DE2259360C2 - Verfahren zur Herstellung von dünnen Schichten auf Basis von Polyurethan-Elastomeren - Google Patents
Verfahren zur Herstellung von dünnen Schichten auf Basis von Polyurethan-ElastomerenInfo
- Publication number
- DE2259360C2 DE2259360C2 DE2259360A DE2259360A DE2259360C2 DE 2259360 C2 DE2259360 C2 DE 2259360C2 DE 2259360 A DE2259360 A DE 2259360A DE 2259360 A DE2259360 A DE 2259360A DE 2259360 C2 DE2259360 C2 DE 2259360C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction mixture
- layer
- polyurethane
- monomers
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 27
- 238000004519 manufacturing process Methods 0.000 title claims description 20
- 229920003225 polyurethane elastomer Polymers 0.000 title claims description 11
- 239000011541 reaction mixture Substances 0.000 claims description 42
- 239000000178 monomer Substances 0.000 claims description 29
- 239000000203 mixture Substances 0.000 claims description 23
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 18
- 125000005442 diisocyanate group Chemical group 0.000 claims description 17
- 239000007788 liquid Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 238000010438 heat treatment Methods 0.000 claims description 11
- 229920000728 polyester Polymers 0.000 claims description 11
- 150000002009 diols Chemical class 0.000 claims description 10
- 229920000570 polyether Polymers 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 238000001879 gelation Methods 0.000 claims description 8
- 239000003999 initiator Substances 0.000 claims description 8
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 7
- 150000002513 isocyanates Chemical class 0.000 claims description 7
- 239000012190 activator Substances 0.000 claims description 6
- 239000012948 isocyanate Substances 0.000 claims description 6
- 150000004985 diamines Chemical class 0.000 claims description 5
- 238000004132 cross linking Methods 0.000 claims description 4
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 4
- 150000003673 urethanes Chemical class 0.000 claims description 4
- 239000010410 layer Substances 0.000 description 56
- 229920002635 polyurethane Polymers 0.000 description 30
- 239000004814 polyurethane Substances 0.000 description 30
- 238000002156 mixing Methods 0.000 description 17
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- 235000019589 hardness Nutrition 0.000 description 12
- 238000005266 casting Methods 0.000 description 10
- 150000003077 polyols Chemical class 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 229920005862 polyol Polymers 0.000 description 9
- 125000001931 aliphatic group Chemical group 0.000 description 8
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- -1 polyethylene terephthalate Polymers 0.000 description 8
- 230000004913 activation Effects 0.000 description 7
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 229910000831 Steel Inorganic materials 0.000 description 6
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 6
- 239000010959 steel Substances 0.000 description 6
- 238000000576 coating method Methods 0.000 description 5
- 238000001723 curing Methods 0.000 description 5
- 230000005855 radiation Effects 0.000 description 5
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- INQDDHNZXOAFFD-UHFFFAOYSA-N 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOC(=O)C=C INQDDHNZXOAFFD-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000011888 foil Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 238000001029 thermal curing Methods 0.000 description 4
- BQZJOQXSCSZQPS-UHFFFAOYSA-N 2-methoxy-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(OC)C(=O)C1=CC=CC=C1 BQZJOQXSCSZQPS-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- DAKWPKUUDNSNPN-UHFFFAOYSA-N Trimethylolpropane triacrylate Chemical compound C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C DAKWPKUUDNSNPN-UHFFFAOYSA-N 0.000 description 3
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 230000006735 deficit Effects 0.000 description 3
- 239000012975 dibutyltin dilaurate Substances 0.000 description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 3
- DNTMQTKDNSEIFO-UHFFFAOYSA-N n-(hydroxymethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCO DNTMQTKDNSEIFO-UHFFFAOYSA-N 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920005906 polyester polyol Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- 239000004971 Cross linker Substances 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- 229920002176 Pluracol® Polymers 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 230000005670 electromagnetic radiation Effects 0.000 description 2
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- POTYORUTRLSAGZ-UHFFFAOYSA-N (3-chloro-2-hydroxypropyl) prop-2-enoate Chemical compound ClCC(O)COC(=O)C=C POTYORUTRLSAGZ-UHFFFAOYSA-N 0.000 description 1
- VNMOIBZLSJDQEO-UHFFFAOYSA-N 1,10-diisocyanatodecane Chemical compound O=C=NCCCCCCCCCCN=C=O VNMOIBZLSJDQEO-UHFFFAOYSA-N 0.000 description 1
- GFNDFCFPJQPVQL-UHFFFAOYSA-N 1,12-diisocyanatododecane Chemical compound O=C=NCCCCCCCCCCCCN=C=O GFNDFCFPJQPVQL-UHFFFAOYSA-N 0.000 description 1
- MSAHTMIQULFMRG-UHFFFAOYSA-N 1,2-diphenyl-2-propan-2-yloxyethanone Chemical compound C=1C=CC=CC=1C(OC(C)C)C(=O)C1=CC=CC=C1 MSAHTMIQULFMRG-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- QFGCFKJIPBRJGM-UHFFFAOYSA-N 12-[(2-methylpropan-2-yl)oxy]-12-oxododecanoic acid Chemical compound CC(C)(C)OC(=O)CCCCCCCCCCC(O)=O QFGCFKJIPBRJGM-UHFFFAOYSA-N 0.000 description 1
- VZMLJEYQUZKERO-UHFFFAOYSA-N 2-hydroxy-1-(2-methylphenyl)-2-phenylethanone Chemical compound CC1=CC=CC=C1C(=O)C(O)C1=CC=CC=C1 VZMLJEYQUZKERO-UHFFFAOYSA-N 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- NDWUBGAGUCISDV-UHFFFAOYSA-N 4-hydroxybutyl prop-2-enoate Chemical compound OCCCCOC(=O)C=C NDWUBGAGUCISDV-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 235000000434 Melocanna baccifera Nutrition 0.000 description 1
- 241001497770 Melocanna baccifera Species 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- BWVAOONFBYYRHY-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=C(CO)C=C1 BWVAOONFBYYRHY-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001252 acrylic acid derivatives Polymers 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 150000008365 aromatic ketones Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- ORZGJQJXBLFGRP-AATRIKPKSA-N bis(ethenyl) (e)-but-2-enedioate Chemical compound C=COC(=O)\C=C\C(=O)OC=C ORZGJQJXBLFGRP-AATRIKPKSA-N 0.000 description 1
- ORZGJQJXBLFGRP-WAYWQWQTSA-N bis(ethenyl) (z)-but-2-enedioate Chemical compound C=COC(=O)\C=C/C(=O)OC=C ORZGJQJXBLFGRP-WAYWQWQTSA-N 0.000 description 1
- ZPOLOEWJWXZUSP-WAYWQWQTSA-N bis(prop-2-enyl) (z)-but-2-enedioate Chemical compound C=CCOC(=O)\C=C/C(=O)OCC=C ZPOLOEWJWXZUSP-WAYWQWQTSA-N 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- FPODCVUTIPDRTE-UHFFFAOYSA-N bis(prop-2-enyl) hexanedioate Chemical compound C=CCOC(=O)CCCCC(=O)OCC=C FPODCVUTIPDRTE-UHFFFAOYSA-N 0.000 description 1
- BKXRKRANFLFTFU-UHFFFAOYSA-N bis(prop-2-enyl) oxalate Chemical compound C=CCOC(=O)C(=O)OCC=C BKXRKRANFLFTFU-UHFFFAOYSA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- PMMYEEVYMWASQN-IMJSIDKUSA-N cis-4-Hydroxy-L-proline Chemical compound O[C@@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-IMJSIDKUSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- IYNRVIKPUTZSOR-HWKANZROSA-N ethenyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC=C IYNRVIKPUTZSOR-HWKANZROSA-N 0.000 description 1
- FFYWKOUKJFCBAM-UHFFFAOYSA-N ethenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC=C FFYWKOUKJFCBAM-UHFFFAOYSA-N 0.000 description 1
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229940086559 methyl benzoin Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- YQCFXPARMSSRRK-UHFFFAOYSA-N n-[6-(prop-2-enoylamino)hexyl]prop-2-enamide Chemical compound C=CC(=O)NCCCCCCNC(=O)C=C YQCFXPARMSSRRK-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OEIJHBUUFURJLI-UHFFFAOYSA-N octane-1,8-diol Chemical compound OCCCCCCCCO OEIJHBUUFURJLI-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000004540 pour-on Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical compound C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 229950006389 thiodiglycol Drugs 0.000 description 1
- RUELTTOHQODFPA-UHFFFAOYSA-N toluene 2,6-diisocyanate Chemical compound CC1=C(N=C=O)C=CC=C1N=C=O RUELTTOHQODFPA-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- MEBONNVPKOBPEA-UHFFFAOYSA-N trimethyl cyclohexane Natural products CC1CCCCC1(C)C MEBONNVPKOBPEA-UHFFFAOYSA-N 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/40—High-molecular-weight compounds
- C08G18/63—Block or graft polymers obtained by polymerising compounds having carbon-to-carbon double bonds on to polymers
- C08G18/637—Block or graft polymers obtained by polymerising compounds having carbon-to-carbon double bonds on to polymers characterised by the in situ polymerisation of the compounds having carbon-to-carbon double bonds in a reaction mixture of saturated polymers and isocyanates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F283/00—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyurethanes Or Polyureas (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Application Of Or Painting With Fluid Materials (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Paints Or Removers (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2259360A DE2259360C2 (de) | 1972-12-04 | 1972-12-04 | Verfahren zur Herstellung von dünnen Schichten auf Basis von Polyurethan-Elastomeren |
| CH1686673A CH614725A5 (enExample) | 1972-12-04 | 1973-11-30 | |
| IT54064/73A IT1000184B (it) | 1972-12-04 | 1973-12-03 | Procedimento per la produzione di strati sottili di elastomeri poliuretanici |
| GB5591973A GB1450906A (en) | 1972-12-04 | 1973-12-03 | Manufacture of thin layers of polyurethane elastomers |
| AT1010773A AT329280B (de) | 1972-12-04 | 1973-12-03 | Verfahren zur herstellung von dunnen schichten von polyurethan-elastomeren |
| CA187,265A CA1007595A (en) | 1972-12-04 | 1973-12-03 | Manufacture of thin layers of polyurethane elastomers |
| BE138471A BE808174A (fr) | 1972-12-04 | 1973-12-04 | Procede d'obtention de couches minces d'elastomeres de polyurethane |
| FR7343126A FR2208939B1 (enExample) | 1972-12-04 | 1973-12-04 | |
| US05/421,608 US4013806A (en) | 1972-12-04 | 1973-12-04 | Manufacture of thin layers of polyurethane elastomers |
| NL7316608A NL7316608A (enExample) | 1972-12-04 | 1973-12-04 | |
| JP13494073A JPS5718535B2 (enExample) | 1972-12-04 | 1973-12-04 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2259360A DE2259360C2 (de) | 1972-12-04 | 1972-12-04 | Verfahren zur Herstellung von dünnen Schichten auf Basis von Polyurethan-Elastomeren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2259360A1 DE2259360A1 (de) | 1974-06-12 |
| DE2259360C2 true DE2259360C2 (de) | 1982-06-09 |
Family
ID=5863499
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2259360A Expired DE2259360C2 (de) | 1972-12-04 | 1972-12-04 | Verfahren zur Herstellung von dünnen Schichten auf Basis von Polyurethan-Elastomeren |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4013806A (enExample) |
| JP (1) | JPS5718535B2 (enExample) |
| AT (1) | AT329280B (enExample) |
| BE (1) | BE808174A (enExample) |
| CA (1) | CA1007595A (enExample) |
| CH (1) | CH614725A5 (enExample) |
| DE (1) | DE2259360C2 (enExample) |
| FR (1) | FR2208939B1 (enExample) |
| GB (1) | GB1450906A (enExample) |
| IT (1) | IT1000184B (enExample) |
| NL (1) | NL7316608A (enExample) |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4174307A (en) * | 1972-12-14 | 1979-11-13 | Polychrome Corporation | Room-temperature-radiation-curable polyurethane |
| US4295909A (en) * | 1975-02-03 | 1981-10-20 | Loctite Corporation | Curable polybutadiene-based resins having improved properties |
| US4200762A (en) * | 1976-10-29 | 1980-04-29 | Thiokol Corporation | Actinic radiation curable polymers |
| US4247578A (en) * | 1977-01-14 | 1981-01-27 | Henkel Corporation | Interpenetrating dual cure resin compositions |
| NL7702518A (nl) * | 1977-03-09 | 1978-09-12 | Akzo Nv | Werkwijze voor het bekleden van een substraat met een stralingshardbare bekledingskompositie. |
| US4224357A (en) * | 1977-03-14 | 1980-09-23 | Kansai Paint Co., Ltd. | Method and composition for forming electron beam curing high build coating |
| NL7707669A (nl) * | 1977-07-08 | 1979-01-10 | Akzo Nv | Werkwijze voor het bekleden van een substraat met een stralingshardbare bekledingscompositie. |
| US4131602A (en) * | 1977-09-29 | 1978-12-26 | Union Carbide Corporation | Radiation curable acrylated polyurethane |
| US4135007A (en) * | 1977-12-29 | 1979-01-16 | Gaf Corporation | Radiation curable coating composition comprising an acryl urethane oligomer, and an ultra-violet absorber |
| US4129667A (en) * | 1977-12-29 | 1978-12-12 | Gaf Corporation | Radiation curable coating composition comprising an acryl urethane oligomer and an ultra-violet absorber |
| US4176212A (en) * | 1978-01-25 | 1979-11-27 | Design Cote Corporation | Radiation and moisture curable compositions and method of use |
| DE2964534D1 (en) * | 1978-07-21 | 1983-02-24 | Fischer Ag Georg | Method for the preparation of bodies from a charge resin |
| US4305854A (en) * | 1978-07-31 | 1981-12-15 | Polychrome Corporation | Radiation curable pressure sensitive adhesive |
| AU528378B2 (en) * | 1978-09-13 | 1983-04-28 | Rock, J.D. And Garnett, J.L. | Radiation cured coating for leather |
| DE2908628A1 (de) * | 1979-03-06 | 1980-09-11 | Bayer Ag | Feuchtigkeitshaertende einkomponenten-lacke und verfahren zur beschichtung von leder |
| DE2916271A1 (de) * | 1979-04-21 | 1980-10-30 | Bayer Ag | Verfahren zur herstellung von mit einer lackschicht versehenen formkoerpern aus vulkanisiertem gummi und eine anvulkanisierte lackschicht aufweisende formkoerper aus vulkanisiertem gummi |
| IT1141905B (it) * | 1980-02-22 | 1986-10-08 | Siv Soc Italiana Vetro | Procedimento per ottenere un rivestimento trasparente su lastre di vetro normale o di sicurezza |
| US4337130A (en) * | 1980-06-25 | 1982-06-29 | E. I. Du Pont De Nemours And Company | Photocurable polyurethane film coatings |
| US4454309A (en) * | 1980-11-12 | 1984-06-12 | Tyndale Plains-Hunter, Ltd. | Polyurethane polyene compositions |
| US4359558A (en) | 1980-11-12 | 1982-11-16 | Tyndale Plains-Hunter, Ltd. | Polyurethane diacrylate compositions |
| US4477405A (en) * | 1981-12-31 | 1984-10-16 | Ppg Industries, Inc. | Method of in-mold coating |
| US4451523A (en) * | 1982-11-12 | 1984-05-29 | Loctite Corporation | Conformal coating systems |
| US4415604A (en) * | 1982-11-12 | 1983-11-15 | Loctite Corporation | Conformal coating and potting system |
| US4424252A (en) | 1982-11-12 | 1984-01-03 | Loctite Corporation | Conformal coating systems |
| US4932750A (en) * | 1982-12-09 | 1990-06-12 | Desoto, Inc. | Single-coated optical fiber |
| GB2150938B (en) * | 1983-12-05 | 1987-04-23 | Tyndale Plains Hunter Limited | Hydrophilic polyurethane acrylate compositions |
| US4585819A (en) * | 1984-08-14 | 1986-04-29 | H. B. Fuller Company | Fusion adhesive which can comprise an isocyanate prepolymer, a thermoplastic polymer and/or a lower molecular weight ketone resin |
| IT1204812B (it) * | 1986-02-19 | 1989-03-10 | Siv Soc Italiana Vetro | Procedimento per la fabbricazione di una vetrata di sicurezza per autoveicoli ed edifici,e prodotto cosi' ottenuto |
| EP0241027A3 (en) * | 1986-04-11 | 1989-12-13 | Takeda Chemical Industries, Ltd. | An adhesive composition |
| US4808255A (en) * | 1987-05-07 | 1989-02-28 | H. B. Fuller Company | Thermally stable reactive hot melt urethane adhesive composition having a thermoplastic polymer, a compatible, curing urethane polyester polyol prepolymer and a tackifying agent |
| US4820368A (en) * | 1987-05-07 | 1989-04-11 | H. B. Fuller Company | Thermally stable reactive hot melt urethane adhesive composition having a thermoplastic polymer, a compatible, curing urethane polyalkylene polyol prepolymer and a tackifying agent |
| DE4101696A1 (de) * | 1991-01-22 | 1992-07-23 | Bayer Ag | Verwendung von zweikomponenten-systemen zur herstellung von einbrennbeschichtungen |
| US5391644A (en) * | 1992-05-08 | 1995-02-21 | Showa Highpolymer Co., Ltd. | Polyester injection-molded articles |
| BE1007714A3 (nl) * | 1993-11-09 | 1995-10-03 | Philips Electronics Nv | Werkwijze voor het vervaardigen van een plaat van elektrisch isolerend materiaal met een patroon van gaten en/of holtes. |
| US7728049B2 (en) * | 1996-10-08 | 2010-06-01 | Zamore Alan M | Irradiation conversion of thermoplastic to thermoset polymers |
| US6656550B1 (en) | 1996-10-08 | 2003-12-02 | Alan M. Zamore | Dilatation device of uniform outer diameter |
| US5900444A (en) * | 1996-10-08 | 1999-05-04 | Zamore; Alan | Irradiation conversion of thermoplastic to thermoset polyurethane |
| US7749585B2 (en) * | 1996-10-08 | 2010-07-06 | Alan Zamore | Reduced profile medical balloon element |
| DE69732121T2 (de) * | 1996-10-08 | 2005-12-01 | Alan Zamore | Umwandlung von thermoplastischen zu duroplastischen polymeren durch bestrahlung |
| AU738216B2 (en) * | 1997-03-14 | 2001-09-13 | Dow Chemical Company, The | Postcure treatment for reaction injection molded polyurethanes |
| US5777024A (en) * | 1997-04-30 | 1998-07-07 | The Valspar Corporation | Urethane resins and coating compositions and methods for their use |
| DE19920799A1 (de) | 1999-05-06 | 2000-11-16 | Basf Coatings Ag | Thermisch und mit aktinischer Strahlung härtbarer Beschichtungsstoff und seine Verwendung |
| DE19924674C2 (de) | 1999-05-29 | 2001-06-28 | Basf Coatings Ag | Thermisch und mit aktinischer Strahlung härtbarer Beschichtungsstoff und seine Verwendung |
| AU1245401A (en) * | 1999-10-29 | 2001-05-14 | Avery Dennison Corporation | An apparatus for high-throughput production of coat material arrays, and analytical methods using such arrays |
| US7448258B2 (en) * | 1999-10-29 | 2008-11-11 | Avery Dennison Corporation | High throughput screening for moisture barrier characteristics of materials |
| DE10113884B4 (de) * | 2001-03-21 | 2005-06-02 | Basf Coatings Ag | Verfahren zum Beschichten mikroporöser Oberflächen und Verwendung des Verfahrens |
| US6852771B2 (en) * | 2001-08-28 | 2005-02-08 | Basf Corporation | Dual radiation/thermal cured coating composition |
| US6835759B2 (en) * | 2001-08-28 | 2004-12-28 | Basf Corporation | Dual cure coating composition and processes for using the same |
| US20030077394A1 (en) * | 2001-08-28 | 2003-04-24 | Bradford Christophen J. | Dual cure coating composition and process for using the same |
| US20030078315A1 (en) * | 2001-08-28 | 2003-04-24 | Bradford Christopher J. | Dual cure coating composition and processes for using the same |
| DE10206225C1 (de) * | 2002-02-15 | 2003-09-18 | Basf Coatings Ag | Verfahren zur Herstellung farb- und/oder effektgebender Mehrschichtlackierungen |
| DE10248324A1 (de) * | 2002-10-17 | 2004-05-06 | Basf Coatings Ag | Thermisch und mit aktinischer Strahlung härtbarer Beschichtungsstoff und Verfahren zum Beschichten miktoporöser Oberflächen |
| US10287731B2 (en) * | 2005-11-08 | 2019-05-14 | Stowe Woodward Licensco Llc | Abrasion-resistant rubber roll cover with polyurethane coating |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2965553A (en) * | 1956-05-25 | 1960-12-20 | Du Pont | Curing of high molecular weight polymers |
| US3008917A (en) * | 1956-08-27 | 1961-11-14 | Pittsburgh Plate Glass Co | Coating mixture containing diisocyanate modified polyester and styrene |
| US2948611A (en) * | 1957-10-30 | 1960-08-09 | Du Pont | Photopolymerizable compositions, elements, and processes |
| US3361842A (en) * | 1963-04-25 | 1968-01-02 | Dow Chemical Co | Liquid copolymers of ethylene, another alpha olefin and carboxylic acids and compositions thereof with polyepoxides |
| US3396210A (en) * | 1965-09-20 | 1968-08-06 | Ashland Oil Inc | Compositions made from: (a) isocyanateterminated prepolymers; and (b) polyesters prepared from polyols and alpha, beta-ethylenically unsaturated monocarboxylic acids |
| US3624045A (en) * | 1965-10-22 | 1971-11-30 | Raychem Corp | Crosslinked heat recoverable thermoplastic polyurethanes |
| GB1183693A (en) * | 1967-08-23 | 1970-03-11 | Firestone Tire & Rubber Co | Process for Manufacturing Product of Cross-Linkable Polymeric Material. |
| FR1572362A (enExample) * | 1968-04-12 | 1969-06-27 | ||
| JPS4827897B1 (enExample) * | 1968-07-04 | 1973-08-27 | ||
| DE2103769A1 (de) * | 1970-02-24 | 1971-09-09 | VEB Chemiefaserkombinat Schwarza Wilhelm Pieck, χ 6822 Rudolstadt Schwär | Verfahren und Vorrichtung zur Her stellung von synthetischen Faden oder Flachengebilden |
| US3812063A (en) * | 1971-03-08 | 1974-05-21 | Mitsubishi Rayon Co | Polyester prepolymer useful for coating and a method of preparing the same |
-
1972
- 1972-12-04 DE DE2259360A patent/DE2259360C2/de not_active Expired
-
1973
- 1973-11-30 CH CH1686673A patent/CH614725A5/xx not_active IP Right Cessation
- 1973-12-03 IT IT54064/73A patent/IT1000184B/it active
- 1973-12-03 CA CA187,265A patent/CA1007595A/en not_active Expired
- 1973-12-03 AT AT1010773A patent/AT329280B/de active
- 1973-12-03 GB GB5591973A patent/GB1450906A/en not_active Expired
- 1973-12-04 NL NL7316608A patent/NL7316608A/xx not_active Application Discontinuation
- 1973-12-04 US US05/421,608 patent/US4013806A/en not_active Expired - Lifetime
- 1973-12-04 BE BE138471A patent/BE808174A/xx not_active IP Right Cessation
- 1973-12-04 JP JP13494073A patent/JPS5718535B2/ja not_active Expired
- 1973-12-04 FR FR7343126A patent/FR2208939B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1450906A (en) | 1976-09-29 |
| FR2208939B1 (enExample) | 1976-10-08 |
| USB421608I5 (enExample) | 1976-03-23 |
| JPS5718535B2 (enExample) | 1982-04-17 |
| CA1007595A (en) | 1977-03-29 |
| US4013806A (en) | 1977-03-22 |
| CH614725A5 (enExample) | 1979-12-14 |
| NL7316608A (enExample) | 1974-06-06 |
| JPS4987797A (enExample) | 1974-08-22 |
| IT1000184B (it) | 1976-03-30 |
| BE808174A (fr) | 1974-06-04 |
| AT329280B (de) | 1976-05-10 |
| FR2208939A1 (enExample) | 1974-06-28 |
| DE2259360A1 (de) | 1974-06-12 |
| ATA1010773A (de) | 1975-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2259360C2 (de) | Verfahren zur Herstellung von dünnen Schichten auf Basis von Polyurethan-Elastomeren | |
| DE3854827T2 (de) | Härtbare Zusammensetzungen | |
| DE19626007B4 (de) | Verfahren zur Herstellung von Polyurethan unter Verwendung eines Metallacetylacetonat/Acetylaceton-Katalysator-Systems und das damit hergestellte Produkt | |
| DE2912574C2 (de) | Verfahren zur Herstellung von mit Acrylgruppen abgeschlossenen Urethanoligomeren | |
| DE69131704T2 (de) | Verfahren zur Herstellung von einer Flexodruckplatte | |
| DE2319637C2 (de) | Lagerbeständiges Klebstoff-Gemisch | |
| DE3882835T2 (de) | Mittels 2-Glycerylacrylat oder 2-Glycerylmethacrylat vernetzte Polyurethane und Polyurethan-Polyharnstoffe. | |
| EP0136452B1 (de) | Verfahren zur Herstellung von lichtgehärteten Schichten mit definierter Härte | |
| DE2715185A1 (de) | Verfahren zur behandlung von polyvinylidenfluorid zum haften an einem anderen polymeren | |
| DE2413768A1 (de) | Haertbare materialien | |
| DE2122377A1 (de) | Acryl-Urethan-Gemisch | |
| DE3049051A1 (de) | Fuer die verarbeitung zur bildung einer flexodruck-druckplatte geeigneter mehrfachschicht-gegenstand | |
| DE1719169A1 (de) | Vernetzte,druckempfindliche Klebstoffe | |
| DE68909653T2 (de) | Durch ultraviolettes Licht härtender abstreifbarer Film und Verfahren zu seiner Herstellung. | |
| DE2808870C3 (de) | Verfahren zur Behandlung von Polyvinylfluorid zum Verbessern seiner Haftung mit anderen Polymeren | |
| DE2827450A1 (de) | Polyurethane mit lacton- und hydroxylgruppen im grundgeruest | |
| DE4121703A1 (de) | Folienbildender, strahlenhaertbarer und feuchtigkeitshaertender kaschierklebstoff, verfahren zum kaschieren von textilen bahnen mit diesem kaschierklebstoff und textiles material aus textilen bahnen und folien des kaschierklebstoffes | |
| DE2058504C2 (de) | Verfahren zum Kratzfestmachen von schlagfesten und klar durchsichtigen Kunststoffen | |
| DE3709920A1 (de) | Strahlungshaertbare haftkleber auf basis von polyurethanacrylaten | |
| DE2357402C3 (de) | Mittel und Verfahren zum Aufbringen von Überzügen | |
| CH625261A5 (enExample) | ||
| DE69609170T2 (de) | Klebstoffe | |
| DE2913676A1 (de) | Verfahren zur herstellung von verbundfolien mittels loesungsmittelfreier klebstoffe | |
| DE4231396C1 (de) | Verfahren zur Herstellung mehrschichtiger, wannen- oder schalenförmiger Kunststoffkörper und solche Kunststoffkörper | |
| DE60011332T2 (de) | Mehrschichtwerkstoff aus photoempfindlichem Harz und Verfahren zu seiner Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8330 | Complete disclaimer |