DE2265294B2 - Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren - Google Patents
Verfahren zum Herstellen eines segmentierten, thermoplastischen MischpolyesterelastomerenInfo
- Publication number
- DE2265294B2 DE2265294B2 DE2265294A DE2265294A DE2265294B2 DE 2265294 B2 DE2265294 B2 DE 2265294B2 DE 2265294 A DE2265294 A DE 2265294A DE 2265294 A DE2265294 A DE 2265294A DE 2265294 B2 DE2265294 B2 DE 2265294B2
- Authority
- DE
- Germany
- Prior art keywords
- polyester
- short
- mixed
- mixed polyester
- chain ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 229920000728 polyester Polymers 0.000 title claims description 72
- 229920001169 thermoplastic Polymers 0.000 title claims description 10
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 9
- 229920001971 elastomer Polymers 0.000 title claims description 8
- 239000000806 elastomer Substances 0.000 title claims description 8
- 238000000034 method Methods 0.000 title description 25
- 150000002148 esters Chemical class 0.000 claims description 34
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 125000004185 ester group Chemical group 0.000 claims 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 35
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 30
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000003054 catalyst Substances 0.000 description 13
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 12
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 238000001746 injection moulding Methods 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 230000035515 penetration Effects 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000000748 compression moulding Methods 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 238000006068 polycondensation reaction Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000000155 melt Substances 0.000 description 6
- 238000012545 processing Methods 0.000 description 6
- 238000010791 quenching Methods 0.000 description 6
- 230000000171 quenching effect Effects 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical group O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- -1 terephthalic acid Chemical class 0.000 description 5
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 238000013031 physical testing Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000005809 transesterification reaction Methods 0.000 description 4
- 229920001634 Copolyester Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical class [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 238000004026 adhesive bonding Methods 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- 238000003490 calendering Methods 0.000 description 2
- 238000005266 casting Methods 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000004745 nonwoven fabric Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- KJDRSWPQXHESDQ-UHFFFAOYSA-N 1,4-dichlorobutane Chemical compound ClCCCCCl KJDRSWPQXHESDQ-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- GSOYMOAPJZYXTB-UHFFFAOYSA-N 2,6-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxyphenyl)phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 GSOYMOAPJZYXTB-UHFFFAOYSA-N 0.000 description 1
- OZIKUNPJXSWSMD-UHFFFAOYSA-L 2-carboxyphenolate;manganese(2+) Chemical compound [Mn+2].OC1=CC=CC=C1C([O-])=O.OC1=CC=CC=C1C([O-])=O OZIKUNPJXSWSMD-UHFFFAOYSA-L 0.000 description 1
- PFANXOISJYKQRP-UHFFFAOYSA-N 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(CCC)C1=CC(C(C)(C)C)=C(O)C=C1C PFANXOISJYKQRP-UHFFFAOYSA-N 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical class OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- VSAWBBYYMBQKIK-UHFFFAOYSA-N 4-[[3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-2,6-ditert-butylphenol Chemical compound CC1=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C(CC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)C(C)=C1CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 VSAWBBYYMBQKIK-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 238000007590 electrostatic spraying Methods 0.000 description 1
- 238000010285 flame spraying Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000010128 melt processing Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000909 polytetrahydrofuran Polymers 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007761 roller coating Methods 0.000 description 1
- 238000010106 rotational casting Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000010345 tape casting Methods 0.000 description 1
- 238000009864 tensile test Methods 0.000 description 1
- 238000001721 transfer moulding Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- BOXSVZNGTQTENJ-UHFFFAOYSA-L zinc dibutyldithiocarbamate Chemical compound [Zn+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC BOXSVZNGTQTENJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/66—Polyesters containing oxygen in the form of ether groups
- C08G63/668—Polyesters containing oxygen in the form of ether groups derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/672—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12586071A | 1971-03-18 | 1971-03-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2265294A1 DE2265294A1 (de) | 1977-04-21 |
| DE2265294B2 true DE2265294B2 (de) | 1980-07-03 |
Family
ID=22421773
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2265294A Ceased DE2265294B2 (de) | 1971-03-18 | 1972-03-17 | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren |
| DE2213128A Expired DE2213128C3 (de) | 1971-03-18 | 1972-03-17 | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2213128A Expired DE2213128C3 (de) | 1971-03-18 | 1972-03-17 | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3766146A (enExample) |
| AU (1) | AU463751B2 (enExample) |
| BE (1) | BE779683A (enExample) |
| BR (1) | BR7201570D0 (enExample) |
| CA (1) | CA976295A (enExample) |
| DE (2) | DE2265294B2 (enExample) |
| ES (1) | ES399651A1 (enExample) |
| FR (1) | FR2130378B1 (enExample) |
| GB (1) | GB1372630A (enExample) |
| IT (1) | IT947589B (enExample) |
| NL (1) | NL158823B (enExample) |
| SE (2) | SE407072B (enExample) |
| ZA (1) | ZA72703B (enExample) |
Families Citing this family (144)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3766146A (en) * | 1971-03-18 | 1973-10-16 | Du Pont | Segmented thermoplastic copolyester elastomers |
| US4001188A (en) * | 1972-06-15 | 1977-01-04 | Standard Oil Company (Indiana) | Dimethyl 2,5-dibromoterephthalate esterification |
| US3896078A (en) * | 1972-12-18 | 1975-07-22 | Du Pont | Stabilization of polymers containing poly(alkylene oxide) units |
| CA1035092A (en) * | 1973-02-20 | 1978-07-18 | E.I. Du Pont De Nemours And Company | Soft thermoplastic segmented copolyesters as pressure sensitive adhesives |
| US3904706A (en) * | 1973-03-15 | 1975-09-09 | Du Pont | Stabilization of polymers containing poly(alkylene oxide) units |
| JPS5636241B2 (enExample) * | 1973-10-01 | 1981-08-22 | ||
| JPS5249204B2 (enExample) * | 1973-10-01 | 1977-12-15 | ||
| US3907926A (en) * | 1973-12-19 | 1975-09-23 | Du Pont | Blends of thermoplastic copolyetherester with poly-butylene terephthalate |
| US3957706A (en) * | 1974-02-04 | 1976-05-18 | Eastman Kodak Company | Molding composition |
| US3917743A (en) * | 1974-03-07 | 1975-11-04 | Du Pont | Copolyetherester blends |
| US3905398A (en) * | 1974-04-23 | 1975-09-16 | Moore & Co Samuel | Composite reinforced hose wherein the reinforcing material is braided aromatic polyamide filaments |
| FR2273021B1 (enExample) * | 1974-05-31 | 1977-03-11 | Ato Chimie | |
| US3977454A (en) * | 1974-07-05 | 1976-08-31 | Monsanto Company | Integral pneumatic tire and wheel comprising a wheel portion with axially spaced members |
| JPS5419027B2 (enExample) * | 1974-09-26 | 1979-07-12 | ||
| US3943189A (en) * | 1974-11-29 | 1976-03-09 | Eastman Kodak Company | Process for preparation of copolymers from polyesters and aliphatic polyformals |
| JPS558023B2 (enExample) * | 1975-02-27 | 1980-03-01 | ||
| US4010222A (en) * | 1975-05-23 | 1977-03-01 | E. I. Du Pont De Nemours And Company | Blends of copolyesters and ethylene/carboxylic acid copolymers which are at least ten percent neutralized |
| US4025694A (en) * | 1975-06-30 | 1977-05-24 | Minnesota Mining And Manufacturing Company | Magnetic recording medium having segmented copolyester binder |
| JPS5225898A (en) * | 1975-08-22 | 1977-02-26 | Toray Ind Inc | Process for producing copolyesters |
| DE2545720A1 (de) * | 1975-10-11 | 1977-04-21 | Bayer Ag | Schnellkristallisierende blockcopolyester |
| US4094865A (en) * | 1976-01-02 | 1978-06-13 | Monsanto Company | Polyester of a cyclic diacid anhydride with an epoxide |
| US4206011A (en) * | 1976-05-27 | 1980-06-03 | Western Electric Company, Inc. | Apparatus for insulating flexible conductors |
| US4116925A (en) * | 1976-06-14 | 1978-09-26 | Gaf Corporation | Poly(tetramethylene terephthalate)-polyether block |
| US4076226A (en) * | 1976-09-02 | 1978-02-28 | E. I. Du Pont De Nemours And Company | Energy absorbing mechanism |
| GB1561884A (en) * | 1976-12-14 | 1980-03-05 | Du Pont | Elastomer blend |
| US4198037A (en) * | 1976-12-28 | 1980-04-15 | Miner Enterprises, Inc. | Method of making polyester elastomer compression spring and resulting product |
| US4063713A (en) * | 1977-01-26 | 1977-12-20 | E. I. Du Pont De Nemours And Company | Guard rail |
| US4121642A (en) * | 1977-03-04 | 1978-10-24 | E. I. Du Pont De Nemours And Company | Pneumatic tire |
| GB1603205A (en) * | 1977-04-12 | 1981-11-18 | Raychem Ltd | Polymer compositions |
| US4123411A (en) * | 1977-05-12 | 1978-10-31 | Monsanto Company | Plasticized composition of copolyetherester elastomer and aromatic sulfonamide |
| US4127127A (en) * | 1977-05-23 | 1978-11-28 | Alza Corporation | Therapeutic systems made from certain segmented copolyesters |
| US4185003A (en) * | 1978-02-16 | 1980-01-22 | E. I. Du Pont De Nemours And Company | Stabilized copolyetheresters |
| US4136090A (en) * | 1978-03-02 | 1979-01-23 | E. I. Du Pont De Nemours And Company | Stabilized copolyetherester compositions |
| US4332855A (en) * | 1978-04-14 | 1982-06-01 | Raychem Corporation | Polymeric compositions |
| JPS6042813B2 (ja) * | 1978-06-05 | 1985-09-25 | 東レ株式会社 | ポリエステルエラストマの製造法 |
| US4224946A (en) * | 1978-08-14 | 1980-09-30 | American Cyanamid Company | Surgical sutures derived from segmented polyether-ester block copolymers |
| USRE32770E (en) * | 1978-08-14 | 1988-10-25 | American Cyanamid Company | Surgical suture derived from segmented polyether-ester block copolymers |
| US4246904A (en) * | 1979-01-29 | 1981-01-27 | American Cyanamid Company | Surgical suture derived from segmented polyether-ester block copolymers |
| US4219460A (en) * | 1978-10-04 | 1980-08-26 | Monsanto Company | Block copolymer hot melt adhesive composition |
| US5147382A (en) * | 1978-12-08 | 1992-09-15 | Ethicon, Inc. | Elastomeric surgical sutures comprising segmented copolyether/esters |
| US4314561A (en) * | 1979-01-29 | 1982-02-09 | American Cyanamid Company | Surgical suture derived from segmented polyether-ester block copolymers |
| US4266409A (en) * | 1979-02-16 | 1981-05-12 | E. I. Du Pont De Nemours And Company | Energy-absorbing torque transmitter |
| US4205158A (en) * | 1979-03-28 | 1980-05-27 | E. I. Du Pont De Nemours And Company | Copolyetherester based on ethylene oxide-capped poly(propylene oxide) glycol and branching agent |
| EP0019575B1 (en) * | 1979-05-17 | 1984-04-04 | The Goodyear Tire & Rubber Company | Random elastomeric copolyesters |
| FR2466478B2 (fr) * | 1979-10-02 | 1986-03-14 | Ato Chimie | Procede de preparation de copolyetheresteramides aliphatiques elastomeres |
| US4407888A (en) * | 1979-12-07 | 1983-10-04 | Raychem Limited | Dimensionally recoverable article with adhesive portion |
| US4277391A (en) * | 1979-12-27 | 1981-07-07 | Gaf Corporation | Durable polyester molding composition and product |
| US4351745A (en) * | 1980-01-09 | 1982-09-28 | E. I. Du Pont De Nemours And Company | Electrically conductive polyetherester elastomers |
| US4337192A (en) * | 1980-08-15 | 1982-06-29 | General Electric Company | Thermoplastic molding composition having improved warp resistance and process for preparing the same |
| US4405749A (en) * | 1980-10-14 | 1983-09-20 | Gaf Corporation | Thermoplastic elastomer compositions |
| US4355155A (en) * | 1980-10-14 | 1982-10-19 | Gaf Corporation | Thermoplastic copolyester elastomer |
| US4362836A (en) * | 1980-10-24 | 1982-12-07 | E. I. Du Pont De Nemours And Company | Thermoplastic copolyester elastomers modified with salts of aliphatic polycarboxylic acid |
| CA1177593A (en) * | 1981-05-01 | 1984-11-06 | Daniel W. Fox | Polycarbonate/poly(ethylene terephthalate) resin solutions |
| US4645804A (en) * | 1981-05-01 | 1987-02-24 | General Electric Company | Polycarbonate/imide hetero group condensation polymer blends |
| US4652617A (en) * | 1981-05-01 | 1987-03-24 | General Electric Company | Polycarbonate/ester hetero group condensation polymer blends |
| US4397986A (en) * | 1982-03-03 | 1983-08-09 | Ethyl Corporation | Thermoplastic polyester blends |
| US4363892A (en) * | 1982-03-05 | 1982-12-14 | E. I. Du Pont De Nemours And Company | Thermoplastic copolyester elastomers modified with salts of phenolic compounds |
| ES8607103A1 (es) | 1982-08-12 | 1986-06-01 | Du Pont | Un material de soporte para mobiliario con configuracion reticulada |
| US4426420A (en) | 1982-09-17 | 1984-01-17 | E. I. Du Pont De Nemours And Company | Spunlaced fabric containing elastic fibers |
| US4495668A (en) * | 1982-09-27 | 1985-01-29 | Adams Bruce M | Multistate precipitation removal tool |
| CA1226089A (en) * | 1982-12-02 | 1987-08-25 | Cornelius M.F. Vrouenraets | Packaging film permeable to smoke constituents and packaged, smoked foodstuff |
| US4469738A (en) * | 1983-01-21 | 1984-09-04 | E. I. Du Pont De Nemours And Company | Oriented net furniture support material |
| US4469739A (en) * | 1983-01-21 | 1984-09-04 | E. I. Du Pont De Nemours And Company | Oriented woven furniture support material |
| US4581420A (en) * | 1984-12-24 | 1986-04-08 | General Electric Company | Copolyetherester-hexahydrophthalate ester-block copolymers |
| US4751132A (en) * | 1985-10-28 | 1988-06-14 | E. I. Du Pont De Nemours And Company | Process for making polyetherester elastomer film |
| US4731407A (en) * | 1985-10-28 | 1988-03-15 | E. I. Du Pont De Nemours And Company | Polyetherester elastomer composition |
| US4824723A (en) * | 1986-06-02 | 1989-04-25 | General Electric Company | Flame resistant electrical insulating material |
| EP0374313B2 (en) * | 1988-12-20 | 1997-07-02 | E.I. Du Pont De Nemours And Company | Polyester resin filled with low-adhesive glass fibre |
| US5106678A (en) * | 1989-03-06 | 1992-04-21 | General Motors Corporation | Elastomeric filament and its woven fabric |
| US5009955A (en) * | 1989-03-06 | 1991-04-23 | General Motors Corporation | Dual modulus oriented elastomeric filaments |
| US5012801A (en) * | 1989-07-19 | 1991-05-07 | Johnson & Johnson Consumer Products, Inc. | Low friction film dressing |
| US5399608A (en) * | 1989-10-20 | 1995-03-21 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5254640A (en) * | 1990-06-29 | 1993-10-19 | General Electric Company | Copolyetherimide ester compositions |
| US5262493A (en) * | 1990-06-29 | 1993-11-16 | General Electric Company | Blow-moldable copolyethenimide kister compositions salts of aliphatic polycarboxylic acid |
| US5110668A (en) * | 1990-12-21 | 1992-05-05 | General Electric Company | Flexible laminate having copolyetherester adhesive |
| US5202069A (en) * | 1991-04-23 | 1993-04-13 | Astro-Valcour, Inc. | Method for producing foamed, molded thermoplastic articles |
| US5246976A (en) * | 1991-04-23 | 1993-09-21 | Astro-Valcour, Inc. | Apparatus for producing foamed, molded thermoplastic articles and articles produced thereby |
| DE4137290A1 (de) * | 1991-11-13 | 1993-05-19 | Bayer Ag | Wirkstoffhaltige formkoerper auf basis thermoplastisch verarbeitbarer elastomerer copolyester, verfahren zu ihrer herstellung und verwendung zur kontrolle von schaedlingen |
| WO1993018315A1 (en) * | 1992-03-02 | 1993-09-16 | Dayco Products, Inc. | Toothed belt construction formed mainly of thermoplastic material and method of making the same |
| DE4227419A1 (de) * | 1992-08-19 | 1994-02-24 | Bayer Ag | Thermoplastische Formmassen zur Herstellung von anorganischen Sinterformteilen, sowie Verfahren zur Herstellung von anorganischen Sinterformteilen |
| CA2103420A1 (en) * | 1992-12-22 | 1994-06-23 | Eileen B. Walsh | Stabilization of low molecular weight polybutylene terephthalate/polyester blends with phosphorus compounds |
| US5441997A (en) * | 1992-12-22 | 1995-08-15 | General Electric Company | High density polyester-polycarbonate molding composition |
| US5346767A (en) * | 1992-12-22 | 1994-09-13 | General Electric Company | Abrasion resistant highly filled polyester compositions |
| US5624737A (en) * | 1993-02-18 | 1997-04-29 | General Electric Company | Method for adhering materials having differing expansion properties and articles produced therefrom |
| US5349000A (en) * | 1993-02-25 | 1994-09-20 | Air Products And Chemicals, Inc. | Extrudable polyvinyl alcohol compositions containing polyester-polyether block copolymers |
| IT1264139B1 (it) * | 1993-04-19 | 1996-09-16 | Ausimont Spa | Polimeri fluorurati contenenti sequenze perfluoropoliossialchileniche ed aventi proprieta' di elastomeri termoplastici |
| US5849846A (en) * | 1994-07-25 | 1998-12-15 | Advanced Cardiovascular Systems, Inc. | Balloons for medical catheters |
| US5554120A (en) * | 1994-07-25 | 1996-09-10 | Advanced Cardiovascular Systems, Inc. | Polymer blends for use in making medical devices including catheters and balloons for dilatation catheters |
| US5674931A (en) * | 1995-04-07 | 1997-10-07 | General Electric Company | Flame retardant heavily filled thermoplastic composition |
| US6087591A (en) * | 1995-04-26 | 2000-07-11 | Nguyen; Phu D. | Insulated electrical conductors |
| EP0783016B1 (de) * | 1996-01-02 | 2002-07-31 | Sympatex Technologies GmbH | Mit Kohlenstoffteilchen pigmentierte wasserdampfdurchlässige, wasserdichte Polyetherestermembran |
| US7307031B2 (en) | 1997-05-29 | 2007-12-11 | The Procter & Gamble Company | Breathable composite sheet structure and absorbent articles utilizing same |
| US5865823A (en) | 1996-11-06 | 1999-02-02 | The Procter & Gamble Company | Absorbent article having a breathable, fluid impervious backsheet |
| US6677258B2 (en) | 1996-05-29 | 2004-01-13 | E. I. Du Pont De Nemours And Company | Breathable composite sheet structure and absorbent articles utilizing same |
| US5976692A (en) * | 1997-11-21 | 1999-11-02 | E. I. Du Pont De Nemours And Company | Natural bristle replacement for cosmetic and other brushes |
| US6187696B1 (en) | 1997-12-03 | 2001-02-13 | E. I. Du Pont De Nemours And Company | Breathable composite sheet structure |
| US5938648A (en) * | 1997-12-03 | 1999-08-17 | The Procter & Gamble Co. | Absorbent articles exhibiting improved internal environmental conditions |
| US5861452A (en) * | 1998-03-20 | 1999-01-19 | E. I. Du Pont De Nemours And Company | Scratch and scuff resistant polymer |
| US6060407A (en) * | 1998-07-29 | 2000-05-09 | Atlantech International, Inc. | Advanced integrally formed load support systems |
| CN1103792C (zh) * | 1998-08-21 | 2003-03-26 | 南亚塑胶工业股份有限公司 | 改良了耐光性的热塑性嵌段式共聚醚酯 |
| US6075113A (en) * | 1998-10-05 | 2000-06-13 | Mirror Image Technologies, Inc. | Wheel composition |
| NL1010385C2 (nl) * | 1998-10-23 | 2000-04-26 | Dsm Nv | Bereiding van een copolyetherester. |
| US6562906B2 (en) * | 2000-08-11 | 2003-05-13 | E. I. Du Pont De Nemours And Company | Bi-modal ionomers |
| US8193283B2 (en) | 2000-08-11 | 2012-06-05 | E. I. Du Pont De Nemours And Company | Golf balls with soft, resilient bimodal ionomeric covers |
| US6423789B1 (en) | 2001-08-10 | 2002-07-23 | E. I. Dupont De Nemours & Company | Process to produce poly(alkylene ether)glycol-containing polyesters |
| US6610795B2 (en) | 2001-08-10 | 2003-08-26 | E. I. Du Pont De Nemours And Company | Process to produce poly(alkylene ether) glycol-containing polyesters |
| US6399737B1 (en) | 2001-09-21 | 2002-06-04 | General Electric Company | EMI-shielding thermoplastic composition, method for the preparation thereof, and pellets and articles derived therefrom |
| US6599625B2 (en) | 2001-10-31 | 2003-07-29 | E. I. Du Pont De Nemours And Company | Polyether ester elastomer comprising polytrimethylene ether ester soft segment and trimethylene ester hard segment |
| US6562457B1 (en) | 2001-10-31 | 2003-05-13 | E. I. Du Pont De Nemours And Company | Polyether ester elastomer comprising polytrimethylene ether ester soft segment and tetramethylene ester hard segment |
| US6986864B2 (en) * | 2002-04-30 | 2006-01-17 | David Scott Porter | Polyester compositions |
| US7625994B2 (en) | 2002-07-30 | 2009-12-01 | E.I. Du Pont De Nemours And Company | Sulfonated aliphatic-aromatic copolyetheresters |
| US7223456B2 (en) * | 2004-03-18 | 2007-05-29 | Noveon, Inc. | Flexible laminated plastic pipe having a chlorinated poly(vinyl chloride) hollow core |
| KR20070055507A (ko) * | 2004-08-25 | 2007-05-30 | 이 아이 듀폰 디 네모아 앤드 캄파니 | 골프공용 열가소성 성분의 제조 방법 |
| AU2005304620A1 (en) * | 2004-11-08 | 2006-05-18 | E.I. Dupont De Nemours And Company | Toughened polyamide for food packaging and health care applications |
| US7897685B2 (en) * | 2004-12-07 | 2011-03-01 | E. I. Du Pont De Nemours And Company | Thermoplastic elastomer compositions |
| DE102005048131A1 (de) * | 2005-10-06 | 2007-04-12 | Bayer Innovation Gmbh | Antimikrobielle Kunststoffzusammensetzung mit niedriger Elutionsrate und langer Wirksamkeit |
| EP1839836B1 (en) * | 2006-03-28 | 2018-12-05 | So.F.Ter. Spa | An injection process for making a moulding completely recyclable, multi-layered article |
| US7799838B2 (en) * | 2006-07-26 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Elastomer blends of polyesters and copolyetheresters derived from polyethylene terephthalate, method of manufacture, and articles therefrom |
| US8158710B2 (en) * | 2006-11-27 | 2012-04-17 | Sabic Innovative Plastics Ip B.V. | Polyester blends, methods of making, and articles formed therefrom |
| JP5299819B2 (ja) * | 2007-02-12 | 2013-09-25 | ディーエスエム アイピー アセッツ ビー.ブイ. | ポリマー組成物およびそれから作製されたプラスチック管 |
| DE102007006761A1 (de) | 2007-02-12 | 2008-08-14 | Bayer Innovation Gmbh | Teilneutralisierte Wirkstoffe enthaltende Polymerformmassen |
| US7834089B2 (en) | 2007-05-08 | 2010-11-16 | E. I. Du Pont De Nemours And Company | Ionomeric ethylene vinyl alcohol compositions |
| US20090069489A1 (en) * | 2007-09-12 | 2009-03-12 | Peter Vollenberg | Polycarbonate-poly(ester-ether) copolymer composition, method of manufacture, and articles therefrom |
| US7799892B2 (en) * | 2008-05-02 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Method of making polybutylene terephthalate and compositions and articles comprising the same |
| US20090286905A1 (en) * | 2008-05-19 | 2009-11-19 | E. I. Du Pont De Nemours And Company | Toughened Blends of Cellulose Esters with Polyacetals |
| US20090324975A1 (en) * | 2008-06-27 | 2009-12-31 | E. I. Du Pont De Nemours And Company | Metal-resin composite member and manufacturng method therefo |
| EP2379311B1 (en) * | 2008-12-22 | 2018-05-30 | 3D Systems, Inc. | Polyester powder compositions, methods and articles |
| US8757231B2 (en) * | 2009-01-26 | 2014-06-24 | E. I. Du Pont De Nemours And Company | Elastomer tire sealing ring |
| US20110033710A1 (en) * | 2009-07-24 | 2011-02-10 | E. I. Du Pont De Nemours And Company | Composite structures of a metal component with a resin component and articles thereof |
| US8389604B2 (en) * | 2009-11-02 | 2013-03-05 | E I Du Pont De Nemours And Company | Method for providing toughened poly(trimethylene terephthalate) molding resins |
| US20110105644A1 (en) * | 2009-11-02 | 2011-05-05 | E. I. Du Pont De Nemours And Company | Toughened poly(trimethylene terephthalate) molding resins and molded articles therefrom |
| US8129471B2 (en) * | 2009-12-30 | 2012-03-06 | Sabic Innovative Plastics Ip B.V. | Polycarbonate-poly(ether-ester) copolymer composition, method of manufacture, and articles therefrom |
| US8518313B2 (en) * | 2010-05-21 | 2013-08-27 | E I Du Pont De Nemours And Company | Process for enhancing compression set resistance of foamed copolyester compositions |
| US20130158168A1 (en) * | 2011-12-19 | 2013-06-20 | E I Du Pont De Nemours And Company | Aliphatic-aromatic copolyetheresters |
| US9655691B2 (en) * | 2012-05-14 | 2017-05-23 | Align Technology, Inc. | Multilayer dental appliances and related methods and systems |
| CN113490590A (zh) | 2019-03-07 | 2021-10-08 | 科思创知识产权两合公司 | 用于生产合页,特别是用于生产多层书册封面的层结构 |
| EP4004084B1 (de) | 2019-07-31 | 2023-09-06 | Basf Se | Neue blockcopolymere |
| PT4084942T (pt) * | 2019-12-31 | 2025-06-30 | Dupont Polymers Inc | Mescla de polímeros |
| US12194768B2 (en) | 2020-10-26 | 2025-01-14 | Covestro Deutschland Ag | Layer structure with engraving as visible security element |
| EP4440846A1 (de) | 2021-11-30 | 2024-10-09 | Covestro Deutschland AG | Besondere kunststofffolie für die herstellung von sicherheitsdokumenten |
| DE202022000962U1 (de) | 2022-04-20 | 2022-07-19 | Covestro Deutschland Ag | Schichtaufbau zur Herstellung eines Scharniers, insbesondere für die Herstellung mehrschichtiger Buchdecken mit Sicherheitsmerkmalen |
| WO2024121010A1 (de) | 2022-12-05 | 2024-06-13 | Covestro Deutschland Ag | Mehrschichtaufbau mit guten eigenschaften zum bedrucken |
| WO2024245912A1 (de) | 2023-05-30 | 2024-12-05 | Covestro Deutschland Ag | Bedruckbare kunststofffolie für die herstellung von sicherheitsdokumenten |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1065826B (de) * | 1959-09-24 | LICENTIA Patent-Verwaltungs GmbH Hamburg | Verfahren zum Reinigen von Silicium | |
| US2465319A (en) * | 1941-07-29 | 1949-03-22 | Du Pont | Polymeric linear terephthalic esters |
| DE1056826B (de) * | 1956-06-22 | 1959-05-06 | Basf Ag | Verfahren zur Herstellung von hochmolekularen Polyestern |
| US3013914A (en) * | 1958-03-11 | 1961-12-19 | Du Pont | Terephthalic acid copolyester compositions |
| US3023192A (en) * | 1958-05-29 | 1962-02-27 | Du Pont | Segmented copolyetherester elastomers |
| FR1580834A (enExample) * | 1968-01-04 | 1969-09-12 | ||
| BE753040A (fr) * | 1969-07-18 | 1970-12-16 | Du Pont | Elastomeres de copolyesters thermoplastiques segmentes |
| BE755318A (fr) * | 1970-06-16 | 1971-02-26 | Celanese Corp | Composition peu ou pas combustible de poly (terephtalate d'alkylene) a mouler |
| US3766146A (en) * | 1971-03-18 | 1973-10-16 | Du Pont | Segmented thermoplastic copolyester elastomers |
-
1971
- 1971-03-18 US US00125860A patent/US3766146A/en not_active Expired - Lifetime
-
1972
- 1972-02-03 ZA ZA720703A patent/ZA72703B/xx unknown
- 1972-02-10 ES ES399651A patent/ES399651A1/es not_active Expired
- 1972-02-11 AU AU38905/72A patent/AU463751B2/en not_active Expired
- 1972-02-15 IT IT20601/72A patent/IT947589B/it active
- 1972-02-22 BE BE779683A patent/BE779683A/xx not_active IP Right Cessation
- 1972-02-24 CA CA135,522A patent/CA976295A/en not_active Expired
- 1972-03-09 GB GB1110472A patent/GB1372630A/en not_active Expired
- 1972-03-15 SE SE7203289A patent/SE407072B/xx unknown
- 1972-03-17 NL NL7203622.A patent/NL158823B/xx not_active Application Discontinuation
- 1972-03-17 BR BR1570/72A patent/BR7201570D0/pt unknown
- 1972-03-17 DE DE2265294A patent/DE2265294B2/de not_active Ceased
- 1972-03-17 DE DE2213128A patent/DE2213128C3/de not_active Expired
- 1972-03-17 FR FR7209394A patent/FR2130378B1/fr not_active Expired
-
1986
- 1986-01-16 SE SE8600189A patent/SE8600189L/sv not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SE407072B (sv) | 1979-03-12 |
| GB1372630A (en) | 1974-11-06 |
| DE2213128A1 (de) | 1972-09-21 |
| IT947589B (it) | 1973-05-30 |
| BR7201570D0 (pt) | 1974-01-02 |
| FR2130378A1 (enExample) | 1972-11-03 |
| DE2213128B2 (de) | 1977-06-02 |
| NL7203622A (enExample) | 1972-09-20 |
| AU463751B2 (en) | 1975-08-07 |
| NL158823B (nl) | 1978-12-15 |
| AU3890572A (en) | 1973-08-16 |
| BE779683A (fr) | 1972-06-16 |
| ZA72703B (en) | 1972-10-25 |
| SE8600189D0 (sv) | 1986-01-16 |
| DE2265294A1 (de) | 1977-04-21 |
| FR2130378B1 (enExample) | 1974-08-02 |
| CA976295A (en) | 1975-10-14 |
| US3766146A (en) | 1973-10-16 |
| DE2213128C3 (de) | 1986-03-27 |
| ES399651A1 (es) | 1974-11-16 |
| SE8600189L (sv) | 1986-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2265294B2 (de) | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren | |
| DE2265320B2 (de) | Verfahren zum Herstellen eines segmentierten, thermoplastischen Mischpolyesterelastomeren | |
| DE2327668C3 (de) | Verfahren zur Herstellung eines segmentierten, thermoplastischen Mischpolyesterelastomeren | |
| DE3011561C2 (de) | Copolyätherester, abgeleitet aus Terephthalsäure oder ihrem esterbildenden Äquivalent | |
| DE2303631C3 (de) | Verfahren zur Herstellung eines verbesserten segmentierten thermoplastischen Mischpolyester-Elastomeren | |
| DE2313874B2 (de) | Verfahren zur Herstellung eines segmentierten, thermoplastischen Mischpolyesters | |
| DE2263046B2 (de) | Verfahren zur Herstellung eines segmentierten thermoplastischen Copolyesterelastomeren | |
| DE2458472B2 (de) | Thermoplastische Copolyester | |
| DE2313903A1 (de) | Verzweigte thermoplastische copolyester | |
| DE2035333C2 (de) | Segmentierte thermoplastische Mischpolyesterelastomere und Verfahren zu ihrer Herstellung | |
| DE2412591C2 (enExample) | ||
| DE2328528C3 (de) | Verfahren zur Herstellung von thermoplastischen, elastomeren Copolyätherestern | |
| DE3586414T2 (de) | Zusammensetzung von thermoplastischem elastomer. | |
| DE2331596C3 (de) | Verfahren zur Herstellung von thermoplastischen, elastomeren Copolyätherestern | |
| DE2510111A1 (de) | Copolyaetherestermischungen | |
| DE2458470A1 (de) | Segmentierte, thermoplastische mischpolyesterelastomere | |
| DE2456536A1 (de) | Segmentiertes thermoplastisches copolyesterelastomeres | |
| DE2408149C2 (enExample) | ||
| DE69623258T2 (de) | Copolyetherester | |
| DE2513736A1 (de) | Verfahren zur herstellung eines treibriemens aus einem elastomeren | |
| DE2311849C3 (de) | Verfahren zur Herstellung von segmentierten, thermoplastischen, elastomeren Mischpolyestern | |
| DE2210119C3 (de) | Verfahren zur Herstellung thermoplastischer elastomerer Formmassen | |
| DE2364399A1 (de) | Stabilisierte form- und pressmassen | |
| DE1420467A1 (de) | Verfahren zur Herstellung von Copolyestern | |
| DE2348698A1 (de) | Copolyester mit einer logarithmischen viskositaetszahl von mindestens 0,4 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8235 | Patent refused |