DE2150772A1 - Verfahren zur herstellung von 6-hydroxy-2-pyridon-3-carbonsaeureamidverbindungen - Google Patents
Verfahren zur herstellung von 6-hydroxy-2-pyridon-3-carbonsaeureamidverbindungenInfo
- Publication number
- DE2150772A1 DE2150772A1 DE19712150772 DE2150772A DE2150772A1 DE 2150772 A1 DE2150772 A1 DE 2150772A1 DE 19712150772 DE19712150772 DE 19712150772 DE 2150772 A DE2150772 A DE 2150772A DE 2150772 A1 DE2150772 A1 DE 2150772A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- hydrogen
- condensation
- general formula
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 150000001875 compounds Chemical class 0.000 title claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 238000009833 condensation Methods 0.000 claims description 11
- 230000005494 condensation Effects 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 150000002431 hydrogen Chemical group 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000005017 substituted alkenyl group Chemical group 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 235000019441 ethanol Nutrition 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- -1 carboxamide compounds Chemical class 0.000 description 3
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 3
- WRIRWRKPLXCTFD-UHFFFAOYSA-N malonamide Chemical compound NC(=O)CC(N)=O WRIRWRKPLXCTFD-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SWWQQSDRUYSMAR-UHFFFAOYSA-N 1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride Chemical group Cl.C1=CC(O)=CC=C1CC1C2=CC(O)=C(O)C=C2CCN1 SWWQQSDRUYSMAR-UHFFFAOYSA-N 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-M 3-ethoxy-3-oxopropanoate Chemical compound CCOC(=O)CC([O-])=O HGINADPHJQTSKN-UHFFFAOYSA-M 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- GCPWJFKTWGFEHH-UHFFFAOYSA-N acetoacetamide Chemical class CC(=O)CC(N)=O GCPWJFKTWGFEHH-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- YPMPTULBFPFSEQ-PLNGDYQASA-N ethyl (z)-3-aminobut-2-enoate Chemical compound CCOC(=O)\C=C(\C)N YPMPTULBFPFSEQ-PLNGDYQASA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate group Chemical group [N+](=O)([O-])[O-] NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical class OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712150772 DE2150772A1 (de) | 1971-10-12 | 1971-10-12 | Verfahren zur herstellung von 6-hydroxy-2-pyridon-3-carbonsaeureamidverbindungen |
| FR7235922A FR2156231B1 (https=) | 1971-10-12 | 1972-10-11 | |
| GB4687772A GB1373314A (en) | 1971-10-12 | 1972-10-11 | Process for the preparation of 6-hydroxy-2-pyridone-3-carbonic acid amides |
| JP10121572A JPS4844263A (https=) | 1971-10-12 | 1972-10-11 | |
| CH1490172A CH568289A5 (https=) | 1971-10-12 | 1972-10-12 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712150772 DE2150772A1 (de) | 1971-10-12 | 1971-10-12 | Verfahren zur herstellung von 6-hydroxy-2-pyridon-3-carbonsaeureamidverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2150772A1 true DE2150772A1 (de) | 1973-04-19 |
Family
ID=5822115
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712150772 Pending DE2150772A1 (de) | 1971-10-12 | 1971-10-12 | Verfahren zur herstellung von 6-hydroxy-2-pyridon-3-carbonsaeureamidverbindungen |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS4844263A (https=) |
| CH (1) | CH568289A5 (https=) |
| DE (1) | DE2150772A1 (https=) |
| FR (1) | FR2156231B1 (https=) |
| GB (1) | GB1373314A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0628547A1 (de) * | 1993-06-14 | 1994-12-14 | BASF Aktiengesellschaft | Verfahren zur Herstellung von N-Aminopyridonen |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000015616A1 (en) | 1998-09-16 | 2000-03-23 | Dow Agrosciences Llc | 2-methoxyimino-2-(pyridinyloxymethyl)phenyl acetamides with (derivatised) hydroxyalkyl derivatives on the pyridine ring |
| EP1516874B1 (en) * | 1999-07-20 | 2015-08-19 | Dow AgroSciences LLC | Fungicidal heterocyclic aromatic amides and their compositions, methods of use and preparation |
| US6521622B1 (en) | 1999-07-20 | 2003-02-18 | Dow Agrosciences Llc | Fungicidal heterocyclic aromatic amides and their compositions, methods of use and preparation |
| US7732616B2 (en) | 2003-11-19 | 2010-06-08 | Array Biopharma Inc. | Dihydropyridine and dihydropyridazine derivatives as inhibitors of MEK and methods of use thereof |
| US7517994B2 (en) | 2003-11-19 | 2009-04-14 | Array Biopharma Inc. | Heterocyclic inhibitors of MEK and methods of use thereof |
| CA2546353A1 (en) * | 2003-11-19 | 2005-06-09 | Array Biopharma Inc. | Bicyclic inhibitors of mek and methods of use thereof |
| SG177981A1 (en) | 2005-05-18 | 2012-02-28 | Array Biopharma Inc | 4-(phenylamino)-6-oxo-1, 6-dihydropyridazine-3-carboxamide derivatives as mek inhibitors for the treatment of hyperproliferative diseases |
| JP5020542B2 (ja) | 2006-05-19 | 2012-09-05 | キヤノン株式会社 | 新規色素化合物及び該色素化合物を含有するインク |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1263268A (en) * | 1968-12-11 | 1972-02-09 | Ici Ltd | 0-aminoalkyl-pyridin-2-ones |
-
1971
- 1971-10-12 DE DE19712150772 patent/DE2150772A1/de active Pending
-
1972
- 1972-10-11 JP JP10121572A patent/JPS4844263A/ja active Pending
- 1972-10-11 FR FR7235922A patent/FR2156231B1/fr not_active Expired
- 1972-10-11 GB GB4687772A patent/GB1373314A/en not_active Expired
- 1972-10-12 CH CH1490172A patent/CH568289A5/xx not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0628547A1 (de) * | 1993-06-14 | 1994-12-14 | BASF Aktiengesellschaft | Verfahren zur Herstellung von N-Aminopyridonen |
| US5466812A (en) * | 1993-06-14 | 1995-11-14 | Basf Aktiengesellschaft | Preparation of N-aminopyridones |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2156231A1 (https=) | 1973-05-25 |
| FR2156231B1 (https=) | 1977-12-23 |
| GB1373314A (en) | 1974-11-06 |
| JPS4844263A (https=) | 1973-06-26 |
| CH568289A5 (https=) | 1975-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE928345C (de) | Verfahren zur Herstellung von 10-(3'-Pyrrolidino-propyl)-phenthiazin und seinen Salzen bzw. seinen quaternaeren Ammoniumverbindungen | |
| DE2150772A1 (de) | Verfahren zur herstellung von 6-hydroxy-2-pyridon-3-carbonsaeureamidverbindungen | |
| DE1116221B (de) | Verfahren zur Herstellung von ªú¼ª-Pentamethylenbutyrolacton bzw. Salzen der 3,3-Pentamethylen-4-hydroxybuttersaeure | |
| DE1695633A1 (de) | Verfahren zur Herstellung von neuen Phenoxazinderivaten | |
| DE1954706A1 (de) | Verfahren zur Herstellung von Imidazolderivaten | |
| DE1000822C2 (de) | Verfahren zur Herstellung von Pyridazonverbindungen | |
| DE1770538C3 (de) | Verfahren zur Herstellung von 6,7-Benzomorphanderivaten | |
| DE890189C (de) | Verfahren zur Herstellung von Barbitursaeureabkoemmlingen | |
| DE925168C (de) | Verfahren zur Herstellung von Derivaten der Barbitursaeure bzw. Thiobarbitursaeure | |
| DE1077222B (de) | Verfahren zur Herstellung von Benzimidazolylidenverbindungen | |
| DE2436032A1 (de) | Neue aromatische o-hydroxyaldehyde, verfahren zu ihrer herstellung und ihre verwendung | |
| AT208867B (de) | Verfahren zur Herstellung von neuen substituierten heterocyclischen Säurehydraziden | |
| DE942327C (de) | Verfahren zur Herstellung von Benzimidazol-2-aldehyden oder deren Diacetalen | |
| DE922048C (de) | Verfahren zur Herstellung von Pyrimidinderivaten | |
| AT215996B (de) | Verfahren zur Herstellung von neuen Pyridinderivaten | |
| DE1149004B (de) | Verfahren zur Herstellung von in 1-Stellung substituierten 4-Amino-1, 2, 5, 6-tetrahydrophosphorin-(arsenin)-3-carbonitrilen | |
| DE738400C (de) | Verfahren zur Herstellung von Polyketonen, Ketocarbonsaeure- und Polycarbonsaeureabkoemmlingen | |
| AT222643B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| DE2318566A1 (de) | 3-alkoxy-5-substituierte phenylessigsaeuren | |
| AT215414B (de) | Verfahren zur Herstellung von neuen β-Hydroxybuttersäureamid-Derivaten | |
| DE678152C (de) | Verfahren zur Darstellung von 4,5-Diketopyrrolidinen | |
| DE1445662C (de) | 4- eckige Klammer auf 2-(5-Nitrofuryl)vinyl eckige Klammer zu -pyrimidine und Verfahren zu ihrer Herstellung | |
| DE1158075B (de) | Verfahren zur Herstellung von 4, 5, 5-trisubstituierten Oxazolidon-(2)-carbonsaeureamiden-(4) | |
| DE2262343A1 (de) | Verfahren zur herstellung von ketonen | |
| DE1793261A1 (de) | ss-Phenyl-acrylsaeurenitrile |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |