DE19818044A1 - Verwendung von Vitamin-PP-Verbindungen - Google Patents
Verwendung von Vitamin-PP-VerbindungenInfo
- Publication number
- DE19818044A1 DE19818044A1 DE19818044A DE19818044A DE19818044A1 DE 19818044 A1 DE19818044 A1 DE 19818044A1 DE 19818044 A DE19818044 A DE 19818044A DE 19818044 A DE19818044 A DE 19818044A DE 19818044 A1 DE19818044 A1 DE 19818044A1
- Authority
- DE
- Germany
- Prior art keywords
- pyridin
- butyl
- acrylamide
- piperidin
- piperazin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical class NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 title claims abstract description 189
- 230000003327 cancerostatic effect Effects 0.000 title claims abstract description 91
- 230000000694 effects Effects 0.000 title claims abstract description 72
- 239000003018 immunosuppressive agent Substances 0.000 title claims abstract description 20
- 239000011570 nicotinamide Substances 0.000 title claims description 80
- 235000005152 nicotinamide Nutrition 0.000 title claims description 79
- 229960003966 nicotinamide Drugs 0.000 title claims description 71
- 229940125721 immunosuppressive agent Drugs 0.000 title abstract 7
- 230000003472 neutralizing effect Effects 0.000 title abstract 3
- 150000003222 pyridines Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 73
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical class OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims abstract description 50
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 41
- 235000019160 vitamin B3 Nutrition 0.000 claims abstract description 35
- 239000011708 vitamin B3 Substances 0.000 claims abstract description 35
- 238000002512 chemotherapy Methods 0.000 claims abstract description 22
- 239000000824 cytostatic agent Substances 0.000 claims abstract description 13
- 239000000969 carrier Substances 0.000 claims abstract description 12
- 230000001085 cytostatic effect Effects 0.000 claims abstract description 12
- 238000001959 radiotherapy Methods 0.000 claims abstract description 11
- 230000001154 acute effect Effects 0.000 claims abstract description 10
- 150000001408 amides Chemical class 0.000 claims abstract description 10
- 230000009471 action Effects 0.000 claims abstract description 9
- 230000001506 immunosuppresive effect Effects 0.000 claims abstract description 9
- 230000001028 anti-proliverative effect Effects 0.000 claims abstract description 6
- 206010027476 Metastases Diseases 0.000 claims abstract description 4
- 230000001120 cytoprotective effect Effects 0.000 claims abstract description 4
- 230000009401 metastasis Effects 0.000 claims abstract description 4
- 208000023275 Autoimmune disease Diseases 0.000 claims abstract description 3
- 230000008105 immune reaction Effects 0.000 claims abstract description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract 24
- -1 pyridyl alkene Chemical class 0.000 claims description 286
- 239000000126 substance Substances 0.000 claims description 94
- 239000003814 drug Substances 0.000 claims description 82
- 229940079593 drug Drugs 0.000 claims description 65
- 125000003118 aryl group Chemical group 0.000 claims description 51
- 239000000243 solution Substances 0.000 claims description 50
- 239000002246 antineoplastic agent Substances 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 239000004480 active ingredient Substances 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 32
- 239000000843 powder Substances 0.000 claims description 31
- 150000003839 salts Chemical group 0.000 claims description 30
- 239000003826 tablet Substances 0.000 claims description 30
- 229960003512 nicotinic acid Drugs 0.000 claims description 28
- 150000002431 hydrogen Chemical class 0.000 claims description 24
- 238000002360 preparation method Methods 0.000 claims description 24
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 23
- 125000000623 heterocyclic group Chemical group 0.000 claims description 22
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 20
- 125000005842 heteroatom Chemical group 0.000 claims description 19
- 229920006395 saturated elastomer Polymers 0.000 claims description 19
- 238000011282 treatment Methods 0.000 claims description 19
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 claims description 18
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 18
- 239000008101 lactose Substances 0.000 claims description 18
- 239000003380 propellant Substances 0.000 claims description 18
- 125000006828 (C2-C7) alkoxycarbonyl group Chemical group 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 239000000725 suspension Substances 0.000 claims description 17
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 claims description 16
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 16
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 16
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- 230000001225 therapeutic effect Effects 0.000 claims description 15
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 14
- 229940002612 prodrug Drugs 0.000 claims description 14
- 239000000651 prodrug Substances 0.000 claims description 14
- 238000009472 formulation Methods 0.000 claims description 13
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 239000000839 emulsion Substances 0.000 claims description 12
- 239000002674 ointment Substances 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 150000001204 N-oxides Chemical class 0.000 claims description 11
- 239000000443 aerosol Substances 0.000 claims description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 11
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 10
- 229960003444 immunosuppressant agent Drugs 0.000 claims description 10
- 239000007924 injection Substances 0.000 claims description 10
- 238000002347 injection Methods 0.000 claims description 10
- 230000009467 reduction Effects 0.000 claims description 10
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- 229930195725 Mannitol Natural products 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 9
- 239000002775 capsule Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 9
- 239000000594 mannitol Substances 0.000 claims description 9
- 235000010355 mannitol Nutrition 0.000 claims description 9
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 claims description 8
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 8
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 8
- 230000008030 elimination Effects 0.000 claims description 8
- 238000003379 elimination reaction Methods 0.000 claims description 8
- 239000007943 implant Substances 0.000 claims description 8
- 230000002265 prevention Effects 0.000 claims description 8
- LVGUZGTVOIAKKC-UHFFFAOYSA-N 1,1,1,2-tetrafluoroethane Chemical compound FCC(F)(F)F LVGUZGTVOIAKKC-UHFFFAOYSA-N 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 7
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 7
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 7
- 239000008298 dragée Substances 0.000 claims description 7
- 125000002950 monocyclic group Chemical group 0.000 claims description 7
- 239000000600 sorbitol Substances 0.000 claims description 7
- 235000010356 sorbitol Nutrition 0.000 claims description 7
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 6
- 239000008103 glucose Substances 0.000 claims description 6
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 239000007921 spray Substances 0.000 claims description 6
- 230000009885 systemic effect Effects 0.000 claims description 6
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 125000000524 functional group Chemical group 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 238000001727 in vivo Methods 0.000 claims description 5
- 238000001802 infusion Methods 0.000 claims description 5
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 claims description 5
- 229940071648 metered dose inhaler Drugs 0.000 claims description 5
- JBSPSVYVYTWQNL-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 JBSPSVYVYTWQNL-UHFFFAOYSA-N 0.000 claims description 5
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 claims description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 239000001273 butane Substances 0.000 claims description 4
- 239000012141 concentrate Substances 0.000 claims description 4
- 238000013270 controlled release Methods 0.000 claims description 4
- 230000003111 delayed effect Effects 0.000 claims description 4
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 4
- 239000007938 effervescent tablet Substances 0.000 claims description 4
- UKACHOXRXFQJFN-UHFFFAOYSA-N heptafluoropropane Chemical compound FC(F)C(F)(F)C(F)(F)F UKACHOXRXFQJFN-UHFFFAOYSA-N 0.000 claims description 4
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 claims description 4
- VZGLEQAAAJNIAH-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 VZGLEQAAAJNIAH-UHFFFAOYSA-N 0.000 claims description 4
- ABNUGIPWBGEPAS-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 ABNUGIPWBGEPAS-UHFFFAOYSA-N 0.000 claims description 4
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 claims description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 239000002243 precursor Substances 0.000 claims description 4
- 239000001294 propane Substances 0.000 claims description 4
- 125000004761 (C2-C7) alkylaminocarbonyl group Chemical group 0.000 claims description 3
- 125000004763 (C3-C13) dialkylaminocarbonyl group Chemical group 0.000 claims description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 239000002671 adjuvant Substances 0.000 claims description 3
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 230000027455 binding Effects 0.000 claims description 3
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- 230000002496 gastric effect Effects 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 claims description 3
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 claims description 3
- 238000009117 preventive therapy Methods 0.000 claims description 3
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 claims description 3
- 239000000829 suppository Substances 0.000 claims description 3
- 238000013268 sustained release Methods 0.000 claims description 3
- 239000012730 sustained-release form Substances 0.000 claims description 3
- 239000000811 xylitol Substances 0.000 claims description 3
- 235000010447 xylitol Nutrition 0.000 claims description 3
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 claims description 3
- 229960002675 xylitol Drugs 0.000 claims description 3
- CUCDLJSFYHNNJV-VQTJNVASSA-N (1r,2r)-2-phenyl-n-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]cyclopropane-1-carboxamide Chemical compound C1([C@@H]2C[C@H]2C(=O)NCCCCNC(=O)C=CC=2C=NC=CC=2)=CC=CC=C1 CUCDLJSFYHNNJV-VQTJNVASSA-N 0.000 claims description 2
- 125000004754 (C2-C12) dialkylamino group Chemical group 0.000 claims description 2
- SQHKJSPPFSVNDF-UHFFFAOYSA-N 1,2,2,3-tetrakis(hydroxymethyl)cyclohexan-1-ol Chemical compound OCC1CCCC(O)(CO)C1(CO)CO SQHKJSPPFSVNDF-UHFFFAOYSA-N 0.000 claims description 2
- COMRSYCVLKBODY-UHFFFAOYSA-N 3-pyridin-3-yl-n-[4-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazin-1-yl]butyl]prop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3CCC2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 COMRSYCVLKBODY-UHFFFAOYSA-N 0.000 claims description 2
- PZYHBBYPOVMRAY-UHFFFAOYSA-N 3-pyridin-3-yl-n-[4-[4-(5,6,7,8-tetrahydronaphthalen-1-yl)piperazin-1-yl]butyl]prop-2-enamide Chemical compound C1CN(C=2C=3CCCCC=3C=CC=2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 PZYHBBYPOVMRAY-UHFFFAOYSA-N 0.000 claims description 2
- ABZAKAHITMFTMC-UHFFFAOYSA-N 3-pyridin-3-yl-n-[4-[4-(5h-thieno[2,3-c][2]benzothiepin-10-ylidene)piperidin-1-yl]butyl]propanamide Chemical compound C1CC(=C2C3=CC=CC=C3CSC=3SC=CC=32)CCN1CCCCNC(=O)CCC1=CC=CN=C1 ABZAKAHITMFTMC-UHFFFAOYSA-N 0.000 claims description 2
- RUOPWDVFAXCKCF-UHFFFAOYSA-N 4-[4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperazine-1-carbonyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(=O)N1CCN(CCCCNC(=O)C=CC=2C=NC=CC=2)CC1 RUOPWDVFAXCKCF-UHFFFAOYSA-N 0.000 claims description 2
- LMSDNEUOCUNNFM-UHFFFAOYSA-N 4-[phenyl-[4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperazin-1-yl]methyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=1C=CC=CC=1)N1CCN(CCCCNC(=O)C=CC=2C=NC=CC=2)CC1 LMSDNEUOCUNNFM-UHFFFAOYSA-N 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- HEBKCHPVOIAQTA-QWWZWVQMSA-N D-arabinitol Chemical compound OC[C@@H](O)C(O)[C@H](O)CO HEBKCHPVOIAQTA-QWWZWVQMSA-N 0.000 claims description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims description 2
- 239000004386 Erythritol Substances 0.000 claims description 2
- UNXHWFMMPAWVPI-UHFFFAOYSA-N Erythritol Natural products OCC(O)C(O)CO UNXHWFMMPAWVPI-UHFFFAOYSA-N 0.000 claims description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 2
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 claims description 2
- 235000010654 Melissa officinalis Nutrition 0.000 claims description 2
- KPBNHDGDUADAGP-UHFFFAOYSA-N N-[4-(1-benzoyl-4-piperidinyl)butyl]-3-(3-pyridinyl)-2-propenamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(=O)C1=CC=CC=C1 KPBNHDGDUADAGP-UHFFFAOYSA-N 0.000 claims description 2
- DWVHXGDHRMZZJF-UHFFFAOYSA-N N-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]but-2-ynyl]-3-pyridin-3-ylprop-2-enamide Chemical compound FC1=CC=C(C=C1)C(N1CCN(CC1)CC#CCNC(C=CC=1C=NC=CC=1)=O)C1=CC=C(C=C1)F DWVHXGDHRMZZJF-UHFFFAOYSA-N 0.000 claims description 2
- 150000007945 N-acyl ureas Chemical class 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 150000001414 amino alcohols Chemical class 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 2
- 125000005605 benzo group Chemical group 0.000 claims description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 claims description 2
- UNXHWFMMPAWVPI-ZXZARUISSA-N erythritol Chemical compound OC[C@H](O)[C@H](O)CO UNXHWFMMPAWVPI-ZXZARUISSA-N 0.000 claims description 2
- 229940009714 erythritol Drugs 0.000 claims description 2
- 235000019414 erythritol Nutrition 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 2
- 229960000367 inositol Drugs 0.000 claims description 2
- 239000000865 liniment Substances 0.000 claims description 2
- 239000008297 liquid dosage form Substances 0.000 claims description 2
- 230000009149 molecular binding Effects 0.000 claims description 2
- GJRBOOBAXCGJQY-UHFFFAOYSA-N n,n-diphenyl-4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperazine-1-carboxamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCN1C(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 GJRBOOBAXCGJQY-UHFFFAOYSA-N 0.000 claims description 2
- YJWWURSTYVHABB-UHFFFAOYSA-N n,n-diphenyl-4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperidine-1-carboxamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 YJWWURSTYVHABB-UHFFFAOYSA-N 0.000 claims description 2
- OGGFXHDVOKWRKH-UHFFFAOYSA-N n,n-diphenyl-4-[4-(3-pyridin-3-ylpropanoylamino)butyl]piperidine-1-carboxamide Chemical compound C1CN(C(=O)N(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 OGGFXHDVOKWRKH-UHFFFAOYSA-N 0.000 claims description 2
- RNNHYVMCUYBBON-UHFFFAOYSA-N n-(5-hydroxy-5,5-diphenylpentyl)-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)CCCCNC(=O)C=CC1=CC=CN=C1 RNNHYVMCUYBBON-UHFFFAOYSA-N 0.000 claims description 2
- MTEODOUTYLLFBH-UHFFFAOYSA-N n-(6,6-diphenylhex-5-enyl)-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC=C(C=1C=CC=CC=1)C1=CC=CC=C1 MTEODOUTYLLFBH-UHFFFAOYSA-N 0.000 claims description 2
- ZWWWTBANWKCOIK-UHFFFAOYSA-N n-(6-hydroxy-6,6-diphenylhexyl)-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)CCCCCNC(=O)C=CC1=CC=CN=C1 ZWWWTBANWKCOIK-UHFFFAOYSA-N 0.000 claims description 2
- MOFCWYINYVYDCX-UHFFFAOYSA-N n-(7-phenylheptyl)-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCCC1=CC=CC=C1 MOFCWYINYVYDCX-UHFFFAOYSA-N 0.000 claims description 2
- GRTOVVRWHCOGMJ-UHFFFAOYSA-N n-(8,8-diphenyloctyl)-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCCC(C=1C=CC=CC=1)C1=CC=CC=C1 GRTOVVRWHCOGMJ-UHFFFAOYSA-N 0.000 claims description 2
- PDYNDWDUJZXGFI-UHFFFAOYSA-N n-(8-hydroxy-8,8-diphenyloctyl)-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)CCCCCCCNC(=O)C=CC1=CC=CN=C1 PDYNDWDUJZXGFI-UHFFFAOYSA-N 0.000 claims description 2
- HYMGIVPAGRJMPL-UHFFFAOYSA-N n-[2-(1-benzhydrylpiperidin-4-yl)ethyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 HYMGIVPAGRJMPL-UHFFFAOYSA-N 0.000 claims description 2
- QEZKOYHOZVNHFW-UHFFFAOYSA-N n-[2-(1-benzhydrylpiperidin-4-yl)ethyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCNC(=O)CCC1=CC=CN=C1 QEZKOYHOZVNHFW-UHFFFAOYSA-N 0.000 claims description 2
- ZFFDSAVEVVISAQ-UHFFFAOYSA-N n-[2-(1-benzhydrylpiperidin-4-yl)ethyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 ZFFDSAVEVVISAQ-UHFFFAOYSA-N 0.000 claims description 2
- QMGOUVLXSSUFFY-UHFFFAOYSA-N n-[2-(1-benzhydrylpiperidin-4-yl)ethyl]-5-pyridin-3-ylpentanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCNC(=O)CCCCC1=CC=CN=C1 QMGOUVLXSSUFFY-UHFFFAOYSA-N 0.000 claims description 2
- JONFDAKGRPQNDE-UHFFFAOYSA-N n-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1CCNC(=O)CCC1=CC=CN=C1 JONFDAKGRPQNDE-UHFFFAOYSA-N 0.000 claims description 2
- VSVJUHOKUBMZNB-UHFFFAOYSA-N n-[2-[1-(4-hydroxy-4-phenylbutyl)piperidin-4-yl]ethyl]-3-pyridin-3-ylpropanamide Chemical compound C=1C=CC=CC=1C(O)CCCN(CC1)CCC1CCNC(=O)CCC1=CC=CN=C1 VSVJUHOKUBMZNB-UHFFFAOYSA-N 0.000 claims description 2
- VYOWHSVUJZPJEH-UHFFFAOYSA-N n-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCOCCN(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 VYOWHSVUJZPJEH-UHFFFAOYSA-N 0.000 claims description 2
- VWUIDGCQCZSOTI-UHFFFAOYSA-N n-[2-[4-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)piperazin-1-yl]ethyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3SCC3=CC=CC=C32)CCN1CCNC(=O)C=CC1=CC=CN=C1 VWUIDGCQCZSOTI-UHFFFAOYSA-N 0.000 claims description 2
- BDSDISAAJZRDQB-UHFFFAOYSA-N n-[3-(1-benzhydrylpiperidin-4-yl)oxypropyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCOC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 BDSDISAAJZRDQB-UHFFFAOYSA-N 0.000 claims description 2
- WTQKSVWKIWLPLF-UHFFFAOYSA-N n-[3-(1-benzhydrylpiperidin-4-yl)propyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 WTQKSVWKIWLPLF-UHFFFAOYSA-N 0.000 claims description 2
- MAWXEKQEHAPAHF-UHFFFAOYSA-N n-[3-(1-benzhydrylpiperidin-4-yl)propyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCNC(=O)CCC1=CC=CN=C1 MAWXEKQEHAPAHF-UHFFFAOYSA-N 0.000 claims description 2
- VSVRCYXABIWTGN-UHFFFAOYSA-N n-[3-(1-benzylpiperidin-4-yl)oxypropyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCOC(CC1)CCN1CC1=CC=CC=C1 VSVRCYXABIWTGN-UHFFFAOYSA-N 0.000 claims description 2
- JJYQDFQPXQTTHI-UHFFFAOYSA-N n-[3-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)propyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCN(C1=O)C(=O)C(C=2C=CC=CC=2)=C1C1=CC=CC=C1 JJYQDFQPXQTTHI-UHFFFAOYSA-N 0.000 claims description 2
- ZRQFPVUHZSYAPT-UHFFFAOYSA-N n-[3-(4-benzhydrylpiperazin-1-yl)propoxy]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NOCCCN(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 ZRQFPVUHZSYAPT-UHFFFAOYSA-N 0.000 claims description 2
- OPMSUJVKFJTEBW-UHFFFAOYSA-N n-[3-(4-benzhydrylpiperazin-1-yl)sulfonylpropyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCS(=O)(=O)N(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 OPMSUJVKFJTEBW-UHFFFAOYSA-N 0.000 claims description 2
- SPNQFYDQDOPYQR-UHFFFAOYSA-N n-[4-(1,3-dihydrobenzo[de]isoquinolin-2-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1C(C=23)=CC=CC3=CC=CC=2CN1CCCCNC(=O)C=CC1=CC=CN=C1 SPNQFYDQDOPYQR-UHFFFAOYSA-N 0.000 claims description 2
- YQQZGQFSZHKNGN-UHFFFAOYSA-N n-[4-(1,3-dioxo-4,5,6,7-tetraphenylisoindol-2-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C1=O)C(=O)C(C(=C(C=2C=CC=CC=2)C=2C=3C=CC=CC=3)C=3C=CC=CC=3)=C1C=2C1=CC=CC=C1 YQQZGQFSZHKNGN-UHFFFAOYSA-N 0.000 claims description 2
- SHAODPHIADZBPK-UHFFFAOYSA-N n-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butyl]-3-(1-oxidopyridin-1-ium-3-yl)prop-2-enamide Chemical compound [O-][N+]1=CC=CC(C=CC(=O)NCCCCN2C(C=3C=CC=C4C=CC=C(C=34)C2=O)=O)=C1 SHAODPHIADZBPK-UHFFFAOYSA-N 0.000 claims description 2
- ODYYZJLSWWQTJI-UHFFFAOYSA-N n-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound O=C1C2=CC=CC=C2C(=O)N1CCCCNC(=O)C=CC1=CC=CN=C1 ODYYZJLSWWQTJI-UHFFFAOYSA-N 0.000 claims description 2
- DLXWMXVHNNIOFN-UHFFFAOYSA-N n-[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCC21OCCO2 DLXWMXVHNNIOFN-UHFFFAOYSA-N 0.000 claims description 2
- RIYGFDAGQVEUIR-UHFFFAOYSA-N n-[4-(1-acetylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C(=O)C)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 RIYGFDAGQVEUIR-UHFFFAOYSA-N 0.000 claims description 2
- RYJCJRWFCNMLEK-UHFFFAOYSA-N n-[4-(1-acetylpiperidin-4-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(=O)C)CCC1CCCCNC(=O)CCC1=CC=CN=C1 RYJCJRWFCNMLEK-UHFFFAOYSA-N 0.000 claims description 2
- UEDCOZIIIZHTBF-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-2,2-difluoro-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)C(F)(F)CC1=CC=CN=C1 UEDCOZIIIZHTBF-UHFFFAOYSA-N 0.000 claims description 2
- RNPODAPCSOZJFN-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-2-fluoro-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)C(F)CC1=CC=CN=C1 RNPODAPCSOZJFN-UHFFFAOYSA-N 0.000 claims description 2
- VZNZAFAWOOBEDA-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-(2-fluoropyridin-3-yl)prop-2-enamide Chemical compound FC1=NC=CC=C1C=CC(=O)NCCCCC1CCN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 VZNZAFAWOOBEDA-UHFFFAOYSA-N 0.000 claims description 2
- BWKQOBUKMSAJFJ-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-(2-fluoropyridin-3-yl)propanamide Chemical compound FC1=NC=CC=C1CCC(=O)NCCCCC1CCN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 BWKQOBUKMSAJFJ-UHFFFAOYSA-N 0.000 claims description 2
- PONFDXRJIHDZOO-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-(5-fluoropyridin-3-yl)propanamide Chemical compound FC1=CN=CC(CCC(=O)NCCCCC2CCN(CC2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 PONFDXRJIHDZOO-UHFFFAOYSA-N 0.000 claims description 2
- DNWDLXKLFYIPTI-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-(6-fluoropyridin-3-yl)prop-2-enamide Chemical compound C1=NC(F)=CC=C1C=CC(=O)NCCCCC1CCN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 DNWDLXKLFYIPTI-UHFFFAOYSA-N 0.000 claims description 2
- MZOONQPLVCLTSY-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-hydroxy-3-pyridin-3-ylpropanamide Chemical compound C=1C=CN=CC=1C(O)CC(=O)NCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 MZOONQPLVCLTSY-UHFFFAOYSA-N 0.000 claims description 2
- YFGVUBJQEGVJPM-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-5-pyridin-3-ylpentanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)CCCCC1=CC=CN=C1 YFGVUBJQEGVJPM-UHFFFAOYSA-N 0.000 claims description 2
- VUNZJPKXYIQXGB-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-n-hydroxy-3-pyridin-3-ylpropanamide Chemical compound C=1C=CN=CC=1CCC(=O)N(O)CCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 VUNZJPKXYIQXGB-UHFFFAOYSA-N 0.000 claims description 2
- UKQGSFUTDYQJST-UHFFFAOYSA-N n-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(=O)C=2C=CC=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 UKQGSFUTDYQJST-UHFFFAOYSA-N 0.000 claims description 2
- BMAOVQOVHZRCHM-UHFFFAOYSA-N n-[4-(1-benzoylpiperidin-4-yl)butyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCCCC(CC1)CCN1C(=O)C1=CC=CC=C1 BMAOVQOVHZRCHM-UHFFFAOYSA-N 0.000 claims description 2
- YKRYVWYPIDCPCO-UHFFFAOYSA-N n-[4-(1-benzylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1CC1=CC=CC=C1 YKRYVWYPIDCPCO-UHFFFAOYSA-N 0.000 claims description 2
- OZDDODZSMNLZCZ-UHFFFAOYSA-N n-[4-(1-methylsulfonylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(S(=O)(=O)C)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 OZDDODZSMNLZCZ-UHFFFAOYSA-N 0.000 claims description 2
- DYYHFYBKYBNXCK-UHFFFAOYSA-N n-[4-(1-methylsulfonylpiperidin-4-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(S(=O)(=O)C)CCC1CCCCNC(=O)CCC1=CC=CN=C1 DYYHFYBKYBNXCK-UHFFFAOYSA-N 0.000 claims description 2
- ZJLVRSLKSLHYMZ-UHFFFAOYSA-N n-[4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 ZJLVRSLKSLHYMZ-UHFFFAOYSA-N 0.000 claims description 2
- PKCWQXXZTIHLOF-UHFFFAOYSA-N n-[4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 PKCWQXXZTIHLOF-UHFFFAOYSA-N 0.000 claims description 2
- WJXXCPFHNISDFK-UHFFFAOYSA-N n-[4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C1CN(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CCC1CCCCNC(=O)C=CC=CC1=CC=CN=C1 WJXXCPFHNISDFK-UHFFFAOYSA-N 0.000 claims description 2
- UXVGFBLSUTZGTR-UHFFFAOYSA-N n-[4-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C1=O)C(=O)C(C=2C=CC=CC=2)=C1C1=CC=CC=C1 UXVGFBLSUTZGTR-UHFFFAOYSA-N 0.000 claims description 2
- WPVUZWIIHHGWPX-UHFFFAOYSA-N n-[4-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound O=C1C(C=2C=CC=CC=2)=C(C=2C=CC=CC=2)C(=O)N1CCCCNC(=O)CCC1=CC=CN=C1 WPVUZWIIHHGWPX-UHFFFAOYSA-N 0.000 claims description 2
- DTQSPKBITNPUGD-UHFFFAOYSA-N n-[4-(2,5-dioxo-3-phenylpyrrol-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C1=O)C(=O)C=C1C1=CC=CC=C1 DTQSPKBITNPUGD-UHFFFAOYSA-N 0.000 claims description 2
- ICEPIXBJALVIJL-UHFFFAOYSA-N n-[4-(2,6-dioxo-4-phenylpiperidin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C(C1)=O)C(=O)CC1C1=CC=CC=C1 ICEPIXBJALVIJL-UHFFFAOYSA-N 0.000 claims description 2
- BBLHUAQGJZGSFA-UHFFFAOYSA-N n-[4-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C(C1=O)=O)C(=O)N1CC1=CC=CC=C1 BBLHUAQGJZGSFA-UHFFFAOYSA-N 0.000 claims description 2
- LYRLTNWCNOCAJL-UHFFFAOYSA-N n-[4-(4,4-diphenylpiperidin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCC1(C=1C=CC=CC=1)C1=CC=CC=C1 LYRLTNWCNOCAJL-UHFFFAOYSA-N 0.000 claims description 2
- LZTVTAVDPINMKT-UHFFFAOYSA-N n-[4-(4,5-diphenylimidazol-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN1C=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 LZTVTAVDPINMKT-UHFFFAOYSA-N 0.000 claims description 2
- BPEHUHLANPRGPA-UHFFFAOYSA-N n-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCC(=O)N(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 BPEHUHLANPRGPA-UHFFFAOYSA-N 0.000 claims description 2
- PUSSBYQCSZCMTI-UHFFFAOYSA-N n-[4-(4-benzoylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCN1C(=O)C1=CC=CC=C1 PUSSBYQCSZCMTI-UHFFFAOYSA-N 0.000 claims description 2
- WYJPOJTUEYSIBC-UHFFFAOYSA-N n-[4-(4-benzyl-2,6-dioxopiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C(C1)=O)C(=O)CN1CC1=CC=CC=C1 WYJPOJTUEYSIBC-UHFFFAOYSA-N 0.000 claims description 2
- BLOSBAHOXPFMPY-UHFFFAOYSA-N n-[4-(4-naphthalen-1-ylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C=2C3=CC=CC=C3C=CC=2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 BLOSBAHOXPFMPY-UHFFFAOYSA-N 0.000 claims description 2
- OOABQFDYKHFVHE-UHFFFAOYSA-N n-[4-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 OOABQFDYKHFVHE-UHFFFAOYSA-N 0.000 claims description 2
- WLEYHBYZDMODIE-UHFFFAOYSA-N n-[4-(5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C1)CCC2=CC=CC=C2C1C1=CC=CC=C1 WLEYHBYZDMODIE-UHFFFAOYSA-N 0.000 claims description 2
- MKGHYFIGFZECCM-UHFFFAOYSA-N n-[4-(benzhydrylamino)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCNC(C=1C=CC=CC=1)C1=CC=CC=C1 MKGHYFIGFZECCM-UHFFFAOYSA-N 0.000 claims description 2
- XKMCMLDWHXFBMX-UHFFFAOYSA-N n-[4-(diphenylcarbamoylamino)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCNC(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 XKMCMLDWHXFBMX-UHFFFAOYSA-N 0.000 claims description 2
- PQJHAVGHPXLTQD-UHFFFAOYSA-N n-[4-[1-(2,2-diphenylacetyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(=O)C(C=1C=CC=CC=1)C1=CC=CC=C1 PQJHAVGHPXLTQD-UHFFFAOYSA-N 0.000 claims description 2
- NNAUZAULZZIIQV-UHFFFAOYSA-N n-[4-[1-(2,2-diphenylacetyl)piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(=O)C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 NNAUZAULZZIIQV-UHFFFAOYSA-N 0.000 claims description 2
- VQTNGKYWKKGWHX-UHFFFAOYSA-N n-[4-[1-(2-phenylethyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1CCC1=CC=CC=C1 VQTNGKYWKKGWHX-UHFFFAOYSA-N 0.000 claims description 2
- MJQLINBABSBHBM-UHFFFAOYSA-N n-[4-[1-(5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(=O)N2C3=CC=CC=C3CCC3=CC=CC=C32)CCC1CCCCNC(=O)CCC1=CC=CN=C1 MJQLINBABSBHBM-UHFFFAOYSA-N 0.000 claims description 2
- OSTHEGPTOJALEX-UHFFFAOYSA-N n-[4-[1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3SCC3=CC=CC=C32)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 OSTHEGPTOJALEX-UHFFFAOYSA-N 0.000 claims description 2
- BYKSXKZTLDOGMU-UHFFFAOYSA-N n-[4-[1-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3OCC3=CC=CC=C32)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 BYKSXKZTLDOGMU-UHFFFAOYSA-N 0.000 claims description 2
- GKXXUJSRUOLYGP-UHFFFAOYSA-N n-[4-[1-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C2C3=CC=CC=C3OCC3=CC=CC=C32)CCC1CCCCNC(=O)CCC1=CC=CN=C1 GKXXUJSRUOLYGP-UHFFFAOYSA-N 0.000 claims description 2
- MCPKZKMWSMGDED-UHFFFAOYSA-N n-[4-[1-(9h-fluoren-9-yl)piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C2C3=CC=CC=C3C3=CC=CC=C32)CCC1CCCCNC(=O)CCC1=CC=CN=C1 MCPKZKMWSMGDED-UHFFFAOYSA-N 0.000 claims description 2
- YOOZOSOJTWMFFU-UHFFFAOYSA-N n-[4-[1-(naphthalen-1-ylmethyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(CC=2C3=CC=CC=C3C=CC=2)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 YOOZOSOJTWMFFU-UHFFFAOYSA-N 0.000 claims description 2
- HWYZLFOZABWCJC-UHFFFAOYSA-N n-[4-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1CC(C=C1)=CC=C1C1=CC=CC=C1 HWYZLFOZABWCJC-UHFFFAOYSA-N 0.000 claims description 2
- IYCFQLMGHFHPSX-UHFFFAOYSA-N n-[4-[1-[bis(2-chlorophenyl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound ClC1=CC=CC=C1C(C=1C(=CC=CC=1)Cl)N1CCC(CCCCNC(=O)C=CC=2C=NC=CC=2)CC1 IYCFQLMGHFHPSX-UHFFFAOYSA-N 0.000 claims description 2
- LKIYRSZDWUUMHO-UHFFFAOYSA-N n-[4-[1-[bis(2-chlorophenyl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound ClC1=CC=CC=C1C(C=1C(=CC=CC=1)Cl)N1CCC(CCCCNC(=O)CCC=2C=NC=CC=2)CC1 LKIYRSZDWUUMHO-UHFFFAOYSA-N 0.000 claims description 2
- DQZSBXQOCDVKPE-UHFFFAOYSA-N n-[4-[1-[bis(4-fluorophenyl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)N1CCC(CCCCNC(=O)C=CC=2C=NC=CC=2)CC1 DQZSBXQOCDVKPE-UHFFFAOYSA-N 0.000 claims description 2
- BBNYHCSTHZADET-UHFFFAOYSA-N n-[4-[1-[cyclohexyl(phenyl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1CCCCC1 BBNYHCSTHZADET-UHFFFAOYSA-N 0.000 claims description 2
- FZNILRKAJRZKLG-UHFFFAOYSA-N n-[4-[1-[phenyl(pyridin-3-yl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=NC=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 FZNILRKAJRZKLG-UHFFFAOYSA-N 0.000 claims description 2
- RTGGVVSUNFQQGC-UHFFFAOYSA-N n-[4-[1-[phenyl(pyridin-4-yl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(C=1C=CN=CC=1)C1=CC=CC=C1 RTGGVVSUNFQQGC-UHFFFAOYSA-N 0.000 claims description 2
- NGBNRCCMTHHKSH-UHFFFAOYSA-N n-[4-[4-(1h-indol-3-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CC(C=2C3=CC=CC=C3NC=2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 NGBNRCCMTHHKSH-UHFFFAOYSA-N 0.000 claims description 2
- DFDWGAJVQZUYCS-UHFFFAOYSA-N n-[4-[4-(2,2-diphenylacetyl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCN1C(=O)C(C=1C=CC=CC=1)C1=CC=CC=C1 DFDWGAJVQZUYCS-UHFFFAOYSA-N 0.000 claims description 2
- VFDMQKPNEYXGKM-UHFFFAOYSA-N n-[4-[4-(2-aminobenzoyl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound NC1=CC=CC=C1C(=O)N1CCN(CCCCNC(=O)C=CC=2C=NC=CC=2)CC1 VFDMQKPNEYXGKM-UHFFFAOYSA-N 0.000 claims description 2
- ZHLUQUDTCYTYJA-UHFFFAOYSA-N n-[4-[4-(2-oxo-3h-benzimidazol-1-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CC(N2C(NC3=CC=CC=C32)=O)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 ZHLUQUDTCYTYJA-UHFFFAOYSA-N 0.000 claims description 2
- HXDTVDXODIWBQJ-UHFFFAOYSA-N n-[4-[4-(2-phenylbenzoyl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCN1C(=O)C1=CC=CC=C1C1=CC=CC=C1 HXDTVDXODIWBQJ-UHFFFAOYSA-N 0.000 claims description 2
- JWCCGNPZMJOHJI-UHFFFAOYSA-N n-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-2-pyridin-3-yloxyacetamide Chemical compound C1CN(C=2C(=CC=CC=2)C=2C=CC=CC=2)CCN1CCCCNC(=O)COC1=CC=CN=C1 JWCCGNPZMJOHJI-UHFFFAOYSA-N 0.000 claims description 2
- UKZKBHKWOLQCEJ-UHFFFAOYSA-N n-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C=2C(=CC=CC=2)C=2C=CC=CC=2)CCN1CCCCNC(=O)CCC1=CC=CN=C1 UKZKBHKWOLQCEJ-UHFFFAOYSA-N 0.000 claims description 2
- ALCHSXXBPJKGIR-UHFFFAOYSA-N n-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCCCN(CC1)CCN1C1=CC=CC=C1C1=CC=CC=C1 ALCHSXXBPJKGIR-UHFFFAOYSA-N 0.000 claims description 2
- PAWUMBNDXBALGO-UHFFFAOYSA-N n-[4-[4-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C2C3=CC=CC=C3CCC3=CC=CC=C32)CCN1CCCCNC(=O)CCC1=CC=CN=C1 PAWUMBNDXBALGO-UHFFFAOYSA-N 0.000 claims description 2
- KYIWUGOKVJFIQC-UHFFFAOYSA-N n-[4-[4-(6h-benzo[c][1]benzothiepin-11-ylidene)piperidin-1-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CC(=C2C3=CC=CC=C3SCC3=CC=CC=C32)CCN1CCCCNC(=O)CCC1=CC=CN=C1 KYIWUGOKVJFIQC-UHFFFAOYSA-N 0.000 claims description 2
- GHNYHFGMOINDRA-UHFFFAOYSA-N n-[4-[4-(6h-benzo[c][1]benzothiepin-11-ylidene)piperidin-1-yl]butyl]-5-pyridin-3-ylpentanamide Chemical compound C1CC(=C2C3=CC=CC=C3SCC3=CC=CC=C32)CCN1CCCCNC(=O)CCCCC1=CC=CN=C1 GHNYHFGMOINDRA-UHFFFAOYSA-N 0.000 claims description 2
- XHYZWVLPROZKQN-UHFFFAOYSA-N n-[4-[4-(9-oxofluorene-4-carbonyl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C(=O)C=2C=3C4=CC=CC=C4C(=O)C=3C=CC=2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 XHYZWVLPROZKQN-UHFFFAOYSA-N 0.000 claims description 2
- IDOPKYFPTSRLMS-UHFFFAOYSA-N n-[4-[4-(9h-fluoren-9-yl)piperazin-1-yl]butyl]-2-pyridin-3-yloxyacetamide Chemical compound C1CN(C2C3=CC=CC=C3C3=CC=CC=C32)CCN1CCCCNC(=O)COC1=CC=CN=C1 IDOPKYFPTSRLMS-UHFFFAOYSA-N 0.000 claims description 2
- JXJTZTBPTUIBQF-UHFFFAOYSA-N n-[4-[4-(benzotriazol-1-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CC(N2C3=CC=CC=C3N=N2)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 JXJTZTBPTUIBQF-UHFFFAOYSA-N 0.000 claims description 2
- DXIRALBVLZPMSQ-UHFFFAOYSA-N n-[4-[4-(furan-2-carbonyl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCN1C(=O)C1=CC=CO1 DXIRALBVLZPMSQ-UHFFFAOYSA-N 0.000 claims description 2
- GQFMOSGSXLGHTK-UHFFFAOYSA-N n-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]-2-pyridin-3-yloxyacetamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C(CC1)CCN1CCCCNC(=O)COC1=CC=CN=C1 GQFMOSGSXLGHTK-UHFFFAOYSA-N 0.000 claims description 2
- HEEAWDWOOFRISF-UHFFFAOYSA-N n-[5-(1-benzhydrylpiperidin-4-yl)pentyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 HEEAWDWOOFRISF-UHFFFAOYSA-N 0.000 claims description 2
- RTOVZAWTXPBIEP-UHFFFAOYSA-N n-[5-(1-benzhydrylpiperidin-4-yl)pentyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 RTOVZAWTXPBIEP-UHFFFAOYSA-N 0.000 claims description 2
- HOWWNDCNPJNBIH-UHFFFAOYSA-N n-[5-[4-(2-phenylphenyl)piperazin-1-yl]pentyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCN(CC1)CCN1C1=CC=CC=C1C1=CC=CC=C1 HOWWNDCNPJNBIH-UHFFFAOYSA-N 0.000 claims description 2
- QEPNKFLQCNKHEM-UHFFFAOYSA-N n-[5-[4-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)piperazin-1-yl]pentyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3CCC3=CC=CC=C32)CCN1CCCCCNC(=O)C=CC1=CC=CN=C1 QEPNKFLQCNKHEM-UHFFFAOYSA-N 0.000 claims description 2
- APQDKPOIOQNUBU-UHFFFAOYSA-N n-[5-[4-(9h-fluoren-9-yl)piperazin-1-yl]pentyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3C3=CC=CC=C32)CCN1CCCCCNC(=O)C=CC1=CC=CN=C1 APQDKPOIOQNUBU-UHFFFAOYSA-N 0.000 claims description 2
- GGWHHTKGUWLHMJ-UHFFFAOYSA-N n-[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound O=C1C(C=23)=CC=CC3=CC=CC=2C(=O)N1CCCCCCNC(=O)C=CC1=CC=CN=C1 GGWHHTKGUWLHMJ-UHFFFAOYSA-N 0.000 claims description 2
- NRRZYDHYTJKIQN-UHFFFAOYSA-N n-[6-(1-benzhydrylpiperidin-4-yl)hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 NRRZYDHYTJKIQN-UHFFFAOYSA-N 0.000 claims description 2
- KRFYUWHTBWCRHF-UHFFFAOYSA-N n-[6-(1-benzhydrylpiperidin-4-yl)hexyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCCCNC(=O)CCC1=CC=CN=C1 KRFYUWHTBWCRHF-UHFFFAOYSA-N 0.000 claims description 2
- AVZNELZWYQWZGG-UHFFFAOYSA-N n-[6-(1-benzhydrylpiperidin-4-yl)hexyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 AVZNELZWYQWZGG-UHFFFAOYSA-N 0.000 claims description 2
- UIPIMPOKZACJDM-UHFFFAOYSA-N n-[6-(3-pyridin-3-ylprop-2-enoylamino)hexyl]-5,6-dihydrobenzo[b][1]benzazepine-11-carboxamide Chemical compound C12=CC=CC=C2CCC2=CC=CC=C2N1C(=O)NCCCCCCNC(=O)C=CC1=CC=CN=C1 UIPIMPOKZACJDM-UHFFFAOYSA-N 0.000 claims description 2
- NFBPGGHYHZBRQB-UHFFFAOYSA-N n-[6-(diphenylcarbamoylamino)hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCNC(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 NFBPGGHYHZBRQB-UHFFFAOYSA-N 0.000 claims description 2
- ACDMLMLCTRRPFG-UHFFFAOYSA-N n-[6-[(4-methylphenyl)sulfonylamino]hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NCCCCCCNC(=O)C=CC1=CC=CN=C1 ACDMLMLCTRRPFG-UHFFFAOYSA-N 0.000 claims description 2
- PLZHREALXXJWTB-UHFFFAOYSA-N n-[6-[4-(2-phenylphenyl)piperazin-1-yl]hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCN(CC1)CCN1C1=CC=CC=C1C1=CC=CC=C1 PLZHREALXXJWTB-UHFFFAOYSA-N 0.000 claims description 2
- QSHOXQHLHHLYFP-UHFFFAOYSA-N n-[6-[4-(9h-fluoren-9-yl)piperazin-1-yl]hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3C3=CC=CC=C32)CCN1CCCCCCNC(=O)C=CC1=CC=CN=C1 QSHOXQHLHHLYFP-UHFFFAOYSA-N 0.000 claims description 2
- KYAMVWKIMUMBKN-UHFFFAOYSA-N n-[7-(1-benzhydrylpiperidin-4-yl)heptyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 KYAMVWKIMUMBKN-UHFFFAOYSA-N 0.000 claims description 2
- LHLISGADCPGLQW-UHFFFAOYSA-N n-naphthalen-1-yl-4-[4-(3-pyridin-3-ylprop-2-enoylamino)butyl]piperidine-1-carboxamide Chemical compound C1CN(C(=O)NC=2C3=CC=CC=C3C=CC=2)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 LHLISGADCPGLQW-UHFFFAOYSA-N 0.000 claims description 2
- OYDRJBWRCXGLQE-UHFFFAOYSA-N n-naphthalen-1-yl-4-[4-(3-pyridin-3-ylpropanoylamino)butyl]piperidine-1-carboxamide Chemical compound C1CN(C(=O)NC=2C3=CC=CC=C3C=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 OYDRJBWRCXGLQE-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004437 phosphorous atom Chemical group 0.000 claims description 2
- 125000003367 polycyclic group Chemical group 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 claims description 2
- 150000003568 thioethers Chemical class 0.000 claims description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims 2
- JPBGMJCVEVKVCB-UHFFFAOYSA-N 3-pyridin-3-yl-N-[4-(2,12,14-trioxo-13-azatetracyclo[7.5.1.01,11.05,15]pentadeca-3,5,9(15)-trien-13-yl)butyl]prop-2-enamide Chemical compound O=C1C2CC(CCC=3)=C4C=3C=CC(=O)C24C(=O)N1CCCCNC(=O)C=CC1=CC=CN=C1 JPBGMJCVEVKVCB-UHFFFAOYSA-N 0.000 claims 1
- 241000021559 Dicerandra Species 0.000 claims 1
- HNLTUCHZVXVEBA-UHFFFAOYSA-N N-[4-(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=12C3=CC=CC2=CC=CC=1S(=O)(=O)N3CCCCNC(=O)C=CC1=CC=CN=C1 HNLTUCHZVXVEBA-UHFFFAOYSA-N 0.000 claims 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims 1
- 229940124589 immunosuppressive drug Drugs 0.000 claims 1
- ROFQRYCTOBZTMD-UHFFFAOYSA-N n-[2-(1-benzylpiperidin-4-yl)ethyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(CC=2C=CC=CC=2)CCC1CCNC(=O)CCC1=CC=CN=C1 ROFQRYCTOBZTMD-UHFFFAOYSA-N 0.000 claims 1
- RSBSRWDEJMIRSW-UHFFFAOYSA-N n-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound O=C1C(C=23)=CC=CC3=CC=CC=2C(=O)N1CCCCNC(=O)C=CC1=CC=CN=C1 RSBSRWDEJMIRSW-UHFFFAOYSA-N 0.000 claims 1
- DBOZGEOLRIWRBI-UHFFFAOYSA-N n-[4-(1-benzylpiperidin-4-yl)butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(CC=2C=CC=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 DBOZGEOLRIWRBI-UHFFFAOYSA-N 0.000 claims 1
- ZFQHABVBZYMUHQ-UHFFFAOYSA-N n-[4-(4-benzhydrylpiperazin-1-yl)-3-hydroxybutyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCN1CC(O)CCNC(=O)C=CC1=CC=CN=C1 ZFQHABVBZYMUHQ-UHFFFAOYSA-N 0.000 claims 1
- CGAXTMRHPISBOD-UHFFFAOYSA-N n-[4-(4-diphenylphosphoryloxypiperidin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCC1OP(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 CGAXTMRHPISBOD-UHFFFAOYSA-N 0.000 claims 1
- UVKJVMWMNOUONH-UHFFFAOYSA-N n-[4-[1-(5,6-dihydrobenzo[b][1]benzazepine-11-carbonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C(=O)N2C3=CC=CC=C3CCC3=CC=CC=C32)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 UVKJVMWMNOUONH-UHFFFAOYSA-N 0.000 claims 1
- LPMPMENHCIFVAI-UHFFFAOYSA-N n-[4-[1-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3CCC3=CC=CC=C32)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 LPMPMENHCIFVAI-UHFFFAOYSA-N 0.000 claims 1
- HPSKWLIHYZHGJR-UHFFFAOYSA-N n-[4-[2-[benzhydryl(methyl)amino]ethyl-methylamino]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)N(C)CCN(C)CCCCNC(=O)C=CC1=CC=CN=C1 HPSKWLIHYZHGJR-UHFFFAOYSA-N 0.000 claims 1
- WPZIIEOXPLWRBK-UHFFFAOYSA-N n-[4-[4-(2-phenylphenyl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCN1C1=CC=CC=C1C1=CC=CC=C1 WPZIIEOXPLWRBK-UHFFFAOYSA-N 0.000 claims 1
- TUZOVDPUVJVOFJ-UHFFFAOYSA-N n-[4-[4-(9h-fluoren-9-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3C3=CC=CC=C32)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 TUZOVDPUVJVOFJ-UHFFFAOYSA-N 0.000 claims 1
- LVAMMJOZTZWEMR-UHFFFAOYSA-N n-[6-(2,5-dioxo-3,4-diphenylpyrrol-1-yl)hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCN(C1=O)C(=O)C(C=2C=CC=CC=2)=C1C1=CC=CC=C1 LVAMMJOZTZWEMR-UHFFFAOYSA-N 0.000 claims 1
- SDJUNKBOSALRFM-UHFFFAOYSA-N n-[8,8-bis(4-fluorophenyl)octyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCCCCCNC(=O)C=CC1=CC=CN=C1 SDJUNKBOSALRFM-UHFFFAOYSA-N 0.000 claims 1
- 239000011505 plaster Substances 0.000 claims 1
- 230000003449 preventive effect Effects 0.000 claims 1
- 229940080818 propionamide Drugs 0.000 claims 1
- 230000002110 toxicologic effect Effects 0.000 claims 1
- 231100000027 toxicology Toxicity 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 5
- 238000002560 therapeutic procedure Methods 0.000 abstract description 5
- 239000000654 additive Substances 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 3
- 150000005480 nicotinamides Chemical class 0.000 abstract 1
- PIGFYZPCRLYGLF-UHFFFAOYSA-N Aluminum nitride Chemical compound [Al]#N PIGFYZPCRLYGLF-UHFFFAOYSA-N 0.000 description 48
- 239000008188 pellet Substances 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 30
- 125000006413 ring segment Chemical group 0.000 description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 25
- 239000011664 nicotinic acid Substances 0.000 description 23
- 239000002552 dosage form Substances 0.000 description 22
- 235000001968 nicotinic acid Nutrition 0.000 description 22
- 206010028980 Neoplasm Diseases 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 210000004027 cell Anatomy 0.000 description 20
- 239000004615 ingredient Substances 0.000 description 19
- 238000000034 method Methods 0.000 description 19
- 125000001424 substituent group Chemical group 0.000 description 19
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 18
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 17
- 238000004519 manufacturing process Methods 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 239000011737 fluorine Substances 0.000 description 14
- 229910052731 fluorine Inorganic materials 0.000 description 14
- 239000007903 gelatin capsule Substances 0.000 description 14
- 125000001153 fluoro group Chemical group F* 0.000 description 13
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 12
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 12
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 12
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 12
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 12
- 239000008108 microcrystalline cellulose Substances 0.000 description 12
- 229940016286 microcrystalline cellulose Drugs 0.000 description 12
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 12
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 10
- 230000000259 anti-tumor effect Effects 0.000 description 10
- 229920000159 gelatin Polymers 0.000 description 10
- 235000019322 gelatine Nutrition 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- 239000003708 ampul Substances 0.000 description 9
- 235000014113 dietary fatty acids Nutrition 0.000 description 9
- 239000000194 fatty acid Substances 0.000 description 9
- 229930195729 fatty acid Natural products 0.000 description 9
- 239000008187 granular material Substances 0.000 description 9
- 239000002609 medium Substances 0.000 description 9
- 239000008215 water for injection Substances 0.000 description 9
- 108010010803 Gelatin Proteins 0.000 description 8
- 229920002125 Sokalan® Polymers 0.000 description 8
- 229920002472 Starch Polymers 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- 229910002091 carbon monoxide Inorganic materials 0.000 description 8
- 230000035622 drinking Effects 0.000 description 8
- 239000008273 gelatin Substances 0.000 description 8
- 235000011852 gelatine desserts Nutrition 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 239000003182 parenteral nutrition solution Substances 0.000 description 8
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 8
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 8
- 235000019698 starch Nutrition 0.000 description 8
- 239000000454 talc Substances 0.000 description 8
- 229910052623 talc Inorganic materials 0.000 description 8
- PZNPLUBHRSSFHT-RRHRGVEJSA-N 1-hexadecanoyl-2-octadecanoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCCCC(=O)O[C@@H](COP([O-])(=O)OCC[N+](C)(C)C)COC(=O)CCCCCCCCCCCCCCC PZNPLUBHRSSFHT-RRHRGVEJSA-N 0.000 description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 239000000499 gel Substances 0.000 description 7
- 150000003949 imides Chemical class 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- 239000008347 soybean phospholipid Substances 0.000 description 7
- 229940088594 vitamin Drugs 0.000 description 7
- 229930003231 vitamin Natural products 0.000 description 7
- 235000013343 vitamin Nutrition 0.000 description 7
- 239000011782 vitamin Substances 0.000 description 7
- 229920002261 Corn starch Polymers 0.000 description 6
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 6
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 6
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 6
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 6
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 6
- 239000002168 alkylating agent Substances 0.000 description 6
- 239000005557 antagonist Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 6
- 229920002678 cellulose Polymers 0.000 description 6
- 239000008120 corn starch Substances 0.000 description 6
- 239000006071 cream Substances 0.000 description 6
- 125000000753 cycloalkyl group Chemical group 0.000 description 6
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 235000019359 magnesium stearate Nutrition 0.000 description 6
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 6
- 229960000485 methotrexate Drugs 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 102100025573 1-alkyl-2-acetylglycerophosphocholine esterase Human genes 0.000 description 5
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 5
- 108010088751 Albumins Proteins 0.000 description 5
- 102000009027 Albumins Human genes 0.000 description 5
- 108010024976 Asparaginase Proteins 0.000 description 5
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 5
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 description 5
- 229930105110 Cyclosporin A Natural products 0.000 description 5
- 108010036949 Cyclosporine Proteins 0.000 description 5
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 5
- 108010092160 Dactinomycin Proteins 0.000 description 5
- 229920002307 Dextran Polymers 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- BAWFJGJZGIEFAR-NNYOXOHSSA-N NAD zwitterion Chemical class NC(=O)C1=CC=C[N+]([C@H]2[C@@H]([C@H](O)[C@@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 BAWFJGJZGIEFAR-NNYOXOHSSA-N 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 229920000776 Poly(Adenosine diphosphate-ribose) polymerase Polymers 0.000 description 5
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- 125000000304 alkynyl group Chemical group 0.000 description 5
- 229960002170 azathioprine Drugs 0.000 description 5
- LMEKQMALGUDUQG-UHFFFAOYSA-N azathioprine Chemical compound CN1C=NC([N+]([O-])=O)=C1SC1=NC=NC2=C1NC=N2 LMEKQMALGUDUQG-UHFFFAOYSA-N 0.000 description 5
- 235000010980 cellulose Nutrition 0.000 description 5
- 239000001913 cellulose Substances 0.000 description 5
- 229960001265 ciclosporin Drugs 0.000 description 5
- 229960004397 cyclophosphamide Drugs 0.000 description 5
- 229960000640 dactinomycin Drugs 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 5
- 229940088598 enzyme Drugs 0.000 description 5
- 239000003925 fat Substances 0.000 description 5
- 235000019197 fats Nutrition 0.000 description 5
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 5
- 229960002074 flutamide Drugs 0.000 description 5
- 235000011187 glycerol Nutrition 0.000 description 5
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 5
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 5
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 5
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical class OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 5
- 229940126601 medicinal product Drugs 0.000 description 5
- 150000007522 mineralic acids Chemical class 0.000 description 5
- 125000002757 morpholinyl group Chemical group 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 235000015097 nutrients Nutrition 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- 125000004076 pyridyl group Chemical group 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 5
- 229940099259 vaseline Drugs 0.000 description 5
- VXIMPSPISRVBPZ-YEQDYGLLSA-N (10r,13s,17r)-17-acetyl-17-hydroxy-6,10,13-trimethyl-2,8,9,11,12,14,15,16-octahydro-1h-cyclopenta[a]phenanthren-3-one Chemical compound C1=C(C)C2=CC(=O)CC[C@]2(C)C2C1C1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 VXIMPSPISRVBPZ-YEQDYGLLSA-N 0.000 description 4
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 4
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- 239000001856 Ethyl cellulose Substances 0.000 description 4
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 4
- 229920001214 Polysorbate 60 Polymers 0.000 description 4
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- ROBVIMPUHSLWNV-UHFFFAOYSA-N aminoglutethimide Chemical compound C=1C=C(N)C=CC=1C1(CC)CCC(=O)NC1=O ROBVIMPUHSLWNV-UHFFFAOYSA-N 0.000 description 4
- 229960003437 aminoglutethimide Drugs 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 235000019445 benzyl alcohol Nutrition 0.000 description 4
- 229960004217 benzyl alcohol Drugs 0.000 description 4
- 229920002988 biodegradable polymer Polymers 0.000 description 4
- 239000004621 biodegradable polymer Substances 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 229960001631 carbomer Drugs 0.000 description 4
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 description 4
- 230000000973 chemotherapeutic effect Effects 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 229930182912 cyclosporin Natural products 0.000 description 4
- 231100000433 cytotoxic Toxicity 0.000 description 4
- 230000001472 cytotoxic effect Effects 0.000 description 4
- NLORYLAYLIXTID-ISLYRVAYSA-N diethylstilbestrol diphosphate Chemical compound C=1C=C(OP(O)(O)=O)C=CC=1C(/CC)=C(\CC)C1=CC=C(OP(O)(O)=O)C=C1 NLORYLAYLIXTID-ISLYRVAYSA-N 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 235000019325 ethyl cellulose Nutrition 0.000 description 4
- 229920001249 ethyl cellulose Polymers 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 4
- 239000007888 film coating Substances 0.000 description 4
- 238000009501 film coating Methods 0.000 description 4
- 229960000297 fosfestrol Drugs 0.000 description 4
- CHPZKNULDCNCBW-UHFFFAOYSA-N gallium nitrate Chemical compound [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O CHPZKNULDCNCBW-UHFFFAOYSA-N 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 230000009422 growth inhibiting effect Effects 0.000 description 4
- 150000004677 hydrates Chemical class 0.000 description 4
- 230000001965 increasing effect Effects 0.000 description 4
- 239000002502 liposome Substances 0.000 description 4
- 210000004698 lymphocyte Anatomy 0.000 description 4
- LWYJUZBXGAFFLP-OCNCTQISSA-N menogaril Chemical compound O1[C@@]2(C)[C@H](O)[C@@H](N(C)C)[C@H](O)[C@@H]1OC1=C3C(=O)C(C=C4C[C@@](C)(O)C[C@H](C4=C4O)OC)=C4C(=O)C3=C(O)C=C12 LWYJUZBXGAFFLP-OCNCTQISSA-N 0.000 description 4
- 229950002676 menogaril Drugs 0.000 description 4
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 4
- 239000004005 microsphere Substances 0.000 description 4
- 229950006238 nadide Drugs 0.000 description 4
- 210000001331 nose Anatomy 0.000 description 4
- 235000005985 organic acids Nutrition 0.000 description 4
- 239000012188 paraffin wax Substances 0.000 description 4
- FPVKHBSQESCIEP-JQCXWYLXSA-N pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 4
- 229960002340 pentostatin Drugs 0.000 description 4
- 230000010412 perfusion Effects 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229920000747 poly(lactic acid) Polymers 0.000 description 4
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 4
- 229960004618 prednisone Drugs 0.000 description 4
- 229940071643 prefilled syringe Drugs 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- 230000000979 retarding effect Effects 0.000 description 4
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 4
- 229940081974 saccharin Drugs 0.000 description 4
- 235000019204 saccharin Nutrition 0.000 description 4
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 125000003003 spiro group Chemical group 0.000 description 4
- 239000008223 sterile water Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 230000008685 targeting Effects 0.000 description 4
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 3
- MVQVNTPHUGQQHK-UHFFFAOYSA-N 3-pyridinemethanol Chemical compound OCC1=CC=CN=C1 MVQVNTPHUGQQHK-UHFFFAOYSA-N 0.000 description 3
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 3
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 3
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 3
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 3
- BLCLNMBMMGCOAS-URPVMXJPSA-N Goserelin Chemical compound C([C@@H](C(=O)N[C@H](COC(C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NNC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 BLCLNMBMMGCOAS-URPVMXJPSA-N 0.000 description 3
- 108010069236 Goserelin Proteins 0.000 description 3
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical group C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KDCGOANMDULRCW-UHFFFAOYSA-N Purine Natural products N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 description 3
- 125000004450 alkenylene group Chemical group 0.000 description 3
- 230000002152 alkylating effect Effects 0.000 description 3
- 230000000340 anti-metabolite Effects 0.000 description 3
- 229940100197 antimetabolite Drugs 0.000 description 3
- 239000002256 antimetabolite Substances 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 235000006708 antioxidants Nutrition 0.000 description 3
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 3
- 229940050390 benzoate Drugs 0.000 description 3
- 229960004562 carboplatin Drugs 0.000 description 3
- 125000005019 carboxyalkenyl group Chemical group 0.000 description 3
- 125000004181 carboxyalkyl group Chemical group 0.000 description 3
- 229960005243 carmustine Drugs 0.000 description 3
- 230000001413 cellular effect Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 3
- 229960004316 cisplatin Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001860 citric acid derivatives Chemical class 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 210000001100 crypt cell Anatomy 0.000 description 3
- 229960000684 cytarabine Drugs 0.000 description 3
- 229960003901 dacarbazine Drugs 0.000 description 3
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 3
- 229960000975 daunorubicin Drugs 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 231100000517 death Toxicity 0.000 description 3
- RGLYKWWBQGJZGM-ISLYRVAYSA-N diethylstilbestrol Chemical compound C=1C=C(O)C=CC=1C(/CC)=C(\CC)C1=CC=C(O)C=C1 RGLYKWWBQGJZGM-ISLYRVAYSA-N 0.000 description 3
- 229960000452 diethylstilbestrol Drugs 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 231100000673 dose–response relationship Toxicity 0.000 description 3
- 229960004679 doxorubicin Drugs 0.000 description 3
- 239000006196 drop Substances 0.000 description 3
- 229940093470 ethylene Drugs 0.000 description 3
- 229960005420 etoposide Drugs 0.000 description 3
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 3
- 239000012894 fetal calf serum Substances 0.000 description 3
- 229960002949 fluorouracil Drugs 0.000 description 3
- 235000003599 food sweetener Nutrition 0.000 description 3
- 210000004051 gastric juice Anatomy 0.000 description 3
- 210000001035 gastrointestinal tract Anatomy 0.000 description 3
- 210000004392 genitalia Anatomy 0.000 description 3
- 239000003862 glucocorticoid Substances 0.000 description 3
- 229960002913 goserelin Drugs 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 150000003893 lactate salts Chemical class 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 3
- 229960001924 melphalan Drugs 0.000 description 3
- 229960001428 mercaptopurine Drugs 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 3
- 229960004857 mitomycin Drugs 0.000 description 3
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 3
- 229960001156 mitoxantrone Drugs 0.000 description 3
- 125000005146 naphthylsulfonyl group Chemical group C1(=CC=CC2=CC=CC=C12)S(=O)(=O)* 0.000 description 3
- 229940086322 navelbine Drugs 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 210000003800 pharynx Anatomy 0.000 description 3
- 150000003904 phospholipids Chemical class 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 239000004626 polylactic acid Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 229920000193 polymethacrylate Polymers 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 235000018102 proteins Nutrition 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 3
- 229940100486 rice starch Drugs 0.000 description 3
- 239000008279 sol Substances 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 238000007920 subcutaneous administration Methods 0.000 description 3
- 150000003890 succinate salts Chemical class 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 239000003765 sweetening agent Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 229940037128 systemic glucocorticoids Drugs 0.000 description 3
- 229960001603 tamoxifen Drugs 0.000 description 3
- 150000003892 tartrate salts Chemical class 0.000 description 3
- 229960001278 teniposide Drugs 0.000 description 3
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 3
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 3
- 125000005302 thiazolylmethyl group Chemical group [H]C1=C([H])N=C(S1)C([H])([H])* 0.000 description 3
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 3
- 229960001196 thiotepa Drugs 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 150000003626 triacylglycerols Chemical class 0.000 description 3
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 3
- 229960004528 vincristine Drugs 0.000 description 3
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 3
- CILBMBUYJCWATM-PYGJLNRPSA-N vinorelbine ditartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O.OC(=O)[C@H](O)[C@@H](O)C(O)=O.C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC CILBMBUYJCWATM-PYGJLNRPSA-N 0.000 description 3
- 150000003722 vitamin derivatives Chemical class 0.000 description 3
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 2
- ZZKNRXZVGOYGJT-VKHMYHEASA-N (2s)-2-[(2-phosphonoacetyl)amino]butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)NC(=O)CP(O)(O)=O ZZKNRXZVGOYGJT-VKHMYHEASA-N 0.000 description 2
- KMSKQZKKOZQFFG-YXRRJAAWSA-N (7S,9S)-7-[[(2R,4S,5S,6S)-4-amino-6-methyl-5-[[(2R)-2-oxanyl]oxy]-2-oxanyl]oxy]-6,9,11-trihydroxy-9-(2-hydroxy-1-oxoethyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical compound O([C@H]1[C@@H](N)C[C@@H](O[C@H]1C)O[C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@@H]1CCCCO1 KMSKQZKKOZQFFG-YXRRJAAWSA-N 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 2
- ZGNLFUXWZJGETL-YUSKDDKASA-N (Z)-[(2S)-2-amino-2-carboxyethyl]-hydroxyimino-oxidoazanium Chemical compound N[C@@H](C\[N+]([O-])=N\O)C(O)=O ZGNLFUXWZJGETL-YUSKDDKASA-N 0.000 description 2
- YFMFNYKEUDLDTL-UHFFFAOYSA-N 1,1,1,2,3,3,3-heptafluoropropane Chemical compound FC(F)(F)C(F)C(F)(F)F YFMFNYKEUDLDTL-UHFFFAOYSA-N 0.000 description 2
- ZTXDHEQQZVFGPK-UHFFFAOYSA-N 1,2,4-tris(oxiran-2-ylmethyl)-1,2,4-triazolidine-3,5-dione Chemical compound C1OC1CN1C(=O)N(CC2OC2)C(=O)N1CC1CO1 ZTXDHEQQZVFGPK-UHFFFAOYSA-N 0.000 description 2
- BFPYWIDHMRZLRN-UHFFFAOYSA-N 17alpha-ethynyl estradiol Natural products OC1=CC=C2C3CCC(C)(C(CC4)(O)C#C)C4C3CCC2=C1 BFPYWIDHMRZLRN-UHFFFAOYSA-N 0.000 description 2
- DBPWSSGDRRHUNT-CEGNMAFCSA-N 17α-hydroxyprogesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 DBPWSSGDRRHUNT-CEGNMAFCSA-N 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 2
- PBUUPFTVAPUWDE-UGZDLDLSSA-N 2-[[(2S,4S)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonic acid Chemical compound OS(=O)(=O)CCS[C@H]1CCO[P@](=O)(N(CCCl)CCCl)N1 PBUUPFTVAPUWDE-UGZDLDLSSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 2
- YIMDLWDNDGKDTJ-QLKYHASDSA-N 3'-deamino-3'-(3-cyanomorpholin-4-yl)doxorubicin Chemical compound N1([C@H]2C[C@@H](O[C@@H](C)[C@H]2O)O[C@H]2C[C@@](O)(CC=3C(O)=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(O)C=32)OC)C(=O)CO)CCOCC1C#N YIMDLWDNDGKDTJ-QLKYHASDSA-N 0.000 description 2
- PWMYMKOUNYTVQN-UHFFFAOYSA-N 3-(8,8-diethyl-2-aza-8-germaspiro[4.5]decan-2-yl)-n,n-dimethylpropan-1-amine Chemical compound C1C[Ge](CC)(CC)CCC11CN(CCCN(C)C)CC1 PWMYMKOUNYTVQN-UHFFFAOYSA-N 0.000 description 2
- QNKJFXARIMSDBR-UHFFFAOYSA-N 3-[2-[bis(2-chloroethyl)amino]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCN(CCCl)CCCl)C(=O)NC11CCCCC1 QNKJFXARIMSDBR-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 2
- UPALIKSFLSVKIS-UHFFFAOYSA-N 5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione Chemical compound NC1=CC(C(N(CCN(C)C)C2=O)=O)=C3C2=CC=CC3=C1 UPALIKSFLSVKIS-UHFFFAOYSA-N 0.000 description 2
- MMRCWWRFYLZGAE-ZBZRSYSASA-N 533u947v6q Chemical compound O([C@]12[C@H](OC(C)=O)[C@]3(CC)C=CCN4CC[C@@]5([C@H]34)[C@H]1N(C)C1=C5C=C(C(=C1)OC)[C@]1(C(=O)OC)C3=C(C4=CC=CC=C4N3)CCN3C[C@H](C1)C[C@@](C3)(O)CC)C(=O)N(CCCl)C2=O MMRCWWRFYLZGAE-ZBZRSYSASA-N 0.000 description 2
- VJXSSYDSOJBUAV-UHFFFAOYSA-N 6-(2,5-dimethoxy-benzyl)-5-methyl-pyrido[2,3-d]pyrimidine-2,4-diamine Chemical compound COC1=CC=C(OC)C(CC=2C(=C3C(N)=NC(N)=NC3=NC=2)C)=C1 VJXSSYDSOJBUAV-UHFFFAOYSA-N 0.000 description 2
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 description 2
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 2
- ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 2
- PITHJRRCEANNKJ-UHFFFAOYSA-N Aclacinomycin A Natural products C12=C(O)C=3C(=O)C4=CC=CC=C4C(=O)C=3C=C2C(C(=O)OC)C(CC)(O)CC1OC(OC1C)CC(N(C)C)C1OC(OC1C)CC(O)C1OC1CCC(=O)C(C)O1 PITHJRRCEANNKJ-UHFFFAOYSA-N 0.000 description 2
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 2
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- 108010006654 Bleomycin Proteins 0.000 description 2
- AUJXLBOHYWTPFV-BLWRDSOESA-N CS[C@H]1SC[C@H]2N(C)C(=O)[C@@H](C)NC(=O)[C@H](COC(=O)[C@@H](C(C)C)N(C)C(=O)[C@@H]1N(C)C(=O)[C@@H](C)NC(=O)[C@H](COC(=O)[C@@H](C(C)C)N(C)C2=O)NC(=O)c1cnc2ccccc2n1)NC(=O)c1cnc2ccccc2n1 Chemical compound CS[C@H]1SC[C@H]2N(C)C(=O)[C@@H](C)NC(=O)[C@H](COC(=O)[C@@H](C(C)C)N(C)C(=O)[C@@H]1N(C)C(=O)[C@@H](C)NC(=O)[C@H](COC(=O)[C@@H](C(C)C)N(C)C2=O)NC(=O)c1cnc2ccccc2n1)NC(=O)c1cnc2ccccc2n1 AUJXLBOHYWTPFV-BLWRDSOESA-N 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- JWBOIMRXGHLCPP-UHFFFAOYSA-N Chloditan Chemical compound C=1C=CC=C(Cl)C=1C(C(Cl)Cl)C1=CC=C(Cl)C=C1 JWBOIMRXGHLCPP-UHFFFAOYSA-N 0.000 description 2
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 2
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 2
- 108020004414 DNA Proteins 0.000 description 2
- 230000005778 DNA damage Effects 0.000 description 2
- 231100000277 DNA damage Toxicity 0.000 description 2
- KYHUYMLIVQFXRI-SJPGYWQQSA-N Didemnin B Chemical compound CN([C@H](CC(C)C)C(=O)N[C@@H]1C(=O)N[C@@H]([C@H](CC(=O)O[C@H](C(=O)[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=O)N(C)[C@@H](CC=2C=CC(OC)=CC=2)C(=O)O[C@@H]1C)C(C)C)O)[C@@H](C)CC)C(=O)[C@@H]1CCCN1C(=O)[C@H](C)O KYHUYMLIVQFXRI-SJPGYWQQSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 108010009858 Echinomycin Proteins 0.000 description 2
- 241000792859 Enema Species 0.000 description 2
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 2
- 229940102550 Estrogen receptor antagonist Drugs 0.000 description 2
- BFPYWIDHMRZLRN-SLHNCBLASA-N Ethinyl estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 BFPYWIDHMRZLRN-SLHNCBLASA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 229920003134 Eudragit® polymer Polymers 0.000 description 2
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- 102000009165 Gonadoliberin Human genes 0.000 description 2
- 108050000048 Gonadoliberin Proteins 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 108010024118 Hypothalamic Hormones Proteins 0.000 description 2
- 102000015611 Hypothalamic Hormones Human genes 0.000 description 2
- 206010021143 Hypoxia Diseases 0.000 description 2
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 2
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 2
- 102000014150 Interferons Human genes 0.000 description 2
- 108010050904 Interferons Proteins 0.000 description 2
- MLFKVJCWGUZWNV-UHFFFAOYSA-N L-alanosine Natural products OC(=O)C(N)CN(O)N=O MLFKVJCWGUZWNV-UHFFFAOYSA-N 0.000 description 2
- 102000007330 LDL Lipoproteins Human genes 0.000 description 2
- 108010007622 LDL Lipoproteins Proteins 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N Lactic Acid Natural products CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000004166 Lanolin Substances 0.000 description 2
- 229920001491 Lentinan Polymers 0.000 description 2
- 108010000817 Leuprolide Proteins 0.000 description 2
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 2
- 206010025323 Lymphomas Diseases 0.000 description 2
- VJRAUFKOOPNFIQ-UHFFFAOYSA-N Marcellomycin Natural products C12=C(O)C=3C(=O)C4=C(O)C=CC(O)=C4C(=O)C=3C=C2C(C(=O)OC)C(CC)(O)CC1OC(OC1C)CC(N(C)C)C1OC(OC1C)CC(O)C1OC1CC(O)C(O)C(C)O1 VJRAUFKOOPNFIQ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- DWODOIKZDGJOPQ-UHFFFAOYSA-N Nicofetamide Chemical compound C=1C=CN=CC=1C(=O)NC(C=1C=CC=CC=1)CC1=CC=CC=C1 DWODOIKZDGJOPQ-UHFFFAOYSA-N 0.000 description 2
- 206010029400 Nicotinic acid deficiency Diseases 0.000 description 2
- BRZANEXCSZCZCI-UHFFFAOYSA-N Nifenazone Chemical compound O=C1N(C=2C=CC=CC=2)N(C)C(C)=C1NC(=O)C1=CC=CN=C1 BRZANEXCSZCZCI-UHFFFAOYSA-N 0.000 description 2
- VWBYXJRDIQCSLW-UHFFFAOYSA-N O=[P](c1ccccc1)c1ccccc1 Chemical group O=[P](c1ccccc1)c1ccccc1 VWBYXJRDIQCSLW-UHFFFAOYSA-N 0.000 description 2
- 239000005642 Oleic acid Substances 0.000 description 2
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- 208000002141 Pellagra Diseases 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- XESARGFCSKSFID-UHFFFAOYSA-N Pyrazofurin Natural products OC1=C(C(=O)N)NN=C1C1C(O)C(O)C(CO)O1 XESARGFCSKSFID-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 239000004147 Sorbitan trioleate Substances 0.000 description 2
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 2
- DOOTYTYQINUNNV-UHFFFAOYSA-N Triethyl citrate Chemical compound CCOC(=O)CC(O)(C(=O)OCC)CC(=O)OCC DOOTYTYQINUNNV-UHFFFAOYSA-N 0.000 description 2
- 108010050144 Triptorelin Pamoate Proteins 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 2
- OIRDTQYFTABQOQ-UHTZMRCNSA-N Vidarabine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O OIRDTQYFTABQOQ-UHTZMRCNSA-N 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- XZSRRNFBEIOBDA-CFNBKWCHSA-N [2-[(2s,4s)-4-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1h-tetracen-2-yl]-2-oxoethyl] 2,2-diethoxyacetate Chemical compound O([C@H]1C[C@](CC2=C(O)C=3C(=O)C4=CC=CC(OC)=C4C(=O)C=3C(O)=C21)(O)C(=O)COC(=O)C(OCC)OCC)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 XZSRRNFBEIOBDA-CFNBKWCHSA-N 0.000 description 2
- MHVFYGIQJNFWGQ-UHFFFAOYSA-N [[4,6-bis[hydroxymethyl(methyl)amino]-1,3,5-triazin-2-yl]-methylamino]methanol Chemical compound OCN(C)C1=NC(N(C)CO)=NC(N(C)CO)=N1 MHVFYGIQJNFWGQ-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- QAWIHIJWNYOLBE-OKKQSCSOSA-N acivicin Chemical compound OC(=O)[C@@H](N)[C@@H]1CC(Cl)=NO1 QAWIHIJWNYOLBE-OKKQSCSOSA-N 0.000 description 2
- 229950008427 acivicin Drugs 0.000 description 2
- USZYSDMBJDPRIF-SVEJIMAYSA-N aclacinomycin A Chemical compound O([C@H]1[C@@H](O)C[C@@H](O[C@H]1C)O[C@H]1[C@H](C[C@@H](O[C@H]1C)O[C@H]1C[C@]([C@@H](C2=CC=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C21)C(=O)OC)(O)CC)N(C)C)[C@H]1CCC(=O)[C@H](C)O1 USZYSDMBJDPRIF-SVEJIMAYSA-N 0.000 description 2
- 229960004176 aclarubicin Drugs 0.000 description 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 2
- 229930183665 actinomycin Natural products 0.000 description 2
- 239000008186 active pharmaceutical agent Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229930013930 alkaloid Natural products 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 239000004086 alkylating cytostatic agent Substances 0.000 description 2
- 125000004419 alkynylene group Chemical group 0.000 description 2
- 229960000473 altretamine Drugs 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 229960003896 aminopterin Drugs 0.000 description 2
- 229960004701 amonafide Drugs 0.000 description 2
- XCPGHVQEEXUHNC-UHFFFAOYSA-N amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 description 2
- 229960001220 amsacrine Drugs 0.000 description 2
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 2
- 239000003098 androgen Substances 0.000 description 2
- 229940030486 androgens Drugs 0.000 description 2
- 229940045799 anthracyclines and related substance Drugs 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 230000002280 anti-androgenic effect Effects 0.000 description 2
- 229940046836 anti-estrogen Drugs 0.000 description 2
- 230000001833 anti-estrogenic effect Effects 0.000 description 2
- 230000002927 anti-mitotic effect Effects 0.000 description 2
- 239000000051 antiandrogen Substances 0.000 description 2
- 229940030495 antiandrogen sex hormone and modulator of the genital system Drugs 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000003080 antimitotic agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229940078010 arimidex Drugs 0.000 description 2
- 239000003886 aromatase inhibitor Substances 0.000 description 2
- 229940046844 aromatase inhibitors Drugs 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000005110 aryl thio group Chemical group 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 229960003272 asparaginase Drugs 0.000 description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001541 aziridines Chemical class 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 125000005872 benzooxazolyl group Chemical group 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- KVYGGMBOZFWZBQ-UHFFFAOYSA-N benzyl nicotinate Chemical compound C=1C=CN=CC=1C(=O)OCC1=CC=CC=C1 KVYGGMBOZFWZBQ-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 229960001561 bleomycin Drugs 0.000 description 2
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 2
- 210000000601 blood cell Anatomy 0.000 description 2
- 229960002092 busulfan Drugs 0.000 description 2
- KVUAALJSMIVURS-ZEDZUCNESA-L calcium folinate Chemical compound [Ca+2].C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)C=C1 KVUAALJSMIVURS-ZEDZUCNESA-L 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical class [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- XREUEWVEMYWFFA-CSKJXFQVSA-N carminomycin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=C(O)C=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XREUEWVEMYWFFA-CSKJXFQVSA-N 0.000 description 2
- 229930188550 carminomycin Natural products 0.000 description 2
- XREUEWVEMYWFFA-UHFFFAOYSA-N carminomycin I Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=C(O)C=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XREUEWVEMYWFFA-UHFFFAOYSA-N 0.000 description 2
- 229950001725 carubicin Drugs 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 230000030833 cell death Effects 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 229960004630 chlorambucil Drugs 0.000 description 2
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 2
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 2
- 229960001380 cimetidine Drugs 0.000 description 2
- 230000004087 circulation Effects 0.000 description 2
- 229940001468 citrate Drugs 0.000 description 2
- 210000001072 colon Anatomy 0.000 description 2
- 229940000425 combination drug Drugs 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- DUSHUSLJJMDGTE-ZJPMUUANSA-N cyproterone Chemical compound C1=C(Cl)C2=CC(=O)[C@@H]3C[C@@H]3[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 DUSHUSLJJMDGTE-ZJPMUUANSA-N 0.000 description 2
- 229960003843 cyproterone Drugs 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 229950003913 detorubicin Drugs 0.000 description 2
- 238000003745 diagnosis Methods 0.000 description 2
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 2
- KYHUYMLIVQFXRI-UHFFFAOYSA-N didemnin B Natural products CC1OC(=O)C(CC=2C=CC(OC)=CC=2)N(C)C(=O)C2CCCN2C(=O)C(CC(C)C)NC(=O)C(C)C(=O)C(C(C)C)OC(=O)CC(O)C(C(C)CC)NC(=O)C1NC(=O)C(CC(C)C)N(C)C(=O)C1CCCN1C(=O)C(C)O KYHUYMLIVQFXRI-UHFFFAOYSA-N 0.000 description 2
- 108010061297 didemnins Proteins 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000012377 drug delivery Methods 0.000 description 2
- 239000003844 drug implant Substances 0.000 description 2
- 229940088679 drug related substance Drugs 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 229950006700 edatrexate Drugs 0.000 description 2
- FSIRXIHZBIXHKT-MHTVFEQDSA-N edatrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CC(CC)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FSIRXIHZBIXHKT-MHTVFEQDSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000007920 enema Substances 0.000 description 2
- 229940095399 enema Drugs 0.000 description 2
- 229960001904 epirubicin Drugs 0.000 description 2
- ITSGNOIFAJAQHJ-BMFNZSJVSA-N esorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)C[C@H](C)O1 ITSGNOIFAJAQHJ-BMFNZSJVSA-N 0.000 description 2
- 229950002017 esorubicin Drugs 0.000 description 2
- 229960005309 estradiol Drugs 0.000 description 2
- 229930182833 estradiol Natural products 0.000 description 2
- 229960001842 estramustine Drugs 0.000 description 2
- FRPJXPJMRWBBIH-RBRWEJTLSA-N estramustine Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 FRPJXPJMRWBBIH-RBRWEJTLSA-N 0.000 description 2
- 229940011871 estrogen Drugs 0.000 description 2
- 239000000262 estrogen Substances 0.000 description 2
- 239000000328 estrogen antagonist Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229960002568 ethinylestradiol Drugs 0.000 description 2
- 229960000255 exemestane Drugs 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- ODKNJVUHOIMIIZ-RRKCRQDMSA-N floxuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ODKNJVUHOIMIIZ-RRKCRQDMSA-N 0.000 description 2
- 229960000961 floxuridine Drugs 0.000 description 2
- 229960000390 fludarabine Drugs 0.000 description 2
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- LJJQENSFXLXPIV-UHFFFAOYSA-N fluorenylidene Chemical group C1=CC=C2[C]C3=CC=CC=C3C2=C1 LJJQENSFXLXPIV-UHFFFAOYSA-N 0.000 description 2
- YLRFCQOZQXIBAB-RBZZARIASA-N fluoxymesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1CC[C@](C)(O)[C@@]1(C)C[C@@H]2O YLRFCQOZQXIBAB-RBZZARIASA-N 0.000 description 2
- 229960001751 fluoxymesterone Drugs 0.000 description 2
- 235000008191 folinic acid Nutrition 0.000 description 2
- 239000011672 folinic acid Substances 0.000 description 2
- OSVMTWJCGUFAOD-KZQROQTASA-N formestane Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1O OSVMTWJCGUFAOD-KZQROQTASA-N 0.000 description 2
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 2
- 229940044658 gallium nitrate Drugs 0.000 description 2
- 239000003349 gelling agent Substances 0.000 description 2
- 229940050410 gluconate Drugs 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- 125000005368 heteroarylthio group Chemical group 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 2
- HYFHYPWGAURHIV-UHFFFAOYSA-N homoharringtonine Natural products C1=C2CCN3CCCC43C=C(OC)C(OC(=O)C(O)(CCCC(C)(C)O)CC(=O)OC)C4C2=CC2=C1OCO2 HYFHYPWGAURHIV-UHFFFAOYSA-N 0.000 description 2
- 230000003054 hormonal effect Effects 0.000 description 2
- 229940088597 hormone Drugs 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- 239000003667 hormone antagonist Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 229960002899 hydroxyprogesterone Drugs 0.000 description 2
- 229940043650 hypothalamic hormone Drugs 0.000 description 2
- 239000000601 hypothalamic hormone Substances 0.000 description 2
- 230000001146 hypoxic effect Effects 0.000 description 2
- 229960000908 idarubicin Drugs 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- 210000000987 immune system Anatomy 0.000 description 2
- 238000002650 immunosuppressive therapy Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- 229940079322 interferon Drugs 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 2
- 235000019388 lanolin Nutrition 0.000 description 2
- 229940115286 lentinan Drugs 0.000 description 2
- 229960001691 leucovorin Drugs 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- GFIJNRVAKGFPGQ-LIJARHBVSA-N leuprolide Chemical compound CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CC=C(O)C=C1 GFIJNRVAKGFPGQ-LIJARHBVSA-N 0.000 description 2
- 229960004338 leuprorelin Drugs 0.000 description 2
- 208000014018 liver neoplasm Diseases 0.000 description 2
- 229960002247 lomustine Drugs 0.000 description 2
- 229960003538 lonidamine Drugs 0.000 description 2
- WDRYRZXSPDWGEB-UHFFFAOYSA-N lonidamine Chemical compound C12=CC=CC=C2C(C(=O)O)=NN1CC1=CC=C(Cl)C=C1Cl WDRYRZXSPDWGEB-UHFFFAOYSA-N 0.000 description 2
- 229950000547 mafosfamide Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 150000002688 maleic acid derivatives Chemical class 0.000 description 2
- 150000004701 malic acid derivatives Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 2
- 229960004961 mechlorethamine Drugs 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 210000004379 membrane Anatomy 0.000 description 2
- VJRAUFKOOPNFIQ-TVEKBUMESA-N methyl (1r,2r,4s)-4-[(2r,4s,5s,6s)-5-[(2s,4s,5s,6s)-5-[(2s,4s,5s,6s)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-(dimethylamino)-6-methyloxan-2-yl]oxy-2-ethyl-2,5,7,10-tetrahydroxy-6,11-dioxo-3,4-dihydro-1h-tetracene-1-carboxylat Chemical compound O([C@H]1[C@@H](O)C[C@@H](O[C@H]1C)O[C@H]1[C@H](C[C@@H](O[C@H]1C)O[C@H]1C[C@]([C@@H](C2=CC=3C(=O)C4=C(O)C=CC(O)=C4C(=O)C=3C(O)=C21)C(=O)OC)(O)CC)N(C)C)[C@H]1C[C@H](O)[C@H](O)[C@H](C)O1 VJRAUFKOOPNFIQ-TVEKBUMESA-N 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N methyl nicotinate Chemical compound COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 239000003094 microcapsule Substances 0.000 description 2
- 239000011859 microparticle Substances 0.000 description 2
- VKHAHZOOUSRJNA-GCNJZUOMSA-N mifepristone Chemical compound C1([C@@H]2C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]3CC[C@@]([C@]3(C2)C)(O)C#CC)=CC=C(N(C)C)C=C1 VKHAHZOOUSRJNA-GCNJZUOMSA-N 0.000 description 2
- 229960003248 mifepristone Drugs 0.000 description 2
- VFKZTMPDYBFSTM-GUCUJZIJSA-N mitolactol Chemical compound BrC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CBr VFKZTMPDYBFSTM-GUCUJZIJSA-N 0.000 description 2
- 229950010913 mitolactol Drugs 0.000 description 2
- 229960000350 mitotane Drugs 0.000 description 2
- QXYYYPFGTSJXNS-UHFFFAOYSA-N mitozolomide Chemical compound N1=NN(CCCl)C(=O)N2C1=C(C(=O)N)N=C2 QXYYYPFGTSJXNS-UHFFFAOYSA-N 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 210000004400 mucous membrane Anatomy 0.000 description 2
- 239000002105 nanoparticle Substances 0.000 description 2
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 2
- 229960002715 nicotine Drugs 0.000 description 2
- 229960001420 nimustine Drugs 0.000 description 2
- VFEDRRNHLBGPNN-UHFFFAOYSA-N nimustine Chemical compound CC1=NC=C(CNC(=O)N(CCCl)N=O)C(N)=N1 VFEDRRNHLBGPNN-UHFFFAOYSA-N 0.000 description 2
- OSTGTTZJOCZWJG-UHFFFAOYSA-N nitrosourea Chemical class NC(=O)N=NO OSTGTTZJOCZWJG-UHFFFAOYSA-N 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- HYFHYPWGAURHIV-JFIAXGOJSA-N omacetaxine mepesuccinate Chemical compound C1=C2CCN3CCC[C@]43C=C(OC)[C@@H](OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)OC)[C@H]4C2=CC2=C1OCO2 HYFHYPWGAURHIV-JFIAXGOJSA-N 0.000 description 2
- 229960002230 omacetaxine mepesuccinate Drugs 0.000 description 2
- 230000003204 osmotic effect Effects 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 238000005191 phase separation Methods 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- XESARGFCSKSFID-FLLFQEBCSA-N pirazofurin Chemical compound OC1=C(C(=O)N)NN=C1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 XESARGFCSKSFID-FLLFQEBCSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- CPTBDICYNRMXFX-UHFFFAOYSA-N procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 2
- 229960000624 procarbazine Drugs 0.000 description 2
- 239000000186 progesterone Substances 0.000 description 2
- 229960003387 progesterone Drugs 0.000 description 2
- 239000000583 progesterone congener Substances 0.000 description 2
- 229940095055 progestogen systemic hormonal contraceptives Drugs 0.000 description 2
- 238000004080 punching Methods 0.000 description 2
- 125000005400 pyridylcarbonyl group Chemical group N1=C(C=CC=C1)C(=O)* 0.000 description 2
- 125000005030 pyridylthio group Chemical group N1=C(C=CC=C1)S* 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- AUJXLBOHYWTPFV-UHFFFAOYSA-N quinomycin A Natural products CN1C(=O)C(C)NC(=O)C(NC(=O)C=2N=C3C=CC=CC3=NC=2)COC(=O)C(C(C)C)N(C)C(=O)C2N(C)C(=O)C(C)NC(=O)C(NC(=O)C=3N=C4C=CC=CC4=NC=3)COC(=O)C(C(C)C)N(C)C(=O)C1CSC2SC AUJXLBOHYWTPFV-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 230000008439 repair process Effects 0.000 description 2
- QXKJWHWUDVQATH-UHFFFAOYSA-N rogletimide Chemical compound C=1C=NC=CC=1C1(CC)CCC(=O)NC1=O QXKJWHWUDVQATH-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 238000000935 solvent evaporation Methods 0.000 description 2
- 235000019337 sorbitan trioleate Nutrition 0.000 description 2
- 229960000391 sorbitan trioleate Drugs 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 229950006315 spirogermanium Drugs 0.000 description 2
- 229950006050 spiromustine Drugs 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 230000003068 static effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000006190 sub-lingual tablet Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 230000009182 swimming Effects 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- 229960004964 temozolomide Drugs 0.000 description 2
- 229960005353 testolactone Drugs 0.000 description 2
- BPEWUONYVDABNZ-DZBHQSCQSA-N testolactone Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(OC(=O)CC4)[C@@H]4[C@@H]3CCC2=C1 BPEWUONYVDABNZ-DZBHQSCQSA-N 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- FVRDYQYEVDDKCR-DBRKOABJSA-N tiazofurine Chemical compound NC(=O)C1=CSC([C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)=N1 FVRDYQYEVDDKCR-DBRKOABJSA-N 0.000 description 2
- 229960003723 tiazofurine Drugs 0.000 description 2
- 229960003087 tioguanine Drugs 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 239000001069 triethyl citrate Substances 0.000 description 2
- 235000013769 triethyl citrate Nutrition 0.000 description 2
- VMYFZRTXGLUXMZ-UHFFFAOYSA-N triethyl citrate Natural products CCOC(=O)C(O)(C(=O)OCC)C(=O)OCC VMYFZRTXGLUXMZ-UHFFFAOYSA-N 0.000 description 2
- VXKHXGOKWPXYNA-PGBVPBMZSA-N triptorelin Chemical compound C([C@@H](C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 VXKHXGOKWPXYNA-PGBVPBMZSA-N 0.000 description 2
- 229960004824 triptorelin Drugs 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- UMKFEPPTGMDVMI-UHFFFAOYSA-N trofosfamide Chemical compound ClCCN(CCCl)P1(=O)OCCCN1CCCl UMKFEPPTGMDVMI-UHFFFAOYSA-N 0.000 description 2
- 229960000875 trofosfamide Drugs 0.000 description 2
- ZDPHROOEEOARMN-UHFFFAOYSA-M undecanoate Chemical compound CCCCCCCCCCC([O-])=O ZDPHROOEEOARMN-UHFFFAOYSA-M 0.000 description 2
- ZOCKGBMQLCSHFP-KQRAQHLDSA-N valrubicin Chemical compound O([C@H]1C[C@](CC2=C(O)C=3C(=O)C4=CC=CC(OC)=C4C(=O)C=3C(O)=C21)(O)C(=O)COC(=O)CCCC)[C@H]1C[C@H](NC(=O)C(F)(F)F)[C@H](O)[C@H](C)O1 ZOCKGBMQLCSHFP-KQRAQHLDSA-N 0.000 description 2
- 229960003636 vidarabine Drugs 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 2
- 229950005839 vinzolidine Drugs 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 230000003313 weakening effect Effects 0.000 description 2
- FBTUMDXHSRTGRV-ALTNURHMSA-N zorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\NC(=O)C=1C=CC=CC=1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 FBTUMDXHSRTGRV-ALTNURHMSA-N 0.000 description 2
- 229960000641 zorubicin Drugs 0.000 description 2
- VLCYCQAOQCDTCN-ZCFIWIBFSA-N α-difluoromethylornithine Chemical compound NCCC[C@@](N)(C(F)F)C(O)=O VLCYCQAOQCDTCN-ZCFIWIBFSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- BLUGYPPOFIHFJS-UUFHNPECSA-N (2s)-n-[(2s)-1-[[(3r,4s,5s)-3-methoxy-1-[(2s)-2-[(1r,2r)-1-methoxy-2-methyl-3-oxo-3-[[(1s)-2-phenyl-1-(1,3-thiazol-2-yl)ethyl]amino]propyl]pyrrolidin-1-yl]-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamid Chemical compound CN[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H]([C@@H](C)CC)[C@H](OC)CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)N[C@H](C=1SC=CN=1)CC1=CC=CC=C1 BLUGYPPOFIHFJS-UUFHNPECSA-N 0.000 description 1
- FELGMEQIXOGIFQ-CYBMUJFWSA-N (3r)-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1h-carbazol-4-one Chemical compound CC1=NC=CN1C[C@@H]1C(=O)C(C=2C(=CC=CC=2)N2C)=C2CC1 FELGMEQIXOGIFQ-CYBMUJFWSA-N 0.000 description 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000006795 (C2-C7) alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- QZCJOXAIQXPLNS-UHFFFAOYSA-N 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-octadecafluoronaphthalene 4-(2-aminoethyl)benzene-1,2-diol Chemical compound NCCc1ccc(O)c(O)c1.FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C1(F)F QZCJOXAIQXPLNS-UHFFFAOYSA-N 0.000 description 1
- WHPWLUGDBCVLLK-UHFFFAOYSA-N 1,2-dihydro-3h-dibenz[de,h]isoquinoline-1,3-dione Chemical compound C1=CC(C(=O)NC2=O)=C3C2=C(C=CC=C2)C2=CC3=C1 WHPWLUGDBCVLLK-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- AXTGDCSMTYGJND-UHFFFAOYSA-N 1-dodecylazepan-2-one Chemical compound CCCCCCCCCCCCN1CCCCCC1=O AXTGDCSMTYGJND-UHFFFAOYSA-N 0.000 description 1
- IKQFHPOZPYEPOW-UHFFFAOYSA-N 1-ethyl-2h-pyridine-3-carboxamide Chemical compound CCN1CC(C(N)=O)=CC=C1 IKQFHPOZPYEPOW-UHFFFAOYSA-N 0.000 description 1
- WOWBGMOQMOMTQR-UHFFFAOYSA-N 1-methyl-1,2-dihydropyridin-1-ium-3-carboxamide;chloride Chemical compound Cl.CN1CC(C(N)=O)=CC=C1 WOWBGMOQMOMTQR-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- CRJFOPZHQMBHNQ-UHFFFAOYSA-N 1-methyl-2h-pyridine-3-carboxamide Chemical compound CN1CC(C(N)=O)=CC=C1 CRJFOPZHQMBHNQ-UHFFFAOYSA-N 0.000 description 1
- WGUXTQDCAZNJIF-UHFFFAOYSA-N 1-methyl-3,5-bis(trifluoromethyl)benzene Chemical compound CC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 WGUXTQDCAZNJIF-UHFFFAOYSA-N 0.000 description 1
- SWYJYGCPTGKBDS-UHFFFAOYSA-N 2,3-dihydroxypropyl 2-(3-chloro-2-methylanilino)pyridine-3-carboxylate Chemical compound CC1=C(Cl)C=CC=C1NC1=NC=CC=C1C(=O)OCC(O)CO SWYJYGCPTGKBDS-UHFFFAOYSA-N 0.000 description 1
- BOMZMNZEXMAQQW-UHFFFAOYSA-N 2,5,11-trimethyl-6h-pyrido[4,3-b]carbazol-2-ium-9-ol;acetate Chemical compound CC([O-])=O.C[N+]1=CC=C2C(C)=C(NC=3C4=CC(O)=CC=3)C4=C(C)C2=C1 BOMZMNZEXMAQQW-UHFFFAOYSA-N 0.000 description 1
- XEQIPELDMSEBJG-UHFFFAOYSA-N 2-(2,3-dimethylanilino)pyridine-3-carboxylic acid Chemical compound CC1=CC=CC(NC=2C(=CC=CN=2)C(O)=O)=C1C XEQIPELDMSEBJG-UHFFFAOYSA-N 0.000 description 1
- HUIJQYKRBFBVAO-UHFFFAOYSA-N 2-(2,6-dimethylanilino)pyridine-3-carboxylic acid Chemical compound CC1=CC=CC(C)=C1NC1=NC=CC=C1C(O)=O HUIJQYKRBFBVAO-UHFFFAOYSA-N 0.000 description 1
- ADIBYIWFBDMKNY-UHFFFAOYSA-N 2-(4-butylanilino)pyridine-3-carboxylic acid Chemical compound C1=CC(CCCC)=CC=C1NC1=NC=CC=C1C(O)=O ADIBYIWFBDMKNY-UHFFFAOYSA-N 0.000 description 1
- NTPIQBSWTZGMTC-UHFFFAOYSA-N 2-(diethylamino)ethyl 4-(pyridine-3-carbonylamino)benzoate Chemical compound C1=CC(C(=O)OCCN(CC)CC)=CC=C1NC(=O)C1=CC=CN=C1 NTPIQBSWTZGMTC-UHFFFAOYSA-N 0.000 description 1
- BNHYXXAGSCPBAN-UHFFFAOYSA-N 2-[(1,5-dichlorocyclohexa-2,4-dien-1-yl)amino]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=C1NC1(Cl)C=CC=C(Cl)C1 BNHYXXAGSCPBAN-UHFFFAOYSA-N 0.000 description 1
- LEHYPZPPMMKARP-VEWLUABCSA-N 2-[(4R,4aR,12bS)-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]pyridine-3-carboxylic acid Chemical compound C([C@H]1[C@H]2CC3=CC=C(C=4OC5[C@@]1(C3=4)CCN2C)OC)CC5C1=NC=CC=C1C(O)=O LEHYPZPPMMKARP-VEWLUABCSA-N 0.000 description 1
- HILPCWYKPQNXHU-UHFFFAOYSA-N 2-[10-[2-(pyridine-3-carbonyloxy)ethylsulfanyl]decylsulfanyl]ethyl pyridine-3-carboxylate Chemical compound C=1C=CN=CC=1C(=O)OCCSCCCCCCCCCCSCCOC(=O)C1=CC=CN=C1 HILPCWYKPQNXHU-UHFFFAOYSA-N 0.000 description 1
- NSCJAZOJASIHLI-UHFFFAOYSA-N 2-[2-(3-carboxypyridin-2-yl)-4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]phenyl]pyridine-3-carboxylic acid Chemical compound COC1=C(C=C2C(=C1)C=CN=C2CC3=CC(=C(C=C3)C4=C(C=CC=N4)C(=O)O)C5=C(C=CC=N5)C(=O)O)OC NSCJAZOJASIHLI-UHFFFAOYSA-N 0.000 description 1
- DDQOEXWUZHRSOZ-UHFFFAOYSA-N 2-[5-methoxy-2-methyl-1-(pyridine-3-carbonyl)indol-3-yl]acetic acid Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=CN=C1 DDQOEXWUZHRSOZ-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- NLBIKXOJCISNQP-UHFFFAOYSA-N 4-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC=C1NC1=CC=CC(C(F)(F)F)=C1 NLBIKXOJCISNQP-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-M 4-chlorobenzoate Chemical compound [O-]C(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-M 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 1
- QGNQEODJYRGEJX-UHFFFAOYSA-N 4h-isoquinoline-1,3-dione Chemical compound C1=CC=C2C(=O)NC(=O)CC2=C1 QGNQEODJYRGEJX-UHFFFAOYSA-N 0.000 description 1
- ZUBFYWCZDWBIEE-UHFFFAOYSA-N 6-acetamido-2-phenylpyridine-3-carboxylic acid Chemical compound CC(=O)NC1=CC=C(C(O)=O)C(C=2C=CC=CC=2)=N1 ZUBFYWCZDWBIEE-UHFFFAOYSA-N 0.000 description 1
- NWPRCRWQMGIBOT-UHFFFAOYSA-N 7-(2-hydroxyethyl)-1,3-dimethylpurine-2,6-dione Chemical compound O=C1N(C)C(=O)N(C)C2=C1N(CCO)C=N2 NWPRCRWQMGIBOT-UHFFFAOYSA-N 0.000 description 1
- 208000007934 ACTH-independent macronodular adrenal hyperplasia Diseases 0.000 description 1
- 102000009062 ADP Ribose Transferases Human genes 0.000 description 1
- 108010049290 ADP Ribose Transferases Proteins 0.000 description 1
- PWJFNRJRHXWEPT-UHFFFAOYSA-N ADP ribose Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OCC(O)C(O)C(O)C=O)C(O)C1O PWJFNRJRHXWEPT-UHFFFAOYSA-N 0.000 description 1
- 230000005730 ADP ribosylation Effects 0.000 description 1
- SRNWOUGRCWSEMX-KEOHHSTQSA-N ADP-beta-D-ribose Chemical compound C([C@H]1O[C@H]([C@@H]([C@@H]1O)O)N1C=2N=CN=C(C=2N=C1)N)OP(O)(=O)OP(O)(=O)OC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O SRNWOUGRCWSEMX-KEOHHSTQSA-N 0.000 description 1
- 102100033350 ATP-dependent translocase ABCB1 Human genes 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 206010000830 Acute leukaemia Diseases 0.000 description 1
- 229920000936 Agarose Polymers 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical class C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 241001671700 Bilia Species 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- 206010006417 Bronchial carcinoma Diseases 0.000 description 1
- 108010037003 Buserelin Proteins 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- 102000011632 Caseins Human genes 0.000 description 1
- 108010076119 Caseins Proteins 0.000 description 1
- 208000035484 Cellulite Diseases 0.000 description 1
- 208000007192 Childhood Schizophrenia Diseases 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 102000029816 Collagenase Human genes 0.000 description 1
- 108060005980 Collagenase Proteins 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 241000699802 Cricetulus griseus Species 0.000 description 1
- 244000303965 Cyamopsis psoralioides Species 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 230000004568 DNA-binding Effects 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 238000002965 ELISA Methods 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 208000009849 Female Genital Neoplasms Diseases 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 229920001917 Ficoll Polymers 0.000 description 1
- PLDUPXSUYLZYBN-UHFFFAOYSA-N Fluphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 PLDUPXSUYLZYBN-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 102000005720 Glutathione transferase Human genes 0.000 description 1
- 108010070675 Glutathione transferase Proteins 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- 102000001554 Hemoglobins Human genes 0.000 description 1
- 108010054147 Hemoglobins Proteins 0.000 description 1
- 206010019695 Hepatic neoplasm Diseases 0.000 description 1
- GUIBJJJLGSYNKE-UHFFFAOYSA-N Hepronicate Chemical compound C=1C=CN=CC=1C(=O)OCC(COC(=O)C=1C=NC=CC=1)(CCCCCC)COC(=O)C1=CC=CN=C1 GUIBJJJLGSYNKE-UHFFFAOYSA-N 0.000 description 1
- 239000004705 High-molecular-weight polyethylene Substances 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 108091006905 Human Serum Albumin Proteins 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
- 206010020843 Hyperthermia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010062016 Immunosuppression Diseases 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- PWWVAXIEGOYWEE-UHFFFAOYSA-N Isophenergan Chemical compound C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 PWWVAXIEGOYWEE-UHFFFAOYSA-N 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- LKDRXBCSQODPBY-AMVSKUEXSA-N L-(-)-Sorbose Chemical compound OCC1(O)OC[C@H](O)[C@@H](O)[C@@H]1O LKDRXBCSQODPBY-AMVSKUEXSA-N 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 206010024305 Leukaemia monocytic Diseases 0.000 description 1
- 208000019428 Ligament disease Diseases 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 1
- 244000062730 Melissa officinalis Species 0.000 description 1
- 108010047230 Member 1 Subfamily B ATP Binding Cassette Transporter Proteins 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 238000011785 NMRI mouse Methods 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 101150049168 Nisch gene Proteins 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 206010049752 Peau d'orange Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 102000012338 Poly(ADP-ribose) Polymerases Human genes 0.000 description 1
- 108010061844 Poly(ADP-ribose) Polymerases Proteins 0.000 description 1
- 108091026813 Poly(ADPribose) Proteins 0.000 description 1
- 229920000805 Polyaspartic acid Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- 206010038389 Renal cancer Diseases 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 208000021712 Soft tissue sarcoma Diseases 0.000 description 1
- 241000708948 Solva Species 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QJJXYPPXXYFBGM-LFZNUXCKSA-N Tacrolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1\C=C(/C)[C@@H]1[C@H](C)[C@@H](O)CC(=O)[C@H](CC=C)/C=C(C)/C[C@H](C)C[C@H](OC)[C@H]([C@H](C[C@H]2C)OC)O[C@@]2(O)C(=O)C(=O)N2CCCC[C@H]2C(=O)O1 QJJXYPPXXYFBGM-LFZNUXCKSA-N 0.000 description 1
- 208000024313 Testicular Neoplasms Diseases 0.000 description 1
- 241000011102 Thera Species 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 208000024770 Thyroid neoplasm Diseases 0.000 description 1
- 102000004338 Transferrin Human genes 0.000 description 1
- 108090000901 Transferrin Proteins 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 206010045170 Tumour lysis syndrome Diseases 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- 229930003537 Vitamin B3 Natural products 0.000 description 1
- 206010047700 Vomiting Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- JSZILQVIPPROJI-CEXWTWQISA-N [(2R,3R,11bS)-3-(diethylcarbamoyl)-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] acetate Chemical compound C1CC2=CC(OC)=C(OC)C=C2[C@H]2N1C[C@@H](C(=O)N(CC)CC)[C@H](OC(C)=O)C2 JSZILQVIPPROJI-CEXWTWQISA-N 0.000 description 1
- FXMSQUVSUXBBAB-TXDQRGGKSA-N [(8r,9s,13s,14s,17s)-13-methyl-3-propanoyloxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] pyridine-3-carboxylate Chemical compound O([C@@H]1[C@@]2(C)CC[C@@H]3C4=CC=C(C=C4CC[C@H]3[C@@H]2CC1)OC(=O)CC)C(=O)C1=CC=CN=C1 FXMSQUVSUXBBAB-TXDQRGGKSA-N 0.000 description 1
- DFPAKSUCGFBDDF-ZQBYOMGUSA-N [14c]-nicotinamide Chemical compound N[14C](=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-ZQBYOMGUSA-N 0.000 description 1
- BNYZXONJFQJYPC-UHFFFAOYSA-N [4-(4-methoxycarbonyl-5-methylfuran-2-yl)-2,3,4-tris(pyridine-3-carbonyloxy)butyl] pyridine-3-carboxylate Chemical compound O1C(C)=C(C(=O)OC)C=C1C(C(OC(=O)C=1C=NC=CC=1)C(COC(=O)C=1C=NC=CC=1)OC(=O)C=1C=NC=CC=1)OC(=O)C1=CC=CN=C1 BNYZXONJFQJYPC-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000004015 abortifacient agent Substances 0.000 description 1
- 231100000641 abortifacient agent Toxicity 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001278 adipic acid derivatives Chemical class 0.000 description 1
- 208000024447 adrenal gland neoplasm Diseases 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005108 alkenylthio group Chemical group 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000005109 alkynylthio group Chemical group 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical class [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000000947 anti-immunosuppressive effect Effects 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000008122 artificial sweetener Substances 0.000 description 1
- 235000021311 artificial sweeteners Nutrition 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 206010061691 benign mesothelioma Diseases 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- UDEWPOVQBGFNGE-UHFFFAOYSA-N benzoic acid n-propyl ester Natural products CCCOC(=O)C1=CC=CC=C1 UDEWPOVQBGFNGE-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 229960004564 benzquinamide Drugs 0.000 description 1
- 229950004580 benzyl nicotinate Drugs 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 229910001423 beryllium ion Inorganic materials 0.000 description 1
- IZJRISIINLJVBU-UHFFFAOYSA-N beta-Butoxyethyl nicotinate Chemical compound CCCCOCCOC(=O)C1=CC=CN=C1 IZJRISIINLJVBU-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229950008548 bisantrene Drugs 0.000 description 1
- OYVAGSVQBOHSSS-WXFSZRTFSA-O bleomycin Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](OC1C(C(O)C(O)C(CO)O1)OC1C(C(OC(N)=O)C(O)C(CO)O1)O)C=1NC=NC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-WXFSZRTFSA-O 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 230000008081 blood perfusion Effects 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- 206010006007 bone sarcoma Diseases 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 208000003362 bronchogenic carcinoma Diseases 0.000 description 1
- MOYGZHXDRJNJEP-UHFFFAOYSA-N buclizine Chemical compound C1=CC(C(C)(C)C)=CC=C1CN1CCN(C(C=2C=CC=CC=2)C=2C=CC(Cl)=CC=2)CC1 MOYGZHXDRJNJEP-UHFFFAOYSA-N 0.000 description 1
- 229960001705 buclizine Drugs 0.000 description 1
- 239000013590 bulk material Substances 0.000 description 1
- CUWODFFVMXJOKD-UVLQAERKSA-N buserelin Chemical compound CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CC=C(O)C=C1 CUWODFFVMXJOKD-UVLQAERKSA-N 0.000 description 1
- 229960002719 buserelin Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007910 chewable tablet Substances 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 1
- 229960001076 chlorpromazine Drugs 0.000 description 1
- 208000024207 chronic leukemia Diseases 0.000 description 1
- GQSGZTBDVNUIQS-DGCLKSJQSA-N ciclonicate Chemical compound C1C(C)(C)C[C@H](C)C[C@H]1OC(=O)C1=CC=CN=C1 GQSGZTBDVNUIQS-DGCLKSJQSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- CLOMYZFHNHFSIQ-UHFFFAOYSA-N clonixin Chemical compound CC1=C(Cl)C=CC=C1NC1=NC=CC=C1C(O)=O CLOMYZFHNHFSIQ-UHFFFAOYSA-N 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 229960002424 collagenase Drugs 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000599 controlled substance Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 229960000913 crospovidone Drugs 0.000 description 1
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000002993 cycloalkylene group Chemical group 0.000 description 1
- 125000005366 cycloalkylthio group Chemical group 0.000 description 1
- 229940097362 cyclodextrins Drugs 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- WVYXNIXAMZOZFK-UHFFFAOYSA-N diaziquone Chemical compound O=C1C(NC(=O)OCC)=C(N2CC2)C(=O)C(NC(=O)OCC)=C1N1CC1 WVYXNIXAMZOZFK-UHFFFAOYSA-N 0.000 description 1
- 229950002389 diaziquone Drugs 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- MZDOIJOUFRQXHC-UHFFFAOYSA-N dimenhydrinate Chemical compound O=C1N(C)C(=O)N(C)C2=NC(Cl)=N[C]21.C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 MZDOIJOUFRQXHC-UHFFFAOYSA-N 0.000 description 1
- 229960004993 dimenhydrinate Drugs 0.000 description 1
- XVLXYDXJEKLXHN-UHFFFAOYSA-M dioc6 Chemical compound [I-].O1C2=CC=CC=C2[N+](CCCCCC)=C1C=CC=C1N(CCCCCC)C2=CC=CC=C2O1 XVLXYDXJEKLXHN-UHFFFAOYSA-M 0.000 description 1
- OGAKLTJNUQRZJU-UHFFFAOYSA-N diphenidol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)CCCN1CCCCC1 OGAKLTJNUQRZJU-UHFFFAOYSA-N 0.000 description 1
- 229960003520 diphenidol Drugs 0.000 description 1
- 235000021186 dishes Nutrition 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 108010007093 dispase Proteins 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 1
- FGXWKSZFVQUSTL-UHFFFAOYSA-N domperidone Chemical compound C12=CC=CC=C2NC(=O)N1CCCN(CC1)CCC1N1C2=CC=C(Cl)C=C2NC1=O FGXWKSZFVQUSTL-UHFFFAOYSA-N 0.000 description 1
- 229960001253 domperidone Drugs 0.000 description 1
- 229940052760 dopamine agonists Drugs 0.000 description 1
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 1
- RMEDXOLNCUSCGS-UHFFFAOYSA-N droperidol Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CC=C(N2C(NC3=CC=CC=C32)=O)CC1 RMEDXOLNCUSCGS-UHFFFAOYSA-N 0.000 description 1
- 229960000394 droperidol Drugs 0.000 description 1
- 229950005101 drostanolone Drugs 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- KSCFJBIXMNOVSH-UHFFFAOYSA-N dyphylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1N(CC(O)CO)C=N2 KSCFJBIXMNOVSH-UHFFFAOYSA-N 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 229950000549 elliptinium acetate Drugs 0.000 description 1
- JROGBPMEKVAPEH-GXGBFOEMSA-N emetine dihydrochloride Chemical compound Cl.Cl.N1CCC2=CC(OC)=C(OC)C=C2[C@H]1C[C@H]1C[C@H]2C3=CC(OC)=C(OC)C=C3CCN2C[C@@H]1CC JROGBPMEKVAPEH-GXGBFOEMSA-N 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- 235000020774 essential nutrients Nutrition 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- XXRVYAFBUDSLJX-UHFFFAOYSA-N etofibrate Chemical compound C=1C=CN=CC=1C(=O)OCCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 XXRVYAFBUDSLJX-UHFFFAOYSA-N 0.000 description 1
- 229960005387 etofylline Drugs 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- NOOCSNJCXJYGPE-UHFFFAOYSA-N flunixin Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1NC1=NC=CC=C1C(O)=O NOOCSNJCXJYGPE-UHFFFAOYSA-N 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 229960002690 fluphenazine Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 239000004052 folic acid antagonist Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 229940050411 fumarate Drugs 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N glutaric acid Chemical compound OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 229960003878 haloperidol Drugs 0.000 description 1
- 201000010536 head and neck cancer Diseases 0.000 description 1
- 208000014829 head and neck neoplasm Diseases 0.000 description 1
- 230000010224 hepatic metabolism Effects 0.000 description 1
- 239000008131 herbal destillate Substances 0.000 description 1
- 125000005241 heteroarylamino group Chemical group 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 description 1
- 125000004634 hexahydroazepinyl group Chemical group N1(CCCCCC1)* 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 239000008311 hydrophilic ointment Substances 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- WPFVBOQKRVRMJB-UHFFFAOYSA-N hydroxycitronellal Chemical compound O=CCC(C)CCCC(C)(C)O WPFVBOQKRVRMJB-UHFFFAOYSA-N 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- JRFKIOFLCXKVOT-UHFFFAOYSA-N hydroxymethylnicotinamide Chemical compound OCNC(=O)C1=CC=CN=C1 JRFKIOFLCXKVOT-UHFFFAOYSA-N 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 229940071676 hydroxypropylcellulose Drugs 0.000 description 1
- 230000036031 hyperthermia Effects 0.000 description 1
- PPVUCLAYECHOQZ-UHFFFAOYSA-N imidazolidine-4,5-dione Chemical compound O=C1NCNC1=O PPVUCLAYECHOQZ-UHFFFAOYSA-N 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000006301 indolyl methyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 238000009830 intercalation Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 1
- 229960004768 irinotecan Drugs 0.000 description 1
- SZVJSHCCFOBDDC-UHFFFAOYSA-N iron(II,III) oxide Inorganic materials O=[Fe]O[Fe]O[Fe]=O SZVJSHCCFOBDDC-UHFFFAOYSA-N 0.000 description 1
- SFVVQRJOGUKCEG-UHFFFAOYSA-N isoechinatine Natural products C1CC(O)C2C(COC(=O)C(O)(C(C)O)C(C)C)=CCN21 SFVVQRJOGUKCEG-UHFFFAOYSA-N 0.000 description 1
- FZWBNHMXJMCXLU-BLAUPYHCSA-N isomaltotriose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)O1 FZWBNHMXJMCXLU-BLAUPYHCSA-N 0.000 description 1
- WJDDCFNFNAHLAF-UHFFFAOYSA-N isonixin Chemical compound CC1=CC=CC(C)=C1NC(=O)C1=CC=CNC1=O WJDDCFNFNAHLAF-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 201000010982 kidney cancer Diseases 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 210000000867 larynx Anatomy 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 201000007270 liver cancer Diseases 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 201000005296 lung carcinoma Diseases 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 208000006178 malignant mesothelioma Diseases 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- IKXILDNPCZPPRV-RFMGOVQKSA-N metholone Chemical compound C1C[C@@H]2[C@@]3(C)C[C@@H](C)C(=O)C[C@@H]3CC[C@H]2[C@@H]2CC[C@H](O)[C@]21C IKXILDNPCZPPRV-RFMGOVQKSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- OLXYLDUSSBULGU-UHFFFAOYSA-N methyl pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1 OLXYLDUSSBULGU-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 210000003470 mitochondria Anatomy 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 201000006894 monocytic leukemia Diseases 0.000 description 1
- LDXSPUSKBDTEKA-UHFFFAOYSA-N morniflumate Chemical compound FC(F)(F)C1=CC=CC(NC=2C(=CC=CN=2)C(=O)OCCN2CCOCC2)=C1 LDXSPUSKBDTEKA-UHFFFAOYSA-N 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- QLPQPTXSAXQCMR-UHFFFAOYSA-N morpholin-4-yl(pyridin-3-yl)methanone Chemical compound C=1C=CN=CC=1C(=O)N1CCOCC1 QLPQPTXSAXQCMR-UHFFFAOYSA-N 0.000 description 1
- DPVVFPHRCQLSNL-UHFFFAOYSA-N n,n-diphenyl-4-[4-(5-pyridin-3-ylpenta-2,4-dienoylamino)butyl]piperidine-1-carboxamide Chemical compound C=1C=CN=CC=1C=CC=CC(=O)NCCCCC(CC1)CCN1C(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 DPVVFPHRCQLSNL-UHFFFAOYSA-N 0.000 description 1
- ZFQYVYTZPJERTQ-UHFFFAOYSA-N n-(1-phenylheptyl)pyridine-3-carboxamide Chemical compound C=1C=CC=CC=1C(CCCCCC)NC(=O)C1=CC=CN=C1 ZFQYVYTZPJERTQ-UHFFFAOYSA-N 0.000 description 1
- MHFWNCHPSFKJJY-UHFFFAOYSA-N n-(1-phenylpropan-2-yl)pyridine-3-carbothioamide Chemical compound C=1C=CN=CC=1C(=S)NC(C)CC1=CC=CC=C1 MHFWNCHPSFKJJY-UHFFFAOYSA-N 0.000 description 1
- KJRJJAZBUWXZFN-UHFFFAOYSA-N n-(1-phenylpropan-2-yl)pyridine-3-carboxamide Chemical compound C=1C=CN=CC=1C(=O)NC(C)CC1=CC=CC=C1 KJRJJAZBUWXZFN-UHFFFAOYSA-N 0.000 description 1
- SJZLOWYUGKIWAK-UHFFFAOYSA-N n-(2-hydroxyethyl)pyridine-3-carboxamide Chemical compound OCCNC(=O)C1=CC=CN=C1 SJZLOWYUGKIWAK-UHFFFAOYSA-N 0.000 description 1
- NJSMWLQOCQIOPE-OCHFTUDZSA-N n-[(e)-[10-[(e)-(4,5-dihydro-1h-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydro-1h-imidazol-2-amine Chemical compound N1CCN=C1N\N=C\C(C1=CC=CC=C11)=C(C=CC=C2)C2=C1\C=N\NC1=NCCN1 NJSMWLQOCQIOPE-OCHFTUDZSA-N 0.000 description 1
- AZCHUHIVSUJYTO-UHFFFAOYSA-N n-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3-pyridin-3-ylprop-2-enamide Chemical compound O=C1C(C=23)=CC=CC3=CC=CC=2C(=O)N1CCNC(=O)C=CC1=CC=CN=C1 AZCHUHIVSUJYTO-UHFFFAOYSA-N 0.000 description 1
- IAEGMISYTZHFAU-UHFFFAOYSA-N n-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl]pyridine-3-carboxamide Chemical compound O=C1N(C=2C=CC=CC=2)N(C)C(C)=C1NC(=O)CNC(=O)C1=CC=CN=C1 IAEGMISYTZHFAU-UHFFFAOYSA-N 0.000 description 1
- FQTHEQNFMCCPND-UHFFFAOYSA-N n-[2-[1-(4-phenylbutyl)piperidin-4-yl]ethyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(CCCCC=2C=CC=CC=2)CCC1CCNC(=O)CCC1=CC=CN=C1 FQTHEQNFMCCPND-UHFFFAOYSA-N 0.000 description 1
- QCVCXTVWFJCPAR-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-2-hydroxy-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCNC(=O)C(O)CC1=CC=CN=C1 QCVCXTVWFJCPAR-UHFFFAOYSA-N 0.000 description 1
- ORFWYQXUNZBYFW-UHFFFAOYSA-N n-[4-(1-benzhydrylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide;methanesulfonic acid Chemical compound CS(O)(=O)=O.C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 ORFWYQXUNZBYFW-UHFFFAOYSA-N 0.000 description 1
- LPLXNYOOYXDJFK-UHFFFAOYSA-N n-[4-(4-phenylpiperidin-1-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(CC1)CCC1C1=CC=CC=C1 LPLXNYOOYXDJFK-UHFFFAOYSA-N 0.000 description 1
- LSHBVTSVZKMOJP-UHFFFAOYSA-N n-[4-(5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl)butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCN(C1=O)C(=O)SC1=CC1=CC=CC=C1 LSHBVTSVZKMOJP-UHFFFAOYSA-N 0.000 description 1
- CURLDCOJPPDLFP-UHFFFAOYSA-N n-[4-[(2,2-diphenylacetyl)amino]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCNC(=O)C(C=1C=CC=CC=1)C1=CC=CC=C1 CURLDCOJPPDLFP-UHFFFAOYSA-N 0.000 description 1
- GRTBFFDLPDANJH-UHFFFAOYSA-N n-[4-[1-(3,3-diphenylpropanoyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(=O)CC(C=1C=CC=CC=1)C1=CC=CC=C1 GRTBFFDLPDANJH-UHFFFAOYSA-N 0.000 description 1
- QVFBKSORXODNNN-UHFFFAOYSA-N n-[4-[1-(9-oxofluorene-4-carbonyl)piperidin-4-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(=O)C=2C=3C4=CC=CC=C4C(=O)C=3C=CC=2)CCC1CCCCNC(=O)CCC1=CC=CN=C1 QVFBKSORXODNNN-UHFFFAOYSA-N 0.000 description 1
- ROFJHDSDXDBVFQ-UHFFFAOYSA-N n-[4-[1-(anthracen-9-ylmethyl)piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(CC=2C3=CC=CC=C3C=C3C=CC=CC3=2)CCC1CCCCNC(=O)C=CC1=CC=CN=C1 ROFJHDSDXDBVFQ-UHFFFAOYSA-N 0.000 description 1
- SHVXMKWLGXBIAA-UHFFFAOYSA-N n-[4-[1-[phenyl(pyridin-3-yl)methyl]piperidin-4-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCC(CC1)CCN1C(C=1C=NC=CC=1)C1=CC=CC=C1 SHVXMKWLGXBIAA-UHFFFAOYSA-N 0.000 description 1
- MSPKFNJUVWXLCH-UHFFFAOYSA-N n-[4-[4-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3CCC3=CC=CC=C32)CCN1CCCCNC(=O)C=CC1=CC=CN=C1 MSPKFNJUVWXLCH-UHFFFAOYSA-N 0.000 description 1
- YHVQVTILSIGIDE-UHFFFAOYSA-N n-[4-[4-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)piperazin-1-yl]butyl]-5-pyridin-3-ylpenta-2,4-dienamide Chemical compound C1CN(C2C3=CC=CC=C3CCC3=CC=CC=C32)CCN1CCCCNC(=O)C=CC=CC1=CC=CN=C1 YHVQVTILSIGIDE-UHFFFAOYSA-N 0.000 description 1
- FLYHWUQSSUQINQ-UHFFFAOYSA-N n-[4-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-yl)piperazin-1-yl]butyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C2C3=CC=CC=C3OCC3=CC=CC=C32)CCN1CCCCNC(=O)CCC1=CC=CN=C1 FLYHWUQSSUQINQ-UHFFFAOYSA-N 0.000 description 1
- YINZYZWIBJJCMX-UHFFFAOYSA-N n-[4-[4-[(4-aminophenyl)-phenylmethyl]piperazin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1=CC(N)=CC=C1C(C=1C=CC=CC=1)N1CCN(CCCCNC(=O)C=CC=2C=NC=CC=2)CC1 YINZYZWIBJJCMX-UHFFFAOYSA-N 0.000 description 1
- DORZSCZPSGZOKB-UHFFFAOYSA-N n-[5-(1-benzhydrylpiperidin-4-yl)pentyl]-3-pyridin-3-ylpropanamide Chemical compound C1CN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CCC1CCCCCNC(=O)CCC1=CC=CN=C1 DORZSCZPSGZOKB-UHFFFAOYSA-N 0.000 description 1
- MMTIFNOYPVXYLB-UHFFFAOYSA-N n-[6-[4-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)piperazin-1-yl]hexyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C1CN(C2C3=CC=CC=C3CCC3=CC=CC=C32)CCN1CCCCCCNC(=O)C=CC1=CC=CN=C1 MMTIFNOYPVXYLB-UHFFFAOYSA-N 0.000 description 1
- BIXSSMJSZJRUSO-UHFFFAOYSA-N n-[8,8-bis(4-fluorophenyl)octyl]-3-pyridin-3-ylprop-2-enamide;hydrochloride Chemical compound Cl.C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCCCCCNC(=O)C=CC1=CC=CN=C1 BIXSSMJSZJRUSO-UHFFFAOYSA-N 0.000 description 1
- AGGJAKIWECHSCV-UHFFFAOYSA-N n-[8-(1-benzhydrylpiperidin-4-yl)octyl]-3-pyridin-3-ylprop-2-enamide Chemical compound C=1C=CN=CC=1C=CC(=O)NCCCCCCCCC(CC1)CCN1C(C=1C=CC=CC=1)C1=CC=CC=C1 AGGJAKIWECHSCV-UHFFFAOYSA-N 0.000 description 1
- HLMSEQWISJOZRY-UHFFFAOYSA-N n-naphthalen-1-yl-4-[4-(3-pyridin-3-ylpropanoylamino)butyl]piperazine-1-carboxamide Chemical compound C1CN(C(=O)NC=2C3=CC=CC=C3C=CC=2)CCN1CCCCNC(=O)CCC1=CC=CN=C1 HLMSEQWISJOZRY-UHFFFAOYSA-N 0.000 description 1
- 239000002088 nanocapsule Substances 0.000 description 1
- WURUEAGEEANDFN-UHFFFAOYSA-N naphtho[2,3-f]isoindole-1,3-dione Chemical compound C1=CC=C2C=C(C=C3C(=O)NC(=O)C3=C3)C3=CC2=C1 WURUEAGEEANDFN-UHFFFAOYSA-N 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 208000025189 neoplasm of testis Diseases 0.000 description 1
- 125000000627 niacin group Chemical group 0.000 description 1
- RSKQGBFMNPDPLR-UHFFFAOYSA-N niaprazine Chemical compound C=1C=CN=CC=1C(=O)NC(C)CCN(CC1)CCN1C1=CC=C(F)C=C1 RSKQGBFMNPDPLR-UHFFFAOYSA-N 0.000 description 1
- XPPXHQUWVYMTDM-UHFFFAOYSA-N nicoclonate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)OC(=O)C1=CC=CN=C1 XPPXHQUWVYMTDM-UHFFFAOYSA-N 0.000 description 1
- HNDXBGYRMHRUFN-CIVUWBIHSA-N nicomorphine Chemical compound O([C@H]1C=C[C@H]2[C@H]3CC=4C5=C(C(=CC=4)OC(=O)C=4C=NC=CC=4)O[C@@H]1[C@]52CCN3C)C(=O)C1=CC=CN=C1 HNDXBGYRMHRUFN-CIVUWBIHSA-N 0.000 description 1
- 229960004300 nicomorphine Drugs 0.000 description 1
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 1
- 229960004738 nicotinyl alcohol Drugs 0.000 description 1
- NCYVXEGFNDZQCU-UHFFFAOYSA-N nikethamide Chemical compound CCN(CC)C(=O)C1=CC=CN=C1 NCYVXEGFNDZQCU-UHFFFAOYSA-N 0.000 description 1
- 229960003226 nikethamide Drugs 0.000 description 1
- 239000002353 niosome Substances 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 229960005343 ondansetron Drugs 0.000 description 1
- COWNFYYYZFRNOY-UHFFFAOYSA-N oxazolidinedione Chemical compound O=C1COC(=O)N1 COWNFYYYZFRNOY-UHFFFAOYSA-N 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 238000006213 oxygenation reaction Methods 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- ZFLIKDUSUDBGCD-UHFFFAOYSA-N parabanic acid Chemical compound O=C1NC(=O)C(=O)N1 ZFLIKDUSUDBGCD-UHFFFAOYSA-N 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229940021222 peritoneal dialysis isotonic solution Drugs 0.000 description 1
- LCCQEESYPUHVCT-UHFFFAOYSA-N phenanthro[9,10-c]pyrrole-1,3-dione Chemical compound C12=CC=CC=C2C2=CC=CC=C2C2=C1C(=O)NC2=O LCCQEESYPUHVCT-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- DHHVAGZRUROJKS-UHFFFAOYSA-N phentermine Chemical compound CC(C)(N)CC1=CC=CC=C1 DHHVAGZRUROJKS-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical class NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 1
- CYJAWBVQRMVFEO-UHFFFAOYSA-N piperazine-2,6-dione Chemical compound O=C1CNCC(=O)N1 CYJAWBVQRMVFEO-UHFFFAOYSA-N 0.000 description 1
- KNCYXPMJDCCGSJ-UHFFFAOYSA-N piperidine-2,6-dione Chemical compound O=C1CCCC(=O)N1 KNCYXPMJDCCGSJ-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920005575 poly(amic acid) Polymers 0.000 description 1
- 229920001308 poly(aminoacid) Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 108010064470 polyaspartate Proteins 0.000 description 1
- 229920002721 polycyanoacrylate Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000008389 polyethoxylated castor oil Substances 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229960003910 promethazine Drugs 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- XJMOSONTPMZWPB-UHFFFAOYSA-M propidium iodide Chemical compound [I-].[I-].C12=CC(N)=CC=C2C2=CC=C(N)C=C2[N+](CCC[N+](C)(CC)CC)=C1C1=CC=CC=C1 XJMOSONTPMZWPB-UHFFFAOYSA-M 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- IGFXRKMLLMBKSA-UHFFFAOYSA-N purine Chemical compound N1=C[N]C2=NC=NC2=C1 IGFXRKMLLMBKSA-UHFFFAOYSA-N 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- 125000005554 pyridyloxy group Chemical group 0.000 description 1
- ZRKGTINFVOLLNT-UHFFFAOYSA-N pyrrolo[3,4-b]pyridine-5,7-dione Chemical compound C1=CC=C2C(=O)NC(=O)C2=N1 ZRKGTINFVOLLNT-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000000637 radiosensitizating effect Effects 0.000 description 1
- ZAHRKKWIAAJSAO-UHFFFAOYSA-N rapamycin Natural products COCC(O)C(=C/C(C)C(=O)CC(OC(=O)C1CCCCN1C(=O)C(=O)C2(O)OC(CC(OC)C(=CC=CC=CC(C)CC(C)C(=O)C)C)CCC2C)C(C)CC3CCC(O)C(C3)OC)C ZAHRKKWIAAJSAO-UHFFFAOYSA-N 0.000 description 1
- 206010038038 rectal cancer Diseases 0.000 description 1
- 208000020615 rectal carcinoma Diseases 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 235000019192 riboflavin Nutrition 0.000 description 1
- 229960002477 riboflavin Drugs 0.000 description 1
- 239000002151 riboflavin Substances 0.000 description 1
- AYJVGKWCGIYEAK-UHFFFAOYSA-N ronifibrate Chemical compound C=1C=CN=CC=1C(=O)OCCCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 AYJVGKWCGIYEAK-UHFFFAOYSA-N 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 201000000379 schizophrenia 2 Diseases 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- QFJCIRLUMZQUOT-HPLJOQBZSA-N sirolimus Chemical compound C1C[C@@H](O)[C@H](OC)C[C@@H]1C[C@@H](C)[C@H]1OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@](O)(O2)[C@H](C)CC[C@H]2C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C(=O)[C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(=O)C1 QFJCIRLUMZQUOT-HPLJOQBZSA-N 0.000 description 1
- 229960002930 sirolimus Drugs 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000001433 sodium tartrate Substances 0.000 description 1
- 229960002167 sodium tartrate Drugs 0.000 description 1
- 235000011004 sodium tartrates Nutrition 0.000 description 1
- JUJBNYBVVQSIOU-UHFFFAOYSA-M sodium;4-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzene-1,3-disulfonate Chemical compound [Na+].C1=CC([N+](=O)[O-])=CC=C1N1[N+](C=2C=CC(I)=CC=2)=NC(C=2C(=CC(=CC=2)S([O-])(=O)=O)S([O-])(=O)=O)=N1 JUJBNYBVVQSIOU-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 229940124547 specific antidotes Drugs 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 210000004989 spleen cell Anatomy 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 229940098466 sublingual tablet Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- FIAFUQMPZJWCLV-UHFFFAOYSA-N suramin Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=C2C(NC(=O)C3=CC=C(C(=C3)NC(=O)C=3C=C(NC(=O)NC=4C=C(C=CC=4)C(=O)NC=4C(=CC=C(C=4)C(=O)NC=4C5=C(C=C(C=C5C(=CC=4)S(O)(=O)=O)S(O)(=O)=O)S(O)(=O)=O)C)C=CC=3)C)=CC=C(S(O)(=O)=O)C2=C1 FIAFUQMPZJWCLV-UHFFFAOYSA-N 0.000 description 1
- 229960005314 suramin Drugs 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000007910 systemic administration Methods 0.000 description 1
- 229940126703 systemic medication Drugs 0.000 description 1
- QJJXYPPXXYFBGM-SHYZHZOCSA-N tacrolimus Natural products CO[C@H]1C[C@H](CC[C@@H]1O)C=C(C)[C@H]2OC(=O)[C@H]3CCCCN3C(=O)C(=O)[C@@]4(O)O[C@@H]([C@H](C[C@H]4C)OC)[C@@H](C[C@H](C)CC(=C[C@@H](CC=C)C(=O)C[C@H](O)[C@H]2C)C)OC QJJXYPPXXYFBGM-SHYZHZOCSA-N 0.000 description 1
- 229960001967 tacrolimus Drugs 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 201000003120 testicular cancer Diseases 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 230000009974 thixotropic effect Effects 0.000 description 1
- RQAITHJHUFFEIV-UHFFFAOYSA-N thurfyl nicotinate Chemical compound C=1C=CN=CC=1C(=O)OCC1CCCO1 RQAITHJHUFFEIV-UHFFFAOYSA-N 0.000 description 1
- 229950006036 thurfyl nicotinate Drugs 0.000 description 1
- 201000002510 thyroid cancer Diseases 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 1
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 1
- 229960000303 topotecan Drugs 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- UMFCIIBZHQXRCJ-NSCUHMNNSA-N trans-anol Chemical compound C\C=C\C1=CC=C(O)C=C1 UMFCIIBZHQXRCJ-NSCUHMNNSA-N 0.000 description 1
- 239000012581 transferrin Substances 0.000 description 1
- 238000002054 transplantation Methods 0.000 description 1
- 239000006163 transport media Substances 0.000 description 1
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- FEZBIKUBAYAZIU-UHFFFAOYSA-N trimethobenzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NCC=2C=CC(OCCN(C)C)=CC=2)=C1 FEZBIKUBAYAZIU-UHFFFAOYSA-N 0.000 description 1
- 229960004161 trimethobenzamide Drugs 0.000 description 1
- 229960001099 trimetrexate Drugs 0.000 description 1
- NOYPYLRCIDNJJB-UHFFFAOYSA-N trimetrexate Chemical compound COC1=C(OC)C(OC)=CC(NCC=2C(=C3C(N)=NC(N)=NC3=CC=2)C)=C1 NOYPYLRCIDNJJB-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 208000010380 tumor lysis syndrome Diseases 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000000277 virosome Substances 0.000 description 1
- 210000003905 vulva Anatomy 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/63—Compounds containing para-N-benzenesulfonyl-N-groups, e.g. sulfanilamide, p-nitrobenzenesulfonyl hydrazide
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4406—Non condensed pyridines; Hydrogenated derivatives thereof only substituted in position 3, e.g. zimeldine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4523—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems
- A61K31/4545—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems containing a six-membered ring with nitrogen as a ring hetero atom, e.g. pipamperone, anabasine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
- A61K31/553—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole having at least one nitrogen and one oxygen as ring hetero atoms, e.g. loxapine, staurosporine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P39/00—General protective or antinoxious agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Epidemiology (AREA)
- Organic Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Toxicology (AREA)
- Transplantation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicinal Preparation (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19818044A DE19818044A1 (de) | 1998-04-22 | 1998-04-22 | Verwendung von Vitamin-PP-Verbindungen |
| DK99922119T DK1079832T3 (da) | 1998-04-22 | 1999-04-21 | Anvendelse af vitamin-PP-forbindelser |
| PCT/EP1999/002686 WO1999053920A1 (en) | 1998-04-22 | 1999-04-21 | Use of vitamin pp compounds |
| DE69928660T DE69928660T2 (de) | 1998-04-22 | 1999-04-21 | Verwendung von vitamin-pp-verbindungen |
| JP2000544324A JP4607319B2 (ja) | 1998-04-22 | 1999-04-21 | ビタミンpp化合物の使用 |
| ES99922119T ES2253890T3 (es) | 1998-04-22 | 1999-04-21 | Uso de compuestos de vitamina pp. |
| EP99922119A EP1079832B1 (en) | 1998-04-22 | 1999-04-21 | Use of vitamin pp compounds |
| AT99922119T ATE311186T1 (de) | 1998-04-22 | 1999-04-21 | Verwendung von vitamin pp verbindungen |
| AU39282/99A AU3928299A (en) | 1998-04-22 | 1999-04-21 | Use of vitamin pp compounds |
| US12/779,698 US20100227896A1 (en) | 1998-04-22 | 2010-05-13 | Use of vitamin pp compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19818044A DE19818044A1 (de) | 1998-04-22 | 1998-04-22 | Verwendung von Vitamin-PP-Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE19818044A1 true DE19818044A1 (de) | 1999-10-28 |
Family
ID=7865483
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19818044A Ceased DE19818044A1 (de) | 1998-04-22 | 1998-04-22 | Verwendung von Vitamin-PP-Verbindungen |
| DE69928660T Expired - Lifetime DE69928660T2 (de) | 1998-04-22 | 1999-04-21 | Verwendung von vitamin-pp-verbindungen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69928660T Expired - Lifetime DE69928660T2 (de) | 1998-04-22 | 1999-04-21 | Verwendung von vitamin-pp-verbindungen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US20100227896A1 (cg-RX-API-DMAC7.html) |
| EP (1) | EP1079832B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP4607319B2 (cg-RX-API-DMAC7.html) |
| AT (1) | ATE311186T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU3928299A (cg-RX-API-DMAC7.html) |
| DE (2) | DE19818044A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK1079832T3 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2253890T3 (cg-RX-API-DMAC7.html) |
| WO (1) | WO1999053920A1 (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000007580A3 (en) * | 1998-08-03 | 2000-05-18 | Gene Kutato Kft N | Pharmaceutical compositions against autoimmune diseases |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB0104240D0 (en) | 2001-02-21 | 2001-04-11 | Clariant Int Ltd | Copolymer composition having pigment like properties |
| EP1348434A1 (en) * | 2002-03-27 | 2003-10-01 | Fujisawa Deutschland GmbH | Use of pyridyl amides as inhibitors of angiogenesis |
| US8067457B2 (en) | 2005-11-01 | 2011-11-29 | Millennium Pharmaceuticals, Inc. | Compounds useful as antagonists of CCR2 |
| WO2007053499A2 (en) | 2005-11-01 | 2007-05-10 | Millennium Pharmaceuticals, Inc. | Compounds useful as antagonists of ccr2 |
| WO2009072004A2 (en) * | 2007-09-26 | 2009-06-11 | Gemin X Pharmaceuticals Canada, Inc. | Compositions and methods for effecting nad+ levels using a nicotinamide phosphoribosyl transferase inhibitor |
| EP2213288A1 (en) * | 2009-01-30 | 2010-08-04 | Karl Welte | NAMPT and vitamin B3 for treating or preventing diseases |
| CA2768338A1 (en) | 2009-07-17 | 2011-01-20 | Topotarget A/S | Method for predicting the utility of administering nicotinic acid or a precursor or prodrug thereof to reduce the severity of side-effects of cancer treatment with nicotinamide phosphoribosyltransferase inhibitors |
| US8912184B1 (en) | 2010-03-01 | 2014-12-16 | Alzheimer's Institute Of America, Inc. | Therapeutic and diagnostic methods |
| US8791045B2 (en) | 2011-11-09 | 2014-07-29 | Kimberly-Clark Worldwide, Inc. | Non-tacky wetness indicator composition for application on a polymeric substrate |
| US9889222B2 (en) | 2011-11-09 | 2018-02-13 | Kimberly-Clark Worldwide, Inc. | Aqueous medium-sensitive coating compositions for triggered release of active ingredients and visual indication for wetness |
| US9585826B2 (en) | 2012-11-07 | 2017-03-07 | Kimberly-Clark Worldwide, Inc. | Triggerable compositions for two-stage, controlled release of active chemistry |
| HK1215579A1 (zh) | 2012-11-29 | 2016-09-02 | Karyopharm Therapeutics, Inc. | 被取代的2,3-二氫苯並呋喃基化合物和其用途 |
| DK3016946T3 (da) | 2013-07-03 | 2023-01-09 | Karyopharm Therapeutics Inc | Substituerede benzofuranyl- og benzoxazolylforbindelser og anvendelser deraf |
| US9994558B2 (en) | 2013-09-20 | 2018-06-12 | Karyopharm Therapeutics Inc. | Multicyclic compounds and methods of using same |
| US9119780B2 (en) | 2013-10-30 | 2015-09-01 | Kimberly-Clark Worldwide, Inc. | Triggerable compositions for two-stage, controlled release of proactive chemistry |
| WO2017031323A1 (en) | 2015-08-18 | 2017-02-23 | Karyopharm Therapeutics Inc. | (s,e)-3-(6-aminopyridin-3-yl)-n-((5-(4-(3-fluoro-3-methylpyrrolidine-1-carbonyl)phenyl)-7-(4-fluorophenyl)benzofuran-2-yl)methyl)acrylamide for the treatment of cancer |
| US10858347B2 (en) | 2015-12-31 | 2020-12-08 | Karyopharm Therapeutics Inc. | Multicyclic compounds and uses thereof |
| RU2651047C1 (ru) * | 2017-05-04 | 2018-04-18 | Общество С Ограниченной Ответственностью "Научно-Технологическая Фармацевтическая Фирма "Полисан" | Лекарственная композиция цитопротекторного действия и способ ее получения |
| WO2019153007A2 (en) * | 2018-02-05 | 2019-08-08 | The Boaro Of Trustees Of The University Of Illinois | Nicotinamide phosphoribosyltransferase inhibitors and methods for use of the same |
| CN115177594B (zh) * | 2022-07-04 | 2023-08-15 | 武汉大学中南医院 | 一种阿昔替尼药物制剂及其制备方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3148115A (en) * | 1958-12-08 | 1964-09-08 | Horner Frank W Ltd | Potentiation of tumor-growth inhibition from deoxypyridoxine, testosterone, or 6-mercaptopurine, by 6-aminonicotinamide |
| JPH04103538A (ja) * | 1990-08-24 | 1992-04-06 | Ajinomoto Co Inc | 制癌剤副作用抑制剤 |
| US5547927A (en) * | 1993-05-28 | 1996-08-20 | Abbott Laboratories | Enteral nutritional product for patients undergoing radiation therapy and/or chemotherapy |
| FI970588A7 (fi) * | 1994-08-12 | 1997-04-11 | Wellstat Therapeutics Corp | Menetelmät verenmyrkytyksen tai tulehdussairauksien hoitamiseksi oksipuriininukleosideillä |
| JPH0881371A (ja) * | 1994-09-09 | 1996-03-26 | Suntory Ltd | 造血機能亢進剤 |
| EP0800829B2 (en) * | 1994-12-29 | 2012-07-25 | Chugai Seiyaku Kabushiki Kaisha | Use of a pm-1 antibody or of a mh 166 antibody for enhancing the anti-tumor effect of cisplatin or carboplatin |
| JP3119430B2 (ja) * | 1995-07-25 | 2000-12-18 | 大鵬薬品工業株式会社 | 水酸基ラジカル消去剤 |
| JP2860637B2 (ja) * | 1995-12-11 | 1999-02-24 | 末綱 陽子 | 新規なペプチドおよび活性化酸素阻害剤 |
| JP3836203B2 (ja) * | 1995-12-20 | 2006-10-25 | 日本臓器製薬株式会社 | 活性酸素・フリーラジカル消去剤 |
| DE19624668A1 (de) * | 1996-06-20 | 1998-02-19 | Klinge Co Chem Pharm Fab | Verwendung von Pyridylalkan-, Pyridylalken- bzw. Pyridylalkinsäureamiden |
| DE19624704A1 (de) * | 1996-06-20 | 1998-01-08 | Klinge Co Chem Pharm Fab | Neue Pyridylalkansäureamide |
| US6451816B1 (en) * | 1997-06-20 | 2002-09-17 | Klinge Pharma Gmbh | Use of pyridyl alkane, pyridyl alkene and/or pyridyl alkine acid amides in the treatment of tumors or for immunosuppression |
| DE19624659A1 (de) * | 1996-06-20 | 1998-01-08 | Klinge Co Chem Pharm Fab | Neue Pyridylalken- und Pyridylalkinsäureamide |
| JPH1036260A (ja) * | 1996-07-18 | 1998-02-10 | Mitsui Norin Kk | 抗ガン剤の効力増強方法 |
| JPH1045594A (ja) * | 1996-07-30 | 1998-02-17 | Mitsubishi Gas Chem Co Inc | 活性酸素消去剤 |
-
1998
- 1998-04-22 DE DE19818044A patent/DE19818044A1/de not_active Ceased
-
1999
- 1999-04-21 WO PCT/EP1999/002686 patent/WO1999053920A1/en not_active Ceased
- 1999-04-21 AT AT99922119T patent/ATE311186T1/de active
- 1999-04-21 DK DK99922119T patent/DK1079832T3/da active
- 1999-04-21 EP EP99922119A patent/EP1079832B1/en not_active Expired - Lifetime
- 1999-04-21 AU AU39282/99A patent/AU3928299A/en not_active Abandoned
- 1999-04-21 JP JP2000544324A patent/JP4607319B2/ja not_active Expired - Fee Related
- 1999-04-21 DE DE69928660T patent/DE69928660T2/de not_active Expired - Lifetime
- 1999-04-21 ES ES99922119T patent/ES2253890T3/es not_active Expired - Lifetime
-
2010
- 2010-05-13 US US12/779,698 patent/US20100227896A1/en not_active Abandoned
Non-Patent Citations (3)
| Title |
|---|
| Chem. Abstr.115:150041w * |
| Chem. Abstr.124:173015r * |
| Rote Liste 1997, Nr.86013 * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000007580A3 (en) * | 1998-08-03 | 2000-05-18 | Gene Kutato Kft N | Pharmaceutical compositions against autoimmune diseases |
Also Published As
| Publication number | Publication date |
|---|---|
| DK1079832T3 (da) | 2006-04-03 |
| AU3928299A (en) | 1999-11-08 |
| ATE311186T1 (de) | 2005-12-15 |
| WO1999053920A1 (en) | 1999-10-28 |
| US20100227896A1 (en) | 2010-09-09 |
| DE69928660T2 (de) | 2006-09-14 |
| JP4607319B2 (ja) | 2011-01-05 |
| ES2253890T3 (es) | 2006-06-01 |
| EP1079832B1 (en) | 2005-11-30 |
| JP2002512190A (ja) | 2002-04-23 |
| EP1079832A1 (en) | 2001-03-07 |
| DE69928660D1 (de) | 2006-01-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69928660T2 (de) | Verwendung von vitamin-pp-verbindungen | |
| DE69831877T2 (de) | Neue piperazinyl-substituierte pyridylalkan, alken and alkin carboxamide | |
| DE69715888T2 (de) | Pyridylalken- und pyridylalkin-säureamide als cytostatika und immunosuppressive arzneimittel | |
| DE69715861T2 (de) | Verwendung von pyridyl-alkan-,pyridiyl alkan- und/oder pyridyl-säuren amiden zur behandlung von tumoren oder für immunsuppression | |
| JP5180816B2 (ja) | 神経変性疾患および認知症のためのジヒドロピリジン化合物 | |
| DE19756261A1 (de) | Neue arylsubstituierte Pyridylalkan-, alken- und alkincarbonsäureamide | |
| DE69715439T2 (de) | Pyridylalkan-säureamide als cytostatika und immunosupressive arzneimittel | |
| DE60216139T2 (de) | Arylharnstoff-verbindungen in kombination mit anderen zytostatisch oder zytotoxisch wirksamen stoffen zur behandlung menschlicher krebserkrankungen | |
| DE69823229T2 (de) | Zyklisch imid-substituierte pyridylalkan-, alken-, und alkin- carboxamid-derivate, verwendbar als zytostatische und immunosuppressive mittel | |
| JP7777624B2 (ja) | 糖尿病性末梢神経障害のための医薬 | |
| CA2659605A1 (en) | Inhibitors of undecaprenyl pyrophosphate synthase | |
| EP2242492A1 (en) | Antitumoral agents with a benzophenanthridine structure and formulations containing them | |
| KR20010023413A (ko) | 뉴런 활성을 가진 화합물 | |
| SK8982000A3 (en) | Combination of benzocycloheptapyridine compounds and antineoplastic drugs for treating proliferative diseases | |
| CN117157281B (zh) | 1,2,4,5-四噁烷化合物的靶向递送及其用途 | |
| EP2301547A1 (de) | Verwendung von Aktivatoren der löslichen Guanylatzyklase zur Förderung der Wundheilung | |
| CA1087987A (en) | Pharmaceutical composition containing 3- phenoxypyridine | |
| CN102378630A (zh) | 用于治疗精神分裂症的包含2,4,6-三氨基-1,3,5-三嗪衍生物的组合物 | |
| HK1021974B (en) | Pyridyl alkene-and pyridyl alkine-acid amides as cytostatics and immunosuppressives | |
| MXPA99011155A (en) | Peripherally acting anti-pruritic opiates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8131 | Rejection |