DE2363092C2 - Photodepolymerisierbares Gemisch und dessen Verwendung - Google Patents
Photodepolymerisierbares Gemisch und dessen VerwendungInfo
- Publication number
- DE2363092C2 DE2363092C2 DE2363092A DE2363092A DE2363092C2 DE 2363092 C2 DE2363092 C2 DE 2363092C2 DE 2363092 A DE2363092 A DE 2363092A DE 2363092 A DE2363092 A DE 2363092A DE 2363092 C2 DE2363092 C2 DE 2363092C2
- Authority
- DE
- Germany
- Prior art keywords
- film
- mixture
- irradiated
- isobutyl ketone
- copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 39
- 229920001577 copolymer Polymers 0.000 claims description 33
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 229920002554 vinyl polymer Polymers 0.000 claims description 6
- -1 vinyl compound Chemical group 0.000 claims description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical group CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004018 acid anhydride group Chemical group 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 claims 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 claims 1
- 239000000463 material Substances 0.000 description 55
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 45
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 45
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 45
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 25
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 22
- 229940102838 methylmethacrylate Drugs 0.000 description 19
- 238000004132 cross linking Methods 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- 229920000642 polymer Polymers 0.000 description 16
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 14
- 239000004342 Benzoyl peroxide Substances 0.000 description 12
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 12
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 12
- 235000019400 benzoyl peroxide Nutrition 0.000 description 12
- 238000010438 heat treatment Methods 0.000 description 12
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 12
- 229910052710 silicon Inorganic materials 0.000 description 12
- 239000010703 silicon Substances 0.000 description 12
- 235000012431 wafers Nutrition 0.000 description 12
- 230000000694 effects Effects 0.000 description 8
- 238000007654 immersion Methods 0.000 description 8
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229940117841 methacrylic acid copolymer Drugs 0.000 description 6
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 6
- 239000004926 polymethyl methacrylate Substances 0.000 description 6
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 229930016911 cinnamic acid Natural products 0.000 description 4
- 235000013985 cinnamic acid Nutrition 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- 238000009987 spinning Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- MQUUQPKBOFIRRS-UHFFFAOYSA-N 1,4,6-trimethylcyclohexa-2,4-dien-1-amine Chemical compound CC1C=C(C)C=CC1(C)N MQUUQPKBOFIRRS-UHFFFAOYSA-N 0.000 description 2
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000011243 crosslinked material Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920006254 polymer film Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- PTTPXKJBFFKCEK-UHFFFAOYSA-N 2-Methyl-4-heptanone Chemical compound CC(C)CC(=O)CC(C)C PTTPXKJBFFKCEK-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- YCIGYTFKOXGYTA-UHFFFAOYSA-N 4-(3-cyanopropyldiazenyl)butanenitrile Chemical compound N#CCCCN=NCCCC#N YCIGYTFKOXGYTA-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000003948 formamides Chemical group 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000010884 ion-beam technique Methods 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/039—Macromolecular compounds which are photodegradable, e.g. positive electron resists
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Electrophotography Using Other Than Carlson'S Method (AREA)
- Materials For Photolithography (AREA)
- Exposure And Positioning Against Photoresist Photosensitive Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5906372A GB1445345A (en) | 1972-12-21 | 1972-12-21 | Positive-working electron resists |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2363092A1 DE2363092A1 (de) | 1974-07-04 |
| DE2363092C2 true DE2363092C2 (de) | 1982-11-25 |
Family
ID=10482994
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2363092A Expired DE2363092C2 (de) | 1972-12-21 | 1973-12-19 | Photodepolymerisierbares Gemisch und dessen Verwendung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3981985A (enExample) |
| JP (1) | JPS5530208B2 (enExample) |
| DE (1) | DE2363092C2 (enExample) |
| FR (1) | FR2211489B1 (enExample) |
| GB (1) | GB1445345A (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1500541A (en) * | 1975-03-20 | 1978-02-08 | Mullard Ltd | Method of producing positive-working electron resist coatings |
| US4004043A (en) * | 1975-09-26 | 1977-01-18 | International Business Machines Corporation | Nitrated polymers as positive resists |
| JPS52128132A (en) * | 1976-04-20 | 1977-10-27 | Fujitsu Ltd | Positive type electron beam sensitive composition |
| US4096290A (en) * | 1976-10-04 | 1978-06-20 | International Business Machines Corporation | Resist mask formation process with haloalkyl methacrylate copolymers |
| JPS5466122A (en) * | 1977-11-07 | 1979-05-28 | Fujitsu Ltd | Pattern formation material |
| JPS5466829A (en) * | 1977-11-07 | 1979-05-29 | Fujitsu Ltd | Pattern formation materil |
| JPS5471579A (en) * | 1977-11-17 | 1979-06-08 | Matsushita Electric Ind Co Ltd | Electron beam resist |
| DE2757932A1 (de) * | 1977-12-24 | 1979-07-05 | Licentia Gmbh | Strahlungsempfindliche positiv arbeitende materialien |
| DE2757931A1 (de) * | 1977-12-24 | 1979-07-12 | Licentia Gmbh | Verfahren zum herstellen von positiven aetzresistenten masken |
| JPS54118776A (en) * | 1978-03-08 | 1979-09-14 | Fujitsu Ltd | Pattern forming method |
| JPS54158173A (en) * | 1978-06-05 | 1979-12-13 | Fujitsu Ltd | Micropattern forming method |
| JPS54161320A (en) * | 1978-06-12 | 1979-12-20 | Fujitsu Ltd | Production of cross linking type resist |
| JPS5590942A (en) * | 1978-12-29 | 1980-07-10 | Fujitsu Ltd | Positive type resist material |
| JPS55117239A (en) * | 1979-03-02 | 1980-09-09 | Fujitsu Ltd | Making method of microminiature pattern |
| JPS55133042A (en) * | 1979-04-04 | 1980-10-16 | Fujitsu Ltd | Pattern forming method |
| US4276365A (en) * | 1979-07-02 | 1981-06-30 | Fujitsu Limited | Positive resist terpolymer composition and method of forming resist pattern |
| US4286518A (en) * | 1979-07-25 | 1981-09-01 | Armstrong World Industries, Inc. | Print screen stencil |
| US5391624A (en) * | 1992-02-10 | 1995-02-21 | S. C. Johnson & Son, Inc. | Thermosettable compositions |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1141175A (en) * | 1964-02-20 | 1969-01-29 | Monsanto Chemicals | Aromatic polymers containing anhydride groups |
| US3445530A (en) * | 1965-05-14 | 1969-05-20 | Marathon Oil Co | Nitroso compounds and processes for their production |
| US3535137A (en) * | 1967-01-13 | 1970-10-20 | Ibm | Method of fabricating etch resistant masks |
| US3546182A (en) * | 1967-12-18 | 1970-12-08 | Sumitomo Electric Industries | Liner polymeric compositions,method of manufacturing them and products made from them |
| US3526612A (en) * | 1969-04-16 | 1970-09-01 | Marathon Oil Co | Polyanhydrides,and processes for their production |
-
1972
- 1972-12-21 GB GB5906372A patent/GB1445345A/en not_active Expired
-
1973
- 1973-12-12 US US05/424,113 patent/US3981985A/en not_active Expired - Lifetime
- 1973-12-19 DE DE2363092A patent/DE2363092C2/de not_active Expired
- 1973-12-20 JP JP14195173A patent/JPS5530208B2/ja not_active Expired
- 1973-12-21 FR FR7345962A patent/FR2211489B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2211489A1 (enExample) | 1974-07-19 |
| US3981985A (en) | 1976-09-21 |
| JPS5530208B2 (enExample) | 1980-08-09 |
| FR2211489B1 (enExample) | 1976-11-19 |
| DE2363092A1 (de) | 1974-07-04 |
| GB1445345A (en) | 1976-08-11 |
| JPS49103632A (enExample) | 1974-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2363092C2 (de) | Photodepolymerisierbares Gemisch und dessen Verwendung | |
| DE69126586T2 (de) | Verfahren zur Herstellung einer Vorrichtung | |
| DE2735377C2 (de) | Mit einem gegenüber Elektronen- und Röntgenstrahlung empfindlichen Negativ-Resistmaterial beschichteter Werkstoff | |
| EP0000702B1 (de) | Verfahren zur Herstellung einer fliessbeständigen Resistmaske aus strahlungsempfindlichem Resistmaterial | |
| DE2655455C2 (de) | Verfahren zum Herstellen einer Maske und Lackstruktur zur Verwendung bei dem Verfahren | |
| DE2205660C3 (de) | Verfahren zum Antistatischausrüsten eines Kunststoffüms oder einer Kunststoffolie | |
| DE2628467A1 (de) | Verfahren zum herstellen eines positiven lackbildes | |
| DE2459156C3 (de) | Verfahren zum Herstellen einer Photolackmaske auf einem Halbleitersubstrat | |
| DE2451902A1 (de) | Hochempfindliche positivaetz- bzw. -reliefschichten und ihre anwendung fuer die maskenbildung | |
| DE2743763A1 (de) | Positivlackmaterial und verfahren zur herstellung einer lackmaske | |
| DE3115860A1 (de) | "waermeempfindliches aufzeichnungsmaterial und unter seiner verwendung durchgefuehrtes aufzeichnungsverfahren" | |
| DE3201815C2 (enExample) | ||
| DE2610301C2 (de) | Verfahren zur Herstellung einer positiv wirkenden Resistmaterialschicht und Verfahren zum Erzeugen eines Resistmusters | |
| DE69009503T2 (de) | Resist-Materialien für Lithographie mittels eines Elektronen- oder Röntgenstrahls. | |
| DE2827492A1 (de) | Photographischer filmtraeger | |
| DE2849996C2 (de) | Photodepolymerisierbares Gemisch und ein Verfahren zur Herstellung eines Positivbildes | |
| EP0195322B1 (de) | Verfahren zur Herstellung eines photopolymerisierbaren Aufzeichnungsmaterials | |
| DE3884502T2 (de) | Polydiacetylen-Dünnschicht-Herstellungsverfahren. | |
| DE2423280A1 (de) | Photographisches verfahren zur herstellung einer bildschirmstruktur unter verwendung von organischen, das licht streuenden teilchen | |
| DE2452326C2 (de) | Verfahren zur Herstellung einer Ätzmaske mittels energiereicher Strahlung | |
| DE1622285A1 (de) | Verfahren zur Herstellung von AEtzbildern | |
| DE2642269A1 (de) | Verfahren zur herstellung eines positiven resistbildes | |
| DE1900331A1 (de) | Schichttraegerelement,insbesondere fuer photographische und Magnetbandzwecke | |
| DE2063259C3 (de) | Verfahren zum Aufbringen eines Überzugs auf die Oberfläche eines Kunststoffes | |
| DE2056361A1 (de) | Substrierungsmasse fur Polyester Filmträger |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination |