DE2705219C2 - - Google Patents
Info
- Publication number
- DE2705219C2 DE2705219C2 DE2705219A DE2705219A DE2705219C2 DE 2705219 C2 DE2705219 C2 DE 2705219C2 DE 2705219 A DE2705219 A DE 2705219A DE 2705219 A DE2705219 A DE 2705219A DE 2705219 C2 DE2705219 C2 DE 2705219C2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- polycarbonate
- polycarbonates
- hydroxyphenyl
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 claims description 47
- 239000004417 polycarbonate Substances 0.000 claims description 47
- 229920001169 thermoplastic Polymers 0.000 claims description 17
- 239000004416 thermosoftening plastic Substances 0.000 claims description 17
- 125000003118 aryl group Chemical group 0.000 claims description 16
- 238000000465 moulding Methods 0.000 claims description 14
- 150000002989 phenols Chemical class 0.000 claims description 12
- 150000003918 triazines Chemical class 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- AYJRCSIUFZENHW-UHFFFAOYSA-L barium carbonate Inorganic materials [Ba+2].[O-]C([O-])=O AYJRCSIUFZENHW-UHFFFAOYSA-L 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 230000000087 stabilizing effect Effects 0.000 claims description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 239000003063 flame retardant Substances 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910000018 strontium carbonate Inorganic materials 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 2
- 239000000203 mixture Substances 0.000 description 14
- 230000003301 hydrolyzing effect Effects 0.000 description 9
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 8
- -1 ethylidene, n-propylidene Chemical group 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- 150000001299 aldehydes Chemical class 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 229920005668 polycarbonate resin Polymers 0.000 description 7
- 239000004431 polycarbonate resin Substances 0.000 description 7
- 239000003381 stabilizer Substances 0.000 description 7
- 239000003963 antioxidant agent Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 4
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 4
- 229930185605 Bisphenol Natural products 0.000 description 4
- 230000032683 aging Effects 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 description 3
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 description 2
- RHAIZNLUYMALOF-UHFFFAOYSA-N 2,4-dichloro-6-fluoro-1,3,5-triazine Chemical compound FC1=NC(Cl)=NC(Cl)=N1 RHAIZNLUYMALOF-UHFFFAOYSA-N 0.000 description 2
- XOUQAVYLRNOXDO-UHFFFAOYSA-N 2-tert-butyl-5-methylphenol Chemical compound CC1=CC=C(C(C)(C)C)C(O)=C1 XOUQAVYLRNOXDO-UHFFFAOYSA-N 0.000 description 2
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 125000001118 alkylidene group Chemical group 0.000 description 2
- 229940106691 bisphenol a Drugs 0.000 description 2
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 2
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 2
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000006082 mold release agent Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 1
- YIYBRXKMQFDHSM-UHFFFAOYSA-N 2,2'-Dihydroxybenzophenone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1O YIYBRXKMQFDHSM-UHFFFAOYSA-N 0.000 description 1
- RIRMMJBLWVZDJF-UHFFFAOYSA-N 2,4,6-triiodo-1,3,5-triazine Chemical compound IC1=NC(I)=NC(I)=N1 RIRMMJBLWVZDJF-UHFFFAOYSA-N 0.000 description 1
- VXHYVVAUHMGCEX-UHFFFAOYSA-N 2-(2-hydroxyphenoxy)phenol Chemical compound OC1=CC=CC=C1OC1=CC=CC=C1O VXHYVVAUHMGCEX-UHFFFAOYSA-N 0.000 description 1
- XSVZEASGNTZBRQ-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfinylphenol Chemical class OC1=CC=CC=C1S(=O)C1=CC=CC=C1O XSVZEASGNTZBRQ-UHFFFAOYSA-N 0.000 description 1
- QUWAJPZDCZDTJS-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfonylphenol Chemical class OC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1O QUWAJPZDCZDTJS-UHFFFAOYSA-N 0.000 description 1
- FRFFMRSDNZVIEO-UHFFFAOYSA-N 2-chloro-4,6-difluoro-1,3,5-triazine Chemical compound FC1=NC(F)=NC(Cl)=N1 FRFFMRSDNZVIEO-UHFFFAOYSA-N 0.000 description 1
- XBQRPFBBTWXIFI-UHFFFAOYSA-N 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C(Cl)=CC=1C(C)(C)C1=CC=C(O)C(Cl)=C1 XBQRPFBBTWXIFI-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- SUCTVKDVODFXFX-UHFFFAOYSA-N 4-(4-hydroxy-3,5-dimethylphenyl)sulfonyl-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(S(=O)(=O)C=2C=C(C)C(O)=C(C)C=2)=C1 SUCTVKDVODFXFX-UHFFFAOYSA-N 0.000 description 1
- AZZWZMUXHALBCQ-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1 AZZWZMUXHALBCQ-UHFFFAOYSA-N 0.000 description 1
- BWCAVNWKMVHLFW-UHFFFAOYSA-N 4-[1-(4-hydroxy-3,5-dimethylphenyl)cyclohexyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(O)=C(C)C=2)=C1 BWCAVNWKMVHLFW-UHFFFAOYSA-N 0.000 description 1
- OBZFGWBLZXIBII-UHFFFAOYSA-N 4-[3-(4-hydroxy-3,5-dimethylphenyl)-3-methylbutyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CCC(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 OBZFGWBLZXIBII-UHFFFAOYSA-N 0.000 description 1
- NIRYBKWMEWFDPM-UHFFFAOYSA-N 4-[3-(4-hydroxyphenyl)-3-methylbutyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CCC1=CC=C(O)C=C1 NIRYBKWMEWFDPM-UHFFFAOYSA-N 0.000 description 1
- YDHNHFNGJCKAIZ-UHFFFAOYSA-N 6-chloro-1,3,5-triazine-2,4-diol Chemical compound OC1=NC(O)=NC(Cl)=N1 YDHNHFNGJCKAIZ-UHFFFAOYSA-N 0.000 description 1
- GIXXQTYGFOHYPT-UHFFFAOYSA-N Bisphenol P Chemical compound C=1C=C(C(C)(C)C=2C=CC(O)=CC=2)C=CC=1C(C)(C)C1=CC=C(O)C=C1 GIXXQTYGFOHYPT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 241001620634 Roger Species 0.000 description 1
- 229910010252 TiO3 Inorganic materials 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 125000005427 anthranyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- XMHIUKTWLZUKEX-UHFFFAOYSA-M cerotate Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCC([O-])=O XMHIUKTWLZUKEX-UHFFFAOYSA-M 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229940117916 cinnamic aldehyde Drugs 0.000 description 1
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical group C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000005034 decoration Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 238000006864 oxidative decomposition reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3467—Heterocyclic compounds having nitrogen in the ring having more than two nitrogen atoms in the ring
- C08K5/3477—Six-membered rings
- C08K5/3492—Triazines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/13—Phenols; Phenolates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/52—Phosphorus bound to oxygen only
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/52—Phosphorus bound to oxygen only
- C08K5/521—Esters of phosphoric acids, e.g. of H3PO4
- C08K5/523—Esters of phosphoric acids, e.g. of H3PO4 with hydroxyaryl compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/657,653 US4260537A (en) | 1976-02-12 | 1976-02-12 | Stabilized polycarbonate compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2705219A1 DE2705219A1 (de) | 1977-08-18 |
| DE2705219C2 true DE2705219C2 (enExample) | 1987-07-16 |
Family
ID=24638086
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772705219 Granted DE2705219A1 (de) | 1976-02-12 | 1977-02-08 | Stabilisierte polycarbonatformmassen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4260537A (enExample) |
| JP (2) | JPS5298763A (enExample) |
| CA (1) | CA1089589A (enExample) |
| DE (1) | DE2705219A1 (enExample) |
| FR (1) | FR2352029A1 (enExample) |
| GB (1) | GB1514444A (enExample) |
| IT (1) | IT1086624B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4454261A (en) * | 1982-03-15 | 1984-06-12 | Mobay Chemical Corporation | Polycarbonate-calcite compositions |
| DE3408804A1 (de) * | 1983-09-30 | 1985-04-18 | Bayer Ag, 5090 Leverkusen | Polyether-copolycarbonate fuer dialysemembranen |
| JPS60203666A (ja) * | 1984-03-28 | 1985-10-15 | Hitachi Ltd | ポリカ−ボネ−ト組成物 |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| JPH0374980U (enExample) * | 1989-11-24 | 1991-07-26 | ||
| JPH0441525A (ja) * | 1990-06-08 | 1992-02-12 | Daicel Chem Ind Ltd | ポリカーボネートの製造法 |
| DE4020258A1 (de) * | 1990-06-26 | 1992-01-02 | Bayer Ag | Thermoplastische polycarbonatformmassen mit flammwidrigen eigenschaften |
| US5240978A (en) * | 1990-06-26 | 1993-08-31 | Bayer Aktiengesellschaft | Thermoplastic polycarbonate moulding compositions with flame-resistant properties |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3014891A (en) * | 1961-12-26 | Resinous compositions | ||
| US2581907A (en) * | 1946-03-09 | 1952-01-08 | Firestone Tire & Rubber Co | Rubbery diolefinic polymers containing as antioxidant a mixture of antimony oxide and a 2, 4, 6 trihydrocarbon substituted phenol |
| NL104015C (enExample) * | 1953-10-16 | |||
| DE1007996B (de) * | 1955-03-26 | 1957-05-09 | Bayer Ag | Verfahren zur Herstellung thermoplastischer Kunststoffe |
| US2991273A (en) * | 1956-07-07 | 1961-07-04 | Bayer Ag | Process for manufacture of vacuum moulded parts of high molecular weight thermoplastic polycarbonates |
| US3148172A (en) * | 1956-07-19 | 1964-09-08 | Gen Electric | Polycarbonates of dihydroxyaryl ethers |
| US2999846A (en) * | 1956-11-30 | 1961-09-12 | Schnell Hermann | High molecular weight thermoplastic aromatic sulfoxy polycarbonates |
| US2999835A (en) * | 1959-01-02 | 1961-09-12 | Gen Electric | Resinous mixture comprising organo-polysiloxane and polymer of a carbonate of a dihydric phenol, and products containing same |
| US3186962A (en) * | 1960-04-14 | 1965-06-01 | Ici Ltd | Polyethylene terephthalate stabilized with a condensation product of a phenol with an unsaturated aldehyde |
| US3238178A (en) * | 1962-01-15 | 1966-03-01 | Eastman Kodak Co | Elastomeric polymers stabilized with trialkylated phenol and thioor-ganic esters |
| BE624206A (enExample) * | 1961-10-30 | |||
| US3239484A (en) * | 1962-10-04 | 1966-03-08 | Exxon Research Engineering Co | Stabilization of polyolefins with oxanilide and a crotonaldehyde-phenol condensation product |
| GB1045533A (en) * | 1963-02-21 | 1966-10-12 | Gen Electric | Flame-resistant polycarbonate compositions |
| US3271368A (en) * | 1963-05-02 | 1966-09-06 | Borg Warner | Sulfonate-thiocarbonate copolymers |
| US3398212A (en) * | 1963-07-01 | 1968-08-20 | Eastman Kodak Co | Bisphenol polycarbonates and polyesters containing units derived from a thiodiphenol |
| US3280078A (en) * | 1963-09-26 | 1966-10-18 | Union Carbide Corp | Polyethylenically unsaturated polycarbonate polymers |
| GB1122003A (en) * | 1964-10-07 | 1968-07-31 | Gen Electric | Improvements in aromatic polycarbonates |
| NL152889B (nl) * | 1967-03-10 | 1977-04-15 | Gen Electric | Werkwijze ter bereiding van een lineair polycarbonaatcopolymeer, alsmede orienteerbare textielvezel van dit copolymeer. |
| US3637907A (en) * | 1969-02-26 | 1972-01-25 | Phillips Petroleum Co | Polyolefins stabilized with diphosphines |
| US3676531A (en) * | 1969-05-19 | 1972-07-11 | Ciba Geigy Corp | Bis-(hindered phenol)-alkane phosphonates |
| US3729471A (en) * | 1969-12-16 | 1973-04-24 | Ashland Oil Inc | Triazine derivatives of bisphenols |
| US3647747A (en) * | 1970-04-15 | 1972-03-07 | Gen Electric | High temperature molding flame retardant polycarbonate composition |
| CH549407A (de) * | 1970-07-06 | 1974-05-31 | Ciba Geigy Ag | Verwendung sterisch gehinderter phenolestern von glykolen als stabilisatoren. |
| DE2063050C3 (de) * | 1970-12-22 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | Verseifungsbeständige Polycarbonate, Verfahren zu deren Herstellung und deren Verwendung |
| DE2063052A1 (de) * | 1970-12-22 | 1972-07-13 | Bayer | Verseifungsbeständige Polycarbonate |
| US3733296A (en) * | 1971-07-22 | 1973-05-15 | Baychem Corp | Stabilized polycarbonates |
| CH559696A5 (enExample) * | 1971-10-14 | 1975-03-14 | Moessinger Sa | |
| US3915926A (en) * | 1972-03-10 | 1975-10-28 | Gen Electric | Flame retardant thermoplastic compositions |
| DE2211956A1 (de) * | 1972-03-11 | 1973-10-25 | Bayer Ag | Verfahren zur herstellung verseifungsstabiler blockcopolycarbonate |
| US3812220A (en) * | 1972-05-15 | 1974-05-21 | Ashland Oil Inc | Phosphate esters of hindered phenols |
| CH574967A5 (enExample) * | 1973-03-27 | 1976-04-30 | Ciba Geigy Ag | |
| AU6597174A (en) * | 1973-04-04 | 1975-08-28 | Gen Electric | Photooxidatively stable polycarbonate composition |
| CH589056A5 (enExample) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag | |
| CH602906A5 (enExample) * | 1974-01-21 | 1978-08-15 | Ciba Geigy Ag | |
| US3956361A (en) * | 1974-05-23 | 1976-05-11 | Ciba-Geigy Corporation | Hindered phenolic derivatives of norbornane thioalcohols |
-
1976
- 1976-02-12 US US05/657,653 patent/US4260537A/en not_active Expired - Lifetime
- 1976-12-30 CA CA268,973A patent/CA1089589A/en not_active Expired
-
1977
- 1977-02-08 DE DE19772705219 patent/DE2705219A1/de active Granted
- 1977-02-09 GB GB5303/77A patent/GB1514444A/en not_active Expired
- 1977-02-10 IT IT47991/77A patent/IT1086624B/it active
- 1977-02-10 JP JP1310877A patent/JPS5298763A/ja active Granted
- 1977-02-11 FR FR7703982A patent/FR2352029A1/fr active Granted
-
1979
- 1979-11-30 JP JP54154471A patent/JPS5853665B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2352029A1 (fr) | 1977-12-16 |
| CA1089589A (en) | 1980-11-11 |
| IT1086624B (it) | 1985-05-28 |
| GB1514444A (en) | 1978-06-14 |
| DE2705219A1 (de) | 1977-08-18 |
| US4260537A (en) | 1981-04-07 |
| JPS5298763A (en) | 1977-08-18 |
| FR2352029B1 (enExample) | 1985-01-04 |
| JPS55129445A (en) | 1980-10-07 |
| JPS5853665B2 (ja) | 1983-11-30 |
| JPS5750821B2 (enExample) | 1982-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0247480B1 (de) | Verzweigte thermoplastische Polycarbonate mit verbessertem Schutz gegen UV-Licht | |
| DE2140207C3 (de) | Stabilisiertes aromatisches PoIycarbonat | |
| DE2148598C3 (de) | Flammfeste thermoplastische Formmassen und Formkörper mit hoher Schlagzähigkeit | |
| EP1287061A1 (de) | Ir-absorbierende zusammensetzungen | |
| DE2631755A1 (de) | Neue, flammhemmende polycarbonat- zusammensetzungen | |
| DE2721596A1 (de) | Flammhemmendes polycarbonat mit verbesserter kritischer dicke und verfahren zu seiner herstellung | |
| EP0001096A2 (de) | Polycarbonatgemische mit verbesserter Flammwidrigkeit | |
| EP0096818A1 (de) | Stabilisatorkombinationen, ihre Verwendung zur Stabilisierung von thermoplastischen Polycarbonaten sowie stabilisierte, thermoplastische Polycarbonate | |
| DE2705219C2 (enExample) | ||
| DE3226810A1 (de) | Aromatische polycarbonat-zubereitung mit verbesserter hydrolytischer stabilitaet | |
| DE69701782T2 (de) | Polycarbonatzusammensetzungen mit geringer Belagbildung | |
| DE2709419A1 (de) | Farbstabilisierte halogenbisphenolaethylen-polycarbonate | |
| EP0043998B1 (de) | Stabilisatorlösungen, ihre Verwendung zur Stabilisierung von thermoplastischen Polycarbonaten sowie stabilisierte thermoplastische Polycarbonate | |
| EP1266931A1 (de) | Wärmeabsorbierende Polymer-Zusammensetzung | |
| DE2751218A1 (de) | Plastizierte polycarbonatzusammensetzung | |
| DE3133512A1 (de) | Flammwidrige polycarbonatharz-zusammensetzung | |
| EP0001823A2 (de) | Verwendung von Borsäureestern zum Stabilisieren von phosphitfreien Polycarbonaten und die erhaltenen stabilisierten Polycarbonatformmassen | |
| EP0120296B1 (de) | Schwerentflammbare, transparente Poly-(arylether-arylsulfon)-Formmassen, Verfahren zu deren Herstellung sowie deren Verwendung | |
| DE60107830T2 (de) | Gegen gammastrahlung beständige polycarbonatzusammensetzung | |
| DE4236142A1 (de) | Gegen gamma-strahlung bestaendige polycarbonat-zusammensetzungen | |
| DE60318578T2 (de) | Thermoplastische polycarbonatzusammensetzungen mit hoher zähigkeit | |
| DE2631756A1 (de) | Neue, flammhemmende polycarbonat- zusammensetzungen | |
| DE2435508C2 (de) | Flammwidrige Polycarbonat-Formmassen | |
| DE2659756A1 (de) | Gegen thermische oxidation stabile polycarbonatzusammensetzung | |
| DE2644437A1 (de) | Verwendung von ferrocen und seinen derivaten als flammhemmer in polycarbonatformmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8127 | New person/name/address of the applicant |
Owner name: MOBAY CORP., PITTSBURGH, PA., US |
|
| 8128 | New person/name/address of the agent |
Representative=s name: MUELLER, G., DIPL.-CHEM. DR.RER.NAT., PAT.-ASS., 5 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |