DE2241801A1 - Quadruplex-fernsehaufzeichnungsband und verfahren zu seiner herstellung - Google Patents
Quadruplex-fernsehaufzeichnungsband und verfahren zu seiner herstellungInfo
- Publication number
- DE2241801A1 DE2241801A1 DE2241801A DE2241801A DE2241801A1 DE 2241801 A1 DE2241801 A1 DE 2241801A1 DE 2241801 A DE2241801 A DE 2241801A DE 2241801 A DE2241801 A DE 2241801A DE 2241801 A1 DE2241801 A1 DE 2241801A1
- Authority
- DE
- Germany
- Prior art keywords
- magnetizable
- layer
- particles
- tape
- quadruplex
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 7
- 239000002245 particle Substances 0.000 claims description 47
- 238000000576 coating method Methods 0.000 claims description 30
- 239000011248 coating agent Substances 0.000 claims description 28
- 239000006185 dispersion Substances 0.000 claims description 22
- 239000011230 binding agent Substances 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 12
- 229940090961 chromium dioxide Drugs 0.000 claims description 10
- IAQWMWUKBQPOIY-UHFFFAOYSA-N chromium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Cr+4] IAQWMWUKBQPOIY-UHFFFAOYSA-N 0.000 claims description 10
- AYTAKQFHWFYBMA-UHFFFAOYSA-N chromium(IV) oxide Inorganic materials O=[Cr]=O AYTAKQFHWFYBMA-UHFFFAOYSA-N 0.000 claims description 10
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical class [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 8
- 229910000428 cobalt oxide Inorganic materials 0.000 claims description 6
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical group [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 3
- 230000003746 surface roughness Effects 0.000 claims description 2
- 239000010410 layer Substances 0.000 description 73
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 36
- 238000003801 milling Methods 0.000 description 8
- 230000035945 sensitivity Effects 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- 230000007423 decrease Effects 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 5
- 238000000227 grinding Methods 0.000 description 5
- 239000000787 lecithin Substances 0.000 description 5
- 229940067606 lecithin Drugs 0.000 description 5
- 235000010445 lecithin Nutrition 0.000 description 5
- 229920006287 phenoxy resin Polymers 0.000 description 5
- 239000013034 phenoxy resin Substances 0.000 description 5
- 229920002635 polyurethane Polymers 0.000 description 5
- 239000004814 polyurethane Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 238000005498 polishing Methods 0.000 description 3
- 229920003225 polyurethane elastomer Polymers 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000009499 grossing Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 229920002799 BoPET Polymers 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229920000538 Poly[(phenyl isocyanate)-co-formaldehyde] Polymers 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 229910001566 austenite Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- MHNDZRYFECQADU-UHFFFAOYSA-N butan-2-one;cyclohexanone;toluene Chemical compound CCC(C)=O.CC1=CC=CC=C1.O=C1CCCCC1 MHNDZRYFECQADU-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000007772 electroless plating Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- -1 polyethylene terephthalate Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 230000010181 polygamy Effects 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 235000020004 porter Nutrition 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000008054 signal transmission Effects 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000005236 sound signal Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B5/00—Recording by magnetisation or demagnetisation of a record carrier; Reproducing by magnetic means; Record carriers therefor
- G11B5/62—Record carriers characterised by the selection of the material
- G11B5/68—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent
- G11B5/70—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer
- G11B5/716—Record carriers characterised by the selection of the material comprising one or more layers of magnetisable material homogeneously mixed with a bonding agent on a base layer characterised by two or more magnetic layers
Landscapes
- Paints Or Removers (AREA)
- Magnetic Record Carriers (AREA)
- Manufacturing Of Magnetic Record Carriers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17510671A | 1971-08-26 | 1971-08-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2241801A1 true DE2241801A1 (de) | 1973-03-08 |
Family
ID=22638923
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2241801A Pending DE2241801A1 (de) | 1971-08-26 | 1972-08-25 | Quadruplex-fernsehaufzeichnungsband und verfahren zu seiner herstellung |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3775178A (enExample) |
| JP (1) | JPS518003B2 (enExample) |
| AU (1) | AU450189B2 (enExample) |
| BR (1) | BR7205857D0 (enExample) |
| CA (1) | CA964127A (enExample) |
| DE (1) | DE2241801A1 (enExample) |
| FR (1) | FR2150543B1 (enExample) |
| GB (1) | GB1386683A (enExample) |
| IT (1) | IT962229B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2615961A1 (de) * | 1975-04-11 | 1976-10-21 | Fuji Photo Film Co Ltd | Magnetisches aufzeichnungsmaterial |
| DE2647941A1 (de) * | 1975-10-23 | 1977-04-28 | Fuji Photo Film Co Ltd | Magnetband |
| DE2801410A1 (de) * | 1977-01-14 | 1978-07-20 | Fuji Photo Film Co Ltd | Verfahren zur herstellung mehrschichtiger magnetischer aufzeichnungsbaender |
| DE2931043A1 (de) * | 1978-08-01 | 1980-02-14 | Pyral Soc | Magnetischer sicherheits-aufzeichnungstraeger |
| DE3130147A1 (de) * | 1980-07-31 | 1982-03-18 | TDK Electronics Co., Ltd., Tokyo | Magnetisches aufzeichnungsmedium |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4237189A (en) * | 1973-10-31 | 1980-12-02 | Robert J. Deffeyes | Polymodal magnetic recording media process for making and verifying the same and compositions useful therein |
| DE2556188C3 (de) * | 1975-12-13 | 1979-07-05 | Basf Ag, 6700 Ludwigshafen | Flexible Mehrschichtmagnetogrammträger |
| FR2353110A1 (fr) * | 1976-03-12 | 1977-12-23 | Kodak Pathe | Nouveau produit d'enregistrement magnetique et procede pour sa preparation |
| JPS5391158A (en) * | 1977-01-21 | 1978-08-10 | Takashi Ozaki | Production of canned food of citrus fruits |
| JPS5419711A (en) * | 1977-07-13 | 1979-02-14 | Tdk Corp | Multi-layer magnetic recording medium |
| US4277809A (en) * | 1979-09-26 | 1981-07-07 | Memorex Corporation | Apparatus for recording magnetic impulses perpendicular to the surface of a recording medium |
| JPS59140860A (ja) * | 1983-01-28 | 1984-08-13 | Nippon Suisan Kaisha Ltd | 魚翅類似食品を製造する方法及び装置 |
| JPS6015818A (ja) * | 1983-07-06 | 1985-01-26 | Sanyo Electric Co Ltd | 磁気記録媒体の製造方法 |
| US4587066A (en) * | 1984-07-02 | 1986-05-06 | Polaroid Corporation | Method and apparatus for forming magnetic recording media |
| JPH0242935A (ja) * | 1988-08-04 | 1990-02-13 | Machida Oputo Giken:Kk | 食用植物の保存法 |
| JPH0376531A (ja) * | 1989-08-17 | 1991-04-02 | Kibun Kk | コーティング剥皮果実食品及びその製造方法 |
| JPH03155745A (ja) * | 1989-11-13 | 1991-07-03 | Kooyoo Furetsushiyu Foods:Kk | 食品の鮮度保持方法 |
| WO1996033480A1 (en) | 1995-04-20 | 1996-10-24 | The Nippon Signal Co., Ltd. | Monitor and control unit for traffic signals |
| US6504485B2 (en) | 1996-12-17 | 2003-01-07 | The Nippon Signal Co., Ltd. | Monitoring apparatus and control apparatus for traffic signal lights |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2643130A (en) * | 1949-11-02 | 1953-06-23 | Brush Dev Co | Multilayer magnetic record member |
| US3505109A (en) * | 1965-09-29 | 1970-04-07 | Basf Ag | Production of magnetic recording media |
| GB1080614A (en) * | 1966-04-21 | 1967-08-23 | Agfa Gevaert Nv | Magnetic recording material |
| GB1244108A (en) * | 1968-02-12 | 1971-08-25 | Fuji Photo Film Co Ltd | Magnetic recording medium |
| US3573980A (en) * | 1968-02-19 | 1971-04-06 | Minnesota Mining & Mfg | Method of making magnetic particles and recording tape |
| NL6909118A (enExample) * | 1969-06-13 | 1970-12-15 |
-
1971
- 1971-08-26 US US00175106A patent/US3775178A/en not_active Expired - Lifetime
-
1972
- 1972-02-25 BR BR5857/72*A patent/BR7205857D0/pt unknown
- 1972-08-17 CA CA149,680A patent/CA964127A/en not_active Expired
- 1972-08-25 DE DE2241801A patent/DE2241801A1/de active Pending
- 1972-08-25 FR FR7230451A patent/FR2150543B1/fr not_active Expired
- 1972-08-25 AU AU45992/72A patent/AU450189B2/en not_active Expired
- 1972-08-25 JP JP47085219A patent/JPS518003B2/ja not_active Expired
- 1972-08-25 GB GB3981572A patent/GB1386683A/en not_active Expired
- 1972-08-25 IT IT52364/72A patent/IT962229B/it active
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2615961A1 (de) * | 1975-04-11 | 1976-10-21 | Fuji Photo Film Co Ltd | Magnetisches aufzeichnungsmaterial |
| DE2647941A1 (de) * | 1975-10-23 | 1977-04-28 | Fuji Photo Film Co Ltd | Magnetband |
| DE2801410A1 (de) * | 1977-01-14 | 1978-07-20 | Fuji Photo Film Co Ltd | Verfahren zur herstellung mehrschichtiger magnetischer aufzeichnungsbaender |
| DE2931043A1 (de) * | 1978-08-01 | 1980-02-14 | Pyral Soc | Magnetischer sicherheits-aufzeichnungstraeger |
| DE3130147A1 (de) * | 1980-07-31 | 1982-03-18 | TDK Electronics Co., Ltd., Tokyo | Magnetisches aufzeichnungsmedium |
Also Published As
| Publication number | Publication date |
|---|---|
| CA964127A (en) | 1975-03-11 |
| FR2150543A1 (enExample) | 1973-04-06 |
| FR2150543B1 (enExample) | 1976-08-13 |
| JPS518003B2 (enExample) | 1976-03-12 |
| JPS4831907A (enExample) | 1973-04-26 |
| AU450189B2 (en) | 1974-07-04 |
| GB1386683A (en) | 1975-03-12 |
| IT962229B (it) | 1973-12-20 |
| BR7205857D0 (pt) | 1973-07-03 |
| US3775178A (en) | 1973-11-27 |
| AU4599272A (en) | 1974-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2241801A1 (de) | Quadruplex-fernsehaufzeichnungsband und verfahren zu seiner herstellung | |
| DE3208865C2 (enExample) | ||
| DE112004000008T5 (de) | Magnetaufzeichnungsmedium | |
| DE2647941A1 (de) | Magnetband | |
| DE3219779A1 (de) | Magnetisches aufzeichnungsmaterial | |
| DE3208503A1 (de) | Magnetischer aufzeichnungstraeger | |
| DE69026315T2 (de) | Verwendung eines magnetischen Aufzeichnungsträgers für die Aufzeichnung eines Video-signals | |
| DE3232008C2 (enExample) | ||
| DE3124560C2 (de) | Magnetischer Aufzeichnungsträger | |
| DE69005495T2 (de) | Ein magnetischer Aufzeichnungsträger. | |
| DE3325972C2 (de) | Magnetaufzeichnungsmaterial | |
| DE2905037C2 (de) | Magnetisches Material für Magnetaufzeichnungsmedien | |
| DE3430760A1 (de) | Magnetisches aufzeichnungsmedium | |
| DE69005471T3 (de) | Magnetischer Aufzeichnungsträger. | |
| DE3517439A1 (de) | Magnetisches aufzeichnungsmedium fuer die bildaufzeichnung | |
| DE3445345A1 (de) | Magnetisches aufzeichnungsmedium | |
| DE2831542A1 (de) | Zweischichtige magnetische aufzeichnungsbaender | |
| DE3426676A1 (de) | Magnetisches aufzeichnungsmedium | |
| DE3502908A1 (de) | Magnetisches aufzeichnungsmedium | |
| DE1955699B2 (enExample) | ||
| DE2208792A1 (de) | Magnetisches tonband mit verbessertem frequenzgang fuer hohe frequenzen und verfahren zu seiner herstellung | |
| DE2909162A1 (de) | Magnetisches aufzeichnungsmedium | |
| DE2434940A1 (de) | Magnetisches aufzeichnungsband | |
| EP0585834B1 (de) | Magnetische Aufzeichnungsträger | |
| DE2801410C2 (de) | Verfahren zur Herstellung eines mehrschichtigen magnetischen Aufzeichnungsbandes |