DE2105490C3 - 1 -Imidazolylketonderivate - Google Patents
1 -ImidazolylketonderivateInfo
- Publication number
- DE2105490C3 DE2105490C3 DE2105490A DE2105490A DE2105490C3 DE 2105490 C3 DE2105490 C3 DE 2105490C3 DE 2105490 A DE2105490 A DE 2105490A DE 2105490 A DE2105490 A DE 2105490A DE 2105490 C3 DE2105490 C3 DE 2105490C3
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- compounds
- imidazolyl
- imidazole
- acetophenone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical class C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 42
- 239000003814 drug Substances 0.000 claims description 7
- 239000000969 carrier Substances 0.000 claims description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 43
- 238000000034 method Methods 0.000 description 24
- -1 alkyl radical Chemical class 0.000 description 23
- 150000003839 salts Chemical class 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 12
- 208000015181 infectious disease Diseases 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 8
- 230000000843 anti-fungal effect Effects 0.000 description 8
- 125000000468 ketone group Chemical group 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 230000037396 body weight Effects 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 230000001857 anti-mycotic effect Effects 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241000799767 Scutula Species 0.000 description 4
- 241000223238 Trichophyton Species 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000002543 antimycotic Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 150000002460 imidazoles Chemical class 0.000 description 4
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 241000251730 Chondrichthyes Species 0.000 description 3
- 208000007163 Dermatomycoses Diseases 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000555688 Malassezia furfur Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229940121375 antifungal agent Drugs 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- LEZWWPYKPKIXLL-UHFFFAOYSA-N 1-{2-(4-chlorobenzyloxy)-2-(2,4-dichlorophenyl)ethyl}imidazole Chemical compound C1=CC(Cl)=CC=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 LEZWWPYKPKIXLL-UHFFFAOYSA-N 0.000 description 2
- 241001480043 Arthrodermataceae Species 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BYBLEWFAAKGYCD-UHFFFAOYSA-N Miconazole Chemical compound ClC1=CC(Cl)=CC=C1COC(C=1C(=CC(Cl)=CC=1)Cl)CN1C=NC=C1 BYBLEWFAAKGYCD-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229960004022 clotrimazole Drugs 0.000 description 2
- VNFPBHJOKIVQEB-UHFFFAOYSA-N clotrimazole Chemical compound ClC1=CC=CC=C1C(N1C=NC=C1)(C=1C=CC=CC=1)C1=CC=CC=C1 VNFPBHJOKIVQEB-UHFFFAOYSA-N 0.000 description 2
- 230000037304 dermatophytes Effects 0.000 description 2
- 229960003913 econazole Drugs 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229960002509 miconazole Drugs 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- NPZDCTUDQYGYQD-UHFFFAOYSA-N 1-tritylimidazole Chemical class C1=NC=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NPZDCTUDQYGYQD-UHFFFAOYSA-N 0.000 description 1
- JDIIGWSSTNUWGK-UHFFFAOYSA-N 1h-imidazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C=CN=C1 JDIIGWSSTNUWGK-UHFFFAOYSA-N 0.000 description 1
- HOLHYSJJBXSLMV-UHFFFAOYSA-N 2,6-dichlorophenol Chemical compound OC1=C(Cl)C=CC=C1Cl HOLHYSJJBXSLMV-UHFFFAOYSA-N 0.000 description 1
- FBAOVPVVMDOHPK-UHFFFAOYSA-N 2-(1h-imidazol-2-ylsulfinyl)-1h-imidazole Chemical compound N=1C=CNC=1S(=O)C1=NC=CN1 FBAOVPVVMDOHPK-UHFFFAOYSA-N 0.000 description 1
- KGHKDTKCPWYXJA-UHFFFAOYSA-N 2-(2-chlorophenoxy)-1-phenylethanone Chemical compound ClC1=CC=CC=C1OCC(=O)C1=CC=CC=C1 KGHKDTKCPWYXJA-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001337994 Cryptococcus <scale insect> Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000224432 Entamoeba histolytica Species 0.000 description 1
- 241000305071 Enterobacterales Species 0.000 description 1
- 241001480035 Epidermophyton Species 0.000 description 1
- 241001480036 Epidermophyton floccosum Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241000228143 Penicillium Species 0.000 description 1
- 241000985694 Polypodiopsida Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 206010067409 Trichophytosis Diseases 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000003974 aralkylamines Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- GRSTVVGJSKHCCS-UHFFFAOYSA-N bis(1h-imidazol-2-yl)methanone Chemical compound N=1C=CNC=1C(=O)C1=NC=CN1 GRSTVVGJSKHCCS-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 201000003929 dermatomycosis Diseases 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229940007078 entamoeba histolytica Drugs 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000000763 evoking effect Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005283 haloketone group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- IMACFCSSMIZSPP-UHFFFAOYSA-N phenacyl chloride Chemical compound ClCC(=O)C1=CC=CC=C1 IMACFCSSMIZSPP-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000003809 water extraction Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 244000235231 white angels trumpet Species 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2105490A DE2105490C3 (de) | 1971-02-05 | 1971-02-05 | 1 -Imidazolylketonderivate |
| DD159986A DD94819A5 (enExample) | 1971-02-05 | 1971-12-29 | |
| US00219556A US3812142A (en) | 1971-02-05 | 1972-01-20 | Imidazolyl ketones |
| IL38687A IL38687A (en) | 1971-02-05 | 1972-02-02 | Omega-imidazolyl-omega-phenoxy-alkanones,their preparation and pharmaceutical compositions containing them |
| CH157372A CH577978A5 (enExample) | 1971-02-05 | 1972-02-03 | |
| GB532672A GB1351542A (en) | 1971-02-05 | 1972-02-04 | Imidazole derivatives their preparation and their medicidal use |
| HUBA2700A HU163992B (enExample) | 1971-02-05 | 1972-02-04 | |
| FR7203855A FR2124506B1 (enExample) | 1971-02-05 | 1972-02-04 | |
| BE778973A BE778973A (fr) | 1971-02-05 | 1972-02-04 | Nouveaux derives d'imidazole a usage pharmaceutique et leur procede de preparation |
| JP47012303A JPS5142110B1 (enExample) | 1971-02-05 | 1972-02-04 | |
| AT95172A AT311337B (de) | 1971-02-05 | 1972-02-07 | Verfahren zur Herstellung von neuen Imidazolderivaten und ihren Salzen |
| US402050A US3903287A (en) | 1971-02-05 | 1973-10-01 | Imidazolyl ketones for treating mycotic infections |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2105490A DE2105490C3 (de) | 1971-02-05 | 1971-02-05 | 1 -Imidazolylketonderivate |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2105490A1 DE2105490A1 (de) | 1972-08-10 |
| DE2105490B2 DE2105490B2 (de) | 1978-10-12 |
| DE2105490C3 true DE2105490C3 (de) | 1979-06-13 |
Family
ID=5797915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2105490A Expired DE2105490C3 (de) | 1971-02-05 | 1971-02-05 | 1 -Imidazolylketonderivate |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3812142A (enExample) |
| JP (1) | JPS5142110B1 (enExample) |
| AT (1) | AT311337B (enExample) |
| BE (1) | BE778973A (enExample) |
| CH (1) | CH577978A5 (enExample) |
| DD (1) | DD94819A5 (enExample) |
| DE (1) | DE2105490C3 (enExample) |
| FR (1) | FR2124506B1 (enExample) |
| GB (1) | GB1351542A (enExample) |
| HU (1) | HU163992B (enExample) |
| IL (1) | IL38687A (enExample) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2324424A1 (de) * | 1973-05-15 | 1974-12-05 | Bayer Ag | Antimikrobielle mittel |
| DE2325156A1 (de) * | 1973-05-18 | 1974-12-05 | Bayer Ag | Fungizide und mikrobizide mittel |
| DE2333355C2 (de) * | 1973-06-30 | 1984-01-19 | Bayer Ag, 5090 Leverkusen | Antimikrobielle Mittel |
| DE2347057A1 (de) * | 1973-09-19 | 1975-04-03 | Bayer Ag | Antimikrobielle mittel |
| DE2348663A1 (de) * | 1973-09-27 | 1975-04-03 | Bayer Ag | Verfahren zur herstellung von neuen 1-aethyl-azolylderivaten |
| DE2350121A1 (de) * | 1973-10-05 | 1975-04-10 | Bayer Ag | Antimikrobielle mittel |
| DE2350124A1 (de) * | 1973-10-05 | 1975-04-10 | Bayer Ag | Antimikrobielle mittel |
| DE2423987C2 (de) * | 1974-05-17 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2429514A1 (de) * | 1974-06-20 | 1976-01-15 | Bayer Ag | Eckige klammer auf 1-imidazolyl-(1) eckige klammer zu- eckige klammer auf 1-(4'-(4''-chlorphenyl)-phenoxy eckige klammer zu-3,3-dimethyl-butan-2-on und seine salze, ein verfahren zu ihrer herstellung als arzneimittel |
| DE2430039C2 (de) * | 1974-06-22 | 1983-11-10 | Bayer Ag, 5090 Leverkusen | Climbazol in kosmetischen Mitteln |
| DE2455953A1 (de) * | 1974-11-27 | 1976-08-12 | Bayer Ag | Fungizide mittel |
| DE2455954A1 (de) * | 1974-11-27 | 1976-08-12 | Bayer Ag | Diaryloxy-imidazolyl-o,n-acetale, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| NZ181916A (en) * | 1975-09-10 | 1979-01-11 | Ici Ltd | 1-substituted-1,2,4-triazoles and fungicidal compositions |
| DE2600800C2 (de) * | 1976-01-10 | 1986-10-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur Bekämpfung von Pilzen im Haushaltssektor |
| DE2604761A1 (de) * | 1976-02-07 | 1977-08-11 | Bayer Ag | Acylierte imidazolyl-o,n-acetale, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| US4172141A (en) * | 1976-03-17 | 1979-10-23 | Syntex (U.S.A.) Inc. | N-(naphthylethyl)imidazole derivatives |
| DE2635883A1 (de) * | 1976-08-10 | 1978-02-16 | Bayer Ag | N-sulfenylierte oximcarbamate, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und nematozide |
| DE2635666A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | 1-azolyl-4-hydroxy-butan-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und bakterizide |
| PT66803B (en) * | 1976-07-20 | 1978-12-20 | Bayer Ag | Process for preparing a fungicidal composition containing halogenated 1-azolyl-butane derivatives and their phisiologically suitable salts |
| DE2635663A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | Azolyl-carbonsaeure-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE2635665A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | Antimikrobielle mittel |
| DK156408C (da) * | 1977-01-18 | 1990-01-22 | Bayer Ag | Fremgangsmaade til bekaempelse af svampe inden for husholdningssektoren ved hjaelp af 1-(4-chlorphenoxy)-1-imidazolyl-(1)-3,3-dimethyl-butan-2-on |
| DE2705677A1 (de) * | 1977-02-11 | 1978-08-17 | Bayer Ag | 2,4-dichlorphenyl-imidazolyl-aethanone(ole), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4207328A (en) * | 1977-02-11 | 1980-06-10 | Bayer Aktiengesellschaft | 1-Phenoxy-2-(2,4-dichlorophenyl)-1-imidazol-1-yl-ethan-2-ones and -ols and antimycotic and fungicidal use |
| DE2713777C3 (de) * | 1977-03-29 | 1979-10-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von l-Azolyl-33-dimethyl-l-phenoxy-butan-2-onen |
