DE231646C - - Google Patents
Info
- Publication number
- DE231646C DE231646C DENDAT231646D DE231646DA DE231646C DE 231646 C DE231646 C DE 231646C DE NDAT231646 D DENDAT231646 D DE NDAT231646D DE 231646D A DE231646D A DE 231646DA DE 231646 C DE231646 C DE 231646C
- Authority
- DE
- Germany
- Prior art keywords
- calcium cyanamide
- water
- nitrogen
- lime
- calcium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- MVXMNHYVCLMLDD-UHFFFAOYSA-N 4-methoxynaphthalene-1-carbaldehyde Chemical compound C1=CC=C2C(OC)=CC=C(C=O)C2=C1 MVXMNHYVCLMLDD-UHFFFAOYSA-N 0.000 claims description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 3
- 239000003337 fertilizer Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 4
- 101100399296 Mus musculus Lime1 gene Proteins 0.000 description 4
- 235000011941 Tilia x europaea Nutrition 0.000 description 4
- 239000004571 lime Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- QGZNMXOKPQPNMY-UHFFFAOYSA-N [Mg].[Cl] Chemical compound [Mg].[Cl] QGZNMXOKPQPNMY-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- MYFXBBAEXORJNB-UHFFFAOYSA-N calcium cyanamide Chemical compound [Ca+2].[N-]=C=[N-] MYFXBBAEXORJNB-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05C—NITROGENOUS FERTILISERS
- C05C7/00—Fertilisers containing calcium or other cyanamides
- C05C7/02—Granulation; Pelletisation; Degassing; Hydrating; Hardening; Stabilisation; Oiling
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE231646C true DE231646C (enExample) |
Family
ID=491736
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT231646D Active DE231646C (enExample) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE231646C (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE932616C (de) * | 1937-05-14 | 1955-10-13 | American Cyanamid Co | Verfahren zum Granulieren von rohem Calciumcyanamid |
| DE1012932B (de) * | 1955-08-09 | 1957-08-01 | Sueddeutsche Kalkstickstoff | Verfahren zum Granulieren von Kalkstickstoff |
| DE1121084B (de) * | 1960-04-06 | 1962-01-04 | Sueddeutsche Kalkstickstoff | Verfahren zur Herstellung von Presskalkstickstoff |
| DE1241467B (de) * | 1963-08-02 | 1967-06-01 | Wintershall Ag | Verfahren zur Herstellung poroeser, granulierter Duengemittel |
| DE1242249B (de) * | 1961-07-14 | 1967-06-15 | Wintershall Ag | Verfahren zur Herstellung granulierter Mischduengemittel aus Kalkstickstoff und Kaliduengesalz |
-
0
- DE DENDAT231646D patent/DE231646C/de active Active
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE932616C (de) * | 1937-05-14 | 1955-10-13 | American Cyanamid Co | Verfahren zum Granulieren von rohem Calciumcyanamid |
| DE1012932B (de) * | 1955-08-09 | 1957-08-01 | Sueddeutsche Kalkstickstoff | Verfahren zum Granulieren von Kalkstickstoff |
| DE1121084B (de) * | 1960-04-06 | 1962-01-04 | Sueddeutsche Kalkstickstoff | Verfahren zur Herstellung von Presskalkstickstoff |
| DE1242249B (de) * | 1961-07-14 | 1967-06-15 | Wintershall Ag | Verfahren zur Herstellung granulierter Mischduengemittel aus Kalkstickstoff und Kaliduengesalz |
| DE1241467B (de) * | 1963-08-02 | 1967-06-01 | Wintershall Ag | Verfahren zur Herstellung poroeser, granulierter Duengemittel |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE231646C (enExample) | ||
| DE1265146C2 (de) | Verfahren zur kontinuierlichen Herstellung vorzugsweise konzentrierter waessriger Ammoniumthiosulfatloesungen | |
| DE2704336A1 (de) | Verfahren zum behandeln von tonhaltigem phosphatgestein | |
| DE475429C (de) | Verfahren zur Herstellung eines dauernd streufaehigen Duengemittels aus eingedickter Melasseschlempe | |
| DE969208C (de) | Mischduenger aus Thomasphosphat und Kaliduengesalzen | |
| DE860496C (de) | Verfahren zur Herstellung von granuliertem Superphosphat | |
| DE612708C (de) | Verfahren zur Herstellung nicht backender, ammonnitrathaltiger Mischduenger | |
| DE581558C (de) | Verfahren zur Herstellung eines stickstoffreichen Humusduengemittels | |
| DE731119C (de) | Verfahren zur UEberfuehrung unbestaendiger Salzgemische in bestaendige Form | |
| DE304184C (enExample) | ||
| DE1542432C3 (de) | Verfahren zur Herstellung eines Superphosphatdungemi ttels | |
| DE1519885A1 (de) | Verfahren zur Verfestigung oder Agglomerierung von feinteiligen Stoffen | |
| DE545866C (de) | Verfahren zur Herstellung eines AEtzmittels zur Mattglaserzeugung | |
| DE2603771A1 (de) | Verfahren zur herstellung eines phosphathaltigen duengemittels | |
| AT99793B (de) | Verfahren zur Herstellung von hochwirksamen Düngemitteln aus mineralischen Phosphaten. | |
| DE909104C (de) | Verfahren zur Herstellung von Stickstoff enthaltenden Kalkhumat-Duengemitteln | |
| DE887949C (de) | Verfahren zur Herstellung von granuliertem Superphosphat | |
| DE852671C (de) | Herstellung eines hydraulischen Bindemittels | |
| DE940707C (de) | Verfahren zur Herstellung von Phosphatduengemitteln mit einem Gehalt an organischer Substanz | |
| DE2001835C3 (de) | Mittel zur Verhinderung des Verbackens und Staubens von Düngesalzen | |
| DE317919C (enExample) | ||
| DE446409C (de) | Herstellung von Bleiarsenat | |
| DE34086C (de) | Neuerung in dem Verfahren zur Darstellung von Ammoniumsulfat aus Torfmoor. (I | |
| AT86639B (de) | Schwimmverfahren zur Aufbereitung von Erzen. | |
| DE556779C (de) | Verfahren zur Herstellung von Duengemitteln |