DE2250106A1 - Verfahren zur herstellung von 1,1'dianthrachinonylen - Google Patents
Verfahren zur herstellung von 1,1'dianthrachinonylenInfo
- Publication number
- DE2250106A1 DE2250106A1 DE19722250106 DE2250106A DE2250106A1 DE 2250106 A1 DE2250106 A1 DE 2250106A1 DE 19722250106 DE19722250106 DE 19722250106 DE 2250106 A DE2250106 A DE 2250106A DE 2250106 A1 DE2250106 A1 DE 2250106A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- solvent
- parts
- process according
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- 150000004056 anthraquinones Chemical class 0.000 claims description 5
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 239000003880 polar aprotic solvent Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 claims 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 125000003277 amino group Chemical group 0.000 description 6
- -1 prooyl Chemical group 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000006887 Ullmann reaction Methods 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- KBTJYNAFUYTSNN-UHFFFAOYSA-N [Na].OO Chemical compound [Na].OO KBTJYNAFUYTSNN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- TYVQOKYICZEZRI-UHFFFAOYSA-N n-(1-chloro-9,10-dioxoanthracen-2-yl)acetamide Chemical compound C1=CC=C2C(=O)C3=C(Cl)C(NC(=O)C)=CC=C3C(=O)C2=C1 TYVQOKYICZEZRI-UHFFFAOYSA-N 0.000 description 1
- UHOBHCSUUYEDIQ-UHFFFAOYSA-N n-(1-chloro-9,10-dioxoanthracen-2-yl)benzamide Chemical compound C1=CC=2C(=O)C3=CC=CC=C3C(=O)C=2C(Cl)=C1NC(=O)C1=CC=CC=C1 UHOBHCSUUYEDIQ-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/005—Di-anthraquinonyl and derivative compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1497571A CH555390A (de) | 1971-10-14 | 1971-10-14 | Verfahren zur herstellung von 1,1'-dianthrachinonylen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2250106A1 true DE2250106A1 (de) | 1973-04-19 |
Family
ID=4405322
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722250106 Pending DE2250106A1 (de) | 1971-10-14 | 1972-10-12 | Verfahren zur herstellung von 1,1'dianthrachinonylen |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS4847532A (enExample) |
| BE (1) | BE790056A (enExample) |
| CH (1) | CH555390A (enExample) |
| DE (1) | DE2250106A1 (enExample) |
| FR (1) | FR2149194A5 (enExample) |
| GB (1) | GB1346126A (enExample) |
| IT (1) | IT966300B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2353580A1 (de) * | 1973-10-25 | 1975-05-07 | Bayer Ag | Verfahren zur herstellung von diarylverbindungen |
| US4102924A (en) | 1973-10-25 | 1978-07-25 | Bayer Aktiengesellschaft | Process for the preparation of diaryl compounds |
| US6013776A (en) * | 1993-10-13 | 2000-01-11 | Ciba Specialty Chemicals Corporation | Fluorescent azo pigments |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE59007845D1 (de) * | 1989-10-10 | 1995-01-12 | Ciba Geigy Ag | Neue Dianthrachinonylverbindungen. |
| US5238984A (en) * | 1989-10-10 | 1993-08-24 | Ciba-Geigy Corporation | Dianthraquinonyl compounds |
-
0
- BE BE790056D patent/BE790056A/xx unknown
-
1971
- 1971-10-14 CH CH1497571A patent/CH555390A/xx not_active IP Right Cessation
-
1972
- 1972-08-07 FR FR7228436A patent/FR2149194A5/fr not_active Expired
- 1972-09-07 JP JP8915572A patent/JPS4847532A/ja active Pending
- 1972-09-08 GB GB4192472A patent/GB1346126A/en not_active Expired
- 1972-10-12 IT IT5332172A patent/IT966300B/it active
- 1972-10-12 DE DE19722250106 patent/DE2250106A1/de active Pending
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2353580A1 (de) * | 1973-10-25 | 1975-05-07 | Bayer Ag | Verfahren zur herstellung von diarylverbindungen |
| US4102924A (en) | 1973-10-25 | 1978-07-25 | Bayer Aktiengesellschaft | Process for the preparation of diaryl compounds |
| US6013776A (en) * | 1993-10-13 | 2000-01-11 | Ciba Specialty Chemicals Corporation | Fluorescent azo pigments |
| US6271401B1 (en) * | 1993-10-13 | 2001-08-07 | Ciba Specialty Chemicals Corp. | Fluorescent anthraquinoid pigments |
Also Published As
| Publication number | Publication date |
|---|---|
| CH555390A (de) | 1974-10-31 |
| BE790056A (fr) | 1973-04-13 |
| JPS4847532A (enExample) | 1973-07-06 |
| FR2149194A5 (enExample) | 1973-03-23 |
| GB1346126A (en) | 1974-02-06 |
| IT966300B (it) | 1974-02-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1445591A1 (de) | Verfahren zur Herstellung von Derivaten des 7-Oxy-2-oxo-1,2-dihydrochinolins | |
| DE2250106A1 (de) | Verfahren zur herstellung von 1,1'dianthrachinonylen | |
| DE1070315B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE1142212B (de) | Verfahren zur Herstellung von sulfonsaeuregruppenfreien Dioxazinfarbstoffen | |
| DE1545602A1 (de) | Verfahren zur Herstellung 3-substituierter Phthalimidine | |
| DE2250107A1 (de) | Verfahren zur herstellung von 1,1'dianthrachinonylen | |
| DE2000509C3 (de) | Verfahren zur Herstellung von 1-(N-Cyanoäthylamino)-benzolen | |
| DE935566C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE2727331C2 (de) | Anthrachinoide Dispersionsfarbstoffe und deren Verwendung | |
| AT234105B (de) | Verfahren zur Herstellung von 4-Methyl-6-isobutenyl-pyron-(2) | |
| AT259562B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1178052B (de) | Verfahren zur Herstellung von heterocyclischen Verbindungne, die mindestens ein einem Ringstickstoffatom benachbartes Chloratom enthalten. | |
| AT275552B (de) | Verfahren zur Herstellung neuer Kupferkomplexsalze | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| DE911493C (de) | Verfahren zur Herstellung von 2-(1, 4-Diamino-2-anthrachinonyl)-1, 3, 4-oxydiazolen | |
| AT204048B (de) | Verfahren zur Herstellung von neuen Phenazinderivaten | |
| AT238161B (de) | Verfahren zur Herstellung von neuen Acylhydrazonen | |
| DE664995C (de) | Verfahren zur Darstellung von Thiazthioniumchloriden | |
| DE562630C (de) | Verfahren zur Darstellung von 1íñ2íñ5íñ6-Diphthaloylnaphthalin, seinen Homologen undSubstitutionsprodukten | |
| AT214440B (de) | Verfahren zur Herstellung von 3-Iminoisoindolin-1-onen | |
| DE3342462A1 (de) | Verfahren zur herstellung von 4,4'-diaminobenzophenonen | |
| DE1240604B (de) | Verfahren zur Herstellung von Phthaloylpyrrocolinen | |
| DE2049161A1 (de) | Verfahren zur Herstellung von aromatischen o-Aminonitrilen | |
| DE2944098A1 (de) | Verfahren zur herstellung von aromatischen thiocyano-derivaten | |
| DE1768900A1 (de) | Verfahren zur Herstellung von reinen Dihydraziden |