| DE2723942C2 (de) * | 1977-05-27 | 1982-11-11 | Basf Ag, 6700 Ludwigshafen | ω-(1,2,4-Triazol-1-yl) acetophenonoximäther |
| DE2816818A1 (de) * | 1978-04-18 | 1979-10-31 | Bayer Ag | Optisch aktive 1-aethyl-imidazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2832233A1 (de) * | 1978-07-21 | 1980-01-31 | Bayer Ag | Alpha -azolyl- beta -hydroxy-ketone, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE2918893A1 (de) * | 1979-05-10 | 1980-11-20 | Bayer Ag | Fluorierte 1-imidazolyl-butan-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE2926280A1 (de) * | 1979-06-29 | 1981-01-08 | Basf Ag | Fungizide alpha -triazolylglykolderivate, ihre herstellung und verwendung |
| EP0024023B2 (de) * | 1979-08-11 | 1992-11-11 | Bayer Ag | Antimykotische Mittel mit höherer Freisetzung der Wirkstoffe |
| US4329335A (en) * | 1980-11-10 | 1982-05-11 | Colgate-Palmolive Company | Amphoteric-nonionic based antimicrobial shampoo |
| US4329336A (en) * | 1980-11-10 | 1982-05-11 | Colgate-Palmolive Company | Nonionic based antimicrobial shampoo |
| US4329334A (en) * | 1980-11-10 | 1982-05-11 | Colgate-Palmolive Company | Anionic-amphoteric based antimicrobial shampoo |
| DE3130435A1 (de) * | 1981-08-01 | 1983-02-17 | Bayer Ag, 5090 Leverkusen | 5-aryloxy-5-azolyl-3,3-dimethyl-1-penten-4-one und -ole, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE3150204A1 (de) * | 1981-12-18 | 1983-06-30 | Basf Ag, 6700 Ludwigshafen | Fungizide alpha-azolylglykole |
| DE3200414A1 (de) * | 1982-01-09 | 1983-07-21 | Bayer Ag, 5090 Leverkusen | Azolyl-thioether-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und pflanzenwachstumsregulatoren |
| ATE30322T1 (de) * | 1982-04-01 | 1987-11-15 | Schering Agrochemicals Ltd | Heterocyclische pilztoetende und wachstumsregulierende verbindungen und diese enthaltende zusammensetzungen. |
| US4514382A (en) * | 1982-11-17 | 1985-04-30 | Colgate-Palmolive Company | Oral product for controlling gingivitis |
| ZA838185B (en) * | 1982-11-17 | 1985-06-26 | Colgate Palmolive Co | Oral product for controlling gingivitis |
| DE3540523A1 (de) | 1985-11-15 | 1987-05-27 | Bayer Ag | Azolyletherketone und -alkohole |
| US5006513A (en) * | 1987-11-09 | 1991-04-09 | Miles Inc. | Antimycotic compositions of nikkomycin compounds and azole antimycotica |
| US5194427A (en) * | 1987-11-09 | 1993-03-16 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US5096889A (en) * | 1987-11-09 | 1992-03-17 | Bayer Ag | Antimycotic compositions of nikkomycin compounds and azole antimycotics |
| US4914087A (en) * | 1988-02-29 | 1990-04-03 | Bayer Ag | Nikkomycin derivatives, antimycotic compositions of nikkomycin derivatives and azole antimycotics |
| US4867971A (en) * | 1988-04-22 | 1989-09-19 | Colgate-Palmolive Company | Low pH shampoo containing climbazole |
| US5900393A (en) * | 1995-03-31 | 1999-05-04 | Colgate-Palmolive Company | Scalp care products containing anti itching /anti irritant agents |
| DE19618578C1 (de) * | 1996-05-09 | 1997-01-23 | Bayer Ag | Verfahren zur Reinigung von Climbazol |
| DE10353673A1 (de) * | 2003-11-17 | 2005-06-23 | Symrise Gmbh & Co. Kg | Verfahren zur Reinigung von Climbazol |
| CN100532366C (zh) * | 2007-03-20 | 2009-08-26 | 盐城市绿叶化工有限公司 | 咪菌酮的合成方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU557755A3 (ru) * | 1968-08-19 | 1977-05-05 | Янссен Фармасьютика Н.В. (Фирма) | Способ получени производных имидазола |
-
1971
- 1971-02-05 DE DE2105490A patent/DE2105490C3/de not_active Expired
- 1971-12-29 DD DD159986A patent/DD94819A5/xx unknown
-
1972
- 1972-01-20 US US00219556A patent/US3812142A/en not_active Expired - Lifetime
- 1972-02-02 IL IL38687A patent/IL38687A/xx unknown
- 1972-02-03 CH CH157372A patent/CH577978A5/xx not_active IP Right Cessation
- 1972-02-04 JP JP47012303A patent/JPS5142110B1/ja active Pending
- 1972-02-04 HU HUBA2700A patent/HU163992B/hu not_active IP Right Cessation
- 1972-02-04 GB GB532672A patent/GB1351542A/en not_active Expired
- 1972-02-04 FR FR7203855A patent/FR2124506B1/fr not_active Expired
- 1972-02-04 BE BE778973A patent/BE778973A/xx not_active IP Right Cessation
- 1972-02-07 AT AT95172A patent/AT311337B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3812142A (en) | 1974-05-21 |
| DD94819A5 (enExample) | 1973-01-05 |
| DE2105490B2 (de) | 1978-10-12 |
| AT311337B (de) | 1973-11-12 |
| FR2124506A1 (enExample) | 1972-09-22 |
| DE2105490A1 (de) | 1972-08-10 |
| BE778973A (fr) | 1972-08-04 |
| HU163992B (enExample) | 1973-12-28 |
| FR2124506B1 (enExample) | 1976-04-16 |
| IL38687A0 (en) | 1972-04-27 |
| JPS5142110B1 (enExample) | 1976-11-13 |
| CH577978A5 (enExample) | 1976-07-30 |
| IL38687A (en) | 1975-11-25 |
| GB1351542A (en) | 1974-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2105490C3 (de) | 1 -Imidazolylketonderivate | |
| DE2041771C3 (de) | derivate | |
| DE2037610C3 (enExample) | ||
| EP0041673B1 (de) | Imidazolderivate, deren Herstellung sowie diese enthaltende Präparate | |
| EP0011769B1 (de) | Hydroxyethyl-azole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| EP0011768B1 (de) | Hydroxypropyl-triazole, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0003796B1 (de) | Substituierte Diphenyl-imidazolyl-methane, Verfahren zu ihrer Herstellung sowie sie enthaltende Arzneimittel | |
| DE2523103A1 (de) | Neue propargyl-2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE2053080A1 (de) | N substituierte Imidazole, Ver fahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2242454A1 (de) | 1-aethyl-imidazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE69424215T2 (de) | Verfahren zur Herstellung von 1-(1,2,4-Triazol-1-yl)-propan-2-ol-Derivaten | |
| DE2013793C2 (de) | N-Methyl-imidazol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE3042844A1 (de) | 2-(1h-imidazol-1-yl)-aethoxyderivate von chinolin-2- und 4-methanolen, verfahren zu ihrer herstellung, arzneimittel und ihre verwendung | |
| DE2059949C3 (de) | Thienyl-fettsäurederivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2140865B2 (de) | 1 -Imidazolyl-methanphosphonsäureester, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE2022206C3 (de) | Basisch substituierte Diphenylazolyl-essigsäureester, Verfahren zu ihrer Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2044621C3 (de) | 33-Diphenyl-3-i]nidazol-l-yl-propine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| EP0031883B1 (de) | Antimikrobielle Mittel enthaltend Hydroxybutylimidazol-Derivate | |
| CH620683A5 (enExample) | ||
| DE2213863C3 (de) | Disubstituierte Triphenylmethylimidazole, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| EP0149814B1 (de) | Azolylmethylcycloacetale, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE2229128C2 (de) | 1-(Dialkylphenyl-phenyl-pyridyl-)methyl-imidazole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2705677A1 (de) | 2,4-dichlorphenyl-imidazolyl-aethanone(ole), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1617481C3 (de) | N-Trityl-imidazole, Verfahren zu ihrer Herstellung sowie Arzneimittel | |
| AT281023B (de) | Verfahren zur Herstellung von neuen Piperidinderivaten und ihren Salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |