DE2101344A1 - Verfahren zur Herstellung von Färb kopiermaterial - Google Patents
Verfahren zur Herstellung von Färb kopiermaterialInfo
- Publication number
- DE2101344A1 DE2101344A1 DE19712101344 DE2101344A DE2101344A1 DE 2101344 A1 DE2101344 A1 DE 2101344A1 DE 19712101344 DE19712101344 DE 19712101344 DE 2101344 A DE2101344 A DE 2101344A DE 2101344 A1 DE2101344 A1 DE 2101344A1
- Authority
- DE
- Germany
- Prior art keywords
- bleach
- water
- soluble
- fix
- quaternary ammonium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 38
- 238000000034 method Methods 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- 229910052709 silver Inorganic materials 0.000 claims description 40
- 239000004332 silver Substances 0.000 claims description 40
- -1 Silver halide Chemical class 0.000 claims description 21
- 239000000243 solution Substances 0.000 claims description 14
- OHUHAKQCZVMIOF-UHFFFAOYSA-N OS(O)(=O)=O.[SeH2] Chemical compound OS(O)(=O)=O.[SeH2] OHUHAKQCZVMIOF-UHFFFAOYSA-N 0.000 claims description 9
- 239000007800 oxidant agent Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 229910021645 metal ion Inorganic materials 0.000 claims description 8
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 8
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 7
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 7
- 239000000839 emulsion Substances 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 4
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 claims 3
- 230000002378 acidificating effect Effects 0.000 claims 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 23
- 239000000975 dye Substances 0.000 description 23
- 239000007844 bleaching agent Substances 0.000 description 15
- 239000010410 layer Substances 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000005406 washing Methods 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000004061 bleaching Methods 0.000 description 6
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 229940101006 anhydrous sodium sulfite Drugs 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 4
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 4
- PBKADZMAZVCJMR-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;dihydrate Chemical compound O.O.OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O PBKADZMAZVCJMR-UHFFFAOYSA-N 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 3
- XUQYOMJHENVHCZ-UHFFFAOYSA-M [O-]S(O)(=O)=O.[Na+].[SeH2] Chemical compound [O-]S(O)(=O)=O.[Na+].[SeH2] XUQYOMJHENVHCZ-UHFFFAOYSA-M 0.000 description 3
- 239000000987 azo dye Substances 0.000 description 3
- 239000013522 chelant Substances 0.000 description 3
- JAWGVVJVYSANRY-UHFFFAOYSA-N cobalt(3+) Chemical compound [Co+3] JAWGVVJVYSANRY-UHFFFAOYSA-N 0.000 description 3
- AJEYDHVLZAADJS-UHFFFAOYSA-L disodium sulfurothioic O-acid sulfite pentahydrate Chemical compound S(=O)([O-])[O-].[Na+].O.O.O.O.O.S(=S)(=O)(O)O.[Na+] AJEYDHVLZAADJS-UHFFFAOYSA-L 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- UOMQUZPKALKDCA-UHFFFAOYSA-K 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;iron(3+) Chemical compound [Fe+3].OC(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UOMQUZPKALKDCA-UHFFFAOYSA-K 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- DFBNYABONNLOHS-UHFFFAOYSA-N O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB([O-])[O-] Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].OB(O)O.OB(O)O.OB(O)O.OB(O)O.OB([O-])[O-] DFBNYABONNLOHS-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000004697 chelate complex Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 150000003378 silver Chemical class 0.000 description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 2
- KSYPVUFEDOKEAQ-UHFFFAOYSA-N (4-azaniumylphenyl)-ethyl-(4-hydroxybutyl)azanium;sulfate Chemical compound [O-]S([O-])(=O)=O.OCCCC[NH+](CC)C1=CC=C([NH3+])C=C1 KSYPVUFEDOKEAQ-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- 229910001312 Amalgam (dentistry) Inorganic materials 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 235000011126 aluminium potassium sulphate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- RJWJCQLFAYQGBG-UHFFFAOYSA-L disodium;sulfite;hydrate Chemical compound [OH-].[Na+].[Na+].OS([O-])=O RJWJCQLFAYQGBG-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical compound OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229940050271 potassium alum Drugs 0.000 description 1
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 1
- GEKZMSAPPIYQAN-UHFFFAOYSA-L potassium sodium hydrogen sulfate hydroxylamine sulfuric acid bromide Chemical compound S(=O)(=O)([O-])O.[Na+].S(=O)(=O)(O)O.NO.[Br-].[K+] GEKZMSAPPIYQAN-UHFFFAOYSA-L 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000001008 quinone-imine dye Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical class [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- PODWXQQNRWNDGD-UHFFFAOYSA-L sodium thiosulfate pentahydrate Chemical compound O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O PODWXQQNRWNDGD-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/42—Bleach-fixing or agents therefor ; Desilvering processes
- G03C7/421—Additives other than bleaching or fixing agents
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB161670 | 1970-01-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2101344A1 true DE2101344A1 (de) | 1971-07-22 |
Family
ID=9725038
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712101344 Pending DE2101344A1 (de) | 1970-01-13 | 1971-01-13 | Verfahren zur Herstellung von Färb kopiermaterial |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3702247A (enrdf_load_stackoverflow) |
| BE (1) | BE761509A (enrdf_load_stackoverflow) |
| CH (1) | CH554004A (enrdf_load_stackoverflow) |
| DE (1) | DE2101344A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2075433A5 (enrdf_load_stackoverflow) |
| GB (1) | GB1297905A (enrdf_load_stackoverflow) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3847619A (en) * | 1972-11-20 | 1974-11-12 | Eastman Kodak Co | Ion-paired cobaltic complexes and photographic elements containing same |
| JPS51101530A (enrdf_load_stackoverflow) * | 1975-03-05 | 1976-09-08 | Fuji Photo Film Co Ltd | |
| IT7925699A0 (it) * | 1978-09-14 | 1979-09-12 | Eastman Kodak Co | Composizioni fotografiche di sbianca, e metodi per trattamento fotografico. |
| GB8516054D0 (en) * | 1985-06-25 | 1985-07-31 | Ciba Geigy Ag | Photographic material |
| EP1269260A4 (en) * | 2000-01-06 | 2003-06-25 | Trebla Chemical Company | ONE-PIECE CONCENTRATE OF A WHITE FIXING SOLUTION |
| EP1160622A1 (en) * | 2000-05-27 | 2001-12-05 | Agfa-Gevaert N.V. | A bleach-fixing concentrate |
-
1970
- 1970-01-13 GB GB161670A patent/GB1297905A/en not_active Expired
-
1971
- 1971-01-12 BE BE761509A patent/BE761509A/xx unknown
- 1971-01-12 FR FR7100761A patent/FR2075433A5/fr not_active Expired
- 1971-01-12 US US105955A patent/US3702247A/en not_active Expired - Lifetime
- 1971-01-13 DE DE19712101344 patent/DE2101344A1/de active Pending
- 1971-01-13 CH CH48271A patent/CH554004A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE761509A (fr) | 1971-06-16 |
| FR2075433A5 (enrdf_load_stackoverflow) | 1971-10-08 |
| US3702247A (en) | 1972-11-07 |
| GB1297905A (enrdf_load_stackoverflow) | 1972-11-29 |
| CH554004A (de) | 1974-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE964203C (de) | Photographisches Kontaktverfahren zur Erzeugung mehrfarbiger Bilder | |
| DE1290812B (de) | Verfahren zum Bleichfixieren von photographischen Silberbildern | |
| DE2251908A1 (de) | Verfahren zur regenerierung von blixing-loesungen zur farbphotographischen behandlung | |
| DE1814834A1 (de) | Photographische Verarbeitungsfluessigkeit | |
| DE2139401A1 (de) | Verfahren zum Ausbleichen von metallischem Silber aus photographischen Materialien | |
| DE2101344A1 (de) | Verfahren zur Herstellung von Färb kopiermaterial | |
| DE941769C (de) | Silber-Farbstoff-Bleichbaeder mit Katalysatoren | |
| DE2554528C3 (de) | Bleichfixierbad | |
| DE2037684A1 (de) | Verfahren zum Entfernen von metallischem Silber aus photographi schem Material | |
| DE1202638B (de) | Photographisches Entwicklungsverfahren zur Herstellung von Farbbildern nach dem Farbentwicklungsverfahren | |
| DE1043806B (de) | Verfahren zur Herstellung eines stabilen Blaubildes in photographischem Farbenentwicklungsmaterial | |
| DE2264986A1 (de) | Entwicklerloesung fuer die farbumkehrentwicklung von photographischen aufzeichnungsmaterialien, die mindestens eine halogensilberemulsionsschicht enthalten | |
| DE1772945A1 (de) | Rasches Stabilisierungsverfahren fuer farbenphotographische Materialien | |
| DE69101632T2 (de) | Bleichfixierer mit überschüssigem sulfit. | |
| DE2657438C2 (de) | Verfahren zur Erzeugung eines farbigen Bildes in einem silberhalogenidhaltigen, farbphotographischen Aufzeichnungsmaterial | |
| DE2101436A1 (de) | Verfahren zur Herstellung von Material mit Farbstoffbildern | |
| DE2453641A1 (de) | Mehrschichtiges farbphotographisches aufzeichnungsmaterial sowie verfahren zur herstellung positiver farbphotographischer bilder | |
| DE2128801A1 (de) | Farbphotographisches Rapidumkehrentwicklungsverfahren | |
| DE2063576C3 (de) | Verfahren zum Bleichfixieren von farbphotographischen Aufzeichnungsmaterialien | |
| DE968447C (de) | Verfahren zur gleichmaessigen Entwicklung von belichteten, mehrschichtigen Farbumkehrfilmen | |
| DE2524431A1 (de) | Verfahren zur herstellung eines positiven farbphotographischen bildes | |
| DE2102713A1 (de) | Härtende Bleichfixierbäder | |
| DE2745955A1 (de) | Verfahren zur erzeugung von farbbildern | |
| DE1145487B (de) | Verfahren zur Herstellung eines der Vorlage gegenlaeufigen Farbbildes nach dem Silberfarbbleichverfahren | |
| DE2044994A1 (de) | Farbbleichbad für das Silberfarbbleichverfahren |