DE2218004C3 - Verfahren zur Herstellung von Anthracenen - Google Patents
Verfahren zur Herstellung von AnthracenenInfo
- Publication number
- DE2218004C3 DE2218004C3 DE2218004A DE2218004A DE2218004C3 DE 2218004 C3 DE2218004 C3 DE 2218004C3 DE 2218004 A DE2218004 A DE 2218004A DE 2218004 A DE2218004 A DE 2218004A DE 2218004 C3 DE2218004 C3 DE 2218004C3
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- sulfur
- acid
- reaction
- methane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 12
- 150000001454 anthracenes Chemical class 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 3
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 30
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 22
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 22
- -1 aralkyl radicals Chemical group 0.000 description 18
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 16
- 229910052717 sulfur Inorganic materials 0.000 description 15
- 239000011593 sulfur Substances 0.000 description 15
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 150000003464 sulfur compounds Chemical class 0.000 description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 10
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical class C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 10
- PQTAUFTUHHRKSS-UHFFFAOYSA-N 1-benzyl-2-methylbenzene Chemical compound CC1=CC=CC=C1CC1=CC=CC=C1 PQTAUFTUHHRKSS-UHFFFAOYSA-N 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 9
- 238000007792 addition Methods 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- BSZXAFXFTLXUFV-UHFFFAOYSA-N 1-phenylethylbenzene Chemical compound C=1C=CC=CC=1C(C)C1=CC=CC=C1 BSZXAFXFTLXUFV-UHFFFAOYSA-N 0.000 description 5
- 229910000831 Steel Inorganic materials 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000010959 steel Substances 0.000 description 5
- CETBSQOFQKLHHZ-UHFFFAOYSA-N Diethyl disulfide Chemical compound CCSSCC CETBSQOFQKLHHZ-UHFFFAOYSA-N 0.000 description 4
- 229940054021 anxiolytics diphenylmethane derivative Drugs 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- 125000006840 diphenylmethane group Chemical class 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical compound C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 2
- LJBGURBFHJJQQU-UHFFFAOYSA-N 2-benzyl-1,4-dimethylbenzene Chemical compound CC1=CC=C(C)C(CC=2C=CC=CC=2)=C1 LJBGURBFHJJQQU-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UBJVUCKUDDKUJF-UHFFFAOYSA-N Diallyl sulfide Chemical compound C=CCSCC=C UBJVUCKUDDKUJF-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 2
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- PFRGXCVKLLPLIP-UHFFFAOYSA-N diallyl disulfide Chemical compound C=CCSSCC=C PFRGXCVKLLPLIP-UHFFFAOYSA-N 0.000 description 2
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- QZXIAZMRRQBSFL-UHFFFAOYSA-N (benzylpentasulfanyl)methylbenzene Chemical compound C=1C=CC=CC=1CSSSSSCC1=CC=CC=C1 QZXIAZMRRQBSFL-UHFFFAOYSA-N 0.000 description 1
- WYHWGJJOJLOJSZ-UHFFFAOYSA-N (phenyltrisulfanyl)benzene Chemical compound C=1C=CC=CC=1SSSC1=CC=CC=C1 WYHWGJJOJLOJSZ-UHFFFAOYSA-N 0.000 description 1
- DHBXNPKRAUYBTH-UHFFFAOYSA-N 1,1-ethanedithiol Chemical compound CC(S)S DHBXNPKRAUYBTH-UHFFFAOYSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical class C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- BEUFFHMNIMJUHH-UHFFFAOYSA-N 1-(pentyltetrasulfanyl)pentane Chemical compound CCCCCSSSSCCCCC BEUFFHMNIMJUHH-UHFFFAOYSA-N 0.000 description 1
- AIDFJGKWTOULTC-UHFFFAOYSA-N 1-butylsulfonylbutane Chemical compound CCCCS(=O)(=O)CCCC AIDFJGKWTOULTC-UHFFFAOYSA-N 0.000 description 1
- VKWPRZBXGKESLF-UHFFFAOYSA-N 1-methyl-2-[(2-methylphenyl)trisulfanyl]benzene Chemical compound CC1=CC=CC=C1SSSC1=CC=CC=C1C VKWPRZBXGKESLF-UHFFFAOYSA-N 0.000 description 1
- KZNJSFHJUQDYHE-UHFFFAOYSA-N 1-methylanthracene Chemical compound C1=CC=C2C=C3C(C)=CC=CC3=CC2=C1 KZNJSFHJUQDYHE-UHFFFAOYSA-N 0.000 description 1
- DLLMHEDYJQACRM-UHFFFAOYSA-N 2-(carboxymethyldisulfanyl)acetic acid Chemical compound OC(=O)CSSCC(O)=O DLLMHEDYJQACRM-UHFFFAOYSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical compound CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- GSNKRSKIWFBWEG-UHFFFAOYSA-N 3-ethylpentan-2-one Chemical compound CCC(CC)C(C)=O GSNKRSKIWFBWEG-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- 229910000975 Carbon steel Inorganic materials 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- JJHHIJFTHRNPIK-UHFFFAOYSA-N Diphenyl sulfoxide Chemical compound C=1C=CC=CC=1S(=O)C1=CC=CC=C1 JJHHIJFTHRNPIK-UHFFFAOYSA-N 0.000 description 1
- ZERULLAPCVRMCO-UHFFFAOYSA-N Dipropyl sulfide Chemical compound CCCSCCC ZERULLAPCVRMCO-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 125000002066 L-histidyl group Chemical group [H]N1C([H])=NC(C([H])([H])[C@](C(=O)[*])([H])N([H])[H])=C1[H] 0.000 description 1
- PNRDAGXRLMPNGJ-UHFFFAOYSA-N [C].C1=CC=CC2=CC3=CC=CC=C3C=C12 Chemical compound [C].C1=CC=CC2=CC3=CC=CC=C3C=C12 PNRDAGXRLMPNGJ-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- ZGRWZUDBZZBJQB-UHFFFAOYSA-N benzenecarbodithioic acid Chemical compound SC(=S)C1=CC=CC=C1 ZGRWZUDBZZBJQB-UHFFFAOYSA-N 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000010962 carbon steel Substances 0.000 description 1
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical class OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001944 continuous distillation Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical class CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- DTGSFFWQUULHIF-UHFFFAOYSA-N imino-dimethyl-oxo-$l^{6}-sulfane Chemical compound CS(C)(=N)=O DTGSFFWQUULHIF-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- GRHBQAYDJPGGLF-UHFFFAOYSA-N isothiocyanic acid Chemical compound N=C=S GRHBQAYDJPGGLF-UHFFFAOYSA-N 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical compound NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 1
- XLTBPTGNNLIKRW-UHFFFAOYSA-N methyldisulfanylethane Chemical compound CCSSC XLTBPTGNNLIKRW-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000004250 monothioacetals Chemical class 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002898 organic sulfur compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 150000003450 sulfenic acids Chemical class 0.000 description 1
- 150000003455 sulfinic acids Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000005555 sulfoximide group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- 150000004897 thiazines Chemical class 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- XDDVRYDDMGRFAZ-UHFFFAOYSA-N thiobenzophenone Chemical compound C=1C=CC=CC=1C(=S)C1=CC=CC=C1 XDDVRYDDMGRFAZ-UHFFFAOYSA-N 0.000 description 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 150000003574 thionaphthenes Chemical class 0.000 description 1
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 1
- AKGRVZBVOBKUAM-UHFFFAOYSA-N trisulfanylethane Chemical compound CCSSS AKGRVZBVOBKUAM-UHFFFAOYSA-N 0.000 description 1
- 239000006200 vaporizer Substances 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C5/00—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms
- C07C5/32—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms by dehydrogenation with formation of free hydrogen
- C07C5/373—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms by dehydrogenation with formation of free hydrogen with simultaneous isomerisation
- C07C5/393—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms by dehydrogenation with formation of free hydrogen with simultaneous isomerisation with cyclisation to an aromatic six-membered ring, e.g. dehydrogenation of n-hexane to benzene
- C07C5/41—Catalytic processes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2218004A DE2218004C3 (de) | 1972-04-14 | 1972-04-14 | Verfahren zur Herstellung von Anthracenen |
| SU1907664A SU472497A3 (ru) | 1972-04-14 | 1973-04-10 | Способ получени антрацена или его производных |
| BG023247A BG20556A3 (bg) | 1972-04-14 | 1973-04-10 | Метод за получаване на антрацени |
| NL7305078A NL7305078A (enExample) | 1972-04-14 | 1973-04-11 | |
| CH525973A CH586171A5 (enExample) | 1972-04-14 | 1973-04-12 | |
| LU67418A LU67418A1 (enExample) | 1972-04-14 | 1973-04-12 | |
| IT49383/73A IT980171B (it) | 1972-04-14 | 1973-04-12 | Procedimento per produrre antraceni |
| AT324873A AT321290B (de) | 1972-04-14 | 1973-04-12 | Verfahren zur Herstellung von Anthracenen |
| US00350571A US3801662A (en) | 1972-04-14 | 1973-04-12 | Production of anthracene from 2-methyl diphenyl methanes in presence of sulfur |
| DD170122A DD105437A5 (enExample) | 1972-04-14 | 1973-04-12 | |
| AU54487/73A AU5448773A (en) | 1972-04-14 | 1973-04-13 | Production of antrhacene from 2-methyl diphenyl methanes in presence of sulfur |
| AR247553A AR194172A1 (es) | 1972-04-14 | 1973-04-13 | Procedimiento para la produccion de antracenos |
| BR732701A BR7302701D0 (pt) | 1972-04-14 | 1973-04-13 | Processo para a preparacao de antraceno |
| FR7313547A FR2180104B1 (enExample) | 1972-04-14 | 1973-04-13 | |
| PL1973161907A PL85377B1 (enExample) | 1972-04-14 | 1973-04-13 | |
| GB1783373A GB1405833A (en) | 1972-04-14 | 1973-04-13 | Production of anthracenes from 2-methyl diphenyl methanes in presence of sulphur |
| BE129979A BE798180A (fr) | 1972-04-14 | 1973-04-13 | Procede de preparation d'anthracenes |
| ZA732570A ZA732570B (en) | 1972-04-14 | 1973-04-13 | Production of anthracene from 2-methyl diphenyl methanes in presence of sulfur |
| JP48041478A JPS5125020B2 (enExample) | 1972-04-14 | 1973-04-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2218004A DE2218004C3 (de) | 1972-04-14 | 1972-04-14 | Verfahren zur Herstellung von Anthracenen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2218004A1 DE2218004A1 (de) | 1973-11-08 |
| DE2218004B2 DE2218004B2 (de) | 1979-03-15 |
| DE2218004C3 true DE2218004C3 (de) | 1979-11-08 |
Family
ID=5841940
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2218004A Expired DE2218004C3 (de) | 1972-04-14 | 1972-04-14 | Verfahren zur Herstellung von Anthracenen |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3801662A (enExample) |
| JP (1) | JPS5125020B2 (enExample) |
| AR (1) | AR194172A1 (enExample) |
| AT (1) | AT321290B (enExample) |
| AU (1) | AU5448773A (enExample) |
| BE (1) | BE798180A (enExample) |
| BG (1) | BG20556A3 (enExample) |
| BR (1) | BR7302701D0 (enExample) |
| CH (1) | CH586171A5 (enExample) |
| DD (1) | DD105437A5 (enExample) |
| DE (1) | DE2218004C3 (enExample) |
| FR (1) | FR2180104B1 (enExample) |
| GB (1) | GB1405833A (enExample) |
| IT (1) | IT980171B (enExample) |
| LU (1) | LU67418A1 (enExample) |
| NL (1) | NL7305078A (enExample) |
| PL (1) | PL85377B1 (enExample) |
| SU (1) | SU472497A3 (enExample) |
| ZA (1) | ZA732570B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51127872A (en) * | 1975-04-28 | 1976-11-08 | Dainichi Sangiyou Kk | Packaging bag |
| JPS52114915U (enExample) * | 1976-02-25 | 1977-08-31 | ||
| JPS52114914U (enExample) * | 1976-02-25 | 1977-08-31 | ||
| JPS5460016U (enExample) * | 1977-10-03 | 1979-04-25 |
-
1972
- 1972-04-14 DE DE2218004A patent/DE2218004C3/de not_active Expired
-
1973
- 1973-04-10 BG BG023247A patent/BG20556A3/xx unknown
- 1973-04-10 SU SU1907664A patent/SU472497A3/ru active
- 1973-04-11 NL NL7305078A patent/NL7305078A/xx unknown
- 1973-04-12 CH CH525973A patent/CH586171A5/xx not_active IP Right Cessation
- 1973-04-12 LU LU67418A patent/LU67418A1/xx unknown
- 1973-04-12 DD DD170122A patent/DD105437A5/xx unknown
- 1973-04-12 US US00350571A patent/US3801662A/en not_active Expired - Lifetime
- 1973-04-12 AT AT324873A patent/AT321290B/de not_active IP Right Cessation
- 1973-04-12 IT IT49383/73A patent/IT980171B/it active
- 1973-04-13 AU AU54487/73A patent/AU5448773A/en not_active Expired
- 1973-04-13 AR AR247553A patent/AR194172A1/es active
- 1973-04-13 JP JP48041478A patent/JPS5125020B2/ja not_active Expired
- 1973-04-13 GB GB1783373A patent/GB1405833A/en not_active Expired
- 1973-04-13 ZA ZA732570A patent/ZA732570B/xx unknown
- 1973-04-13 BR BR732701A patent/BR7302701D0/pt unknown
- 1973-04-13 PL PL1973161907A patent/PL85377B1/pl unknown
- 1973-04-13 FR FR7313547A patent/FR2180104B1/fr not_active Expired
- 1973-04-13 BE BE129979A patent/BE798180A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2180104B1 (enExample) | 1978-06-30 |
| ZA732570B (en) | 1974-03-27 |
| FR2180104A1 (enExample) | 1973-11-23 |
| NL7305078A (enExample) | 1973-10-16 |
| BE798180A (fr) | 1973-10-15 |
| BG20556A3 (bg) | 1975-12-05 |
| JPS4918861A (enExample) | 1974-02-19 |
| DE2218004A1 (de) | 1973-11-08 |
| DD105437A5 (enExample) | 1974-04-20 |
| BR7302701D0 (pt) | 1974-07-18 |
| AR194172A1 (es) | 1973-06-22 |
| GB1405833A (en) | 1975-09-10 |
| IT980171B (it) | 1974-09-30 |
| PL85377B1 (enExample) | 1976-04-30 |
| US3801662A (en) | 1974-04-02 |
| DE2218004B2 (de) | 1979-03-15 |
| AU5448773A (en) | 1974-10-17 |
| LU67418A1 (enExample) | 1973-06-18 |
| SU472497A3 (ru) | 1975-05-30 |
| AT321290B (de) | 1975-03-25 |
| JPS5125020B2 (enExample) | 1976-07-28 |
| CH586171A5 (enExample) | 1977-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102009027837A1 (de) | Verfahren zur kontinuierlichen Herstellung von Methylmercaptan aus kohlenstoffhaltigen Verbindungen, Schwefel und Wasserstoff | |
| DE2215495C2 (de) | Verfahren zur Herstellung organischer Disulfide | |
| DE2218004C3 (de) | Verfahren zur Herstellung von Anthracenen | |
| DE69305372T2 (de) | Verfahren zur Herstellung von Hydrocarbyltrisulfide-Produkt | |
| EP2118054B1 (de) | Verfahren zur herstellung von alkylmercaptan aus dialkylsulfiden und/oder dialkylpolysulfiden | |
| DE2622763B2 (de) | Verfahren zur umwandlung der mercaptane in disulfide einer erdoeldestillationsbeschickung | |
| DE69209192T2 (de) | Verfahren zur selektiven Darstellung von organischen Trisulfiden | |
| DE69101074T2 (de) | Niobtrisulfid-Katalysator zur Wasserstoffbehandlung von Kohlenwasserstoffeinsätzen und damit durchgeführtes Wasserstoffbehandlungsverfahren. | |
| DE68903313T2 (de) | Verfahren zur synthese von organischen polysulfiden. | |
| DE2001818C3 (de) | Verfahren zur Herstellung von 4,4'-Dithiobis-(2,6-di-t-butylphenol) | |
| DE60100083T2 (de) | Verfahren zur Herstellung von sulfurierten Olefinen | |
| DE2234306C3 (de) | Verfahren zur Herstellung von 1,4-Naphthochinon neben Phthalsäureanhydrid | |
| DE1270017B (de) | Verfahren zur Gewinnung von hochgereinigtem Benzol | |
| DE2001102A1 (de) | Verfahren zum Oligomerisieren von AEthylen | |
| DE2363647A1 (de) | Verfahren zur herstellung organischer sulfidverbindungen | |
| DE2222239A1 (de) | Verfahren zur Herstellung von Episulfiden | |
| DE2312838A1 (de) | Verfahren zur herstellung von 1,4naphthochinon neben phthalsaeureanhydrid | |
| AT226210B (de) | Verfahren zur Herstellung von Thioäthern | |
| DE2558370C2 (de) | Verfahren zur Herstellung von Polytrithiocarbonaten | |
| DE2053797C3 (de) | Verfahren zum Vermindern des Ammoniumhydrogensulfidgehaltes in einem dieses enthaltenden Abwasser | |
| DE1931060C3 (de) | Verfahren zur Oligomerisierung von Äthylen in flüssiger Phase | |
| DE831841C (de) | Verfahren zur Herstellung organischer, Schwefel und Sauerstoff enthaltender Verbindungen | |
| DE2638389C3 (de) | Verfahren zur Oxidation von Schwefelverbindungen | |
| DE2063919A1 (de) | Verfahren zur Herstellung von Dial kylsulfiden | |
| DE1568994A1 (de) | Verfahren zur Herstellung von Styrol |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |