DE2017255A1 - 1-substituierte-3-Pheny!pyrrolidine und Verfahren zu deren Herstellung - Google Patents
1-substituierte-3-Pheny!pyrrolidine und Verfahren zu deren HerstellungInfo
- Publication number
- DE2017255A1 DE2017255A1 DE19702017255 DE2017255A DE2017255A1 DE 2017255 A1 DE2017255 A1 DE 2017255A1 DE 19702017255 DE19702017255 DE 19702017255 DE 2017255 A DE2017255 A DE 2017255A DE 2017255 A1 DE2017255 A1 DE 2017255A1
- Authority
- DE
- Germany
- Prior art keywords
- pyrrolidine
- lower alkyl
- halide
- pheny
- phenylcarbamoyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 23
- 238000002360 preparation method Methods 0.000 title claims description 11
- 150000003235 pyrrolidines Chemical class 0.000 title claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 106
- -1 amino, amidino, carbamoyl Chemical group 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 19
- 239000004480 active ingredient Substances 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- PRRFFTYUBPGHLE-UHFFFAOYSA-N 3-phenylpyrrolidine Chemical compound C1NCCC1C1=CC=CC=C1 PRRFFTYUBPGHLE-UHFFFAOYSA-N 0.000 claims description 12
- 150000004820 halides Chemical class 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 5
- DUYDZGBSZJZIOZ-UHFFFAOYSA-N 3-[3-(trifluoromethyl)phenyl]pyrrolidine Chemical compound FC(F)(F)C1=CC=CC(C2CNCC2)=C1 DUYDZGBSZJZIOZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- AYPKYQSHFKQVDL-UHFFFAOYSA-N 3-(chloromethyl)-2,3-dihydro-1,4-benzodioxine Chemical compound C1=CC=C2OC(CCl)COC2=C1 AYPKYQSHFKQVDL-UHFFFAOYSA-N 0.000 claims description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 3
- YNWYQTQQGZXYFO-UHFFFAOYSA-N 1-[3-(trifluoromethyl)phenyl]pyrrolidine Chemical compound FC(F)(F)C1=CC=CC(N2CCCC2)=C1 YNWYQTQQGZXYFO-UHFFFAOYSA-N 0.000 claims 1
- WKTHBEIQCQUXEY-UHFFFAOYSA-N 5-chloroindole-1-carbonyl chloride Chemical compound ClC=1C=C2C=CN(C2=CC=1)C(=O)Cl WKTHBEIQCQUXEY-UHFFFAOYSA-N 0.000 claims 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 claims 1
- 239000010985 leather Substances 0.000 claims 1
- 229910052744 lithium Inorganic materials 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 81
- 239000000203 mixture Substances 0.000 description 41
- 150000001875 compounds Chemical class 0.000 description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 30
- 239000003921 oil Substances 0.000 description 26
- 235000019198 oils Nutrition 0.000 description 26
- 238000004458 analytical method Methods 0.000 description 22
- 239000002904 solvent Substances 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 9
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- AFQYBBFSDHKQJV-UHFFFAOYSA-N 3-phenylpyrrolidin-3-ol Chemical class C=1C=CC=CC=1C1(O)CCNC1 AFQYBBFSDHKQJV-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- 231100000252 nontoxic Toxicity 0.000 description 6
- 230000003000 nontoxic effect Effects 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 229920002261 Corn starch Polymers 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000008120 corn starch Substances 0.000 description 5
- 229940099112 cornstarch Drugs 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 4
- 235000013539 calcium stearate Nutrition 0.000 description 4
- 239000008116 calcium stearate Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- MDJWIDATPRVAQE-UHFFFAOYSA-N 5-phenylpyrrolidin-3-ol Chemical compound C1C(O)CNC1C1=CC=CC=C1 MDJWIDATPRVAQE-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 239000003158 myorelaxant agent Substances 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- VTOJUZHJWUBFJD-UHFFFAOYSA-N 1-benzyl-3-phenylpyrrolidin-3-ol Chemical compound C1C(O)(C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 VTOJUZHJWUBFJD-UHFFFAOYSA-N 0.000 description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 2
- MGGZDDQAOZEEDU-UHFFFAOYSA-N 3-(4-chlorophenyl)pyrrolidine Chemical compound C1=CC(Cl)=CC=C1C1CNCC1 MGGZDDQAOZEEDU-UHFFFAOYSA-N 0.000 description 2
- RMASDOGCVKBOCY-UHFFFAOYSA-N 3-phenyl-2,5-dihydro-1h-pyrrole Chemical compound C1NCC(C=2C=CC=CC=2)=C1 RMASDOGCVKBOCY-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N Lactic Acid Natural products CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N aniline-p-carboxylic acid Natural products NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 229940125681 anticonvulsant agent Drugs 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 2
- 229940035363 muscle relaxants Drugs 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- XACWJIQLDLUFSR-UHFFFAOYSA-N pyrrolidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCCC1 XACWJIQLDLUFSR-UHFFFAOYSA-N 0.000 description 2
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- DHGMDHQNUNRMIN-UHFFFAOYSA-N 1-benzylpyrrolidin-3-one Chemical compound C1C(=O)CCN1CC1=CC=CC=C1 DHGMDHQNUNRMIN-UHFFFAOYSA-N 0.000 description 1
- HHIRBXHEYVDUAM-UHFFFAOYSA-N 1-chloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1 HHIRBXHEYVDUAM-UHFFFAOYSA-N 0.000 description 1
- SXJYSIBLFGQAND-UHFFFAOYSA-N 1-isocyanato-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=C=O)=C1 SXJYSIBLFGQAND-UHFFFAOYSA-N 0.000 description 1
- CFOXGLLEGVOLKT-UHFFFAOYSA-N 1-phenylpyrrolidin-3-ol Chemical compound C1C(O)CCN1C1=CC=CC=C1 CFOXGLLEGVOLKT-UHFFFAOYSA-N 0.000 description 1
- RDMFEHLCCOQUMH-UHFFFAOYSA-N 2,4'-Diphenyldiamine Chemical compound C1=CC(N)=CC=C1C1=CC=CC=C1N RDMFEHLCCOQUMH-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- XYJJNJMGKPBTGD-UHFFFAOYSA-N 3-(2,4-dimethylphenyl)pyrrolidine Chemical compound CC1=CC(C)=CC=C1C1CNCC1 XYJJNJMGKPBTGD-UHFFFAOYSA-N 0.000 description 1
- FQSUFJMIMCTWRI-UHFFFAOYSA-N 3-(3-chlorophenyl)pyrrolidine Chemical compound ClC1=CC=CC(C2CNCC2)=C1 FQSUFJMIMCTWRI-UHFFFAOYSA-N 0.000 description 1
- REQRIBDNGWXWFI-UHFFFAOYSA-N 3-(3-fluorophenyl)pyrrolidin-3-ol Chemical compound C=1C=CC(F)=CC=1C1(O)CCNC1 REQRIBDNGWXWFI-UHFFFAOYSA-N 0.000 description 1
- QVQBKQODOLUXAQ-UHFFFAOYSA-N 3-(4-chlorophenyl)pyrrolidin-1-amine Chemical compound C1N(N)CCC1C1=CC=C(Cl)C=C1 QVQBKQODOLUXAQ-UHFFFAOYSA-N 0.000 description 1
- UNNNSSSZULOEPR-UHFFFAOYSA-N 3-phenylpyrrolidine-1-carbonyl chloride Chemical compound C1N(C(=O)Cl)CCC1C1=CC=CC=C1 UNNNSSSZULOEPR-UHFFFAOYSA-N 0.000 description 1
- FVSWNQYFMNGPLF-UHFFFAOYSA-N 3-phenylpyrrolidine-2,5-dione Chemical compound O=C1NC(=O)CC1C1=CC=CC=C1 FVSWNQYFMNGPLF-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- FYEUZUOVZVREHA-UHFFFAOYSA-N 5-chloro-2,3-dihydroindole-1-carbonyl chloride Chemical compound ClC1=CC=C2N(C(=O)Cl)CCC2=C1 FYEUZUOVZVREHA-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- MZAQOOWXHQBKBK-UHFFFAOYSA-N N,3-diphenyl-1-pyrrolidinecarboxamide Chemical compound C1CC(C=2C=CC=CC=2)CN1C(=O)NC1=CC=CC=C1 MZAQOOWXHQBKBK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- VOVZXURTCKPRDQ-CQSZACIVSA-N n-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3r)-3-hydroxypyrrolidin-1-yl]-5-(1h-pyrazol-5-yl)pyridine-3-carboxamide Chemical compound C1[C@H](O)CCN1C1=NC=C(C(=O)NC=2C=CC(OC(F)(F)Cl)=CC=2)C=C1C1=CC=NN1 VOVZXURTCKPRDQ-CQSZACIVSA-N 0.000 description 1
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000001126 phototherapy Methods 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/06—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with radicals, containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81444369A | 1969-04-08 | 1969-04-08 | |
| US81444269A | 1969-04-08 | 1969-04-08 | |
| US81549569A | 1969-04-11 | 1969-04-11 | |
| US81549269A | 1969-04-11 | 1969-04-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2017255A1 true DE2017255A1 (de) | 1970-10-08 |
Family
ID=27505843
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702017255 Pending DE2017255A1 (de) | 1969-04-08 | 1970-04-10 | 1-substituierte-3-Pheny!pyrrolidine und Verfahren zu deren Herstellung |
| DE19702017265 Pending DE2017265A1 (de) | 1969-04-08 | 1970-04-10 | l-(omega-substituierte-Alkyl)-2mehtylbenzimidazole und Verfahren zu deren Herstellung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702017265 Pending DE2017265A1 (de) | 1969-04-08 | 1970-04-10 | l-(omega-substituierte-Alkyl)-2mehtylbenzimidazole und Verfahren zu deren Herstellung |
Country Status (10)
| Country | Link |
|---|---|
| US (4) | US3647790A (enExample) |
| AT (1) | AT294815B (enExample) |
| BE (1) | BE748392A (enExample) |
| CA (1) | CA974995A (enExample) |
| CH (2) | CH549038A (enExample) |
| DE (2) | DE2017255A1 (enExample) |
| FR (2) | FR2042322B1 (enExample) |
| GB (2) | GB1299621A (enExample) |
| NL (1) | NL7005191A (enExample) |
| SE (1) | SE366040B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2010058018A1 (en) * | 2008-11-24 | 2010-05-27 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | 3-phenyl-3-methoxypyrrolidine derivatives as modulators of cortical catecholaminergic neurotransmission |
| US8188301B2 (en) | 2007-06-05 | 2012-05-29 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | Disubstituted phenylpyrrolidines as modulators of cortical catecholaminergic neurotransmission |
| WO2018056854A1 (en) * | 2016-09-23 | 2018-03-29 | BIAL - PORTELA & Cª, S.A. | Blood-brain barrier-penetrant dopamine-b-hydroxylase inhibitors |
| US11434242B2 (en) | 2017-12-04 | 2022-09-06 | Bial—Portela & Ca, S.A. | Dopamine-b-hydroxylase inhibitors |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| US4066772A (en) * | 1975-07-21 | 1978-01-03 | Janssen Pharmaceutica N.V. | 1,3-Dihydro-1-[3-(1-piperidinyl)propyl]-2H-benzimidazol-2-ones and related compounds |
| US4175129A (en) | 1975-07-21 | 1979-11-20 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzoxazolylalkyl)-piperidine derivatives |
| US4035369A (en) * | 1975-10-08 | 1977-07-12 | Janssen Pharmaceutica N.V. | 1-Benzazolylalkyl-4-substituted-piperidines |
| US4126688A (en) * | 1976-05-17 | 1978-11-21 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzotriazolyl-alkyl)-piperidine derivatives |
| LU75478A1 (enExample) * | 1976-07-28 | 1978-02-08 | ||
| US4241061A (en) * | 1979-05-21 | 1980-12-23 | International Minerals & Chemical Corp. | Oxazolidinyl-quinoxalines and use as growth promoters |
| US4303667A (en) * | 1979-05-25 | 1981-12-01 | Nippon Soda Company Limited | Phenylprrole derivatives |
| EP0084920B1 (en) * | 1979-12-05 | 1989-04-19 | Per Arvid Emil Carlsson | New compounds useful as intermediates or starting materials for preparation of therapeutically useful phenyl-azacycloalkanes |
| US4656276A (en) * | 1980-08-07 | 1987-04-07 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4720548A (en) * | 1980-08-07 | 1988-01-19 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4348389A (en) * | 1980-08-07 | 1982-09-07 | International Minerals & Chemical Corp. | Quinoxaline adducts useful as anthelmintics |
| US4658028A (en) * | 1980-08-07 | 1987-04-14 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4629790A (en) * | 1980-08-07 | 1986-12-16 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4661593A (en) * | 1980-08-07 | 1987-04-28 | Angus Chemcial Company | Quinoxaline adducts useful as anthelmintics |
| DE3328643A1 (de) * | 1983-08-09 | 1985-02-21 | Gödecke AG, 1000 Berlin | 3-aryl-3-pyrrolin-derivate, verfahren zu deren herstellung sowie deren verwendung bei der bekaempfung von herz- und gefaesskrankheiten |
| US5118816A (en) * | 1990-12-26 | 1992-06-02 | American Cyanamid Company | 2-aryl-5-(trifluoromethyl)-2-pyrroline compounds useful in the manufacture of insecticidal, nematocidal and acaricidal arylpyrroles |
| US5514678A (en) * | 1992-03-26 | 1996-05-07 | E. I. Du Pont De Nemours And Company | Arthropodicidal 1,2,4-triazinyl amides |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| US6355659B1 (en) | 1994-07-29 | 2002-03-12 | Laboratorios Del Dr. Esteve, S.A. | 4-(4-Chlorophenyl)-1236-tetrahydro-1(1H-124-triazol-1-yl)butty)pyrideine and salts thereof; pharmaceutical compositions and method of treating psychoses utilizing same |
| FR2723091B1 (fr) * | 1994-07-29 | 1996-11-08 | Esteve Labor Dr | Tetrahydropyridine-(6,4-hydroxypiperidine) alkylazoles |
| PT775118E (pt) | 1994-08-05 | 2003-10-31 | Pfizer | Derivados de benzimidazole com actividade dopaminergica |
| US5883094A (en) * | 1995-04-24 | 1999-03-16 | Pfizer Inc. | Benzimidazolone derivatives with central dopaminergic activity |
| US5889010A (en) * | 1995-05-18 | 1999-03-30 | Pfizer Inc. | Benzimidazole derivatives having dopaminergic activity |
| DE19615232A1 (de) * | 1996-04-18 | 1997-10-23 | Merck Patent Gmbh | Neue Carbamoylderivate und deren Verwendung als 5-HT ¶1¶¶A¶-Antagonisten |
| GB9801392D0 (en) | 1998-01-22 | 1998-03-18 | Smithkline Beecham Plc | Novel compounds |
| KR20050010515A (ko) * | 2002-06-14 | 2005-01-27 | 머크 앤드 캄파니 인코포레이티드 | 유사분열 키네신 억제제 |
| US7301028B2 (en) * | 2002-06-14 | 2007-11-27 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| AU2003287057B2 (en) * | 2002-10-18 | 2008-08-21 | Merck Sharp & Dohme Corp. | Mitotic kinesin inhibitors |
| WO2005018547A2 (en) * | 2003-08-15 | 2005-03-03 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| JP2007502775A (ja) * | 2003-08-15 | 2007-02-15 | メルク エンド カムパニー インコーポレーテッド | 有糸分裂キネシン阻害剤 |
| DE602004019229D1 (de) * | 2003-08-15 | 2009-03-12 | Merck & Co Inc | Inhibitoren von mitotischem kinesin |
| EA200800013A1 (ru) * | 2005-06-10 | 2008-06-30 | Эликсир Фармасьютикалз, Инк. | Сульфонамидные соединения и их применение |
| US7829589B2 (en) * | 2005-06-10 | 2010-11-09 | Elixir Pharmaceuticals, Inc. | Sulfonamide compounds and uses thereof |
| FR2902790A1 (fr) * | 2006-06-27 | 2007-12-28 | Sanofi Aventis Sa | Derives d'urees de piperidine ou pyrrolidine,leur preparation et leur application en therapeutique |
| DE602008006720D1 (de) * | 2007-06-05 | 2011-06-16 | Nsab, Filial Af Neurosearch Sweden Ab | Neue disubstituierte phenylpyrrolidine als modulatoren der kortikalen katecholaminergen neurotransmission |
| TWI457122B (zh) | 2007-07-20 | 2014-10-21 | Orion Corp | 作為用於治療周邊和中央神經系統疾病之alpha2C拮抗劑的2,3-二氫苯並[1,4]戴奧辛-2-基甲基衍生物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3362956A (en) * | 1965-08-19 | 1968-01-09 | Sterling Drug Inc | 1-[(heterocyclyl)-lower-alkyl]-4-substituted-piperazines |
-
1969
- 1969-04-08 US US814442A patent/US3647790A/en not_active Expired - Lifetime
- 1969-04-08 US US814443A patent/US3635982A/en not_active Expired - Lifetime
- 1969-04-11 US US815495A patent/US3644414A/en not_active Expired - Lifetime
- 1969-04-11 US US815492A patent/US3634441A/en not_active Expired - Lifetime
-
1970
- 1970-02-20 CH CH249470A patent/CH549038A/xx not_active IP Right Cessation
- 1970-02-20 CH CH250270A patent/CH556336A/xx not_active IP Right Cessation
- 1970-03-24 GB GB04118/70A patent/GB1299621A/en not_active Expired
- 1970-04-02 BE BE748392D patent/BE748392A/xx unknown
- 1970-04-07 GB GB1289089D patent/GB1289089A/en not_active Expired
- 1970-04-09 SE SE04844/70A patent/SE366040B/xx unknown
- 1970-04-09 AT AT325570A patent/AT294815B/de not_active IP Right Cessation
- 1970-04-10 DE DE19702017255 patent/DE2017255A1/de active Pending
- 1970-04-10 FR FR707013078A patent/FR2042322B1/fr not_active Expired
- 1970-04-10 CA CA079,859A patent/CA974995A/en not_active Expired
- 1970-04-10 FR FR7013077A patent/FR2042321B1/fr not_active Expired
- 1970-04-10 NL NL7005191A patent/NL7005191A/xx unknown
- 1970-04-10 DE DE19702017265 patent/DE2017265A1/de active Pending
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8188301B2 (en) | 2007-06-05 | 2012-05-29 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | Disubstituted phenylpyrrolidines as modulators of cortical catecholaminergic neurotransmission |
| WO2010058018A1 (en) * | 2008-11-24 | 2010-05-27 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | 3-phenyl-3-methoxypyrrolidine derivatives as modulators of cortical catecholaminergic neurotransmission |
| WO2010058019A1 (en) * | 2008-11-24 | 2010-05-27 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | 3-phenyl-3-methoxypyrrolidine derivatives as modulators of cortical catecholaminergic neurotransmission |
| US8673962B2 (en) | 2008-11-24 | 2014-03-18 | Integrative Research Laboratories Sweden Ab | 3-phenyl-3-methoxypyrrolidine derivatives as modulators of cortical catecholaminergic neurotransmission |
| US9035073B2 (en) | 2008-11-24 | 2015-05-19 | Integrative Research Laboratories Sweden Ab | 3-phenyl-3-methoxy-pyrrolidine derivatives useful as modulators of cortical catecholaminergic neurotransmission |
| WO2018056854A1 (en) * | 2016-09-23 | 2018-03-29 | BIAL - PORTELA & Cª, S.A. | Blood-brain barrier-penetrant dopamine-b-hydroxylase inhibitors |
| CN109715155A (zh) * | 2016-09-23 | 2019-05-03 | 巴尔-波特拉及康邦亚股份有限公司 | 血脑屏障-穿透剂多巴胺-β-羟化酶抑制剂 |
| US11434242B2 (en) | 2017-12-04 | 2022-09-06 | Bial—Portela & Ca, S.A. | Dopamine-b-hydroxylase inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| US3635982A (en) | 1972-01-18 |
| GB1289089A (enExample) | 1972-09-13 |
| CH556336A (de) | 1974-11-29 |
| FR2042322B1 (enExample) | 1973-06-08 |
| FR2042321B1 (enExample) | 1974-03-22 |
| US3644414A (en) | 1972-02-22 |
| US3647790A (en) | 1972-03-07 |
| GB1299621A (en) | 1972-12-13 |
| US3634441A (en) | 1972-01-11 |
| AT294815B (de) | 1971-12-10 |
| SE366040B (enExample) | 1974-04-08 |
| NL7005191A (enExample) | 1970-10-13 |
| CH549038A (de) | 1974-05-15 |
| BE748392A (fr) | 1970-09-16 |
| DE2017265A1 (de) | 1970-10-15 |
| FR2042321A1 (enExample) | 1971-02-12 |
| CA974995A (en) | 1975-09-23 |
| FR2042322A1 (enExample) | 1971-02-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2017255A1 (de) | 1-substituierte-3-Pheny!pyrrolidine und Verfahren zu deren Herstellung | |
| EP0136658B1 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2235544C3 (de) | 33-Disubstituierte l-Methyl-1,2,4triazolderivate und Verfahren zu deren Herstellung | |
| DE1964516A1 (de) | 1-Substituierte 3-Amidopyrrolidine und Verfahren zu ihrer Herstellung | |
| DE1964511A1 (de) | 1-substituierte-3-Phenoxypyrrolidine und Verfahren zu ihrer Herstellung | |
| DE2952279A1 (de) | Neue 2-acylaminomethyl-1,4-benzodiazepine und deren salze sowie verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2149249A1 (de) | 6-Arylpyrimidine | |
| DE2601137A1 (de) | Substituierte perhalogenalkylamidine und herzstimulantien | |
| CH645352A5 (en) | N-Lower alkyl-3-phenoxy-1-azetidinecarboxamides | |
| EP0163260A1 (de) | Neue substituierte Pyrrolidinone, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2818672A1 (de) | Alpha-(1-r-3-azetidinyl)-alpha- phenyl-alpha-substituierte-acetamide oder -acetonitrile, verfahren zu ihrer herstellung und verwendung zur behandlung von herzarrhythmien | |
| DE3216843C2 (de) | 3-Thiomethyl-pyridin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2143614A1 (de) | 2-substituierte benzimidazole und verfahren zu deren herstellung | |
| DE1964515A1 (de) | 1-Substituierte-4-Phenoxypiperidine und Verfahren zu ihrer Herstellung | |
| DE2017256A1 (de) | l-Carbamoyl-3-pheny!pyrrolidine und Verfahren zu deren Herstellung | |
| EP0233483B1 (de) | Pyrrolo[1,2-a][4,1]benzoxazepine, Verfahren zur ihrer Herstellung, pharmazeutische Präparate enthaltend diese Verbindungen, sowie therapeutische Verwendung | |
| DE60207273T2 (de) | Aminopyrrolverbindungen als entzündungshemmende Wirkstoffe | |
| EP0042354B1 (de) | Imidazobenzothiadiazepine, Verfahren zu ihrer Herstellung sowie pharmazeutische Präparate die diese Verbindungen enthalten | |
| DE2609574C3 (de) | 1 -^-Fluor-S-trifluormethylthiophenyD-piperazin, dessen Salze, Verfahren zu dessen Herstellung und Arzneimittel | |
| EP0054839A2 (de) | 2-Acylaminomethyl-1,4-benzodiazepine und deren Salze sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3124013A1 (de) | 2-acylaminomethyl-1,4-benzodiazepin-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE69128845T2 (de) | 4-[3-(4-Oxothiazoldinyl)]butynylamine, Verfahren zu deren Herstellung und ihre Verwendung als Medikament | |
| EP0266563B1 (de) | Verwendung von 1-Benzyl-amino-alkyl-pyrrolidinonen als Antidepressiva | |
| DE1695652A1 (de) | 1,3-Disubstituierte Pyrrolidine und Verfahren zu ihrer Herstellung | |
| DE2856722A1 (de) | Acylhydrocarbylaminoalkansaeuren, ihre herstellung und verwendung sowie sie enthaltende arzneimittel |