GB1289089A - - Google Patents
Info
- Publication number
- GB1289089A GB1289089A GB1289089DA GB1289089A GB 1289089 A GB1289089 A GB 1289089A GB 1289089D A GB1289089D A GB 1289089DA GB 1289089 A GB1289089 A GB 1289089A
- Authority
- GB
- United Kingdom
- Prior art keywords
- phenyl
- compounds
- phenylcarbamyl
- benzodioxan
- april
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 N-substituted 3-phenylpyrrolidines Chemical class 0.000 abstract 6
- 150000001875 compounds Chemical class 0.000 abstract 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- FNJBWEIHVXAHTD-UHFFFAOYSA-N 1-nitroso-3-phenyl-2,3-dihydroindole Chemical compound N(=O)N1CC(C2=CC=CC=C12)C1=CC=CC=C1 FNJBWEIHVXAHTD-UHFFFAOYSA-N 0.000 abstract 1
- RMASDOGCVKBOCY-UHFFFAOYSA-N 3-phenyl-2,5-dihydro-1h-pyrrole Chemical compound C1NCC(C=2C=CC=CC=2)=C1 RMASDOGCVKBOCY-UHFFFAOYSA-N 0.000 abstract 1
- UNNNSSSZULOEPR-UHFFFAOYSA-N 3-phenylpyrrolidine-1-carbonyl chloride Chemical compound C1N(C(=O)Cl)CCC1C1=CC=CC=C1 UNNNSSSZULOEPR-UHFFFAOYSA-N 0.000 abstract 1
- 229910010082 LiAlH Inorganic materials 0.000 abstract 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 abstract 1
- 241000287433 Turdus Species 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 230000001773 anti-convulsant effect Effects 0.000 abstract 1
- 239000001961 anticonvulsive agent Substances 0.000 abstract 1
- 229960003965 antiepileptics Drugs 0.000 abstract 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 210000003169 central nervous system Anatomy 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 239000003158 myorelaxant agent Substances 0.000 abstract 1
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/06—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with radicals, containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81444369A | 1969-04-08 | 1969-04-08 | |
| US81444269A | 1969-04-08 | 1969-04-08 | |
| US81549569A | 1969-04-11 | 1969-04-11 | |
| US81549269A | 1969-04-11 | 1969-04-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1289089A true GB1289089A (enExample) | 1972-09-13 |
Family
ID=27505843
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB04118/70A Expired GB1299621A (en) | 1969-04-08 | 1970-03-24 | 0-substituted-2-methylbenzimidazoles |
| GB1289089D Expired GB1289089A (enExample) | 1969-04-08 | 1970-04-07 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB04118/70A Expired GB1299621A (en) | 1969-04-08 | 1970-03-24 | 0-substituted-2-methylbenzimidazoles |
Country Status (10)
| Country | Link |
|---|---|
| US (4) | US3647790A (enExample) |
| AT (1) | AT294815B (enExample) |
| BE (1) | BE748392A (enExample) |
| CA (1) | CA974995A (enExample) |
| CH (2) | CH549038A (enExample) |
| DE (2) | DE2017255A1 (enExample) |
| FR (2) | FR2042322B1 (enExample) |
| GB (2) | GB1299621A (enExample) |
| NL (1) | NL7005191A (enExample) |
| SE (1) | SE366040B (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| US4066772A (en) * | 1975-07-21 | 1978-01-03 | Janssen Pharmaceutica N.V. | 1,3-Dihydro-1-[3-(1-piperidinyl)propyl]-2H-benzimidazol-2-ones and related compounds |
| US4175129A (en) | 1975-07-21 | 1979-11-20 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzoxazolylalkyl)-piperidine derivatives |
| US4035369A (en) * | 1975-10-08 | 1977-07-12 | Janssen Pharmaceutica N.V. | 1-Benzazolylalkyl-4-substituted-piperidines |
| US4126688A (en) * | 1976-05-17 | 1978-11-21 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzotriazolyl-alkyl)-piperidine derivatives |
| LU75478A1 (enExample) * | 1976-07-28 | 1978-02-08 | ||
| US4241061A (en) * | 1979-05-21 | 1980-12-23 | International Minerals & Chemical Corp. | Oxazolidinyl-quinoxalines and use as growth promoters |
| US4303667A (en) * | 1979-05-25 | 1981-12-01 | Nippon Soda Company Limited | Phenylprrole derivatives |
| EP0084920B1 (en) * | 1979-12-05 | 1989-04-19 | Per Arvid Emil Carlsson | New compounds useful as intermediates or starting materials for preparation of therapeutically useful phenyl-azacycloalkanes |
| US4656276A (en) * | 1980-08-07 | 1987-04-07 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4720548A (en) * | 1980-08-07 | 1988-01-19 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4348389A (en) * | 1980-08-07 | 1982-09-07 | International Minerals & Chemical Corp. | Quinoxaline adducts useful as anthelmintics |
| US4658028A (en) * | 1980-08-07 | 1987-04-14 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4629790A (en) * | 1980-08-07 | 1986-12-16 | Angus Chemical Company | Quinoxaline adducts useful as anthelmintics |
| US4661593A (en) * | 1980-08-07 | 1987-04-28 | Angus Chemcial Company | Quinoxaline adducts useful as anthelmintics |
| DE3328643A1 (de) * | 1983-08-09 | 1985-02-21 | Gödecke AG, 1000 Berlin | 3-aryl-3-pyrrolin-derivate, verfahren zu deren herstellung sowie deren verwendung bei der bekaempfung von herz- und gefaesskrankheiten |
| US5118816A (en) * | 1990-12-26 | 1992-06-02 | American Cyanamid Company | 2-aryl-5-(trifluoromethyl)-2-pyrroline compounds useful in the manufacture of insecticidal, nematocidal and acaricidal arylpyrroles |
| US5514678A (en) * | 1992-03-26 | 1996-05-07 | E. I. Du Pont De Nemours And Company | Arthropodicidal 1,2,4-triazinyl amides |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| US6355659B1 (en) | 1994-07-29 | 2002-03-12 | Laboratorios Del Dr. Esteve, S.A. | 4-(4-Chlorophenyl)-1236-tetrahydro-1(1H-124-triazol-1-yl)butty)pyrideine and salts thereof; pharmaceutical compositions and method of treating psychoses utilizing same |
| FR2723091B1 (fr) * | 1994-07-29 | 1996-11-08 | Esteve Labor Dr | Tetrahydropyridine-(6,4-hydroxypiperidine) alkylazoles |
| PT775118E (pt) | 1994-08-05 | 2003-10-31 | Pfizer | Derivados de benzimidazole com actividade dopaminergica |
| US5883094A (en) * | 1995-04-24 | 1999-03-16 | Pfizer Inc. | Benzimidazolone derivatives with central dopaminergic activity |
| US5889010A (en) * | 1995-05-18 | 1999-03-30 | Pfizer Inc. | Benzimidazole derivatives having dopaminergic activity |
| DE19615232A1 (de) * | 1996-04-18 | 1997-10-23 | Merck Patent Gmbh | Neue Carbamoylderivate und deren Verwendung als 5-HT ¶1¶¶A¶-Antagonisten |
| GB9801392D0 (en) | 1998-01-22 | 1998-03-18 | Smithkline Beecham Plc | Novel compounds |
| KR20050010515A (ko) * | 2002-06-14 | 2005-01-27 | 머크 앤드 캄파니 인코포레이티드 | 유사분열 키네신 억제제 |
| US7301028B2 (en) * | 2002-06-14 | 2007-11-27 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| AU2003287057B2 (en) * | 2002-10-18 | 2008-08-21 | Merck Sharp & Dohme Corp. | Mitotic kinesin inhibitors |
| WO2005018547A2 (en) * | 2003-08-15 | 2005-03-03 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| JP2007502775A (ja) * | 2003-08-15 | 2007-02-15 | メルク エンド カムパニー インコーポレーテッド | 有糸分裂キネシン阻害剤 |
| DE602004019229D1 (de) * | 2003-08-15 | 2009-03-12 | Merck & Co Inc | Inhibitoren von mitotischem kinesin |
| EA200800013A1 (ru) * | 2005-06-10 | 2008-06-30 | Эликсир Фармасьютикалз, Инк. | Сульфонамидные соединения и их применение |
| US7829589B2 (en) * | 2005-06-10 | 2010-11-09 | Elixir Pharmaceuticals, Inc. | Sulfonamide compounds and uses thereof |
| FR2902790A1 (fr) * | 2006-06-27 | 2007-12-28 | Sanofi Aventis Sa | Derives d'urees de piperidine ou pyrrolidine,leur preparation et leur application en therapeutique |
| DE602008006720D1 (de) * | 2007-06-05 | 2011-06-16 | Nsab, Filial Af Neurosearch Sweden Ab | Neue disubstituierte phenylpyrrolidine als modulatoren der kortikalen katecholaminergen neurotransmission |
| US8188301B2 (en) * | 2007-06-05 | 2012-05-29 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | Disubstituted phenylpyrrolidines as modulators of cortical catecholaminergic neurotransmission |
| TWI457122B (zh) | 2007-07-20 | 2014-10-21 | Orion Corp | 作為用於治療周邊和中央神經系統疾病之alpha2C拮抗劑的2,3-二氫苯並[1,4]戴奧辛-2-基甲基衍生物 |
| WO2010058019A1 (en) | 2008-11-24 | 2010-05-27 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | 3-phenyl-3-methoxypyrrolidine derivatives as modulators of cortical catecholaminergic neurotransmission |
| JOP20190050A1 (ar) | 2016-09-23 | 2019-03-20 | Bial Portela & C? S A | مثبطات دوبامين-b-هيدروكسيلاز تخترق حاجز المخ الدموي |
| MX2020005864A (es) | 2017-12-04 | 2020-09-09 | BIAL PORTELA & Cª S A | Inhibidores de dopamina-b-hidroxilasa. |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3362956A (en) * | 1965-08-19 | 1968-01-09 | Sterling Drug Inc | 1-[(heterocyclyl)-lower-alkyl]-4-substituted-piperazines |
-
1969
- 1969-04-08 US US814442A patent/US3647790A/en not_active Expired - Lifetime
- 1969-04-08 US US814443A patent/US3635982A/en not_active Expired - Lifetime
- 1969-04-11 US US815495A patent/US3644414A/en not_active Expired - Lifetime
- 1969-04-11 US US815492A patent/US3634441A/en not_active Expired - Lifetime
-
1970
- 1970-02-20 CH CH249470A patent/CH549038A/xx not_active IP Right Cessation
- 1970-02-20 CH CH250270A patent/CH556336A/xx not_active IP Right Cessation
- 1970-03-24 GB GB04118/70A patent/GB1299621A/en not_active Expired
- 1970-04-02 BE BE748392D patent/BE748392A/xx unknown
- 1970-04-07 GB GB1289089D patent/GB1289089A/en not_active Expired
- 1970-04-09 SE SE04844/70A patent/SE366040B/xx unknown
- 1970-04-09 AT AT325570A patent/AT294815B/de not_active IP Right Cessation
- 1970-04-10 DE DE19702017255 patent/DE2017255A1/de active Pending
- 1970-04-10 FR FR707013078A patent/FR2042322B1/fr not_active Expired
- 1970-04-10 CA CA079,859A patent/CA974995A/en not_active Expired
- 1970-04-10 FR FR7013077A patent/FR2042321B1/fr not_active Expired
- 1970-04-10 NL NL7005191A patent/NL7005191A/xx unknown
- 1970-04-10 DE DE19702017265 patent/DE2017265A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3635982A (en) | 1972-01-18 |
| CH556336A (de) | 1974-11-29 |
| FR2042322B1 (enExample) | 1973-06-08 |
| FR2042321B1 (enExample) | 1974-03-22 |
| US3644414A (en) | 1972-02-22 |
| US3647790A (en) | 1972-03-07 |
| GB1299621A (en) | 1972-12-13 |
| US3634441A (en) | 1972-01-11 |
| AT294815B (de) | 1971-12-10 |
| SE366040B (enExample) | 1974-04-08 |
| NL7005191A (enExample) | 1970-10-13 |
| CH549038A (de) | 1974-05-15 |
| DE2017255A1 (de) | 1970-10-08 |
| BE748392A (fr) | 1970-09-16 |
| DE2017265A1 (de) | 1970-10-15 |
| FR2042321A1 (enExample) | 1971-02-12 |
| CA974995A (en) | 1975-09-23 |
| FR2042322A1 (enExample) | 1971-02-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1289089A (enExample) | ||
| IL70964A (en) | (2-oxo-1,2,3,5-tetrahydro-imidazo(2,1-b)quinazolinyl)-oxyalkylamides,their preparation and pharmaceutical compositions containing them and some intermediates therefor | |
| GB1309692A (en) | N-substituted lactams | |
| GB1289867A (enExample) | ||
| GB1463575A (en) | Vinca alkaloid derivatives | |
| EP1640367A4 (en) | ISOCHINOLINE-1,3,4-TRION, SYNTHETIC METHOD AND ITS USE | |
| GB1142337A (en) | Amino nitroalkanes and their use as microbiocides | |
| ES8801242A1 (es) | Un procedimiento para la preparacion de metanosulfonatos de dioxolano. | |
| GB1304392A (enExample) | ||
| AU2870492A (en) | Pyrrolo-pyridazines with gastro-intestinal protective action | |
| IE39546B1 (en) | Quinazoline-derived amines | |
| ES8606363A1 (es) | Un procedimiento de preparar derivados de acido 1-destia-2- tiacefalosporanico | |
| GB1325528A (en) | Aminophenylcycloamidine derivatives their production and their medicinal use | |
| SU1318158A3 (ru) | Способ получени производных 4-замещенного-1,3,4,5-тетрагидро-2 @ -1,4-бензодиазепин-2-она | |
| GB1307250A (en) | Benzene derivatives | |
| ES8701741A1 (es) | Procedimiento de preparar derivados iminotiazolidinicos | |
| NZ233728A (en) | Amino acid compounds and pharmaceutical compositions thereof | |
| ATE146774T1 (de) | Phenylethanolamine, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung | |
| GB1346911A (en) | Benzofuran derivatives and a process for the manufacture thereof | |
| GB1236078A (en) | Substituted azetidinols | |
| GB1203430A (en) | Heterocyclic spiro compounds | |
| GB1452411A (en) | N,n-disubstituted benzamidines and toluamidines methods for their preparation and compositions containing them | |
| GB1161062A (en) | Active Sulphonamides | |
| GB1292417A (en) | 4-amino-2-(5-nitro-2-thienyl) quinazolines, their preparation, and compositions containing them | |
| GB1130165A (en) | Inhibition of oxidative deterioration using hydroxylated n-alkylamines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |