DE2020016C3 - Metallschichtzündmittel - Google Patents
MetallschichtzündmittelInfo
- Publication number
- DE2020016C3 DE2020016C3 DE2020016A DE2020016A DE2020016C3 DE 2020016 C3 DE2020016 C3 DE 2020016C3 DE 2020016 A DE2020016 A DE 2020016A DE 2020016 A DE2020016 A DE 2020016A DE 2020016 C3 DE2020016 C3 DE 2020016C3
- Authority
- DE
- Germany
- Prior art keywords
- ignition
- contacts
- bridge
- ignition means
- silver
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052751 metal Inorganic materials 0.000 title claims description 21
- 239000002184 metal Substances 0.000 title claims description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- 239000004020 conductor Substances 0.000 claims description 6
- 229910052715 tantalum Inorganic materials 0.000 claims description 6
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052763 palladium Inorganic materials 0.000 claims description 5
- GNLCAVBZUNZENF-UHFFFAOYSA-N platinum silver Chemical compound [Ag].[Ag].[Ag].[Pt] GNLCAVBZUNZENF-UHFFFAOYSA-N 0.000 claims description 5
- 239000000919 ceramic Substances 0.000 claims description 4
- 239000011521 glass Substances 0.000 claims description 4
- MZLGASXMSKOWSE-UHFFFAOYSA-N tantalum nitride Chemical compound [Ta]#N MZLGASXMSKOWSE-UHFFFAOYSA-N 0.000 claims description 4
- 229910052737 gold Inorganic materials 0.000 claims description 3
- 239000010931 gold Substances 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- SWELZOZIOHGSPA-UHFFFAOYSA-N palladium silver Chemical compound [Pd].[Ag] SWELZOZIOHGSPA-UHFFFAOYSA-N 0.000 claims description 3
- -1 silver aluminum Chemical compound 0.000 claims description 3
- 229910000838 Al alloy Inorganic materials 0.000 claims description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 2
- JUWSSMXCCAMYGX-UHFFFAOYSA-N gold platinum Chemical compound [Pt].[Au] JUWSSMXCCAMYGX-UHFFFAOYSA-N 0.000 claims description 2
- 238000000034 method Methods 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 4
- 239000012876 carrier material Substances 0.000 description 3
- 238000001259 photo etching Methods 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 238000004544 sputter deposition Methods 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- WETZJIOEDGMBMA-UHFFFAOYSA-L lead styphnate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([O-])=C1[N+]([O-])=O WETZJIOEDGMBMA-UHFFFAOYSA-L 0.000 description 1
- MHVVRZIRWITSIP-UHFFFAOYSA-L lead(2+);2,4,6-trinitrophenolate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O.[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O MHVVRZIRWITSIP-UHFFFAOYSA-L 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/103—Mounting initiator heads in initiators; Sealing-plugs
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B3/00—Blasting cartridges, i.e. case and explosive
- F42B3/10—Initiators therefor
- F42B3/195—Manufacture
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Spark Plugs (AREA)
- Air Bags (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2020016A DE2020016C3 (de) | 1970-04-24 | 1970-04-24 | Metallschichtzündmittel |
| FR7114404A FR2090579A5 (enExample) | 1970-04-24 | 1971-04-22 | |
| GB1115971*[A GB1344922A (en) | 1970-04-24 | 1971-04-23 | Electrically operable igniters |
| US00137464A US3763782A (en) | 1970-04-24 | 1971-04-26 | Metal layer initiator |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2020016A DE2020016C3 (de) | 1970-04-24 | 1970-04-24 | Metallschichtzündmittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2020016A1 DE2020016A1 (de) | 1971-11-11 |
| DE2020016B2 DE2020016B2 (de) | 1974-04-11 |
| DE2020016C3 true DE2020016C3 (de) | 1974-12-12 |
Family
ID=5769194
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2020016A Expired DE2020016C3 (de) | 1970-04-24 | 1970-04-24 | Metallschichtzündmittel |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3763782A (enExample) |
| DE (1) | DE2020016C3 (enExample) |
| FR (1) | FR2090579A5 (enExample) |
| GB (1) | GB1344922A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2328184A1 (de) * | 1973-06-02 | 1974-12-19 | Dynamit Nobel Ag | Elektrisch zu zuendendes schaltelement fuer stifteinzug |
| DE3024554A1 (de) * | 1980-06-28 | 1982-01-21 | Dynamit Nobel Ag, 5210 Troisdorf | Anordnung zur kontaktlosen uebertragung elektrischer energie auf flugkoerper bei deren abschuss |
| DE3035932A1 (de) * | 1980-09-24 | 1982-05-06 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches zuendmittel |
| DE3231369C1 (de) * | 1982-08-24 | 1984-01-05 | Dynamit Nobel Ag, 5210 Troisdorf | Sekundaerspule fuer induktive Anzuendmittel |
| DE3245187A1 (de) * | 1982-12-07 | 1984-06-07 | Dynamit Nobel Ag, 5210 Troisdorf | Kontaktierung von traegerelementen in elektrischen zuendmitteln |
| DE3415625A1 (de) * | 1984-04-26 | 1985-10-31 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches zuendelement mit soll-funkenstrecke |
| DE4222223C1 (de) * | 1992-07-07 | 1994-03-17 | Dynamit Nobel Ag | Elektrische Anzünd-/Zündmittel |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2245308C3 (de) * | 1972-09-15 | 1981-05-07 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches Brückenzündmittel |
| DE2648137C2 (de) * | 1976-10-23 | 1984-04-12 | Dynamit Nobel Ag, 5210 Troisdorf | Treibladungsanzünder für Munition |
| DE2654087C3 (de) * | 1976-11-29 | 1981-07-16 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches Zündmittel |
| SE431681B (sv) * | 1977-04-19 | 1984-02-20 | Bofors Ab | Eltenddon |
| DE2747163A1 (de) * | 1977-10-20 | 1979-04-26 | Dynamit Nobel Ag | Elektrisches anzuendelement |
| FR2513751B1 (fr) * | 1981-09-28 | 1986-04-11 | France Etat | Initiateur pyrotechnique electrique a effet joule |
| FR2538099B1 (fr) * | 1982-12-15 | 1986-10-03 | France Etat | Amorce electrique a element resistif |
| EP0120176B1 (de) * | 1983-02-22 | 1987-11-19 | Ems-Inventa AG | Elektrischer Polkörper |
| DE3472295D1 (de) * | 1983-11-09 | 1988-07-28 | Dynamit Nobel Ag | Electric primer |
| DE3440660A1 (de) * | 1983-11-09 | 1985-07-25 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches zuendmittel |
| EP0143071A1 (de) * | 1983-11-18 | 1985-05-29 | Fela E. Uhlmann Aktiengesellschaft für gedruckte Schaltungen | Verfahren zur Herstellung einer elektrischen Zündvorrichtung, danach hergestellte Zündvorrichtung und deren Verwendung |
| ZA852777B (en) * | 1984-05-24 | 1985-11-27 | Inventa Ag | Pole body for an electric fuze,method of manufacturing and method of using the pole body |
| DE3702241C1 (de) * | 1987-01-27 | 1996-06-20 | Daimler Benz Aerospace Ag | Verfahren und Einrichtung zur Herstellung von Primärzündsätzen, insbesondere Brückenzündern und Spaltzündern |
| IL85527A (en) * | 1988-02-24 | 1991-05-12 | Israel Defence | Electric igniter assembly |
| US5912427A (en) * | 1993-02-26 | 1999-06-15 | Quantic Industries, Inc. | Semiconductor bridge explosive device |
| KR960701351A (ko) | 1993-02-26 | 1996-02-24 | 케니스 이. 윌리스 | 개선된 반도체 브리지 폭발 장치(improved semiconductor bridge explosive device) |
| DE4307774A1 (de) * | 1993-03-12 | 1994-09-15 | Dynamit Nobel Ag | Anzündeinrichtung |
| FR2704944B1 (fr) * | 1993-05-05 | 1995-08-04 | Ncs Pyrotechnie Technologies | Initiateur électro-pyrotechnique. |
| ZA946555B (en) * | 1993-05-28 | 1995-06-12 | Altech Ind Pty Ltd | An electric igniter |
| FR2746461B1 (fr) * | 1996-03-21 | 1998-05-29 | Dixi Fresard Microtechniques | Dispositif pour la fixation traversante d'un corps axial dans un support |
| US6133146A (en) * | 1996-05-09 | 2000-10-17 | Scb Technologies, Inc. | Semiconductor bridge device and method of making the same |
| US5732634A (en) * | 1996-09-03 | 1998-03-31 | Teledyne Industries, Inc. | Thin film bridge initiators and method of manufacture |
| US6054760A (en) * | 1996-12-23 | 2000-04-25 | Scb Technologies Inc. | Surface-connectable semiconductor bridge elements and devices including the same |
| US6199484B1 (en) * | 1997-01-06 | 2001-03-13 | The Ensign-Bickford Company | Voltage-protected semiconductor bridge igniter elements |
| AT405591B (de) | 1997-10-03 | 1999-09-27 | Schaffler & Co | Heizelement und verfahren zu dessen herstellung |
| CA2355256A1 (en) * | 1998-12-21 | 2000-06-29 | Adriaan Johannes Goosen | A detonation initiating device |
| WO2002057705A2 (en) | 2001-01-22 | 2002-07-25 | Smi Technology (Pty) Limited | An initiating device for an electronic detonator |
| AT413150B (de) | 2003-01-28 | 2005-11-15 | Hirtenberger Schaffler Automot | Heizelement zum zünden pyrotechnischer ladungen |
| US6910420B1 (en) * | 2003-03-04 | 2005-06-28 | The United States Of America As Represented By The Secretary Of The Navy | Electrical initiation system |
| US8701557B2 (en) | 2011-02-07 | 2014-04-22 | Raytheon Company | Shock hardened initiator and initiator assembly |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1204477A (fr) * | 1957-04-04 | 1960-01-26 | Wasagchemie Ag | Dispositif de mise à feu électrique pour fusée |
| DE1200171B (de) * | 1964-03-12 | 1965-09-02 | Rheinmetall Gmbh | Elektrische Zuendschraube |
| US3420174A (en) * | 1967-09-29 | 1969-01-07 | Us Navy | Pulse sensitive electro-explosive device |
| US3557699A (en) * | 1968-06-26 | 1971-01-26 | Olin Mathieson | Electroexplosive primer ignition assembly |
-
1970
- 1970-04-24 DE DE2020016A patent/DE2020016C3/de not_active Expired
-
1971
- 1971-04-22 FR FR7114404A patent/FR2090579A5/fr not_active Expired
- 1971-04-23 GB GB1115971*[A patent/GB1344922A/en not_active Expired
- 1971-04-26 US US00137464A patent/US3763782A/en not_active Expired - Lifetime
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2328184A1 (de) * | 1973-06-02 | 1974-12-19 | Dynamit Nobel Ag | Elektrisch zu zuendendes schaltelement fuer stifteinzug |
| DE3024554A1 (de) * | 1980-06-28 | 1982-01-21 | Dynamit Nobel Ag, 5210 Troisdorf | Anordnung zur kontaktlosen uebertragung elektrischer energie auf flugkoerper bei deren abschuss |
| DE3035932A1 (de) * | 1980-09-24 | 1982-05-06 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches zuendmittel |
| DE3231369C1 (de) * | 1982-08-24 | 1984-01-05 | Dynamit Nobel Ag, 5210 Troisdorf | Sekundaerspule fuer induktive Anzuendmittel |
| DE3245187A1 (de) * | 1982-12-07 | 1984-06-07 | Dynamit Nobel Ag, 5210 Troisdorf | Kontaktierung von traegerelementen in elektrischen zuendmitteln |
| DE3415625A1 (de) * | 1984-04-26 | 1985-10-31 | Dynamit Nobel Ag, 5210 Troisdorf | Elektrisches zuendelement mit soll-funkenstrecke |
| DE4222223C1 (de) * | 1992-07-07 | 1994-03-17 | Dynamit Nobel Ag | Elektrische Anzünd-/Zündmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| US3763782A (en) | 1973-10-09 |
| DE2020016A1 (de) | 1971-11-11 |
| FR2090579A5 (enExample) | 1972-01-14 |
| GB1344922A (en) | 1974-01-23 |
| DE2020016B2 (de) | 1974-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2020016C3 (de) | Metallschichtzündmittel | |
| DE69113001T2 (de) | Pyrotechnischer Detonator mit Koaxialverbindungen. | |
| DE2816300C2 (enExample) | ||
| DE10212908B4 (de) | Temperatursensor und Herstellungsverfahren dafür | |
| DE3342753C2 (enExample) | ||
| DE960787C (de) | Elektrische Zuendvorrichtung und Verfahren zum Herstellen derselben | |
| DE60023818T2 (de) | Gegen elektostatische Entladungen geschützter, pyrotechnischer Zünder mit durch Photoätzung hergestellter Zündbrücke | |
| DE3119924C2 (enExample) | ||
| DE968077C (de) | Verfahren zur Herstellung von Kristallgleichrichtern | |
| DE2245308C3 (de) | Elektrisches Brückenzündmittel | |
| DE1671417B2 (de) | Elektrolytische coulometer-zelle, die als bauelement fuer elektronische schaltungen geeignet ist | |
| DE3638286A1 (de) | Elektrisches bauelement aus keramik mit mehrlagenmetallisierung und verfahren zu seiner herstellung | |
| DE3446128A1 (de) | Zuendkerze fuer brennkraftmaschinen | |
| DE3416735A1 (de) | Elektrisches zuendelement | |
| DE3036223C2 (enExample) | ||
| DE1215566B (de) | Elektrisch ausgeloester Zuender | |
| DE2408882A1 (de) | Gehaeuse fuer ein elektronisches bauteil | |
| CH643056A5 (de) | Elektrische zuendvorrichtung. | |
| DE1120942B (de) | Elektrischer Geschosszuender | |
| DD153720A5 (de) | Gluehkerze fuer verbrennungsmotoren | |
| DE957735C (de) | Zündelement zum Auslösen der Verbrennung von schwer entzündbaren Stoffen | |
| DE2655886C2 (de) | Elektrischer Zünder für Geschosse | |
| DE2227799C2 (de) | Brückenzünder | |
| DE1200171B (de) | Elektrische Zuendschraube | |
| DE951555C (de) | Elektrischer Zuender und Verfahren zur Herstellung desselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: HUELS TROISDORF AG, 5210 TROISDORF, DE |