EG11750A - (4-trifluoromethyl-phenoxy)-phenoxy-propionic acids derivatives and their use as herbicides - Google Patents
(4-trifluoromethyl-phenoxy)-phenoxy-propionic acids derivatives and their use as herbicidesInfo
- Publication number
- EG11750A EG11750A EG75360A EG36075A EG11750A EG 11750 A EG11750 A EG 11750A EG 75360 A EG75360 A EG 75360A EG 36075 A EG36075 A EG 36075A EG 11750 A EG11750 A EG 11750A
- Authority
- EG
- Egypt
- Prior art keywords
- phenoxy
- herbicides
- trifluoromethyl
- propionic acids
- acids derivatives
- Prior art date
Links
- CZGAOXFRUAWGJI-UHFFFAOYSA-N 2-phenoxy-2-[4-(trifluoromethyl)phenoxy]propanoic acid Chemical class C=1C=C(C(F)(F)F)C=CC=1OC(C(O)=O)(C)OC1=CC=CC=C1 CZGAOXFRUAWGJI-UHFFFAOYSA-N 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742433067 DE2433067B2 (de) | 1974-07-10 | 1974-07-10 | Alpha- eckige klammer auf 4-(4' trifluormethylphenoxy)-phenoxy eckige klammer zu -propionsaeuren und deren derivate, verfahren zu ihrer herstellung und diese enthaltende herbizide mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| EG11750A true EG11750A (en) | 1978-12-31 |
Family
ID=5920140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EG75360A EG11750A (en) | 1974-07-10 | 1975-06-25 | (4-trifluoromethyl-phenoxy)-phenoxy-propionic acids derivatives and their use as herbicides |
Country Status (34)
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4205978A (en) * | 1975-11-20 | 1980-06-03 | Ishihara Sangyo Kaisha, Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxyalkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
| DE2609461C2 (de) * | 1976-03-08 | 1984-11-22 | Hoechst Ag, 6230 Frankfurt | α-4-(Trifluormethylphenoxy)-phenoxy-propionsäuren und ihre Derivate, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel |
| DE2617804C2 (de) * | 1976-04-23 | 1985-01-24 | Hoechst Ag, 6230 Frankfurt | 2-(4-Phenoxy phenoxy)-propionsäurederivate und ihre Verwendung als Herbizide |
| CH624087A5 (en) * | 1976-08-25 | 1981-07-15 | Hoechst Ag | Process for the preparation of phenoxyphenoxypropionic acid derivatives |
| DE2658496A1 (de) | 1976-12-23 | 1978-06-29 | Hoechst Ag | Verfahren zur herstellung von diphenylaethern |
| CH626318A5 (enExample) * | 1977-03-08 | 1981-11-13 | Ciba Geigy Ag | |
| UA6300A1 (uk) * | 1977-07-21 | 1994-12-29 | Ісіхара Сангіо Кайся Лтд | Гербіцидний склад |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| US4200587A (en) | 1977-11-28 | 1980-04-29 | Hoffmann-La Roche Inc. | 2-[P-(p-Substituted phenoxy)phenoxy]propionyl oximes |
| US4192669A (en) * | 1977-12-22 | 1980-03-11 | E. I. Du Pont De Nemours And Company | Herbicidal ethers |
| CH650493A5 (en) * | 1977-12-24 | 1985-07-31 | Hoechst Ag | D-(+)-alpha-phenoxypropionic acid derivatives |
| EP0003059B1 (de) * | 1978-01-10 | 1981-01-07 | Ciba-Geigy Ag | Herbizid wirksame 4-(p-Phenoxy-phenoxy)-alpha-propionsäure-alkoxyalkylamide, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel und deren Verwendung |
| DE2961917D1 (en) | 1978-01-18 | 1982-03-11 | Ciba Geigy Ag | Herbicidal active unsaturated esters of 4- (3',5'-dihalogenpyridyl-(2')-oxy)-alpha-phenoxy propionic acids, process for their preparation, herbicidal compositions containing them and their use |
| EP0003648A3 (en) * | 1978-02-15 | 1979-09-05 | Imperial Chemical Industries Plc | 4-aryloxy-substituted phenoxypropionamide derivatives useful as herbicides, compositions containing them, and processes for making them |
| DE2967486D1 (en) * | 1978-03-01 | 1985-08-29 | Ici Plc | Mixtures of herbicidal pyridyloxyphenoxypropanoic acid derivatives with other herbicides, and processes of killing unwanted plants therewith |
| DE2961736D1 (en) | 1978-03-17 | 1982-02-25 | Ciba Geigy Ag | Derivatives of phenoxy-alkanecarboxylic acids, their preparation, weed-killing products containing them and their use |
| US4309210A (en) * | 1978-12-01 | 1982-01-05 | Ciba-Geigy Corporation | Preemergence method of selectively controlling weeds in crops of cereals and composition therefor |
| DE2854492C2 (de) * | 1978-12-16 | 1982-12-16 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von (Phenoxy- bzw. Benzyl)-phenoxypropionsäuren und ihren Alkalisalzen |
| DE2854542A1 (de) * | 1978-12-16 | 1980-06-19 | Hoechst Ag | Verfahren zur herstellung von optisch aktiven d-(phenoxi- bzw. benzyl)- phenoxipropionsaeuren und ihren alkalisalzen |
| US4284566A (en) * | 1979-01-04 | 1981-08-18 | Ciba-Geigy Corporation | Herbicidal α-[4-trifluoromethylphenoxy)-propionic acid γ-butyrolactone ester and thioester |
| FR2446812A1 (fr) * | 1979-01-16 | 1980-08-14 | Produits Ind Cie Fse | Phenoxy- et thiophenoxynitriles et leurs applications en tant qu'herbicides |
| DK220582A (da) * | 1981-05-26 | 1982-11-27 | Hoffmann La Roche | Propionsyreamider |
| JPS5832890A (ja) * | 1981-08-21 | 1983-02-25 | Sumitomo Chem Co Ltd | ホスホン酸エステル誘導体、その製造方法およびそれを有効成分とする除草剤 |
| US4447259A (en) * | 1981-12-18 | 1984-05-08 | Hokko Chemical Industry Co., Ltd. | 2-(Substituted phenoxy)propionic acid derivatives and their uses for herbicidal purposes |
| US4460399A (en) * | 1982-01-26 | 1984-07-17 | Chevron Research Company | Diphenoxy ether formamide plant-growth regulator |
| US4808750A (en) * | 1983-09-01 | 1989-02-28 | The Dow Chemical Company | Fluorophenoxyphenoxypropionates and derivatives thereof |
| US4550192A (en) * | 1983-09-01 | 1985-10-29 | The Dow Chemical Company | Fluorophenoxyphenoxypropionates and derivatives thereof |
| US4888050A (en) * | 1983-11-10 | 1989-12-19 | The Dow Chemical Company | Fluorophenoxy compounds, herbicidal compositions and methods |
| US4640703A (en) * | 1983-12-06 | 1987-02-03 | Ciba-Geigy Corporation | 2-phenoxypropionic acid cyanamides as herbicides |
| CN1008820B (zh) * | 1985-05-10 | 1990-07-18 | 施林工业产权保护股份公司 | 17α-乙炔基-17β-羟基-18-甲基-4,15-雌甾二烯-3-酮的制备方法 |
| US4589907A (en) * | 1985-09-17 | 1986-05-20 | Stauffer Chemical Company | Amidomethyl ester herbicides |
| US4786731A (en) * | 1987-08-05 | 1988-11-22 | The Dow Chemical Company | Resolution of enantiomers of 2-(phenyl or phenoxy/propionic acids using optically active alkanolamines |
| US4786732A (en) * | 1987-08-05 | 1988-11-22 | The Dow Chemical Company | Resolution of enantiomers of 2-(4-aryloxyphenoxy) propionic acids by liquid chromatography with a chiral eluent |
| US4897481A (en) * | 1988-05-31 | 1990-01-30 | The Dow Chemical Company | Process for the minimization of racemization in the preparation of optically active ((aryloxy)phenoxy)propionate herbicides |
| US5012017A (en) * | 1988-08-18 | 1991-04-30 | Dowelanco | Phenoxyphenoxypropionates, intermediates thereof and methods of preparation |
| DE3902439A1 (de) * | 1989-01-27 | 1990-08-02 | Basf Ag | Pflanzenschuetzende mittel auf basis von 1-aryl- bzw. 1-hetarylimidazolcarbonsaeureestern |
| DE3907938A1 (de) * | 1989-03-11 | 1990-09-13 | Basf Ag | 2,3-substituierte 1,8-naphthyridine, verfahren zu ihrer herstellung und ihre verwendung als antidots |
| DE4318092C1 (de) * | 1993-06-01 | 1995-01-12 | Basf Ag | Verfahren zur Herstellung von (R)- oder (S)-2-(4-Alkanoylphenoxy)- und (R)- oder (S)-2-(4-Aroylphenoxy)-propionsäureestern |
| EP1836894A1 (de) | 2006-03-25 | 2007-09-26 | Bayer CropScience GmbH | Neue Sulfonamid-haltige feste Formulungen |
| DE102007013362A1 (de) | 2007-03-16 | 2008-09-18 | Bayer Cropscience Ag | Penetrationsförderer für herbizide Wirkstoffe |
| EP1844654A1 (de) | 2006-03-29 | 2007-10-17 | Bayer CropScience GmbH | Penetrationsförderer für agrochemische Wirkstoffe |
| WO2011076731A1 (de) | 2009-12-23 | 2011-06-30 | Bayer Cropscience Ag | Flüssige formulierung von 2-iodo-n-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamid |
| US20130316901A1 (en) | 2011-02-15 | 2013-11-28 | Bayer Intellectual Property Gmbh | Synergistic combinations containing a dithino-tetracarboxamide fungicide and a herbicide, safener or plant growth regulator |
| DE102011080007A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Conazole- und Triazol-Fungizide als Safener |
| DE102011080016A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Strobilurin-Fungizide als Safener |
| DE102011079991A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Crop Science Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Nicotinoid-Insektizide als Safener |
| DE102011080010A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus den Gruppen der Anilid- und Thiazol-Fungizide als Safener |
| DE102011079997A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Corpscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Pyrazol-Insektizide als Safener |
| DE102011080020A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Dicarboximid-Fungizide als Safener |
| DE102011080004A1 (de) | 2011-07-28 | 2012-09-13 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Fungizide als Safener |
| DE102011080001A1 (de) | 2011-07-28 | 2012-10-25 | Bayer Cropscience Ag | Verwendung von Saatgutbehandlungs-Wirkstoffen aus der Gruppe der Carbamat-Insektizide als Safener |
| EP2908639A1 (en) | 2012-10-19 | 2015-08-26 | Bayer Cropscience AG | Active compound combinations comprising carboxamide derivatives |
-
1974
- 1974-07-10 DE DE19742433067 patent/DE2433067B2/de active Granted
-
1975
- 1975-06-25 EG EG75360A patent/EG11750A/xx active
- 1975-06-25 ZA ZA00754053A patent/ZA754053B/xx unknown
- 1975-07-01 RO RO7582720A patent/RO68991A/ro unknown
- 1975-07-03 IL IL47640A patent/IL47640A/xx unknown
- 1975-07-03 SU SU7502149601A patent/SU578856A3/ru active
- 1975-07-04 NL NL7508016A patent/NL7508016A/xx not_active Application Discontinuation
- 1975-07-04 ES ES439172A patent/ES439172A1/es not_active Expired
- 1975-07-04 TR TR18262A patent/TR18262A/xx unknown
- 1975-07-05 BG BG030473A patent/BG24937A3/xx unknown
- 1975-07-07 AT AT520275A patent/AT348288B/de not_active IP Right Cessation
- 1975-07-07 CH CH884475A patent/CH614601A5/xx not_active IP Right Cessation
- 1975-07-08 LU LU72924A patent/LU72924A1/xx unknown
- 1975-07-08 IT IT25205/75A patent/IT1039818B/it active
- 1975-07-08 MW MW40/75A patent/MW4075A1/xx unknown
- 1975-07-08 GB GB28690/75A patent/GB1519334A/en not_active Expired
- 1975-07-08 BR BR5508/75D patent/BR7504296A/pt unknown
- 1975-07-08 SE SE7507833A patent/SE7507833L/xx unknown
- 1975-07-08 US US05/594,031 patent/US4332960A/en not_active Expired - Lifetime
- 1975-07-08 DD DD187159A patent/DD121592A5/xx unknown
- 1975-07-09 IE IE1528/75A patent/IE42046B1/en unknown
- 1975-07-09 DK DK310575A patent/DK310575A/da not_active Application Discontinuation
- 1975-07-09 NO NO752466A patent/NO143939B/no unknown
- 1975-07-09 HU HU75HO1818A patent/HU176531B/hu unknown
- 1975-07-09 ZM ZM85/75A patent/ZM8575A1/xx unknown
- 1975-07-09 FR FR7521511A patent/FR2277811A1/fr active Granted
- 1975-07-09 JP JP50083632A patent/JPS6035321B2/ja not_active Expired
- 1975-07-09 YU YU01743/75A patent/YU174375A/xx unknown
- 1975-07-09 CA CA000231130A patent/CA1150294A/en not_active Expired
- 1975-07-10 OA OA55556A patent/OA05056A/xx unknown
- 1975-07-10 CS CS7500004917A patent/CS186289B2/cs unknown
- 1975-07-10 BE BE158168A patent/BE831218A/xx unknown
- 1975-07-10 AR AR259508A patent/AR219048A1/es active
- 1975-07-12 CU CU34303A patent/CU34303A/es unknown
-
1978
- 1978-01-27 SE SE7801047A patent/SE7801047L/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EG11750A (en) | (4-trifluoromethyl-phenoxy)-phenoxy-propionic acids derivatives and their use as herbicides | |
| KE2877A (en) | Benzyl-phenoxyalkane corboxylic acids and derivatives thereof and their use as herbicides | |
| MY7800323A (en) | Substituted (pyridyl-2-oxy) phenoxy alkane carboxylic acid derivatives and their use as herbicides | |
| IL46563A (en) | Substituted pyrazoles their preparation and their use as herbicides | |
| IL49627A0 (en) | Novel carboxylic esters,their preparation and their use as pesticides | |
| ZA753124B (en) | 3-amino-phenylacetic acid derivatives process for their preparation and their use as herbicides | |
| IL46853A0 (en) | Novel alkoxycarbonylphenylureas,their preparation and their use as herbicides | |
| ZA751706B (en) | Novel alkoxycorbonylphenylureas, their preparation and their use as herbicides | |
| IL50342A0 (en) | Novel trifluoromethylphenoxy-phenylureas their preparation and their use as herbicides | |
| ZA75703B (en) | New phenoxy-alkyl-carboxylic acid derivatives and the preparation thereof | |
| IL47335A0 (en) | Hexahydro-diazepino-indole derivatives and the preparation thereof | |
| IL52019A (en) | 5-phenylcarbamoyl-barbituric acids and their use as insecticides | |
| GB1523355A (en) | 19,20-dinorprostanoic acids and salts thereof | |
| IL46299A (en) | N-benzoyl-n-(3,4-difluoropehnyl)-alanine derivatives and their use as herbicides | |
| GB1538764A (en) | Tetraaza-sulpha-heptenone derivatives and their use as pesticides | |
| GB1524242A (en) | D-homosteroid 21-oic acids and derivatives thereof | |
| ZA757458B (en) | New prostenoic acid derivatives and with the preparation thereof | |
| EG12005A (en) | N-tetrachlorofluoroethyltio-halo-benzoyl anilides and their use as fungicides | |
| MY7800022A (en) | 3,5-dihalo-6-fluoro-2-pyridyloxy compounds and their use as herbicides | |
| IL47472A0 (en) | N-sulphenylated arylcarbamates,their preparation and their use as insecticides | |
| GB1517153A (en) | Naphthopyran-and benzodipyran-2-carboxylic acids and derivatives thereof | |
| PH16279A (en) | New benzylamino alkanoic acids,their pharmaceutical compositions and their use | |
| GB1488068A (en) | 7alpha-alkoxy-cephalosporin derivatives and their preparation | |
| EG12044A (en) | New 2,2-dimethyl-3-vinyl-cyclopropanecarboxylic acid ester derivatives and their use as pesticides | |
| IL50297A0 (en) | Nitroaryloxyalkanecarboxylic acid derivatives their preparation and their use as herbicides |