DE2302672A1 - 5-aroylfurane, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate - Google Patents
5-aroylfurane, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparateInfo
- Publication number
- DE2302672A1 DE2302672A1 DE2302672A DE2302672A DE2302672A1 DE 2302672 A1 DE2302672 A1 DE 2302672A1 DE 2302672 A DE2302672 A DE 2302672A DE 2302672 A DE2302672 A DE 2302672A DE 2302672 A1 DE2302672 A1 DE 2302672A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- furan
- compound
- chlorobenzoyl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 19
- 238000000034 method Methods 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title description 3
- -1 -COO-lower-alkyl Chemical group 0.000 claims description 38
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- XAQZDZHAWDJHJF-UHFFFAOYSA-N 2-(furan-2-yl)acetonitrile Chemical compound N#CCC1=CC=CO1 XAQZDZHAWDJHJF-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000010985 leather Substances 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 7
- 150000002825 nitriles Chemical class 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- VEPFWRPCZSXSIF-UHFFFAOYSA-N 2-(5-benzoylfuran-2-yl)acetic acid Chemical compound O1C(CC(=O)O)=CC=C1C(=O)C1=CC=CC=C1 VEPFWRPCZSXSIF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 150000007960 acetonitrile Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical class ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21986072A | 1972-01-21 | 1972-01-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2302672A1 true DE2302672A1 (de) | 1973-07-26 |
Family
ID=22821063
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2302672A Pending DE2302672A1 (de) | 1972-01-21 | 1973-01-19 | 5-aroylfurane, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3801605A (enExample) |
| JP (1) | JPS4880551A (enExample) |
| AT (1) | AT323148B (enExample) |
| AU (1) | AU468159B2 (enExample) |
| BE (1) | BE794159A (enExample) |
| CA (1) | CA1006527A (enExample) |
| CH (1) | CH585216A5 (enExample) |
| DE (1) | DE2302672A1 (enExample) |
| FR (1) | FR2183657B1 (enExample) |
| GB (1) | GB1388513A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3966771A (en) * | 1975-06-16 | 1976-06-29 | Morton-Norwich Products, Inc. | 5-(4-Chlorophenyl)-2-furyl ketones |
| US3971811A (en) * | 1975-06-16 | 1976-07-27 | Morton-Norwich Products, Inc. | 5-(4-Chlorophenyl)-2-furyl phenyl ketone |
| US4036981A (en) * | 1976-07-12 | 1977-07-19 | Morton-Norwich Products, Inc. | Method for treating inflammation |
| EP0783488A4 (en) * | 1994-09-27 | 1998-01-07 | Ono Pharmaceutical Co | FIVE-ELEMENT HETEROCYCLIC COMPOUNDS |
| US5859042A (en) * | 1995-09-27 | 1999-01-12 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
-
1972
- 1972-01-21 US US00219860A patent/US3801605A/en not_active Expired - Lifetime
-
1973
- 1973-01-09 AU AU50903/73A patent/AU468159B2/en not_active Expired
- 1973-01-17 CH CH64873A patent/CH585216A5/xx not_active IP Right Cessation
- 1973-01-17 BE BE794159A patent/BE794159A/xx unknown
- 1973-01-18 FR FR7301763A patent/FR2183657B1/fr not_active Expired
- 1973-01-19 AT AT47473A patent/AT323148B/de not_active IP Right Cessation
- 1973-01-19 GB GB276373A patent/GB1388513A/en not_active Expired
- 1973-01-19 DE DE2302672A patent/DE2302672A1/de active Pending
- 1973-01-19 CA CA161,685A patent/CA1006527A/en not_active Expired
- 1973-01-22 JP JP48009399A patent/JPS4880551A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3801605A (en) | 1974-04-02 |
| AT323148B (de) | 1975-06-25 |
| FR2183657B1 (enExample) | 1976-04-09 |
| AU5090373A (en) | 1974-07-11 |
| AU468159B2 (en) | 1976-01-08 |
| BE794159A (fr) | 1973-07-17 |
| CA1006527A (en) | 1977-03-08 |
| CH585216A5 (enExample) | 1977-02-28 |
| FR2183657A1 (enExample) | 1973-12-21 |
| GB1388513A (en) | 1975-03-26 |
| JPS4880551A (enExample) | 1973-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1958919B2 (de) | l-Oxo-5-indanyloxyessigsäuren und solche Verbindungen enthaltende Arzneimittel | |
| EP0496238A1 (de) | Substituierte Benzoxazepine und Benzthiazepine, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2023000C2 (de) | Neue 5-Cycloalkyl-1-indancarbonsäuren, 6-Cycloalkyltetralin-1-carbonsäuren, Derivate davon und Verfahren zu ihrer Herstellung | |
| DE2356903A1 (de) | Verfahren zur herstellung substituierter chromon-3-carbonitrile, -carboxamide und -carbonsaeuren | |
| DE2302672A1 (de) | 5-aroylfurane, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2708185C3 (de) | Verfahren zur Herstellung von α-Ketocarbonsäuren | |
| DE2022694C3 (de) | alpha-(3,4-Dihydro-4-oxo-1H-2,3benzothiazin-S-dioxyd-3-yl)-N,N-dimethylacetamid und Verfahren zur Herstellung desselben | |
| DE2009474C2 (de) | Verfahren zur Herstellung von Indolderivaten | |
| DE2804894A1 (de) | Halogen-benzofuranon-carbonsaeuren | |
| DE1695554C3 (de) | Verfahren zur Herstellung kondensierter Piperazinonderivate | |
| LU82205A1 (de) | Verfahren zur herstellung eines carbazolderivates | |
| AT343113B (de) | Verfahren zur herstellung von neuen 5- oder 6- substituierten benzoxazolen | |
| DE2302671A1 (de) | 5-acylpyrrole, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln | |
| AT239226B (de) | Verfahren zur Herstellung von neuen, substituierten 2-Oxo-tetrahydrochinolinen | |
| AT354432B (de) | Verfahren zur herstellung von 3-indolylessig- saeuren | |
| CH510008A (de) | Verfahren zur Herstellung von neuen heterocyclischen Carbonsäuren | |
| AT233174B (de) | Verfahren zur Herstellung von 3-Keto-Δ4, 6-10(α)-methylsteroiden | |
| AT244952B (de) | Verfahren zur Herstellung von neuen, gegebenenfalls substituierten 2-(β-Aminoäthyl)-benzofuranen und von deren Salzen | |
| AT246729B (de) | Verfahren zur Herstellung von neuen substituierten Benzoesäureamiden | |
| AT228793B (de) | Verfahren zur Herstellung von neuen Iminodibenzylderivaten | |
| AT270657B (de) | Verfahren zur Herstellung von neuen halogensubstituierten Tetrahydrochinazolinen sowie von deren Säureadditionssalzen | |
| DE2404924A1 (de) | Ergolinderivate | |
| AT343648B (de) | Verfahren zur herstellung neuer substituierter, gegebenenfalls veresterter oder amidierter benzocycloalkenylcarbonsauren | |
| DE1795671C3 (de) | Verfahren zur Herstellung von i-Acyl-3-indolylcarbonsäureverbindungen | |
| AT226724B (de) | Verfahren zur Herstellung von neuen 1-Aza-thioxanthen-Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |