DE2140207C3 - Stabilisiertes aromatisches PoIycarbonat - Google Patents
Stabilisiertes aromatisches PoIycarbonatInfo
- Publication number
- DE2140207C3 DE2140207C3 DE2140207A DE2140207A DE2140207C3 DE 2140207 C3 DE2140207 C3 DE 2140207C3 DE 2140207 A DE2140207 A DE 2140207A DE 2140207 A DE2140207 A DE 2140207A DE 2140207 C3 DE2140207 C3 DE 2140207C3
- Authority
- DE
- Germany
- Prior art keywords
- polycarbonate
- phosphite
- polycarbonates
- stabilized
- phosphites
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 46
- 239000004417 polycarbonate Substances 0.000 title claims description 46
- 125000003118 aryl group Chemical group 0.000 title claims description 6
- 239000003381 stabilizer Substances 0.000 claims description 13
- 238000002845 discoloration Methods 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000003566 oxetanyl group Chemical group 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 7
- 150000002989 phenols Chemical class 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 6
- 150000001298 alcohols Chemical class 0.000 claims description 6
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 230000007935 neutral effect Effects 0.000 claims description 4
- 230000000996 additive effect Effects 0.000 claims 1
- 238000009757 thermoplastic moulding Methods 0.000 claims 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 20
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 15
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical group [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 13
- 239000000243 solution Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 235000011187 glycerol Nutrition 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 229920001169 thermoplastic Polymers 0.000 description 5
- 239000004416 thermosoftening plastic Substances 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 3
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 238000005496 tempering Methods 0.000 description 2
- -1 triodiglycol Chemical compound 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UNMJLQGKEDTEKJ-UHFFFAOYSA-N (3-ethyloxetan-3-yl)methanol Chemical compound CCC1(CO)COC1 UNMJLQGKEDTEKJ-UHFFFAOYSA-N 0.000 description 1
- JYRWPHSOSHVKQO-UHFFFAOYSA-N (3-pentyloxetan-3-yl)methanol Chemical compound CCCCCC1(CO)COC1 JYRWPHSOSHVKQO-UHFFFAOYSA-N 0.000 description 1
- LABRPRANVKSMGP-UHFFFAOYSA-N 1,3,2-dioxaphosphinane Chemical compound C1COPOC1 LABRPRANVKSMGP-UHFFFAOYSA-N 0.000 description 1
- KYGLCUAXJICESS-UHFFFAOYSA-N 2-[2,3-di(propan-2-yl)phenyl]phenol Chemical compound CC(C)C1=CC=CC(C=2C(=CC=CC=2)O)=C1C(C)C KYGLCUAXJICESS-UHFFFAOYSA-N 0.000 description 1
- AODAQIOEZVDQLS-UHFFFAOYSA-N 3,4-ditert-butylbenzene-1,2-diol Chemical compound CC(C)(C)C1=CC=C(O)C(O)=C1C(C)(C)C AODAQIOEZVDQLS-UHFFFAOYSA-N 0.000 description 1
- FBSWPFFKBBRXJB-UHFFFAOYSA-N 3-(4-chlorophenyl)-1h-indole Chemical compound C1=CC(Cl)=CC=C1C1=CNC2=CC=CC=C12 FBSWPFFKBBRXJB-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical class [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical group 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000003260 vortexing Methods 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/655—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms
- C07F9/6551—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms the oxygen atom being part of a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/52—Phosphorus bound to oxygen only
- C08K5/529—Esters containing heterocyclic rings not representing cyclic esters of phosphoric or phosphorous acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2140207A DE2140207C3 (de) | 1971-08-11 | 1971-08-11 | Stabilisiertes aromatisches PoIycarbonat |
| IT52049/72A IT961910B (it) | 1971-08-11 | 1972-08-08 | Policarbunati aromatici stabilizza ti e procedimento per produrli |
| NL7210855.A NL163813C (nl) | 1971-08-11 | 1972-08-08 | Werkwijze voor het stabiliseren van macromoleculaire polycarbonaten, alsmede voorwerpen geheel of gedeeltelijk vervaardigd uit deze polycarbonaten. |
| BE787357D BE787357A (fr) | 1971-08-11 | 1972-08-09 | Polycarbonates aromatiques stabilises |
| US00278909A US3794629A (en) | 1971-08-11 | 1972-08-09 | Stabilized aromatic polycarbonates |
| CA148,989A CA1005945A (en) | 1971-08-11 | 1972-08-09 | Stabilised aromatic polycarbonate |
| JP7987072A JPS5312948B2 (enExample) | 1971-08-11 | 1972-08-09 | |
| GB3736872A GB1382525A (en) | 1971-08-11 | 1972-08-10 | Stabilised aromatic polycarbonate |
| FR7229225A FR2148648B1 (enExample) | 1971-08-11 | 1972-08-11 | |
| US05/635,010 US4073769A (en) | 1971-08-11 | 1975-11-25 | Esters of phosphorous acid |
| US05/843,186 US4323501A (en) | 1971-08-11 | 1977-10-18 | Esters of phosphorous acid |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2140207A DE2140207C3 (de) | 1971-08-11 | 1971-08-11 | Stabilisiertes aromatisches PoIycarbonat |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2140207A1 DE2140207A1 (de) | 1973-02-15 |
| DE2140207B2 DE2140207B2 (de) | 1975-04-17 |
| DE2140207C3 true DE2140207C3 (de) | 1975-11-27 |
Family
ID=5816443
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2140207A Expired DE2140207C3 (de) | 1971-08-11 | 1971-08-11 | Stabilisiertes aromatisches PoIycarbonat |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3794629A (enExample) |
| JP (1) | JPS5312948B2 (enExample) |
| BE (1) | BE787357A (enExample) |
| CA (1) | CA1005945A (enExample) |
| DE (1) | DE2140207C3 (enExample) |
| FR (1) | FR2148648B1 (enExample) |
| GB (1) | GB1382525A (enExample) |
| IT (1) | IT961910B (enExample) |
| NL (1) | NL163813C (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4323501A (en) * | 1971-08-11 | 1982-04-06 | Bayer Aktiengesellschaft | Esters of phosphorous acid |
| JPS5513110B2 (enExample) * | 1974-07-29 | 1980-04-07 | ||
| CA1069521A (en) * | 1975-03-11 | 1980-01-08 | Bayer Aktiengesellschaft | Stabilizer mixtures |
| US4102859A (en) * | 1975-03-11 | 1978-07-25 | Bayer Aktiengesellschaft | Stabilizer mixtures |
| DE2510463C2 (de) * | 1975-03-11 | 1986-04-03 | Bayer Ag, 5090 Leverkusen | Stabilisatormischungen und Verwendung von Stabilisatormischungen zur Stabilisierung von Polycarbonaten |
| JPS51122730A (en) * | 1975-04-18 | 1976-10-27 | Matsushita Electric Industrial Co Ltd | Battery |
| US4066617A (en) * | 1975-12-22 | 1978-01-03 | Mobay Chemical Corporation | Stabilized poly(alkylene terephthalates) |
| US4066611A (en) * | 1976-06-23 | 1978-01-03 | General Electric Company | Stabilized polycarbonate composition |
| DE2658556C2 (de) * | 1976-08-23 | 1986-12-11 | Mobay Corp., Pittsburgh, Pa. | Stabilisierte Polyalkylenterephthalate |
| DE2711184A1 (de) * | 1977-03-15 | 1978-09-28 | Bayer Ag | Verfahren zur herstellung farbheller polycarbonate |
| DE2735775A1 (de) * | 1977-08-09 | 1979-02-22 | Bayer Ag | Verfahren zur herstellung von polycarbonaten |
| DE2750043A1 (de) * | 1977-11-09 | 1979-05-10 | Bayer Ag | Verwendung von borsaeureestern zum stabilisieren von phosphitfreien polycarbonaten |
| JPS5538843A (en) * | 1978-09-14 | 1980-03-18 | Teijin Chem Ltd | Stabilized colored polycarbonate resin composition |
| US4335039A (en) * | 1978-11-02 | 1982-06-15 | General Electric Company | Thermally stable polycarbonate compositions |
| US4247448A (en) * | 1978-11-02 | 1981-01-27 | General Electric Company | Thermally stable polycarbonate compositions comprising oxetane phosphonites |
| DE2920451A1 (de) * | 1979-05-21 | 1981-01-29 | Bayer Ag | Verwendung von organischen siliciumverbindungen in kombination mit oxetanverbindungen, dioxanen oder tetrahydrofuranen zum stabilisieren und aufhellen von phosphitfreien und borsaeureesterfreien polycarbonaten |
| JPS5624761A (en) * | 1979-08-01 | 1981-03-09 | Yuasa Battery Co Ltd | Nonaqueous electrolyte battery |
| JPS5654762A (en) * | 1979-10-09 | 1981-05-14 | Yuasa Battery Co Ltd | Manufacture of nonaqueous-electrolyte battery |
| DE3222522A1 (de) * | 1982-06-16 | 1983-12-22 | Bayer Ag, 5090 Leverkusen | Stabilisatorkombinationen, ihre verwendung zur stabilisierung von thermoplastischen polycarbonaten sowie stabilisierte thermoplastische polycarbonate |
| NL8202845A (nl) * | 1982-07-14 | 1984-02-01 | Gen Electric | Polycarbonaatmassa met permanente geleidbaarheid en de gevormde voortbrengselen, die geheel of ten dele uit deze polycarbonaatmassa bestaan. |
| US4407995A (en) * | 1982-07-28 | 1983-10-04 | The Dow Chemical Company | Stabilized polycarbonate compositions containing cyclic carbonates and organophosphorous compounds |
| JPS59223750A (ja) * | 1983-06-03 | 1984-12-15 | Idemitsu Petrochem Co Ltd | ポリカ−ボネ−ト樹脂組成物 |
| US4686161A (en) * | 1985-09-16 | 1987-08-11 | Allied Corporation | Method of inhibiting voltage suppression lithium/fluorinated carbon batteries |
| DE4029536A1 (de) * | 1990-09-18 | 1992-03-19 | Bayer Ag | Polymerisatmischungen mit verbesserter thermostabilitaet ii |
| DE69418387T2 (de) * | 1993-07-22 | 1999-12-30 | General Electric Co., Schenectady | Neo-Diol Phosphite als Polymer-Stabilisatoren |
| US5523448A (en) | 1993-07-22 | 1996-06-04 | General Electric Company | Diphosphites |
| US5500468A (en) * | 1993-07-22 | 1996-03-19 | General Electric Company | Process for stabilizing polymeric material |
| DE69423147T2 (de) * | 1993-07-22 | 2000-10-19 | General Electric Co., Schenectady | Zyclische Phosphite als Polymer-Stabilisatoren |
| US5605947A (en) * | 1993-07-22 | 1997-02-25 | General Electric Company | Amorphous neo-diol phosphite compositions |
| US5543102A (en) * | 1993-07-22 | 1996-08-06 | General Electric Company | Melt extrusion process |
| US5500467A (en) * | 1993-07-22 | 1996-03-19 | General Electric Company | Polyolefin fiber and film resistant to gas fade |
| US5559167A (en) * | 1993-07-22 | 1996-09-24 | General Electric Company | Gamma irradiated thermoplastics and articles |
| US5614571A (en) * | 1994-09-16 | 1997-03-25 | General Electric Company | Stabilizer blend containing phosphite |
| US5491179A (en) * | 1994-11-23 | 1996-02-13 | Bayer Corporation | Thermally stable, gamma radiation-resistant blend of polycarbonate with polyester |
| DE19544675A1 (de) * | 1995-11-30 | 1997-06-05 | Bayer Ag | Mit Phosphorigsäureestern stabilisierte Polymer-Formmassen |
| US5594053A (en) * | 1996-01-22 | 1997-01-14 | General Electric Company | Aromatic cyclic bisphosphite esters and polymeric compositions thereof |
| US5618866A (en) * | 1996-01-22 | 1997-04-08 | General Electric Company | Neo diol phosphite esters and polymeric compositions thereof |
| DE10052805A1 (de) * | 2000-10-25 | 2002-05-08 | Bayer Ag | Mit Phosphorigsäureestern stabilisierte Polyalkylenterephthalat-Zusammensetzungen |
| DE10360367A1 (de) * | 2003-12-22 | 2005-07-21 | Bayer Materialscience Ag | Stabilisierte thermoplastische Zusammensetzungen |
| AU2013211121A1 (en) * | 2012-01-19 | 2014-08-07 | Bayer Intellectual Property Gmbh | Plastic film for printing by dye diffusion thermal transfer printing |
| CN104144794B (zh) | 2012-01-19 | 2018-03-23 | 科思创德国股份有限公司 | 用于借助染料扩散热转印印刷的塑料膜 |
| JP6408463B2 (ja) * | 2013-05-09 | 2018-10-17 | 住友化学株式会社 | 正極材料、及びその製造方法 |
| EP4074718A1 (de) * | 2021-04-15 | 2022-10-19 | LANXESS Deutschland GmbH | Stabilisatoren für polymere |
-
1971
- 1971-08-11 DE DE2140207A patent/DE2140207C3/de not_active Expired
-
1972
- 1972-08-08 IT IT52049/72A patent/IT961910B/it active
- 1972-08-08 NL NL7210855.A patent/NL163813C/xx not_active IP Right Cessation
- 1972-08-09 CA CA148,989A patent/CA1005945A/en not_active Expired
- 1972-08-09 US US00278909A patent/US3794629A/en not_active Expired - Lifetime
- 1972-08-09 BE BE787357D patent/BE787357A/xx not_active IP Right Cessation
- 1972-08-09 JP JP7987072A patent/JPS5312948B2/ja not_active Expired
- 1972-08-10 GB GB3736872A patent/GB1382525A/en not_active Expired
- 1972-08-11 FR FR7229225A patent/FR2148648B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL163813B (nl) | 1980-05-16 |
| IT961910B (it) | 1973-12-10 |
| DE2140207B2 (de) | 1975-04-17 |
| NL163813C (nl) | 1980-10-15 |
| CA1005945A (en) | 1977-02-22 |
| JPS5312948B2 (enExample) | 1978-05-06 |
| FR2148648B1 (enExample) | 1976-01-23 |
| NL7210855A (enExample) | 1973-02-13 |
| JPS4826891A (enExample) | 1973-04-09 |
| BE787357A (fr) | 1973-02-09 |
| GB1382525A (en) | 1975-02-05 |
| US3794629A (en) | 1974-02-26 |
| FR2148648A1 (enExample) | 1973-03-23 |
| DE2140207A1 (de) | 1973-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2140207C3 (de) | Stabilisiertes aromatisches PoIycarbonat | |
| EP0143906B1 (de) | Verfahren zur Herstellung stabilisierter Polycarbonat-Formkörper nach dem Entgasungsspritzguss--oder dem Entgasungsextrusionsverfahren | |
| DE3222522A1 (de) | Stabilisatorkombinationen, ihre verwendung zur stabilisierung von thermoplastischen polycarbonaten sowie stabilisierte thermoplastische polycarbonate | |
| DE2837027A1 (de) | Neue phosphorigsaeureester und ihre verwendung zur stabilisierung von polyamiden | |
| DE2500092A1 (de) | Verzweigte, hochmolekulare, thermoplastische polycarbonate | |
| DE2829256A1 (de) | Polycarbonate mit uv-licht-vernetzbaren doppelbindungen enthaltenden endgruppen | |
| DE2148598C3 (de) | Flammfeste thermoplastische Formmassen und Formkörper mit hoher Schlagzähigkeit | |
| DE3226810A1 (de) | Aromatische polycarbonat-zubereitung mit verbesserter hydrolytischer stabilitaet | |
| DE2746141A1 (de) | Aromatische ketogruppen enthaltende thermoplastische polycarbonate und ihre verwendung zur herstellung von modifizierten polycarbonaten | |
| DE1719223B2 (de) | Stabilisierte vinylhalogenidpolymerisat-formmasse | |
| EP0712901B1 (de) | Flammwidrige Polycarbonatformmassen | |
| DE2709419A1 (de) | Farbstabilisierte halogenbisphenolaethylen-polycarbonate | |
| EP0043998B1 (de) | Stabilisatorlösungen, ihre Verwendung zur Stabilisierung von thermoplastischen Polycarbonaten sowie stabilisierte thermoplastische Polycarbonate | |
| EP0001823A2 (de) | Verwendung von Borsäureestern zum Stabilisieren von phosphitfreien Polycarbonaten und die erhaltenen stabilisierten Polycarbonatformmassen | |
| DE2254918A1 (de) | Verzweigte aromatische polycarbonate | |
| DE2321055C2 (de) | Flammwidrige Polycarbonatformmassen | |
| DE2510463C2 (de) | Stabilisatormischungen und Verwendung von Stabilisatormischungen zur Stabilisierung von Polycarbonaten | |
| DE2255639B2 (de) | Ester der phosphorigen Säure | |
| DE2658849A1 (de) | Stabilisierte polycarbonatzusammensetzung | |
| DE2460052A1 (de) | Verfahren zur herstellung schwerbrennbarer hochmolekularer thermoplastischer polycarbonate | |
| DE2705219C2 (enExample) | ||
| DE3786567T2 (de) | Stabilisierte aromatische polyesterzusammensetzungen. | |
| US4323501A (en) | Esters of phosphorous acid | |
| DE2329605A1 (de) | Farbstabilisierte polycarbonatzusammensetzung | |
| EP0150497A2 (de) | Stabilisierte aromatische Polyester und Polyestercarbonate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |