DE2410441C2 - Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von Silber - Google Patents
Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von SilberInfo
- Publication number
- DE2410441C2 DE2410441C2 DE2410441A DE2410441A DE2410441C2 DE 2410441 C2 DE2410441 C2 DE 2410441C2 DE 2410441 A DE2410441 A DE 2410441A DE 2410441 A DE2410441 A DE 2410441A DE 2410441 C2 DE2410441 C2 DE 2410441C2
- Authority
- DE
- Germany
- Prior art keywords
- silver
- liter
- bath
- compounds
- thiosulfate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052709 silver Inorganic materials 0.000 title claims description 41
- 239000004332 silver Substances 0.000 title claims description 41
- 238000000034 method Methods 0.000 title claims description 6
- 238000004070 electrodeposition Methods 0.000 title claims 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical group [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 40
- 150000001875 compounds Chemical class 0.000 claims description 18
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 17
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 239000011593 sulfur Substances 0.000 claims description 10
- 238000000151 deposition Methods 0.000 claims description 5
- 230000008021 deposition Effects 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 229940065287 selenium compound Drugs 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 4
- 150000003343 selenium compounds Chemical class 0.000 claims description 4
- 229940100890 silver compound Drugs 0.000 claims description 4
- 150000003379 silver compounds Chemical class 0.000 claims description 4
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- 239000000337 buffer salt Substances 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 150000002897 organic nitrogen compounds Chemical class 0.000 claims description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims 1
- 239000011734 sodium Substances 0.000 description 27
- 238000000576 coating method Methods 0.000 description 18
- -1 thiol sulfate Chemical class 0.000 description 12
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 11
- 235000019345 sodium thiosulphate Nutrition 0.000 description 11
- 229920002873 Polyethylenimine Polymers 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000003792 electrolyte Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 229920000768 polyamine Polymers 0.000 description 6
- 229910052711 selenium Inorganic materials 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229910017464 nitrogen compound Inorganic materials 0.000 description 5
- 150000002830 nitrogen compounds Chemical class 0.000 description 5
- 239000011669 selenium Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000007747 plating Methods 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- KJDRSWPQXHESDQ-UHFFFAOYSA-N 1,4-dichlorobutane Chemical compound ClCCCCCl KJDRSWPQXHESDQ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 2
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- XIMIGUBYDJDCKI-UHFFFAOYSA-N diselenium Chemical compound [Se]=[Se] XIMIGUBYDJDCKI-UHFFFAOYSA-N 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- GKQPCPXONLDCMU-CCEZHUSRSA-N lacidipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C1=CC=CC=C1\C=C\C(=O)OC(C)(C)C GKQPCPXONLDCMU-CCEZHUSRSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 150000004010 onium ions Chemical class 0.000 description 2
- 238000002161 passivation Methods 0.000 description 2
- 229920000333 poly(propyleneimine) Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- PFNFFQXMRSDOHW-UHFFFAOYSA-N spermine Chemical compound NCCCNCCCCNCCCN PFNFFQXMRSDOHW-UHFFFAOYSA-N 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- VDMJCVUEUHKGOY-JXMROGBWSA-N (1e)-4-fluoro-n-hydroxybenzenecarboximidoyl chloride Chemical compound O\N=C(\Cl)C1=CC=C(F)C=C1 VDMJCVUEUHKGOY-JXMROGBWSA-N 0.000 description 1
- JSJQXIKNYJDACT-UHFFFAOYSA-N (potassiodiselanyl)potassium Chemical compound [Se-][Se-].[K+].[K+] JSJQXIKNYJDACT-UHFFFAOYSA-N 0.000 description 1
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- UHXXNUYGEDYXGD-UHFFFAOYSA-N 1-methylsulfanylselanylpropane Chemical compound CCC[Se]SC UHXXNUYGEDYXGD-UHFFFAOYSA-N 0.000 description 1
- JUXXCHAGQCBNTI-UHFFFAOYSA-N 1-n,1-n,2-n,2-n-tetramethylpropane-1,2-diamine Chemical compound CN(C)C(C)CN(C)C JUXXCHAGQCBNTI-UHFFFAOYSA-N 0.000 description 1
- QFEGZYANALYACQ-UHFFFAOYSA-N 2-[3-(carboxymethylsulfanyl)propylsulfanyl]acetic acid Chemical compound OC(=O)CSCCCSCC(O)=O QFEGZYANALYACQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- CETBSQOFQKLHHZ-UHFFFAOYSA-N Diethyl disulfide Chemical compound CCSSCC CETBSQOFQKLHHZ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- FYDGRHCYVIUOSL-UHFFFAOYSA-L S(=O)([O-])[O-].[Ag+2] Chemical class S(=O)([O-])[O-].[Ag+2] FYDGRHCYVIUOSL-UHFFFAOYSA-L 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- NGDDCFINDCHPTF-UHFFFAOYSA-N [Br].[Ag] Chemical class [Br].[Ag] NGDDCFINDCHPTF-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- MASBWURJQFFLOO-UHFFFAOYSA-N ammeline Chemical compound NC1=NC(N)=NC(O)=N1 MASBWURJQFFLOO-UHFFFAOYSA-N 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- 150000003959 diselenides Chemical class 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 238000004870 electrical engineering Methods 0.000 description 1
- 230000005518 electrochemistry Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- DIHKMUNUGQVFES-UHFFFAOYSA-N n,n,n',n'-tetraethylethane-1,2-diamine Chemical compound CCN(CC)CCN(CC)CC DIHKMUNUGQVFES-UHFFFAOYSA-N 0.000 description 1
- UXVMRCQQPJIQGC-UHFFFAOYSA-N n,n,n',n'-tetrakis(ethenyl)ethane-1,2-diamine Chemical group C=CN(C=C)CCN(C=C)C=C UXVMRCQQPJIQGC-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical group 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- KYEKHFSRAXRJBR-UHFFFAOYSA-M potassium;selenocyanate Chemical compound [K+].[Se-]C#N KYEKHFSRAXRJBR-UHFFFAOYSA-M 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- UXAKYQHJRPCIOZ-UHFFFAOYSA-N propyl selenocyanate Chemical compound CCC[Se]C#N UXAKYQHJRPCIOZ-UHFFFAOYSA-N 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000001824 selenocyanato group Chemical group *[Se]C#N 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- YPNVIBVEFVRZPJ-UHFFFAOYSA-L silver sulfate Chemical compound [Ag+].[Ag+].[O-]S([O-])(=O)=O YPNVIBVEFVRZPJ-UHFFFAOYSA-L 0.000 description 1
- 229910000367 silver sulfate Inorganic materials 0.000 description 1
- RHUVFRWZKMEWNS-UHFFFAOYSA-M silver thiocyanate Chemical compound [Ag+].[S-]C#N RHUVFRWZKMEWNS-UHFFFAOYSA-M 0.000 description 1
- HAAYBYDROVFKPU-UHFFFAOYSA-N silver;azane;nitrate Chemical compound N.N.[Ag+].[O-][N+]([O-])=O HAAYBYDROVFKPU-UHFFFAOYSA-N 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229940063675 spermine Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- SSTZGACKDAVIGZ-UHFFFAOYSA-N sulfanium;bromide Chemical compound [SH3+].[Br-] SSTZGACKDAVIGZ-UHFFFAOYSA-N 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 238000005494 tarnishing Methods 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229940006280 thiosulfate ion Drugs 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/46—Electroplating: Baths therefor from solutions of silver
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electroplating And Plating Baths Therefor (AREA)
- Conductive Materials (AREA)
- Manufacture And Refinement Of Metals (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2410441A DE2410441C2 (de) | 1974-03-01 | 1974-03-01 | Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von Silber |
| CH1243074A CH606500A5 (enExample) | 1974-03-01 | 1974-09-12 | |
| DD181617A DD114283A5 (enExample) | 1974-03-01 | 1974-10-10 | |
| YU2873/74A YU36764B (en) | 1974-03-01 | 1974-10-28 | Process for silver-plating of metallic surfaces |
| SU742073760A SU612641A3 (ru) | 1974-03-01 | 1974-10-30 | Электролит серебрени |
| CS7481A CS178182B2 (enExample) | 1974-03-01 | 1974-11-01 | |
| ES431700A ES431700A1 (es) | 1974-03-01 | 1974-11-06 | Procedimiento para la preparacion de un bano libre de cia- nuro para la deposicion de plata por via galvanica. |
| SE7414331A SE413038B (sv) | 1974-03-01 | 1974-11-14 | Vattenhaltigt, cyanidfritt bad for galvanisk utfellning av silver |
| JP14750474A JPS5413213B2 (enExample) | 1974-03-01 | 1974-12-21 | |
| US05/543,206 US3984292A (en) | 1974-03-01 | 1975-01-23 | Cyanide free bath for electrodeposition of silver |
| IE383/75A IE40688B1 (en) | 1974-03-01 | 1975-02-25 | Cyanide-free electrolyte for the electrodeposition of silver |
| AU78605/75A AU497419B2 (en) | 1974-03-01 | 1975-02-26 | Cyanide-free silver plating bath |
| AT152075A AT332694B (de) | 1974-03-01 | 1975-02-27 | Wasseriges, cyanidfreies bad zur galvanischen abscheidung von silber |
| AR257813A AR209761A1 (es) | 1974-03-01 | 1975-02-28 | Bano acuoso exento de cianuro para el deposito galvanico de recubrimientos en plata |
| NL7502446A NL7502446A (nl) | 1974-03-01 | 1975-02-28 | Werkwijze ter bereiding van een waterbevattend cyanidevrij bad voor het galvanisch afscheiden van zilver. |
| HU75SCHE511A HU171683B (hu) | 1974-03-01 | 1975-02-28 | Vanna bez cianidov dlja gal'vanicheskogo osazhdenija serebra |
| IT20806/75A IT1033325B (it) | 1974-03-01 | 1975-02-28 | Bagno esente da cianuri per la deposizione galvanica d argento |
| RO7581527A RO68472A (ro) | 1974-03-01 | 1975-02-28 | Electrolit pentru argintare lucioasa |
| ZA00751274A ZA751274B (en) | 1974-03-01 | 1975-02-28 | A cyanide-free electrolyte, for use in the electrodeposition of silver |
| GB874175A GB1449792A (en) | 1974-03-01 | 1975-03-03 | Cyanide-free electrolyte for the electrodeposition of silver |
| FR7506530A FR2262705B1 (enExample) | 1974-03-01 | 1975-03-03 | |
| CA222,175A CA1042836A (en) | 1974-03-01 | 1975-03-03 | Cyanide-free electrolyte for electrodeposition of silver |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2410441A DE2410441C2 (de) | 1974-03-01 | 1974-03-01 | Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von Silber |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2410441A1 DE2410441A1 (de) | 1975-09-04 |
| DE2410441C2 true DE2410441C2 (de) | 1982-11-11 |
Family
ID=5909129
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2410441A Expired DE2410441C2 (de) | 1974-03-01 | 1974-03-01 | Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von Silber |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3984292A (enExample) |
| JP (1) | JPS5413213B2 (enExample) |
| AR (1) | AR209761A1 (enExample) |
| AT (1) | AT332694B (enExample) |
| AU (1) | AU497419B2 (enExample) |
| CA (1) | CA1042836A (enExample) |
| CH (1) | CH606500A5 (enExample) |
| CS (1) | CS178182B2 (enExample) |
| DD (1) | DD114283A5 (enExample) |
| DE (1) | DE2410441C2 (enExample) |
| ES (1) | ES431700A1 (enExample) |
| FR (1) | FR2262705B1 (enExample) |
| GB (1) | GB1449792A (enExample) |
| HU (1) | HU171683B (enExample) |
| IE (1) | IE40688B1 (enExample) |
| IT (1) | IT1033325B (enExample) |
| NL (1) | NL7502446A (enExample) |
| RO (1) | RO68472A (enExample) |
| SE (1) | SE413038B (enExample) |
| SU (1) | SU612641A3 (enExample) |
| YU (1) | YU36764B (enExample) |
| ZA (1) | ZA751274B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4153519A (en) * | 1976-02-04 | 1979-05-08 | Hitachi, Ltd. | Silver-electroplating method using thiocyanic solution |
| US4067784A (en) * | 1976-06-09 | 1978-01-10 | Oxy Metal Industries Corporation | Non-cyanide acidic silver electroplating bath and additive therefore |
| CA1081651A (en) * | 1976-06-09 | 1980-07-15 | John M. Deuber | Non-cyanide electrodeposition of silver |
| US4121982A (en) * | 1978-02-03 | 1978-10-24 | American Chemical & Refining Company Incorporated | Gold alloy plating bath and method |
| US4155817A (en) * | 1978-08-11 | 1979-05-22 | American Chemical And Refining Company, Inc. | Low free cyanide high purity silver electroplating bath and method |
| BR8001854A (pt) * | 1979-04-04 | 1980-11-18 | Engelhard Min & Chem | Banho de revestimento de prata ou liga da mesma e respectivo processo de estabilizacao |
| US4376682A (en) * | 1980-04-07 | 1983-03-15 | Tdc Technology Development Corporation | Method for producing smooth coherent metal chalconide films |
| JPS61195985A (ja) * | 1985-02-25 | 1986-08-30 | Nippon Engeruharudo Kk | 無光沢高速銀めつき液 |
| JPS61195986A (ja) * | 1985-02-25 | 1986-08-30 | Nippon Engeruharudo Kk | 無光沢高速銀めつき液 |
| US5302278A (en) * | 1993-02-19 | 1994-04-12 | Learonal, Inc. | Cyanide-free plating solutions for monovalent metals |
| GB0508188D0 (en) * | 2005-04-22 | 2005-06-01 | Eastman Kodak Co | Method of forming conductive tracks |
| DE102006004826B4 (de) * | 2006-01-31 | 2013-12-05 | Qimonda Ag | Metall- und Cyanid-Ionen-freie Ätzlösung zur nasschemischen Strukturierung von Metallschichten in der Halbleiterindustrie und deren Verwendung in einem Ätzverfahren |
| RU2323276C2 (ru) * | 2006-03-23 | 2008-04-27 | Закрытое акционерное общество "Драгцветмет" (ЗАО "Драгцветмет") | Электролит серебрения |
| US20130023166A1 (en) * | 2011-07-20 | 2013-01-24 | Tyco Electronics Corporation | Silver plated electrical contact |
| CN103866355A (zh) * | 2014-04-03 | 2014-06-18 | 苏州大学 | 无氰电镀银溶液及其电镀方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1857507A (en) * | 1929-10-22 | 1932-05-10 | Eastman Kodak Co | Process for the separation of silver by electrolysis |
-
1974
- 1974-03-01 DE DE2410441A patent/DE2410441C2/de not_active Expired
- 1974-09-12 CH CH1243074A patent/CH606500A5/xx not_active IP Right Cessation
- 1974-10-10 DD DD181617A patent/DD114283A5/xx unknown
- 1974-10-28 YU YU2873/74A patent/YU36764B/xx unknown
- 1974-10-30 SU SU742073760A patent/SU612641A3/ru active
- 1974-11-01 CS CS7481A patent/CS178182B2/cs unknown
- 1974-11-06 ES ES431700A patent/ES431700A1/es not_active Expired
- 1974-11-14 SE SE7414331A patent/SE413038B/xx unknown
- 1974-12-21 JP JP14750474A patent/JPS5413213B2/ja not_active Expired
-
1975
- 1975-01-23 US US05/543,206 patent/US3984292A/en not_active Expired - Lifetime
- 1975-02-25 IE IE383/75A patent/IE40688B1/xx unknown
- 1975-02-26 AU AU78605/75A patent/AU497419B2/en not_active Expired
- 1975-02-27 AT AT152075A patent/AT332694B/de not_active IP Right Cessation
- 1975-02-28 IT IT20806/75A patent/IT1033325B/it active
- 1975-02-28 NL NL7502446A patent/NL7502446A/xx not_active Application Discontinuation
- 1975-02-28 ZA ZA00751274A patent/ZA751274B/xx unknown
- 1975-02-28 HU HU75SCHE511A patent/HU171683B/hu unknown
- 1975-02-28 AR AR257813A patent/AR209761A1/es active
- 1975-02-28 RO RO7581527A patent/RO68472A/ro unknown
- 1975-03-03 CA CA222,175A patent/CA1042836A/en not_active Expired
- 1975-03-03 FR FR7506530A patent/FR2262705B1/fr not_active Expired
- 1975-03-03 GB GB874175A patent/GB1449792A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA751274B (en) | 1976-01-28 |
| US3984292A (en) | 1976-10-05 |
| SE413038B (sv) | 1980-03-31 |
| YU287374A (en) | 1982-06-18 |
| RO68472A (ro) | 1981-09-24 |
| DE2410441A1 (de) | 1975-09-04 |
| IE40688B1 (en) | 1979-08-01 |
| YU36764B (en) | 1984-08-31 |
| NL7502446A (nl) | 1975-09-03 |
| AT332694B (de) | 1976-10-11 |
| ES431700A1 (es) | 1976-09-16 |
| DD114283A5 (enExample) | 1975-07-20 |
| AU497419B2 (en) | 1978-12-14 |
| CA1042836A (en) | 1978-11-21 |
| CS178182B2 (enExample) | 1977-08-31 |
| AU7860575A (en) | 1976-08-26 |
| JPS50120435A (enExample) | 1975-09-20 |
| SU612641A3 (ru) | 1978-06-25 |
| CH606500A5 (enExample) | 1978-10-31 |
| FR2262705B1 (enExample) | 1978-04-21 |
| FR2262705A1 (enExample) | 1975-09-26 |
| AR209761A1 (es) | 1977-05-31 |
| HU171683B (hu) | 1978-02-28 |
| GB1449792A (en) | 1976-09-15 |
| JPS5413213B2 (enExample) | 1979-05-29 |
| IT1033325B (it) | 1979-07-10 |
| ATA152075A (de) | 1976-01-15 |
| IE40688L (en) | 1975-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2410441C2 (de) | Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von Silber | |
| DE2541897C2 (de) | Wäßriges saures Bad zur galvanischen Abscheidung duktiler und glänzender Kupferüberzüge | |
| DE2830572C2 (de) | Wässriges Bad für die galvanische Abscheidung von glänzenden Metallüberzügen und Verfahren zur galvanischen Abscheidung von glänzenden Nickel-Eisen-Überzügen | |
| DE69404496T2 (de) | Cyanidfreie Plattierungslösung für monovalente Metalle | |
| DE2445538C2 (de) | Cyanidfreies Bad und Verfahren zur galvanischen Abscheidung von Edelmetall - Legierungen | |
| DE2610507A1 (de) | Cyanidfreies bad zur galvanischen abscheidung glaenzender silberueberzuege | |
| DE2900105C2 (enExample) | ||
| CH682823A5 (de) | Platierungszusammensetzungen und -verfahren. | |
| DE60120322T2 (de) | Plattierungsbad und Verfahren zur Plattierung von Zinn-Zink Legierungen | |
| DE102005011708B3 (de) | Polyvinylammoniumverbindung und Verfahren zu deren Herstellung sowie diese Verbindung enthaltende saure Lösung und Verfahren zum elektrolytischen Abscheiden eines Kupferniederschlages | |
| DE2204326C3 (de) | Wäßriges saures Bad zur galvanischen Abscheidung von glänzenden und duktilen Kupferüberzügen | |
| DE2752169A1 (de) | Waessriges bad fuer die elektrolytische abscheidung eines zinkueberzugs auf einem substrat, verfahren zur durchfuehrung der elektrolytischen abscheidung eines zinkueberzugs auf einem substrat unter verwendung dieses bades und additiv-zubereitung fuer dieses bad | |
| DE2506467C2 (de) | Bad und Verfahren zur galvanischen Abscheidung von Palladium-Nickel-Legierungen | |
| DE2608644C3 (de) | Glanzzinkbad | |
| DE2630980C2 (enExample) | ||
| DE2614719C2 (de) | Bad zur galvanischen Abscheidung von glänzendem Zink | |
| DE2509377A1 (de) | Zusammensetzung fuer die galvanische abscheidung von metallen, verfahren zu deren herstellung sowie verwendung derselben | |
| DE2713507A1 (de) | Waessriges galvanisches bad | |
| DE2249037A1 (de) | Verfahren zum plattieren von kupfer auf aluminium | |
| DE2431332C2 (de) | Wäßriges saures Bad zur galvanischen Abscheidung von glänzendem Nickel-Eisen | |
| DE2333069C2 (de) | Saures, wäßriges Bad zur galvanischen Abscheidung eines glänzenden Nickel-Eisen-Überzuges | |
| CH645927A5 (en) | Electroplating bath and use thereof | |
| DE2445537A1 (de) | Bad zur galvanischen abscheidung von gold | |
| DE2360892A1 (de) | Waessriges saures galvanisches kupferbad | |
| DE2654214A1 (de) | Zubereitung und deren verwendung in einem waessrigen alkalischen elektroplattierungsbad |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8339 | Ceased/non-payment of the annual fee |