DE2037610C3 - - Google Patents
Info
- Publication number
- DE2037610C3 DE2037610C3 DE2037610A DE2037610A DE2037610C3 DE 2037610 C3 DE2037610 C3 DE 2037610C3 DE 2037610 A DE2037610 A DE 2037610A DE 2037610 A DE2037610 A DE 2037610A DE 2037610 C3 DE2037610 C3 DE 2037610C3
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- acid
- general formula
- compound
- acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 17
- NZZRRHNSHYCKJA-UHFFFAOYSA-N 2-(1h-pyrrol-2-ylsulfinyl)-1h-pyrrole Chemical compound C=1C=CNC=1S(=O)C1=CC=CN1 NZZRRHNSHYCKJA-UHFFFAOYSA-N 0.000 claims description 8
- YZKAGUHQYDCQOL-UHFFFAOYSA-N 2-benzyl-1h-pyrrole Chemical class C=1C=CC=CC=1CC1=CC=CN1 YZKAGUHQYDCQOL-UHFFFAOYSA-N 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Chemical group CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 31
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 238000002360 preparation method Methods 0.000 description 16
- 241001465754 Metazoa Species 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- 239000003814 drug Substances 0.000 description 9
- 208000015181 infectious disease Diseases 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 150000002366 halogen compounds Chemical class 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000011230 binding agent Substances 0.000 description 6
- 230000037396 body weight Effects 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 241000222122 Candida albicans Species 0.000 description 5
- -1 acetal group Benzylazoles Chemical class 0.000 description 5
- 230000000843 anti-fungal effect Effects 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 4
- 241000699666 Mus <mouse, genus> Species 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 241000799767 Scutula Species 0.000 description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000001762 anti-mycelial effect Effects 0.000 description 3
- 229940121375 antifungal agent Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229940095731 candida albicans Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 150000003852 triazoles Chemical class 0.000 description 3
- FBAOVPVVMDOHPK-UHFFFAOYSA-N 2-(1h-imidazol-2-ylsulfinyl)-1h-imidazole Chemical compound N=1C=CNC=1S(=O)C1=NC=CN1 FBAOVPVVMDOHPK-UHFFFAOYSA-N 0.000 description 2
- 241001480043 Arthrodermataceae Species 0.000 description 2
- 241000228212 Aspergillus Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 206010007134 Candida infections Diseases 0.000 description 2
- 208000007163 Dermatomycoses Diseases 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000223238 Trichophyton Species 0.000 description 2
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 230000001857 anti-mycotic effect Effects 0.000 description 2
- 239000002543 antimycotic Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 201000003984 candidiasis Diseases 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 201000003929 dermatomycosis Diseases 0.000 description 2
- 230000037304 dermatophytes Effects 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011435 rock Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000013207 serial dilution Methods 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- VQUKCZZOXFTXLR-UHFFFAOYSA-N 1,1-dimethoxy-2,2-diphenylethanol Chemical compound C1(=CC=CC=C1)C(C(O)(OC)OC)C1=CC=CC=C1 VQUKCZZOXFTXLR-UHFFFAOYSA-N 0.000 description 1
- ICWPEHBTSFGLLW-UHFFFAOYSA-N 1-bromo-1,1-diphenylpropan-2-one Chemical compound C=1C=CC=CC=1C(Br)(C(=O)C)C1=CC=CC=C1 ICWPEHBTSFGLLW-UHFFFAOYSA-N 0.000 description 1
- MCXAZWSCEWCOCY-UHFFFAOYSA-N 1-imidazol-1-yl-1,1-diphenylpropan-2-one Chemical compound C=1C=CC=CC=1C(N1C=NC=C1)(C(=O)C)C1=CC=CC=C1 MCXAZWSCEWCOCY-UHFFFAOYSA-N 0.000 description 1
- ZEABDYZYINUSSY-UHFFFAOYSA-N 2,2-dimethoxy-1,1-diphenylethanol Chemical compound C1(=CC=CC=C1)C(O)(C(OC)OC)C1=CC=CC=C1 ZEABDYZYINUSSY-UHFFFAOYSA-N 0.000 description 1
- PHELOKYCCWVWFE-UHFFFAOYSA-N 2,2-dimethoxyacetic acid Chemical compound COC(OC)C(O)=O PHELOKYCCWVWFE-UHFFFAOYSA-N 0.000 description 1
- OLVMPQNPFWQNTC-UHFFFAOYSA-N 2-hydroxy-2-phenyl-1-(2-phenylphenyl)ethanone Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1C1=CC=CC=C1 OLVMPQNPFWQNTC-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- QOGFGBNIAWXSOK-UHFFFAOYSA-N Cl.C1(=CC=CC=C1)C(N1C=NC=C1)(C(OC)OC)C1=CC=CC=C1 Chemical compound Cl.C1(=CC=CC=C1)C(N1C=NC=C1)(C(OC)OC)C1=CC=CC=C1 QOGFGBNIAWXSOK-UHFFFAOYSA-N 0.000 description 1
- 241000223205 Coccidioides immitis Species 0.000 description 1
- 201000007336 Cryptococcosis Diseases 0.000 description 1
- 241000221204 Cryptococcus neoformans Species 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 238000002768 Kirby-Bauer method Methods 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000233667 Saprolegnia Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 241001609979 Trichophyton quinckeanum Species 0.000 description 1
- 206010067409 Trichophytosis Diseases 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 125000004036 acetal group Chemical group 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 230000001408 fungistatic effect Effects 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 208000024963 hair loss Diseases 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Substances [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/415—1,2-Diazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702037610 DE2037610A1 (de) | 1970-07-29 | 1970-07-29 | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| US00165321A US3755349A (en) | 1970-07-29 | 1971-07-22 | Alpha-substituted benzyl-imidazoles |
| CA118,951A CA948632A (en) | 1970-07-29 | 1971-07-23 | .alpha.-SUBSTITUTED BENZYL-AZOLES, THEIR PRODUCTION, AND THEIR USE |
| IL37385A IL37385A (en) | 1970-07-29 | 1971-07-26 | Benzyl-imidazoles and 1,2,4-triazoles,their production and pharmaceutical compositions containing them |
| FI2123/71A FI55832C (fi) | 1970-07-29 | 1971-07-27 | Foerfarande foer framstaellning av terapeutiskt verksamma nya alfa-substituerade bensylimidazoler |
| AT653271A AT304536B (de) | 1970-07-29 | 1971-07-27 | Verfahren zur Herstellung von neuen Imidazolderivaten und ihren Salzen |
| NL7110422A NL7110422A (enExample) | 1970-07-29 | 1971-07-28 | |
| CH123775A CH571505A5 (enExample) | 1970-07-29 | 1971-07-28 | |
| CH1112171A CH571504A5 (enExample) | 1970-07-29 | 1971-07-28 | |
| SE7109704A SE375100B (enExample) | 1970-07-29 | 1971-07-28 | |
| GB3540371A GB1330546A (en) | 1970-07-29 | 1971-07-28 | Benzyl-azoles their production and their use as medicines |
| BE770662A BE770662A (fr) | 1970-07-29 | 1971-07-29 | Nouveaux benzylazoles alpha-substitues, leur procede de preparation et leur utilisation comme medicaments |
| FR7127832A FR2100966B1 (enExample) | 1970-07-29 | 1971-07-29 | |
| JP5646771A JPS5529071B1 (enExample) | 1970-07-29 | 1971-07-29 | |
| US00317835A US3821394A (en) | 1970-07-29 | 1972-12-22 | Antimycotic composition and method employing a substituted benzyl-azoles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702037610 DE2037610A1 (de) | 1970-07-29 | 1970-07-29 | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2037610A1 DE2037610A1 (de) | 1972-02-03 |
| DE2037610B2 DE2037610B2 (enExample) | 1978-11-16 |
| DE2037610C3 true DE2037610C3 (enExample) | 1979-07-12 |
Family
ID=5778237
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702037610 Granted DE2037610A1 (de) | 1970-07-29 | 1970-07-29 | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3755349A (enExample) |
| JP (1) | JPS5529071B1 (enExample) |
| AT (1) | AT304536B (enExample) |
| BE (1) | BE770662A (enExample) |
| CA (1) | CA948632A (enExample) |
| CH (2) | CH571504A5 (enExample) |
| DE (1) | DE2037610A1 (enExample) |
| FI (1) | FI55832C (enExample) |
| FR (1) | FR2100966B1 (enExample) |
| GB (1) | GB1330546A (enExample) |
| IL (1) | IL37385A (enExample) |
| NL (1) | NL7110422A (enExample) |
| SE (1) | SE375100B (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1964995A1 (de) * | 1969-12-24 | 1971-07-01 | Bayer Ag | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
| US3892764A (en) * | 1970-08-22 | 1975-07-01 | Bayer Ag | Phenyl-imidazolyl-alkanyl derivatives, their production and use |
| US4147791A (en) * | 1972-01-11 | 1979-04-03 | Bayer Aktiengesellschaft | 1-Substituted-1,2,4-triazole fungicidal compositions and methods for combatting fungi that infect or attack plants |
| US4048318A (en) * | 1972-01-11 | 1977-09-13 | Bayer Aktiengesellschaft | 1-Substituted-1,2,4-triazole fungicides |
| DE2242454A1 (de) * | 1972-08-29 | 1974-03-07 | Bayer Ag | 1-aethyl-imidazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4036966A (en) * | 1972-09-26 | 1977-07-19 | Bayer Aktiengesellschaft | 1,2,4-Triazole antimycotic compositions and use thereof |
| DE2247186A1 (de) * | 1972-09-26 | 1974-03-28 | Bayer Ag | Antimykotisches mittel |
| US4038404A (en) * | 1972-09-26 | 1977-07-26 | Bayer Aktiengesellschaft | 1,2,4-triazole antimycotic compositions and use thereof |
| US4038406A (en) * | 1972-09-26 | 1977-07-26 | Bayer Aktiengesellschaft | 1,2,4-triazole antimycotic compositions and use thereof |
| US4060623A (en) * | 1972-09-26 | 1977-11-29 | Bayer Aktiengesellschaft | 1,2,4-Triazole antimycotic compositions and use thereof |
| US4002763A (en) * | 1972-09-26 | 1977-01-11 | Bayer Aktiengesellschaft | 1,2,4-Triazole antimycotic compositions and use thereof |
| US4036967A (en) * | 1972-09-26 | 1977-07-19 | Bayer Aktiengesellschaft | 1,2,4-Triazole antimycotic compositions and use thereof |
| DE2324010C3 (de) * | 1973-05-12 | 1981-10-08 | Bayer Ag, 5090 Leverkusen | 1-Substituierte 2-Triazolyl-2-phenoxyäthanol-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung von Pilzen |
| DE2324424A1 (de) * | 1973-05-15 | 1974-12-05 | Bayer Ag | Antimikrobielle mittel |
| DE2348663A1 (de) * | 1973-09-27 | 1975-04-03 | Bayer Ag | Verfahren zur herstellung von neuen 1-aethyl-azolylderivaten |
| US4079142A (en) * | 1973-10-05 | 1978-03-14 | Bayer Aktiengesellschaft | 1-Propyl-triazolyl antimycotic compositions and methods of treating mycoses |
| GB1505868A (en) * | 1974-06-13 | 1978-03-30 | Ciba Geigy Ag | I-alkyl-i-cyanohydrazines and their use for the production of 1,2,4-triazole derivatives |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| US4079062A (en) * | 1974-11-18 | 1978-03-14 | Janssen Pharmaceutica N.V. | Triazole derivatives |
| CA1065873A (en) * | 1975-01-27 | 1979-11-06 | Janssen Pharmaceutica Naamloze Vennootschap | Imidazole derivatives |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| GB1535777A (en) * | 1975-08-26 | 1978-12-13 | Ici Ltd | Imidazole and 1,2,4-triazole compounds and their use as pesticides |
| NZ181916A (en) * | 1975-09-10 | 1979-01-11 | Ici Ltd | 1-substituted-1,2,4-triazoles and fungicidal compositions |
| DE2547954A1 (de) * | 1975-10-27 | 1977-04-28 | Bayer Ag | 1-(2-halogen-2-phenyl-aethyl)-triazole, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| US4073925A (en) * | 1975-12-12 | 1978-02-14 | Imperial Chemical Industries Limited | Fungicidally effective imidazoles and use thereof against fungal pests |
| US4172141A (en) * | 1976-03-17 | 1979-10-23 | Syntex (U.S.A.) Inc. | N-(naphthylethyl)imidazole derivatives |
| DE2628152C2 (de) | 1976-06-23 | 1985-03-28 | Bayer Ag, 5090 Leverkusen | Fungizide und nematizide Mittel |
| US4349556A (en) * | 1976-06-24 | 1982-09-14 | Bayer Aktiengesellschaft | Pesticidally active 1-acyloxy-1-phenyl-2-azolyl-ethanes |
| DE2845254A1 (de) * | 1978-10-18 | 1980-05-08 | Basf Ag | Gamma -azolylverbindungen |
| JPS6058965A (ja) * | 1983-09-13 | 1985-04-05 | Kaken Pharmaceut Co Ltd | 新規なイミダゾール誘導体 |
| EP1982715A1 (de) | 2007-04-20 | 2008-10-22 | Bayer CropScience AG | Verwendung von Fungiziden zur Behandlung von Fischmykosen |
| EP1982717A1 (de) * | 2007-04-20 | 2008-10-22 | Bayer CropScience AG | Verwendung von Fungiziden zur Behandlung von Fischmykosen |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL299933A (enExample) * | 1962-10-30 | |||
| FR1486817A (fr) * | 1965-07-22 | 1967-06-30 | Basf Ag | Insecticides |
| US3468902A (en) * | 1966-06-10 | 1969-09-23 | Hoffmann La Roche | 1-substituted-2-nitroimidazole derivatives |
| GB1170188A (en) * | 1967-09-15 | 1969-11-12 | Bayer Ag | N-trityl-imidazoles and salts and uses thereof |
| US3575999A (en) * | 1968-08-19 | 1971-04-20 | Janssen Pharmaceutica Nv | Ketal derivatives of imidazole |
| SU557755A3 (ru) * | 1968-08-19 | 1977-05-05 | Янссен Фармасьютика Н.В. (Фирма) | Способ получени производных имидазола |
| US3658813A (en) * | 1970-01-13 | 1972-04-25 | Janssen Pharmaceutica Nv | 1-(beta-aryl-beta-(r-oxy)-ethyl)-imidazoles |
-
1970
- 1970-07-29 DE DE19702037610 patent/DE2037610A1/de active Granted
-
1971
- 1971-07-22 US US00165321A patent/US3755349A/en not_active Expired - Lifetime
- 1971-07-23 CA CA118,951A patent/CA948632A/en not_active Expired
- 1971-07-26 IL IL37385A patent/IL37385A/xx unknown
- 1971-07-27 AT AT653271A patent/AT304536B/de not_active IP Right Cessation
- 1971-07-27 FI FI2123/71A patent/FI55832C/fi active
- 1971-07-28 CH CH1112171A patent/CH571504A5/xx not_active IP Right Cessation
- 1971-07-28 CH CH123775A patent/CH571505A5/xx not_active IP Right Cessation
- 1971-07-28 NL NL7110422A patent/NL7110422A/xx not_active Application Discontinuation
- 1971-07-28 GB GB3540371A patent/GB1330546A/en not_active Expired
- 1971-07-28 SE SE7109704A patent/SE375100B/xx unknown
- 1971-07-29 JP JP5646771A patent/JPS5529071B1/ja active Pending
- 1971-07-29 BE BE770662A patent/BE770662A/xx unknown
- 1971-07-29 FR FR7127832A patent/FR2100966B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE375100B (enExample) | 1975-04-07 |
| GB1330546A (en) | 1973-09-19 |
| JPS5529071B1 (enExample) | 1980-07-31 |
| FI55832B (fi) | 1979-06-29 |
| CA948632A (en) | 1974-06-04 |
| CH571505A5 (enExample) | 1976-01-15 |
| FI55832C (fi) | 1979-10-10 |
| DE2037610B2 (enExample) | 1978-11-16 |
| BE770662A (fr) | 1972-01-31 |
| FR2100966A1 (enExample) | 1972-03-24 |
| US3755349A (en) | 1973-08-28 |
| AT304536B (de) | 1973-01-10 |
| IL37385A (en) | 1975-02-10 |
| FR2100966B1 (enExample) | 1975-02-07 |
| CH571504A5 (enExample) | 1976-01-15 |
| NL7110422A (enExample) | 1972-02-01 |
| IL37385A0 (en) | 1971-10-20 |
| DE2037610A1 (de) | 1972-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2037610C3 (enExample) | ||
| DE2041771C3 (de) | derivate | |
| DE2105490C3 (de) | 1 -Imidazolylketonderivate | |
| DE2333354A1 (de) | Imidazolyl-o,n-acetale sowie deren salze, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| DE1908991C3 (enExample) | ||
| DE2053080C3 (de) | N-substituierte Imidazole und ihre Verwendung als Arzneimittel | |
| DE3010093A1 (de) | 1,1-diphenyl-2-(1.2.4-triazol-1-yl)-aethan-1-ole, verfahren zu ihrer herstellung und diese enthaltende therapeutische mittel | |
| DE2022206C3 (de) | Basisch substituierte Diphenylazolyl-essigsäureester, Verfahren zu ihrer Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2140865B2 (de) | 1 -Imidazolyl-methanphosphonsäureester, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| DE2013793C2 (de) | N-Methyl-imidazol-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2044621C3 (de) | 33-Diphenyl-3-i]nidazol-l-yl-propine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| EP0031883B1 (de) | Antimikrobielle Mittel enthaltend Hydroxybutylimidazol-Derivate | |
| DE1911646C3 (de) | Heterocyclisch substituierte N-Diphenylmethylimidazole | |
| DE2705677A1 (de) | 2,4-dichlorphenyl-imidazolyl-aethanone(ole), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1770939C3 (de) | N-<Diphenyl-pyridyl-methyl) - imidazole und deren Salze | |
| DE2635664A1 (de) | Antimikrobielle mittel | |
| DE2910974A1 (de) | 3-sulfonyl-benzo-1,2,4-triazine und -benzo-1,2,4-triazin-1-oxide, verfahren zu ihrer herstellung sowie ihre verwendung als antimikrobielle mittel | |
| DE1795782C3 (de) | N-Trityl-imidazole | |
| DE1617481C3 (de) | N-Trityl-imidazole, Verfahren zu ihrer Herstellung sowie Arzneimittel | |
| DE2848221A1 (de) | 1,2,3-dithiazolderivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1770939B2 (de) | N-(diphenyl-pyridyl-methyl) - imidazole und deren salze | |
| DE2358592A1 (de) | Antimikrobielle mittel | |
| DE2004697A1 (de) | 9 Azolyl (1) fluoren 9 carbonsaure Derivate enthaltende Arzneimittel | |
| DE3542676A1 (de) | Verwendung substituierter hydroxyalkyl-azole zur behandlung der chagas-krankheit | |
| DE1806995A1 (de) | Neue Bisimidazolyl-bisphenylmethane und deren Salze |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |