DE2336559A1 - 4a-aryl-trans-decahydrochinoline und verfahren zu ihrer herstellung - Google Patents
4a-aryl-trans-decahydrochinoline und verfahren zu ihrer herstellungInfo
- Publication number
- DE2336559A1 DE2336559A1 DE19732336559 DE2336559A DE2336559A1 DE 2336559 A1 DE2336559 A1 DE 2336559A1 DE 19732336559 DE19732336559 DE 19732336559 DE 2336559 A DE2336559 A DE 2336559A DE 2336559 A1 DE2336559 A1 DE 2336559A1
- Authority
- DE
- Germany
- Prior art keywords
- trans
- formula
- decahydroisoquinoline
- phenyl
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title description 3
- -1 m-hydroxyphenyl Chemical group 0.000 claims description 53
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 49
- 150000001875 compounds Chemical class 0.000 claims description 35
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 11
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 11
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 239000012312 sodium hydride Substances 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 230000000202 analgesic effect Effects 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical group C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 claims description 4
- 229960003328 benzoyl peroxide Drugs 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 4
- BQIKRTGTPBOIMK-UHFFFAOYSA-N [O]C[O] Chemical compound [O]C[O] BQIKRTGTPBOIMK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000004593 Epoxy Substances 0.000 claims 2
- ULQQGOGMQRGFFR-UHFFFAOYSA-N 2-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1Cl ULQQGOGMQRGFFR-UHFFFAOYSA-N 0.000 claims 1
- ZMMPBZMELZHMIT-HOCLYGCPSA-N 3-[(4aR,8aR)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol Chemical compound OC=1C=C(C=CC1)[C@@]12CCN(C[C@@H]2CCCC1)C ZMMPBZMELZHMIT-HOCLYGCPSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 58
- 239000000047 product Substances 0.000 description 54
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 50
- 239000000243 solution Substances 0.000 description 32
- 239000000203 mixture Substances 0.000 description 31
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 30
- 238000002844 melting Methods 0.000 description 27
- 230000008018 melting Effects 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 239000003921 oil Substances 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- 238000000921 elemental analysis Methods 0.000 description 13
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 12
- 238000009835 boiling Methods 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 239000012259 ether extract Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 239000002480 mineral oil Substances 0.000 description 6
- 235000010446 mineral oil Nutrition 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 150000002440 hydroxy compounds Chemical class 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 5
- NDEBTTKKQOYLNO-RDJZCZTQSA-N (4ar,8ar)-4a-(3-methoxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline Chemical compound COC1=CC=CC([C@]23[C@@H](CCCC2)CN(C)CC3)=C1 NDEBTTKKQOYLNO-RDJZCZTQSA-N 0.000 description 4
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 4
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- ZVUPIZCQKCQXCR-HOTGVXAUSA-N (4ar,8ar)-2-methyl-4a-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline Chemical compound C1([C@]23CCN(C[C@@H]2CCCC3)C)=CC=CC=C1 ZVUPIZCQKCQXCR-HOTGVXAUSA-N 0.000 description 3
- ATDSLTNNQHIUGT-UHFFFAOYSA-N 2-(cyclohexylmethyl)-4a-phenyl-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound O=C1CC2(C=3C=CC=CC=3)CCCC=C2C(=O)N1CC1CCCCC1 ATDSLTNNQHIUGT-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- UUWSLBWDFJMSFP-UHFFFAOYSA-N bromomethylcyclohexane Chemical compound BrCC1CCCCC1 UUWSLBWDFJMSFP-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 229940075930 picrate Drugs 0.000 description 3
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- QTJVCDNDJFHYIR-UPVQGACJSA-N (4ar,8ar)-4a-(3-methoxyphenyl)-2-(2-phenylethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinoline Chemical compound COC1=CC=CC([C@]23[C@@H](CCCC2)CN(CCC=2C=CC=CC=2)CC3)=C1 QTJVCDNDJFHYIR-UPVQGACJSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- MDCSEDZSJXOKHT-UHFFFAOYSA-N 2-methyl-4a-phenyl-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound C1CCC=C2C(=O)N(C)C(=O)CC21C1=CC=CC=C1 MDCSEDZSJXOKHT-UHFFFAOYSA-N 0.000 description 2
- DRLVMOAWNVOSPE-UHFFFAOYSA-N 2-phenylcyclohexan-1-one Chemical compound O=C1CCCCC1C1=CC=CC=C1 DRLVMOAWNVOSPE-UHFFFAOYSA-N 0.000 description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 2
- KYCGFUJZJABSFO-UHFFFAOYSA-N 4a-phenyl-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound C1CCC=C2C(=O)NC(=O)CC21C1=CC=CC=C1 KYCGFUJZJABSFO-UHFFFAOYSA-N 0.000 description 2
- DFHUCZVFFSAETP-UGKGYDQZSA-N C1(CCCCC1)CN1C([C@@H]2CCCC[C@]2(CC1=O)C1=CC=CC=C1)=O Chemical compound C1(CCCCC1)CN1C([C@@H]2CCCC[C@]2(CC1=O)C1=CC=CC=C1)=O DFHUCZVFFSAETP-UGKGYDQZSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229910010082 LiAlH Inorganic materials 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- FLHFTXCMKFVKRP-UHFFFAOYSA-N bromomethylcyclobutane Chemical compound BrCC1CCC1 FLHFTXCMKFVKRP-UHFFFAOYSA-N 0.000 description 2
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 2
- 150000001916 cyano esters Chemical class 0.000 description 2
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- DKXIZGHCVIAUNR-DTWKUNHWSA-N (4aS,8aS)-2,3,4,4a,5,6,7,8-octahydro-1H-isoquinolin-8a-ol Chemical compound C1CCC[C@H]2CCNC[C@@]21O DKXIZGHCVIAUNR-DTWKUNHWSA-N 0.000 description 1
- GHCJLQGFFNKTCD-YOEHRIQHSA-N (4ar,8ar)-4a-(3-methoxyphenyl)-2-methyl-4,5,6,7,8,8a-hexahydroisoquinoline-1,3-dione Chemical compound COC1=CC=CC([C@]23[C@@H](CCCC2)C(=O)N(C)C(=O)C3)=C1 GHCJLQGFFNKTCD-YOEHRIQHSA-N 0.000 description 1
- ZVUPIZCQKCQXCR-CVEARBPZSA-N (4ar,8as)-2-methyl-4a-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline Chemical compound C1([C@]23CCN(C[C@H]2CCCC3)C)=CC=CC=C1 ZVUPIZCQKCQXCR-CVEARBPZSA-N 0.000 description 1
- NENLYAQPNATJSU-IUCAKERBSA-N (4as,8ar)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline Chemical group C1NCC[C@@H]2CCCC[C@H]21 NENLYAQPNATJSU-IUCAKERBSA-N 0.000 description 1
- QNLKMCMWNRXPGP-UHFFFAOYSA-N 1-bromo-2,3-dimethoxy-5-methylbenzene Chemical compound COC1=CC(C)=CC(Br)=C1OC QNLKMCMWNRXPGP-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- VIKJTJUHWIWYNO-UHFFFAOYSA-N 2-(2-oxo-1-phenylcyclohexyl)acetic acid Chemical compound C=1C=CC=CC=1C1(CC(=O)O)CCCCC1=O VIKJTJUHWIWYNO-UHFFFAOYSA-N 0.000 description 1
- MGRYVEDNIGXKQE-UHFFFAOYSA-N 2-bromo-4-methoxy-1-methylbenzene Chemical compound COC1=CC=C(C)C(Br)=C1 MGRYVEDNIGXKQE-UHFFFAOYSA-N 0.000 description 1
- SVTTWWUPRPXUDA-UHFFFAOYSA-N 2-bromo-6-methoxy-4-methylphenol Chemical compound COC1=CC(C)=CC(Br)=C1O SVTTWWUPRPXUDA-UHFFFAOYSA-N 0.000 description 1
- CCHNWURRBFGQCD-UHFFFAOYSA-N 2-chlorocyclohexan-1-one Chemical compound ClC1CCCCC1=O CCHNWURRBFGQCD-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- RZQYAGNFCZDLPG-GMAHTHKFSA-N 3-[(4aR,8aR)-2-(2-phenylethyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenol Chemical compound C1(=CC=CC=C1)CCN1C[C@@H]2CCCC[C@]2(CC1)C1=CC(=CC=C1)O RZQYAGNFCZDLPG-GMAHTHKFSA-N 0.000 description 1
- XADCKKKOYZJNAR-UHFFFAOYSA-N 4-methoxycyclohexan-1-one Chemical compound COC1CCC(=O)CC1 XADCKKKOYZJNAR-UHFFFAOYSA-N 0.000 description 1
- WIDDOXWCZPPHAX-UHFFFAOYSA-N 4a,5,6,7-tetrahydro-4h-isoquinoline-1,3-dione Chemical compound C1CCC=C2C(=O)NC(=O)CC21 WIDDOXWCZPPHAX-UHFFFAOYSA-N 0.000 description 1
- LADYEQUWPOAPDC-UHFFFAOYSA-N 4a-(3-methoxyphenyl)-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound COC1=CC=CC(C23C(=CCCC2)C(=O)NC(=O)C3)=C1 LADYEQUWPOAPDC-UHFFFAOYSA-N 0.000 description 1
- 241001136792 Alle Species 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- HRCLWRCEBKHBNE-LPHOPBHVSA-N C1(CC1)CN1C([C@@H]2CCCC[C@]2(CC1=O)C1=CC=CC=C1)=O Chemical compound C1(CC1)CN1C([C@@H]2CCCC[C@]2(CC1=O)C1=CC=CC=C1)=O HRCLWRCEBKHBNE-LPHOPBHVSA-N 0.000 description 1
- LBQAGPTYGDCVSC-PMACEKPBSA-N C1(CCC1)CN1C[C@@H]2CCCC[C@]2(CC1)C1=CC=CC=C1 Chemical compound C1(CCC1)CN1C[C@@H]2CCCC[C@]2(CC1)C1=CC=CC=C1 LBQAGPTYGDCVSC-PMACEKPBSA-N 0.000 description 1
- FSVPKHBCGLKONR-NKWVEPMBSA-N C1CCC[C@H]2C(=O)NC(=O)C[C@@H]21 Chemical compound C1CCC[C@H]2C(=O)NC(=O)C[C@@H]21 FSVPKHBCGLKONR-NKWVEPMBSA-N 0.000 description 1
- WNQSYARJLGHFFI-UHFFFAOYSA-N CCOC(C(CCC1)C=C1C1=CC=CC=C1)=O Chemical compound CCOC(C(CCC1)C=C1C1=CC=CC=C1)=O WNQSYARJLGHFFI-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000000944 Soxhlet extraction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical group OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 1
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical class BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical class *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 238000010520 demethylation reaction Methods 0.000 description 1
- FHHZOYXKOICLGH-UHFFFAOYSA-N dichloromethane;ethanol Chemical compound CCO.ClCCl FHHZOYXKOICLGH-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- DUOKTVFXVRZKOJ-UHFFFAOYSA-N ethyl 2-(2-cyano-1-phenylcyclohex-2-en-1-yl)acetate Chemical compound C=1C=CC=CC=1C1(CC(=O)OCC)CCCC=C1C#N DUOKTVFXVRZKOJ-UHFFFAOYSA-N 0.000 description 1
- XBMJPPLETQINDG-UHFFFAOYSA-N ethyl 2-(2-oxo-1-phenylcyclohexyl)acetate Chemical compound C=1C=CC=CC=1C1(CC(=O)OCC)CCCCC1=O XBMJPPLETQINDG-UHFFFAOYSA-N 0.000 description 1
- XIAYIHJKGNBZON-UHFFFAOYSA-N ethyl 2-[1-(3-methoxyphenyl)-2-oxocyclohexyl]acetate Chemical compound C=1C=CC(OC)=CC=1C1(CC(=O)OCC)CCCCC1=O XIAYIHJKGNBZON-UHFFFAOYSA-N 0.000 description 1
- CVHSSGQGPQJKGJ-UHFFFAOYSA-N ethyl 2-[2-cyano-1-(3-methoxyphenyl)cyclohex-2-en-1-yl]acetate Chemical compound C=1C=CC(OC)=CC=1C1(CC(=O)OCC)CCCC=C1C#N CVHSSGQGPQJKGJ-UHFFFAOYSA-N 0.000 description 1
- JLKRDWNOCHSCKP-UHFFFAOYSA-N ethyl 2-oxo-1-phenylcyclohexane-1-carboxylate Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCCCC1=O JLKRDWNOCHSCKP-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- IHLVCKWPAMTVTG-UHFFFAOYSA-N lithium;carbanide Chemical group [Li+].[CH3-] IHLVCKWPAMTVTG-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical group CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 239000004081 narcotic agent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000526 short-path distillation Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
- C07D217/16—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/24—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US27380672A | 1972-07-20 | 1972-07-20 | |
| US36584373A | 1973-06-01 | 1973-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2336559A1 true DE2336559A1 (de) | 1974-01-31 |
Family
ID=26956443
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732336559 Pending DE2336559A1 (de) | 1972-07-20 | 1973-07-18 | 4a-aryl-trans-decahydrochinoline und verfahren zu ihrer herstellung |
| DE19732351599 Pending DE2351599A1 (de) | 1972-07-20 | 1973-07-18 | 4a-aryl-trans-decahydrochinoline und verfahren zu ihrer herstellung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732351599 Pending DE2351599A1 (de) | 1972-07-20 | 1973-07-18 | 4a-aryl-trans-decahydrochinoline und verfahren zu ihrer herstellung |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS4985075A (enExample) |
| AR (1) | AR208650A1 (enExample) |
| CA (1) | CA1024149A (enExample) |
| DE (2) | DE2336559A1 (enExample) |
| ES (1) | ES417127A1 (enExample) |
| FR (1) | FR2193600B1 (enExample) |
| GB (2) | GB1436377A (enExample) |
| HU (1) | HU167738B (enExample) |
| IE (1) | IE37929B1 (enExample) |
| IL (3) | IL42790A (enExample) |
| LU (1) | LU68066A1 (enExample) |
| NL (1) | NL7310078A (enExample) |
| SE (1) | SE7602150L (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE7509337L (sv) * | 1974-09-23 | 1976-03-24 | Du Pont | Smertstillande foreningar |
| NZ189230A (en) * | 1977-12-27 | 1981-05-15 | Lilly Co Eli | Trans-4a-aryl-2-substituted-octahydro-1h-2-pyrindines |
| EP0485636B1 (en) * | 1990-06-05 | 1997-03-12 | Toray Industries, Inc. | Indole derivative |
| KR100241662B1 (ko) * | 1991-07-05 | 2000-03-02 | 지오르지오 스치니나 | 히드로이소퀴놀린 유도체 |
| IT1307327B1 (it) * | 1995-09-12 | 2001-10-30 | Smithkline Beecham Spa | Derivati idroisochinolinici sostituiti |
-
1973
- 1973-07-18 DE DE19732336559 patent/DE2336559A1/de active Pending
- 1973-07-18 DE DE19732351599 patent/DE2351599A1/de active Pending
- 1973-07-18 CA CA176,763A patent/CA1024149A/en not_active Expired
- 1973-07-19 AR AR249168A patent/AR208650A1/es active
- 1973-07-19 GB GB3938775A patent/GB1436377A/en not_active Expired
- 1973-07-19 FR FR7326508A patent/FR2193600B1/fr not_active Expired
- 1973-07-19 HU HUDU206A patent/HU167738B/hu unknown
- 1973-07-19 IL IL42790A patent/IL42790A/en unknown
- 1973-07-19 GB GB3443873A patent/GB1436376A/en not_active Expired
- 1973-07-19 IE IE1229/73A patent/IE37929B1/xx unknown
- 1973-07-19 IL IL48667A patent/IL48667A/en unknown
- 1973-07-19 NL NL7310078A patent/NL7310078A/xx not_active Application Discontinuation
- 1973-07-20 JP JP48082484A patent/JPS4985075A/ja active Pending
- 1973-07-20 ES ES417127A patent/ES417127A1/es not_active Expired
- 1973-07-20 LU LU68066A patent/LU68066A1/xx unknown
-
1975
- 1975-12-15 IL IL48667A patent/IL48667A0/xx unknown
-
1976
- 1976-02-23 SE SE7602150A patent/SE7602150L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE7602150L (sv) | 1976-02-23 |
| IE37929L (en) | 1974-01-20 |
| LU68066A1 (enExample) | 1973-09-26 |
| HU167738B (enExample) | 1975-12-25 |
| IL42790A0 (en) | 1973-10-25 |
| AU5820773A (en) | 1975-01-23 |
| FR2193600A1 (enExample) | 1974-02-22 |
| DE2351599A1 (de) | 1974-01-31 |
| ES417127A1 (es) | 1976-04-01 |
| CA1024149A (en) | 1978-01-10 |
| IE37929B1 (en) | 1977-11-09 |
| AR208650A1 (es) | 1977-02-28 |
| IL42790A (en) | 1976-11-30 |
| NL7310078A (enExample) | 1974-01-22 |
| JPS4985075A (enExample) | 1974-08-15 |
| IL48667A (en) | 1976-11-30 |
| GB1436376A (en) | 1976-05-19 |
| IL48667A0 (en) | 1976-02-29 |
| GB1436377A (en) | 1976-05-19 |
| FR2193600B1 (enExample) | 1976-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD292911A5 (de) | Verfahren zur herstellung von pyrrolidinderivaten | |
| DE2065636C3 (de) | Tricyclische Verbindungen, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| CH623572A5 (enExample) | ||
| DE2828039A1 (de) | 2-(2-alkoxyethyl)-2'-hydroxy-6,7-benzomorphane deren saeureadditionssalze diese enthaltende arzneimittel und verfahren zu deren herstellung | |
| CH622016A5 (en) | Process for the preparation of novel 2-tetrahydrofurfuryl-6,7-benzomorphans | |
| DE2125634A1 (de) | Verfahren zur Herstellung von neuen Cycloheptenderivaten | |
| DE2229695A1 (de) | 2-(heteroaryl-methyl)-5,9 beta-dialkyl6,7-benzomorphane, deren saeureadditionssalze sowie verfahren zu deren herstellung | |
| DD284011A5 (de) | Verfahren zur herstellung der (3r,s)-oder(3r)-form einer verbindung | |
| DE2539907A1 (de) | 4a-aryl-cis-decahydroisochinoline und diese verbindungen enthaltende arzneimittel | |
| DD272648A5 (de) | Chromon-derivate | |
| DE2336559A1 (de) | 4a-aryl-trans-decahydrochinoline und verfahren zu ihrer herstellung | |
| CH417574A (de) | Verfahren zur Herstellung therapeutisch wirksamer Dibenzocycloheptanderivate | |
| EP0064685A1 (de) | Dibenzo(de,g)chinolin-Derivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2726836A1 (de) | 6,7-benzomorphane, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2708110A1 (de) | Pyrrolbenzoxaaza-alkane | |
| CH556837A (de) | Verfahren zur herstellung neuer spiroindanpyrrolidinderivate. | |
| DE2526966A1 (de) | Tricyclische alkylaminverbindungen, verfahren zu ihrer herstellung und sie enthaltende mittel | |
| DE2217420A1 (de) | N-thienylmethyl-heterocyclen, deren saeureadditionssalze sowie verfahren zu deren herstellung | |
| CH592628A5 (en) | 4a-Aryl-trans-decahydroisoquinolines - analgesics and narcotic antagonists | |
| DD206986A5 (de) | Verfahren zur herstellung von pharmakologisch wirksamen 4-/2-hydroxy-4-(subst.)phenyl/-naphthalin-2(1h)-onen und -2-olen | |
| DE2542152A1 (de) | 4a-aryl-trans-decahydroisochinoline und diese verbindungen enthaltende arzneimittel | |
| AT323163B (de) | Verfahren zur herstellung neuer (4ars,5sr,9bsr)- und (4ars,5sr,9brs)-1,3,4,4a,5,9b-hexahydro-5-phenyl-2h-indeno(1,2-c)pyridine und ihrer saureadditionssalze | |
| DE2348951A1 (de) | Octahydroisochinoline, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2241241A1 (de) | Thiazolinopyrimidin-5-on-derivate, verfahren zu deren herstellung und deren verwendung | |
| DE2610702A1 (de) | Azabicycloalkane und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |