DE2262028C2 - Neue Stilbenderivate - Google Patents
Neue StilbenderivateInfo
- Publication number
- DE2262028C2 DE2262028C2 DE2262028A DE2262028A DE2262028C2 DE 2262028 C2 DE2262028 C2 DE 2262028C2 DE 2262028 A DE2262028 A DE 2262028A DE 2262028 A DE2262028 A DE 2262028A DE 2262028 C2 DE2262028 C2 DE 2262028C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- solution
- stilbene
- sodium
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 title claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 14
- 150000001875 compounds Chemical class 0.000 description 14
- 239000003599 detergent Substances 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 10
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- -1 2-anilino-4-isopropylamino-1,3,5-triazinyl Chemical group 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000003513 alkali Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 239000004552 water soluble powder Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000005282 brightening Methods 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002828 nitro derivatives Chemical class 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 description 2
- 235000019792 magnesium silicate Nutrition 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- KOGDFDWINXIWHI-OWOJBTEDSA-N 4-[(e)-2-(4-aminophenyl)ethenyl]aniline Chemical compound C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1 KOGDFDWINXIWHI-OWOJBTEDSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000009988 textile finishing Methods 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1896571A CH557874A (de) | 1971-12-27 | 1971-12-27 | Waschmittel. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2262028A1 DE2262028A1 (de) | 1973-07-05 |
| DE2262028C2 true DE2262028C2 (de) | 1983-12-01 |
Family
ID=4436447
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2262028A Expired DE2262028C2 (de) | 1971-12-27 | 1972-12-19 | Neue Stilbenderivate |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3895009A (enExample) |
| JP (1) | JPS4875882A (enExample) |
| AU (1) | AU465121B2 (enExample) |
| BE (1) | BE793315A (enExample) |
| CA (1) | CA991176A (enExample) |
| CH (1) | CH557874A (enExample) |
| DE (1) | DE2262028C2 (enExample) |
| FR (1) | FR2167042A5 (enExample) |
| GB (1) | GB1384458A (enExample) |
| IT (1) | IT974258B (enExample) |
| NL (1) | NL7217021A (enExample) |
| SU (1) | SU571190A3 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3064762D1 (en) * | 1979-09-21 | 1983-10-13 | Procter & Gamble | Washing and softening compositions and methods for their manufacture |
| US4549980A (en) * | 1983-10-11 | 1985-10-29 | Mobay Chemical Corporation | White modification of a bis-triazinyl amino stilbene optical brightener and a process for making the same |
| EP0314630A3 (en) * | 1987-10-30 | 1989-10-25 | Sandoz Ag | Detergent compositions |
| DE19706238B4 (de) * | 1997-02-18 | 2005-09-01 | Bayer Chemicals Ag | Verfahren zur Herstellung von substituierten 4,4'-Diaminostilben-2,2'-disulfonsäuren |
| GB9726365D0 (en) | 1997-12-13 | 1998-02-11 | Ciba Sc Holding Ag | Compounds |
| US7270771B2 (en) * | 2002-07-05 | 2007-09-18 | Ciba Specialty Chemicals Corporation | Triazinylaminostilbene disulphonic acid mixtures |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3177207A (en) * | 1965-04-06 | Nh-chs | ||
| DE870263C (de) * | 1951-05-01 | 1953-03-12 | Ciba Geigy | Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') |
| BE551712A (enExample) * | 1955-10-12 | |||
| DE1119646B (de) * | 1959-12-15 | 1961-12-14 | Du Pont | Optisches Bleichmittel fuer Papier |
| CH386436A (de) * | 1960-07-28 | 1965-01-15 | Geigy Ag J R | Verfahren zur Herstellung von Bis-triazinylaminostilbenverbindungen |
| NL130816C (enExample) * | 1964-02-24 | |||
| NL126746C (enExample) * | 1964-11-20 | |||
| US3558611A (en) * | 1968-02-19 | 1971-01-26 | Sandoz Ltd | Novel stilbene derivatives |
| DE1954742C3 (de) * | 1968-10-31 | 1981-02-05 | Ciba-Geigy Ag, Basel (Schweiz) | 4,4'-Bis-(sulfoanilino-triazinylamino)-stilben-2,2'-disulfosäuren |
-
0
- BE BE793315D patent/BE793315A/xx unknown
-
1971
- 1971-12-27 CH CH1896571A patent/CH557874A/xx not_active IP Right Cessation
-
1972
- 1972-12-14 FR FR7244620A patent/FR2167042A5/fr not_active Expired
- 1972-12-14 AU AU50093/72A patent/AU465121B2/en not_active Expired
- 1972-12-14 NL NL7217021A patent/NL7217021A/xx not_active Application Discontinuation
- 1972-12-15 GB GB5804672A patent/GB1384458A/en not_active Expired
- 1972-12-18 US US316154A patent/US3895009A/en not_active Expired - Lifetime
- 1972-12-18 CA CA159,213A patent/CA991176A/en not_active Expired
- 1972-12-19 DE DE2262028A patent/DE2262028C2/de not_active Expired
- 1972-12-22 IT IT54960/72A patent/IT974258B/it active
- 1972-12-25 JP JP47129475A patent/JPS4875882A/ja active Pending
-
1974
- 1974-06-27 SU SU7402038428A patent/SU571190A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4875882A (enExample) | 1973-10-12 |
| CA991176A (en) | 1976-06-15 |
| AU465121B2 (en) | 1975-09-18 |
| NL7217021A (enExample) | 1973-06-29 |
| FR2167042A5 (enExample) | 1973-08-17 |
| US3895009A (en) | 1975-07-15 |
| IT974258B (it) | 1974-06-20 |
| SU571190A3 (ru) | 1977-08-30 |
| AU5009372A (en) | 1974-06-20 |
| CH557874A (de) | 1975-01-15 |
| GB1384458A (en) | 1975-02-19 |
| DE2262028A1 (de) | 1973-07-05 |
| BE793315A (fr) | 1973-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1206296B (de) | Konzentriertes fluessiges Aufhellungsmittel fuer Papiere | |
| EP0053220B1 (de) | Verfahren zur Herstellung elektrolytarmer sulfonsäuregruppenhaltiger Verbindungen | |
| DE2262028C2 (de) | Neue Stilbenderivate | |
| DE2625945A1 (de) | Neue quartaere ammoniumverbindungen und deren verwendung als textilweichmacher | |
| DE859313C (de) | Verfahren zur Herstellung von Bis-[2-morpholino-4-amino-1, 3, 5-triazyl-(6)]-4, 4''-diaminostilbendisulfon- und -dicarbonsaeuren | |
| DE1545920A1 (de) | Verfahren zur Herstellung optischer Aufheller der Stilbenreihe | |
| DE1011889B (de) | Verfahren zur Herstellung von optischen Bleichmitteln | |
| EP0229980B1 (de) | Verfahren zur Herstellung kationischer Hydrazonfarbstoffe | |
| DE1419333B1 (de) | Optische Aufhellungsmittel | |
| DE60133821T2 (de) | Verfahren zum optischen aufhellen von baumwolle | |
| DE3802204A1 (de) | Mischungen von optischen aufhellern | |
| EP0238446B1 (de) | Mischungen von optischen Aufhellern | |
| DE2233429A1 (de) | Bis-s-triazinylamino-stilben-2,2'disulfonsaeuren, deren herstellung und deren verwendung als optische aufhellmittel | |
| EP0248356B1 (de) | Schwefelsäureester-Gruppen enthaltende Naphthalimide, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0074056A1 (de) | Wäscheweichspülmittel | |
| DE2201857C3 (de) | Verwendung von Bis-stilbenverbindeungen als optische Aufhellmittel | |
| DE4228295A1 (de) | N-(n'-langkettiges acyl-beta-alanyl)-beta-alanin oder dessen salz und diese enthaltende detergenszusammensetzungen | |
| DE1100583B (de) | Aufhellungsmittel | |
| DE972955C (de) | Verfahren zur Herstellung von optischen Bleichmitteln | |
| DE2345401A1 (de) | Weichmacherzusammensetzung fuer textilien | |
| DE1419333C (de) | Optische Aufhellungsmittel | |
| DE1519479C3 (de) | Verfahren zum optischen Aufhellen von Fasermaterial aus gegebenenfalls veresterter Cellulose oder aus Polyamid | |
| DE1443980A1 (de) | Verfahren zur Herstellung optischer Aufheller der Stilbenreihe | |
| DE1055001B (de) | Verfahren zur Herstellung von zur optischen Aufhellung von Polyamidfasern geeignetenStilbenabkoemmlingen | |
| DE942396C (de) | Verfahren zur Herstellung von fluoreszierenden Bistriazinylaminostilbenverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8126 | Change of the secondary classification |
Ipc: D06L 3/12 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |