DE1919048B2 - - Google Patents
Info
- Publication number
- DE1919048B2 DE1919048B2 DE1919048A DE1919048A DE1919048B2 DE 1919048 B2 DE1919048 B2 DE 1919048B2 DE 1919048 A DE1919048 A DE 1919048A DE 1919048 A DE1919048 A DE 1919048A DE 1919048 B2 DE1919048 B2 DE 1919048B2
- Authority
- DE
- Germany
- Prior art keywords
- cycloalkenes
- chloro
- aliphatic
- opening polymerization
- nitro compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000003054 catalyst Substances 0.000 claims description 16
- 150000001925 cycloalkenes Chemical class 0.000 claims description 12
- -1 aromatic nitro compound Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 8
- 238000006116 polymerization reaction Methods 0.000 claims description 7
- 239000000178 monomer Substances 0.000 claims description 6
- 238000007151 ring opening polymerisation reaction Methods 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 125000002524 organometallic group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 claims description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 10
- 229920000642 polymer Polymers 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 4
- 230000000737 periodic effect Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 230000003712 anti-aging effect Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- WDCYWAQPCXBPJA-UHFFFAOYSA-N 1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1 WDCYWAQPCXBPJA-UHFFFAOYSA-N 0.000 description 1
- OBRJNJHIDOWUTJ-UHFFFAOYSA-N 1,5-dichloro-2,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(Cl)=C1[N+]([O-])=O OBRJNJHIDOWUTJ-UHFFFAOYSA-N 0.000 description 1
- ZUTCJXFCHHDFJS-UHFFFAOYSA-N 1,5-dinitronaphthalene Chemical compound C1=CC=C2C([N+](=O)[O-])=CC=CC2=C1[N+]([O-])=O ZUTCJXFCHHDFJS-UHFFFAOYSA-N 0.000 description 1
- HJRJRUMKQCMYDL-UHFFFAOYSA-N 1-chloro-2,4,6-trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1 HJRJRUMKQCMYDL-UHFFFAOYSA-N 0.000 description 1
- KMAQZIILEGKYQZ-UHFFFAOYSA-N 1-chloro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1 KMAQZIILEGKYQZ-UHFFFAOYSA-N 0.000 description 1
- YGYZHNBAXADALT-UHFFFAOYSA-N 1-chloro-4-(chloromethylsulfonyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(S(=O)(=O)CCl)=CC=C1Cl YGYZHNBAXADALT-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- KAQBNBSMMVTKRN-UHFFFAOYSA-N 2,4,6-trinitrobenzoic acid Chemical compound OC(=O)C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O KAQBNBSMMVTKRN-UHFFFAOYSA-N 0.000 description 1
- XQDQRCRASHAZBA-UHFFFAOYSA-N 2,4-dinitro-1-thiocyanatobenzene Chemical compound [O-][N+](=O)C1=CC=C(SC#N)C([N+]([O-])=O)=C1 XQDQRCRASHAZBA-UHFFFAOYSA-N 0.000 description 1
- CVYZVNVPQRKDLW-UHFFFAOYSA-N 2,4-dinitroanisole Chemical compound COC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O CVYZVNVPQRKDLW-UHFFFAOYSA-N 0.000 description 1
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 1
- HORQAOAYAYGIBM-UHFFFAOYSA-N 2,4-dinitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HORQAOAYAYGIBM-UHFFFAOYSA-N 0.000 description 1
- NNOHXABAQAGKRZ-UHFFFAOYSA-N 3,5-dinitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC(C(Cl)=O)=CC([N+]([O-])=O)=C1 NNOHXABAQAGKRZ-UHFFFAOYSA-N 0.000 description 1
- LWFUFLREGJMOIZ-UHFFFAOYSA-N 3,5-dinitrosalicylic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O LWFUFLREGJMOIZ-UHFFFAOYSA-N 0.000 description 1
- CXOZQHPXKPDQGT-UHFFFAOYSA-N 3-Methylcyclopentene Chemical compound CC1CCC=C1 CXOZQHPXKPDQGT-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- OSAYFGJUEOYRHY-UHFFFAOYSA-N 4-chloro-1-methoxy-2-nitrobenzene Chemical compound COC1=CC=C(Cl)C=C1[N+]([O-])=O OSAYFGJUEOYRHY-UHFFFAOYSA-N 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 101100425947 Mus musculus Tnfrsf13b gene Proteins 0.000 description 1
- BNUHAJGCKIQFGE-UHFFFAOYSA-N Nitroanisol Chemical compound COC1=CC=C([N+]([O-])=O)C=C1 BNUHAJGCKIQFGE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910010165 TiCu Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- CFBGXYDUODCMNS-UHFFFAOYSA-N cyclobutene Chemical compound C1CC=C1 CFBGXYDUODCMNS-UHFFFAOYSA-N 0.000 description 1
- UCIYGNATMHQYCT-OWOJBTEDSA-N cyclodecene Chemical compound C1CCCC\C=C\CCC1 UCIYGNATMHQYCT-OWOJBTEDSA-N 0.000 description 1
- HYPABJGVBDSCIT-UPHRSURJSA-N cyclododecene Chemical compound C1CCCCC\C=C/CCCC1 HYPABJGVBDSCIT-UPHRSURJSA-N 0.000 description 1
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 1
- URYYVOIYTNXXBN-UPHRSURJSA-N cyclooctene Chemical compound C1CCC\C=C/CC1 URYYVOIYTNXXBN-UPHRSURJSA-N 0.000 description 1
- 239000004913 cyclooctene Substances 0.000 description 1
- GMUVJAZTJOCSND-OWOJBTEDSA-N cycloundecene Chemical compound C1CCCC\C=C\CCCC1 GMUVJAZTJOCSND-OWOJBTEDSA-N 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000004999 nitroaryl group Chemical group 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- SJYNFBVQFBRSIB-UHFFFAOYSA-N norbornadiene Chemical compound C1=CC2C=CC1C2 SJYNFBVQFBRSIB-UHFFFAOYSA-N 0.000 description 1
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920003246 polypentenamer Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G61/00—Macromolecular compounds obtained by reactions forming a carbon-to-carbon link in the main chain of the macromolecule
- C08G61/02—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes
- C08G61/04—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes only aliphatic carbon atoms
- C08G61/06—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes only aliphatic carbon atoms prepared by ring-opening of carbocyclic compounds
- C08G61/08—Macromolecular compounds containing only carbon atoms in the main chain of the macromolecule, e.g. polyxylylenes only aliphatic carbon atoms prepared by ring-opening of carbocyclic compounds of carbocyclic compounds containing one or more carbon-to-carbon double bonds in the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyoxymethylene Polymers And Polymers With Carbon-To-Carbon Bonds (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymerization Catalysts (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691919048 DE1919048A1 (de) | 1969-04-15 | 1969-04-15 | Herstellung von Polyalkenameren |
| US26185A US3684787A (en) | 1969-04-15 | 1970-04-06 | Preparation of polyalkenamers |
| CA079,414A CA953847A (en) | 1969-04-15 | 1970-04-07 | Preparation of polyalkenamers |
| AT325770A AT297311B (de) | 1969-04-15 | 1970-04-09 | Verfahren zur ringöffnenden Polymerisation von Cycloolefinen |
| NL7005356A NL7005356A (enExample) | 1969-04-15 | 1970-04-14 | |
| GB07943/70A GB1294595A (en) | 1969-04-15 | 1970-04-15 | Preparation of polyalkenamers |
| BE749006D BE749006A (fr) | 1969-04-15 | 1970-04-15 | Preparation de polyalcenameres |
| ES378610A ES378610A1 (es) | 1969-04-15 | 1970-04-15 | Procedimiento para polimerizar y copolimerizar cicloalque- nos con apertura de anillo. |
| FR7013648A FR2039196B1 (enExample) | 1969-04-15 | 1970-04-15 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691919048 DE1919048A1 (de) | 1969-04-15 | 1969-04-15 | Herstellung von Polyalkenameren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1919048A1 DE1919048A1 (de) | 1970-12-23 |
| DE1919048B2 true DE1919048B2 (enExample) | 1978-03-30 |
Family
ID=5731243
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691919048 Withdrawn DE1919048A1 (de) | 1969-04-15 | 1969-04-15 | Herstellung von Polyalkenameren |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3684787A (enExample) |
| AT (1) | AT297311B (enExample) |
| BE (1) | BE749006A (enExample) |
| CA (1) | CA953847A (enExample) |
| DE (1) | DE1919048A1 (enExample) |
| ES (1) | ES378610A1 (enExample) |
| FR (1) | FR2039196B1 (enExample) |
| GB (1) | GB1294595A (enExample) |
| NL (1) | NL7005356A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2106302C3 (de) * | 1971-02-10 | 1979-06-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur Polymerisation von acyclischen Verbindungen |
| DE3372102D1 (en) * | 1982-01-25 | 1987-07-23 | Hercules Inc | A dicyclopentadiene thermoset polymer and a catalyst and a method for making it |
| US4699963A (en) * | 1982-01-25 | 1987-10-13 | Hercules Incorporated | Method of cycloolefin polymerization |
| US4568660A (en) * | 1982-01-25 | 1986-02-04 | Hercules Incorporated | Cycloolefin polymerization catalyst composition |
| US4507453A (en) * | 1982-01-25 | 1985-03-26 | Hercules Incorporated | Dicyclopentadiene thermoset polymer |
| US4598102A (en) * | 1983-11-17 | 1986-07-01 | Hercules Incorporated | Method, composition and product produced by delayed gelation in the polymerization of cycloolefins |
| US4696985A (en) * | 1984-11-16 | 1987-09-29 | Hercules Incorporated | Catalyst composition for polymerization of cycloolefins |
| US4708969A (en) * | 1984-11-16 | 1987-11-24 | Hercules Incorporated | Cycloolefin composition and method for making high TG fiber reinforced polymeric product |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE576984A (enExample) * | 1958-03-24 | |||
| US3458489A (en) * | 1963-04-10 | 1969-07-29 | Montedison Spa | Homopolymers of cyclopentene and processes for preparing the same |
| NL123148C (enExample) * | 1963-08-26 | |||
| GB1035282A (en) * | 1964-01-17 | 1966-07-06 | Montedison Spa | High molecular weight unsaturated hydrocarbon homopolymers |
| NL144291B (nl) * | 1965-02-11 | 1974-12-16 | Montedison Spa | Werkwijze om lineaire homopolymeren van cycloalkenen te bereiden. |
| BE688500A (enExample) * | 1965-10-20 | 1967-04-19 |
-
1969
- 1969-04-15 DE DE19691919048 patent/DE1919048A1/de not_active Withdrawn
-
1970
- 1970-04-06 US US26185A patent/US3684787A/en not_active Expired - Lifetime
- 1970-04-07 CA CA079,414A patent/CA953847A/en not_active Expired
- 1970-04-09 AT AT325770A patent/AT297311B/de not_active IP Right Cessation
- 1970-04-14 NL NL7005356A patent/NL7005356A/xx not_active Application Discontinuation
- 1970-04-15 BE BE749006D patent/BE749006A/xx unknown
- 1970-04-15 FR FR7013648A patent/FR2039196B1/fr not_active Expired
- 1970-04-15 ES ES378610A patent/ES378610A1/es not_active Expired
- 1970-04-15 GB GB07943/70A patent/GB1294595A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3684787A (en) | 1972-08-15 |
| CA953847A (en) | 1974-08-27 |
| NL7005356A (enExample) | 1970-10-19 |
| FR2039196A1 (enExample) | 1971-01-15 |
| DE1919048A1 (de) | 1970-12-23 |
| FR2039196B1 (enExample) | 1976-02-06 |
| BE749006A (fr) | 1970-09-16 |
| ES378610A1 (es) | 1972-07-16 |
| GB1294595A (en) | 1972-11-01 |
| AT297311B (de) | 1972-03-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2027905B2 (de) | Verfahren zur herstellung von polyalkenameren | |
| DE1770491B2 (de) | Verfahren zur Herstellung von trans-Polynentenamer | |
| DE2028935C3 (de) | Polyalkenamere und Verfahren zu deren Herstellung | |
| DE1919048B2 (enExample) | ||
| DE1795738A1 (de) | Polypentenamere, deren doppelbindungen im wesentlichen cis-konfiguration aufweisen | |
| DE2105161B2 (de) | Verfahren zur herstellung von fluessigen polybutenameren | |
| DE1945358A1 (de) | Polyalkenamere und Verfahren zu deren Herstellung | |
| DE2028716A1 (de) | Polyalkenamere und Verfahren zu deren Herstellung | |
| DE1919047C3 (de) | Einstellung der Viskosität von Polyalkenamere!! | |
| DE1795206A1 (de) | Terpolymerkautschukzusammensetzung | |
| DE1745100B2 (de) | Verfahren zur herstellung von homo- oder mischpolymerisaten des aethylens | |
| DE1961232B2 (de) | Verfahren zur herstellung von epihalogenhydrinpolymeren | |
| DE1102411B (de) | Verfahren zur Herstellung hochmolekularer Kohlenwasserstoff-polymerisate aus cyclischen Dienen | |
| DE2043763A1 (de) | Polycyclisch^ Verbindungen, Ver fahren zu deren Herstellung und deren Verwendung | |
| DE1909226C3 (de) | Verfahren zur Herstellung von Cycloolefinpolymeri säten | |
| DE1241120B (de) | Verfahren zur Herstellung von Polymerisaten des Butadiens mit vorwiegend 1, 4-cis-Struktur | |
| DE1570541C3 (enExample) | ||
| DE1770844A1 (de) | Verfahren zur Herstellung von trans-Polypentenamer | |
| DE1292844B (de) | Verfahren zur Polymerisation von Isopren | |
| DE1962843C (de) | Verfahren zur Herstellung von hartbaren amorphen Olefinterpolymeri säten | |
| DE2263312C3 (de) | Verfahren zur Polymerisation von gegebenenfalls substituierten Cycloolefinen | |
| AT232725B (de) | Verfahren zur Herstellung hochmolekularer amorpher Olefinmischpolymerisate | |
| AT258563B (de) | Verfahren zur Herstellung von Wachsen | |
| DE1962853C3 (de) | Verfahren zur Herstellung von härtbaren amorphen Olefinterpolymerisaten | |
| DE2110743C3 (de) | 07.10.70 Japan P87476-70 Verfahren zur Herstellung eines Mischpolymerisates aus einem konjugierten Dien, insbesondere Butadien und Vinylchlorid Bridgestone Tire Co. Ltd, Tokio |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BHN | Withdrawal |