DE2426678C3 - Druckempfindliches lösungsmittelfreies Durchschreibematerial - Google Patents
Druckempfindliches lösungsmittelfreies DurchschreibematerialInfo
- Publication number
- DE2426678C3 DE2426678C3 DE2426678A DE2426678A DE2426678C3 DE 2426678 C3 DE2426678 C3 DE 2426678C3 DE 2426678 A DE2426678 A DE 2426678A DE 2426678 A DE2426678 A DE 2426678A DE 2426678 C3 DE2426678 C3 DE 2426678C3
- Authority
- DE
- Germany
- Prior art keywords
- weight
- parts
- chloride
- material according
- dye acceptor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 14
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 47
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 34
- 239000000203 mixture Substances 0.000 claims description 24
- 239000004202 carbamide Substances 0.000 claims description 21
- 239000011592 zinc chloride Substances 0.000 claims description 17
- 235000005074 zinc chloride Nutrition 0.000 claims description 17
- 239000011230 binding agent Substances 0.000 claims description 15
- 229910052751 metal Inorganic materials 0.000 claims description 14
- 239000002184 metal Substances 0.000 claims description 14
- -1 polyethylene Polymers 0.000 claims description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 7
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000004698 Polyethylene Substances 0.000 claims description 5
- 239000010941 cobalt Substances 0.000 claims description 5
- 229910017052 cobalt Inorganic materials 0.000 claims description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 5
- 229920000573 polyethylene Polymers 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- 239000002243 precursor Substances 0.000 claims description 4
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 claims description 4
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 229920001577 copolymer Polymers 0.000 claims description 3
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 3
- 239000011118 polyvinyl acetate Substances 0.000 claims description 3
- 239000004800 polyvinyl chloride Substances 0.000 claims description 3
- 229920003002 synthetic resin Polymers 0.000 claims description 3
- 239000000057 synthetic resin Substances 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical group [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 230000009471 action Effects 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 239000000025 natural resin Substances 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 239000011248 coating agent Substances 0.000 claims 1
- 238000000576 coating method Methods 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 239000000370 acceptor Substances 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000001993 wax Substances 0.000 description 8
- 229910001510 metal chloride Inorganic materials 0.000 description 7
- 229960000892 attapulgite Drugs 0.000 description 6
- 229910052625 palygorskite Inorganic materials 0.000 description 6
- 230000004044 response Effects 0.000 description 6
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical class [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 4
- 239000004372 Polyvinyl alcohol Substances 0.000 description 4
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 4
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 description 4
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229910021556 Chromium(III) chloride Inorganic materials 0.000 description 2
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 2
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- QSWDMMVNRMROPK-UHFFFAOYSA-K chromium(3+) trichloride Chemical compound [Cl-].[Cl-].[Cl-].[Cr+3] QSWDMMVNRMROPK-UHFFFAOYSA-K 0.000 description 2
- 239000011636 chromium(III) chloride Substances 0.000 description 2
- 235000007831 chromium(III) chloride Nutrition 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229940107698 malachite green Drugs 0.000 description 2
- 239000011565 manganese chloride Substances 0.000 description 2
- 235000002867 manganese chloride Nutrition 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- ZQVHTTABFLHMPA-UHFFFAOYSA-N 2-(4-chlorophenoxy)-5-nitropyridine Chemical compound N1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1 ZQVHTTABFLHMPA-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- JARVOPCNRNAXDT-UHFFFAOYSA-L Cl[Zn]Cl.NC(N)=O Chemical compound Cl[Zn]Cl.NC(N)=O JARVOPCNRNAXDT-UHFFFAOYSA-L 0.000 description 1
- 229910021580 Cobalt(II) chloride Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021551 Vanadium(III) chloride Inorganic materials 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- KBAYQFWFCOOCIC-GNVSMLMZSA-N [(1s,4ar,4bs,7s,8ar,10ar)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methanol Chemical compound OC[C@@]1(C)CCC[C@]2(C)[C@H]3CC[C@H](C(C)C)C[C@H]3CC[C@H]21 KBAYQFWFCOOCIC-GNVSMLMZSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000012164 animal wax Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- JPIYZTWMUGTEHX-UHFFFAOYSA-N auramine O free base Chemical compound C1=CC(N(C)C)=CC=C1C(=N)C1=CC=C(N(C)C)C=C1 JPIYZTWMUGTEHX-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- UQLDLKMNUJERMK-UHFFFAOYSA-L di(octadecanoyloxy)lead Chemical compound [Pb+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O UQLDLKMNUJERMK-UHFFFAOYSA-L 0.000 description 1
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Natural products CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- FJOPOOBDMDAVIW-UHFFFAOYSA-N ethenyl acetate;hydrate Chemical compound O.CC(=O)OC=C FJOPOOBDMDAVIW-UHFFFAOYSA-N 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- FRVCGRDGKAINSV-UHFFFAOYSA-L iron(2+);octadecanoate Chemical compound [Fe+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O FRVCGRDGKAINSV-UHFFFAOYSA-L 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- RMLSRFAOCMHQKX-UHFFFAOYSA-N propan-2-one;1,1,2-trichloroethene Chemical group CC(C)=O.ClC=C(Cl)Cl RMLSRFAOCMHQKX-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 239000012178 vegetable wax Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/155—Colour-developing components, e.g. acidic compounds; Additives or binders therefor; Layers containing such colour-developing components, additives or binders
- B41M5/1555—Inorganic mineral developers, e.g. clays
Landscapes
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Paper (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT665673A AT329595B (de) | 1973-07-27 | 1973-07-27 | Druckempfindliches kopierpapier |
| AT665773A AT329596B (de) | 1973-07-27 | 1973-07-27 | Druckempfindliches, losungsmittelfreies aufzeichnungsmaterial |
| AT780673A AT329597B (de) | 1973-09-10 | 1973-09-10 | Druckempfindliches durchschreibematerial |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2426678A1 DE2426678A1 (de) | 1975-02-06 |
| DE2426678B2 DE2426678B2 (de) | 1978-09-14 |
| DE2426678C3 true DE2426678C3 (de) | 1981-08-27 |
Family
ID=27150667
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2426678A Expired DE2426678C3 (de) | 1973-07-27 | 1974-06-01 | Druckempfindliches lösungsmittelfreies Durchschreibematerial |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4321092A (OSRAM) |
| JP (1) | JPS5042912A (OSRAM) |
| AU (1) | AU496998B2 (OSRAM) |
| BR (1) | BR7405966D0 (OSRAM) |
| CA (1) | CA1026095A (OSRAM) |
| CH (1) | CH605161A5 (OSRAM) |
| DD (1) | DD113189A1 (OSRAM) |
| DE (1) | DE2426678C3 (OSRAM) |
| DK (1) | DK137788B (OSRAM) |
| ES (1) | ES428709A1 (OSRAM) |
| FI (1) | FI61839C (OSRAM) |
| FR (1) | FR2238596B1 (OSRAM) |
| GB (1) | GB1472580A (OSRAM) |
| IL (1) | IL45351A (OSRAM) |
| IT (1) | IT1017434B (OSRAM) |
| NL (1) | NL7409090A (OSRAM) |
| SE (1) | SE413587B (OSRAM) |
| TR (1) | TR18390A (OSRAM) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT335477B (de) * | 1975-02-25 | 1977-03-10 | Koreska Ges Mbh W | Druckempfindliches aufzeichnungsmaterial |
| DE2731418C3 (de) * | 1977-07-12 | 1987-10-22 | Feldmühle AG, 4000 Düsseldorf | Farbreaktives Aufzeichnungsmaterial und Verfahren zu seiner Herstellung |
| AT372909B (de) | 1979-03-20 | 1983-11-25 | Manuel Ing Cespon | Farbentwicklermassen zur herstellung eines druck- empfindlichen aufzeichungsmaterials mit besonders starker farbbildung und lichtbestaendigkeit |
| FR2462271A1 (fr) * | 1979-07-30 | 1981-02-13 | Kores Holding Zug Ag | Materiau d'autocopie et son procede de preparation |
| JPS5637189A (en) * | 1979-09-05 | 1981-04-10 | Oji Paper Co Ltd | Tinting paper for pressure sensitive recording |
| GB2088889B (en) * | 1980-10-24 | 1984-09-05 | Fuji Photo Film Co Ltd | Recording materials having a clay-containing developer layer |
| EP0093208A1 (en) * | 1982-04-29 | 1983-11-09 | Frye Copysystems, Inc. | Improved chemical carbonless copy paper and transfer medium therefor |
| ZA834588B (en) * | 1982-06-24 | 1984-03-28 | Ciba Geigy Ag | Pressure-sensitive or heat-sensitive recording material |
| US4525214A (en) * | 1983-03-11 | 1985-06-25 | The Mazer Corporation | Crayon adapted for development of latent images |
| GB8511202D0 (en) * | 1985-05-02 | 1985-06-12 | Wiggins Teape Group Ltd | Record material |
| WO1988000890A1 (fr) * | 1986-07-31 | 1988-02-11 | Goyo Paper Working Co., Ltd | Feuille a revelateur de couleur |
| EP0704316B1 (en) * | 1994-09-30 | 1998-04-22 | Eastman Kodak Company | Ink-jet recording medium containing a vanadyl salt |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3516845A (en) * | 1967-01-24 | 1970-06-23 | Ncr Co | Record sheet sensitized with salt modified kaolin-phenolic material |
| DE1807894A1 (de) * | 1968-11-08 | 1970-08-13 | Naigai Ink Mfg Co Ltd | Adsorptionsmittelmasse fuer druckempfindliches Durchschriftpapier |
| DE2228581C3 (de) * | 1971-06-14 | 1974-05-30 | Matsushita Electric Industrial Co. Ltd., Kadoma, Osaka (Japan) | Hitzeempfindliches Zweifarben-Aufzeichnungsmaterial |
| US3856554A (en) * | 1973-04-16 | 1974-12-24 | Ibm | Pressure-sensitive carbonless transfer sheet and method for providing a chemically formed image on an untreated substrate |
| US3906123A (en) * | 1973-04-23 | 1975-09-16 | Champion Int Corp | Self-contained pressure-sensitive system |
-
1974
- 1974-05-31 FI FI1677/74A patent/FI61839C/fi active
- 1974-06-01 DE DE2426678A patent/DE2426678C3/de not_active Expired
- 1974-07-04 NL NL7409090A patent/NL7409090A/xx not_active Application Discontinuation
- 1974-07-09 CH CH942574A patent/CH605161A5/xx not_active IP Right Cessation
- 1974-07-19 BR BR5966/74A patent/BR7405966D0/pt unknown
- 1974-07-23 TR TR18390A patent/TR18390A/xx unknown
- 1974-07-24 FR FR7425643A patent/FR2238596B1/fr not_active Expired
- 1974-07-24 SE SE7409628A patent/SE413587B/xx not_active IP Right Cessation
- 1974-07-25 AU AU71619/74A patent/AU496998B2/en not_active Expired
- 1974-07-25 IT IT25555/74A patent/IT1017434B/it active
- 1974-07-25 DD DD180126A patent/DD113189A1/xx unknown
- 1974-07-25 GB GB3292374A patent/GB1472580A/en not_active Expired
- 1974-07-26 JP JP49085923A patent/JPS5042912A/ja active Pending
- 1974-07-26 DK DK403974AA patent/DK137788B/da not_active Application Discontinuation
- 1974-07-26 IL IL45351A patent/IL45351A/en unknown
- 1974-07-26 CA CA205,782A patent/CA1026095A/en not_active Expired
- 1974-07-27 ES ES428709A patent/ES428709A1/es not_active Expired
-
1980
- 1980-03-10 US US06/128,806 patent/US4321092A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL45351A (en) | 1976-12-31 |
| SE413587B (sv) | 1980-06-09 |
| DD113189A1 (OSRAM) | 1975-05-20 |
| FI167774A7 (OSRAM) | 1975-01-28 |
| DK137788C (OSRAM) | 1978-10-16 |
| DE2426678A1 (de) | 1975-02-06 |
| DE2426678B2 (de) | 1978-09-14 |
| CA1026095A (en) | 1978-02-14 |
| CH605161A5 (OSRAM) | 1978-09-29 |
| FI61839B (fi) | 1982-06-30 |
| FR2238596B1 (OSRAM) | 1982-10-01 |
| JPS5042912A (OSRAM) | 1975-04-18 |
| TR18390A (tr) | 1977-01-12 |
| DK137788B (da) | 1978-05-08 |
| DK403974A (OSRAM) | 1975-03-10 |
| AU496998B2 (en) | 1978-11-16 |
| GB1472580A (en) | 1977-05-04 |
| FI61839C (fi) | 1982-10-11 |
| ES428709A1 (es) | 1977-01-01 |
| BR7405966D0 (pt) | 1975-05-13 |
| NL7409090A (nl) | 1975-01-29 |
| FR2238596A1 (OSRAM) | 1975-02-21 |
| US4321092A (en) | 1982-03-23 |
| SE7409628L (OSRAM) | 1975-01-28 |
| IT1017434B (it) | 1977-07-20 |
| AU7161974A (en) | 1976-01-29 |
| IL45351A0 (en) | 1974-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0016730B1 (de) | Farbentwicklermasse zur Herstellung eines druckempfindlichen Aufzeichnungsmaterials; Farbentwicklungsblatt für druckempfindliches Aufzeichnungsmaterial; druckempfindliches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE2853120C2 (de) | Wärmeempfindliches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE2152763C3 (de) | Farbentwickler und diesen enthaltender Aufzeichnungsbogen | |
| DE2229354C3 (de) | Druckempfindliches Aufzeichnungsmaterial | |
| DE2348639A1 (de) | Sensibilisiertes blatt fuer ein druckempfindliches kopiersystem und verfahren zu seiner herstellung | |
| DE2822961C2 (de) | Druckempfindliches Kopiermaterial | |
| DE2426678B2 (de) | Druckempfindliches lösungsmittelfreies Durchschreibematerial | |
| EP0181283B1 (de) | Isomerengemische von Metallsalicylaten, ihre Herstellung und Verwendung | |
| EP0067793B1 (de) | Druckempfindliches oder wärmeempfindliches Aufzeichnungsmaterial | |
| CH644551A5 (de) | Chromogene zusammensetzung. | |
| DE3534594C2 (de) | Wärmeempfindliches Aufzeichnungsmaterial | |
| DE3441645A1 (de) | Druckempfindliches aufzeichnungsmaterial | |
| DE3876535T2 (de) | Durch polyvalente metalle modifizierte salizylsaeureharze, farbentwicklungsmittel und diese harze enthaltendes aufzeichnungspapier. | |
| DE3232235A1 (de) | Aufzeichnungsmaterialien | |
| DE2556083A1 (de) | Druckempfindliches aufzeichnungsmaterial | |
| DE2820462B2 (de) | Selbstaufzeichnendes druckempfindliches Papier | |
| DE2946830C2 (de) | Druck- oder wärmeempfindliches Aufzeichnungsmaterial | |
| DE3435513A1 (de) | Hitzeempfindliches aufzeichnungsmaterial | |
| DE2700937A1 (de) | 3-indolyl-3-bis-aminophenyl- phthalidverbindungen | |
| EP0003726B1 (de) | Substituierte Diaminophthalide, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbbildner in druckempfindlichen oder wärmeempfindlichen Aufzeichnungsmaterialien | |
| DE3687195T2 (de) | Waermeempfindliche aufzeichnungsschichten mit sulfonderivaten. | |
| DE2555080A1 (de) | Druck- oder waermeempfindliches aufzeichnungsmaterial | |
| DE3300229A1 (de) | Waermeempfindliche aufzeichnungsblaetter | |
| AT372910B (de) | Beschichtungsmassen zur herstellung eines druck- empfindlichen aufzeichungsmaterials | |
| DE2757865A1 (de) | Farbstoffloesungsmittel fuer druckempfindliche kopiersysteme |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |