-Fungizide als Safener |
| DE102011080016A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Strobilurin-Fungizide als Safener |
| DE102011079991A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Crop Science Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Nicotinoid-Insektizide als Safener |
| DE102011080010A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Anilid- und Thiazol-Fungizide als Safener |
| DE102011079997A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Corpscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Pyrazol-Insektizide als Safener |
| DE102011080020A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Dicarboximid-Fungizide als Safener |
| DE102011080004A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Fungizide als Safener |
| DE102011080001A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Insektizide als Safener |
| EP2908639A1 (en) | 2012-10-19 | 2015-08-26 | Bayer Cropscience AG | Active compound combinations comprising carboxamide derivatives |
-
1974
- 1974-07-10 DE DE19742433067 patent/DE2433067B2/de active Granted
-
1975
- 1975-06-25 EG EG75360A patent/EG11750A/xx active
- 1975-06-25 ZA ZA00754053A patent/ZA754053B/xx unknown
- 1975-07-01 RO RO7582720A patent/RO68991A/ro unknown
- 1975-07-03 IL IL47640A patent/IL47640A/xx unknown
- 1975-07-03 SU SU7502149601A patent/SU578856A3/ru active
- 1975-07-04 NL NL7508016A patent/NL7508016A/xx not_active Application Discontinuation
- 1975-07-04 ES ES439172A patent/ES439172A1/es not_active Expired
- 1975-07-04 TR TR18262A patent/TR18262A/xx unknown
- 1975-07-05 BG BG030473A patent/BG24937A3/xx unknown
- 1975-07-07 AT AT520275A patent/AT348288B/de not_active IP Right Cessation
- 1975-07-07 CH CH884475A patent/CH614601A5/xx not_active IP Right Cessation
- 1975-07-08 LU LU72924A patent/LU72924A1/xx unknown
- 1975-07-08 IT IT25205/75A patent/IT1039818B/it active
- 1975-07-08 MW MW40/75A patent/MW4075A1/xx unknown
- 1975-07-08 GB GB28690/75A patent/GB1519334A/en not_active Expired
- 1975-07-08 BR BR5508/75D patent/BR7504296A/pt unknown
- 1975-07-08 SE SE7507833A patent/SE7507833L/xx unknown
- 1975-07-08 US US05/594,031 patent/US4332960A/en not_active Expired - Lifetime
- 1975-07-08 DD DD187159A patent/DD121592A5/xx unknown
- 1975-07-09 IE IE1528/75A patent/IE42046B1/en unknown
- 1975-07-09 DK DK310575A patent/DK310575A/da not_active Application Discontinuation
- 1975-07-09 NO NO752466A patent/NO143939B/no unknown
- 1975-07-09 HU HU75HO1818A patent/HU176531B/hu unknown
- 1975-07-09 ZM ZM85/75A patent/ZM8575A1/xx unknown
- 1975-07-09 FR FR7521511A patent/FR2277811A1/fr active Granted
- 1975-07-09 JP JP50083632A patent/JPS6035321B2/ja not_active Expired
- 1975-07-09 YU YU01743/75A patent/YU174375A/xx unknown
- 1975-07-09 CA CA000231130A patent/CA1150294A/en not_active Expired
- 1975-07-10 OA OA55556A patent/OA05056A/xx unknown
- 1975-07-10 CS CS7500004917A patent/CS186289B2/cs unknown
- 1975-07-10 BE BE158168A patent/BE831218A/xx unknown
- 1975-07-10 AR AR259508A patent/AR219048A1/es active
- 1975-07-12 CU CU34303A patent/CU34303A/es unknown
-
1978
- 1978-01-27 SE SE7801047A patent/SE7801047L/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2854542A1 (de) * | 1978-12-16 | 1980-06-19 | Hoechst Ag | Verfahren zur herstellung von optisch aktiven d-(phenoxi- bzw. benzyl)- phenoxipropionsaeuren und ihren alkalisalzen |
| DE2854492A1 (de) * | 1978-12-16 | 1980-06-19 | Hoechst Ag | Verfahren zur herstellung von (phenoxi, bzw. benzyl)-phenoxipropionsaeuren und ihren alkalisalzen |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2433067C3 (enExample) | ||
| DE2601548C2 (de) | 2-[4-(2'-Chlor-4'-bromphenoxy)-phenoxy]-propionsäure und Derivate sowie diese enthaltende herbizide Mittel | |
| DE2223894A1 (de) | Herbizide mittel | |
| DE2617804C2 (de) | 2-(4-Phenoxy phenoxy)-propionsäurederivate und ihre Verwendung als Herbizide | |
| DE2623558C2 (de) | 2-[4'-Phenoxy-phenoxy]propionsäure-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel | |
| DE2417487A1 (de) | Herbizide mittel | |
| DE2531643A1 (de) | Herbizide verbindungen, unkrautvertilgungsmittel, worin diese enthalten sind, und verfahren zu ihrer anwendung | |
| DE2546251A1 (de) | Alpha- eckige klammer auf 4-(5- mono-substituiert- oder 3,5-disubstituiert-pyridyl-2-oxy)phenoxy eckige klammer zu alkancarbonsaeuren und ihre derivate | |
| DE2640730A1 (de) | Heterocyclische phenylaether und diese enthaltende herbizide mittel | |
| EP0003114A1 (de) | Herbizid wirksame ungesättigte Ester von 4-(3',5'-Dihalogenpyridyl -(2')-oxy)-alpha-phenoxypropionsäuren, Verfahren zu ihrer Herstellung sowie sie enthaltende herbizide Mittel und deren Verwendung | |
| DD143389A5 (de) | Herbizide zum selektiven bekaempfen von grasartigen unkraeutern | |
| DE2101938C2 (de) | 3-[2-Chlor-4-(3,3-dimethylureido)-phenyl]-5-tert.-butyl-1,3,4-oxadiazolon-(2), seine Herstellung und herbicide Zusammensetzungen, die es enthalten | |
| CH627916A5 (en) | Herbicide | |
| DE2628384A1 (de) | Herbizide und fungizide mittel | |
| DE1542943A1 (de) | Herbizide | |
| EP0007089B1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0058639B1 (de) | 2-(4-(6-Halogen-chinoxalinyl-2-oxy)-phenoxy)-propionsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide und Pflanzenwuchsregulatoren | |
| DE3533440A1 (de) | N-substituierte 3,4,5,6-tetrahydrophthalimide, verfahren zu ihrer herstellung sowie ihre verwendung im pflanzenschutz | |
| CH646941A5 (de) | N-dimethylbenzylacetamidderivate. | |
| EP0098440B1 (de) | 3,7-Dichlor-chinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| EP0072348A2 (de) | Neue Phenoxyphenyl-aminosäure-Derivate, ihre Herstellung, sie enthaltende Mittel sowie ihre Verwendung | |
| DE1618968C2 (enExample) | ||
| DE3300056C2 (de) | 3-Nitrobenzolsulfonanilid-Derivate und diese enthaltende fungizide Mittel | |
| DE1567022A1 (de) | Herbizid | |
| DE2823424A1 (de) | Dibenzofuranoxylakancarbonsaeure-derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |