DE1913466A1 - Antivirale Zusammensetzungen,die Chinolinderivate enthalten - Google Patents
Antivirale Zusammensetzungen,die Chinolinderivate enthaltenInfo
- Publication number
- DE1913466A1 DE1913466A1 DE19691913466 DE1913466A DE1913466A1 DE 1913466 A1 DE1913466 A1 DE 1913466A1 DE 19691913466 DE19691913466 DE 19691913466 DE 1913466 A DE1913466 A DE 1913466A DE 1913466 A1 DE1913466 A1 DE 1913466A1
- Authority
- DE
- Germany
- Prior art keywords
- quinoline
- hydroxy
- methyl
- carboxylic acid
- treated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 title claims description 25
- 230000000840 anti-viral effect Effects 0.000 title description 2
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title description 2
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title 1
- 238000000034 method Methods 0.000 claims description 45
- -1 cyano, carboxy Chemical group 0.000 claims description 31
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 claims description 7
- 208000036142 Viral infection Diseases 0.000 claims description 7
- RJWLKJVVXOEFDR-UHFFFAOYSA-N ethyl 3-methyl-4-oxo-1h-quinoline-2-carboxylate Chemical compound C1=CC=C2C(=O)C(C)=C(C(=O)OCC)NC2=C1 RJWLKJVVXOEFDR-UHFFFAOYSA-N 0.000 claims description 7
- 230000009385 viral infection Effects 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 5
- NGRAIMFUWGFAEM-UHFFFAOYSA-N diethyl 2-oxopentanedioate Chemical compound CCOC(=O)CCC(=O)C(=O)OCC NGRAIMFUWGFAEM-UHFFFAOYSA-N 0.000 claims description 5
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims description 5
- 238000011282 treatment Methods 0.000 claims description 5
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 claims description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- QJXMYFKZSHPGJF-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC.COC1=CC=C(N)C=C1OC QJXMYFKZSHPGJF-UHFFFAOYSA-N 0.000 claims description 2
- 230000037396 body weight Effects 0.000 claims description 2
- SMGJADBITMFQGN-UHFFFAOYSA-N ethyl 4-chloro-6,7-dimethoxyquinoline-2-carboxylate Chemical compound C1=C(OC)C(OC)=CC2=NC(C(=O)OCC)=CC(Cl)=C21 SMGJADBITMFQGN-UHFFFAOYSA-N 0.000 claims description 2
- WQXFODMJBBDDIT-UHFFFAOYSA-N ethyl 6-chloro-3-methyl-4-oxo-1h-quinoline-2-carboxylate Chemical compound C1=C(Cl)C=C2C(=O)C(C)=C(C(=O)OCC)NC2=C1 WQXFODMJBBDDIT-UHFFFAOYSA-N 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 5
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims 3
- 239000003937 drug carrier Substances 0.000 claims 1
- BQUATHGXTCBDKR-UHFFFAOYSA-N ethyl 6-chloro-4-oxo-1h-quinoline-2-carboxylate Chemical compound ClC1=CC=C2NC(C(=O)OCC)=CC(=O)C2=C1 BQUATHGXTCBDKR-UHFFFAOYSA-N 0.000 claims 1
- UZGOCGKTLXIHBB-UHFFFAOYSA-N n-(4-methylphenyl)thiohydroxylamine Chemical compound CC1=CC=C(NS)C=C1 UZGOCGKTLXIHBB-UHFFFAOYSA-N 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 241000700605 Viruses Species 0.000 description 15
- 239000000523 sample Substances 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000538 analytical sample Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 150000003248 quinolines Chemical class 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 241000282693 Cercopithecidae Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- PWOYTBYNBYNZCO-UHFFFAOYSA-N ethyl quinoline-2-carboxylate Chemical compound C1=CC=CC2=NC(C(=O)OCC)=CC=C21 PWOYTBYNBYNZCO-UHFFFAOYSA-N 0.000 description 3
- 241001466953 Echovirus Species 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 208000002606 Paramyxoviridae Infections Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000000120 cytopathologic effect Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 208000023504 respiratory system disease Diseases 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- YKFROQCFVXOUPW-UHFFFAOYSA-N 4-(methylthio) aniline Chemical compound CSC1=CC=C(N)C=C1 YKFROQCFVXOUPW-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- QXRBOXSGWWUUBX-UHFFFAOYSA-N 6,7-dimethoxy-4-oxo-1h-quinoline-2-carboxylic acid Chemical compound OC(=O)C1=CC(O)=C2C=C(OC)C(OC)=CC2=N1 QXRBOXSGWWUUBX-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 208000034657 Convalescence Diseases 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000709661 Enterovirus Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- OEXWWDYOBBQCKD-UHFFFAOYSA-N SSSSSS Chemical compound SSSSSS OEXWWDYOBBQCKD-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 235000014510 cooky Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- FMGOVXIDFZOALR-UHFFFAOYSA-N ethyl 4-chloro-3-methylquinoline-2-carboxylate Chemical compound C1=CC=C2C(Cl)=C(C)C(C(=O)OCC)=NC2=C1 FMGOVXIDFZOALR-UHFFFAOYSA-N 0.000 description 1
- POWYXUDTZJAGFL-UHFFFAOYSA-N ethyl 4-chloroquinoline-2-carboxylate Chemical compound C1=CC=CC2=NC(C(=O)OCC)=CC(Cl)=C21 POWYXUDTZJAGFL-UHFFFAOYSA-N 0.000 description 1
- UACLREXZGKWWIC-UHFFFAOYSA-N ethyl 4-oxo-1h-quinoline-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OCC)=CC(=O)C2=C1 UACLREXZGKWWIC-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71403368A | 1968-03-18 | 1968-03-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1913466A1 true DE1913466A1 (de) | 1969-11-06 |
Family
ID=24868523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691913466 Pending DE1913466A1 (de) | 1968-03-18 | 1969-03-17 | Antivirale Zusammensetzungen,die Chinolinderivate enthalten |
Country Status (3)
| Country | Link |
|---|---|
| DE (1) | DE1913466A1 (enExample) |
| FR (1) | FR2004175A1 (enExample) |
| GB (1) | GB1207771A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2100798A1 (enExample) * | 1970-06-19 | 1972-03-24 | Ici Ltd | |
| EP0459140A3 (en) * | 1990-05-03 | 1992-05-20 | Basf Aktiengesellschaft | Cyanoquinolines as herbicides |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3704322A (en) * | 1969-09-24 | 1972-11-28 | Malesci S A S Inst Farmacobiol | N-alkyl-n'-(1-naphthoyl) ethylene diamines |
| DE3773240D1 (de) * | 1986-03-28 | 1991-10-31 | Otsuka Pharma Co Ltd | Hydrochinolinverbindungen, diese enthaltende zusammensetzungen und verfahren zu ihrer herstellung. |
| GB8719102D0 (en) * | 1987-08-12 | 1987-09-16 | Merck Sharp & Dohme | Therapeutic agents |
| US5270309A (en) * | 1987-08-12 | 1993-12-14 | Merck Sharp & Dohme Limited | Kynurenic acid derivatives useful in the treatment of neurodegenerative disorders |
| AU8448491A (en) * | 1990-09-07 | 1992-03-30 | Schering Corporation | Antiviral compounds and antihypertensive compounds |
| UA80607C2 (en) * | 2003-04-09 | 2007-10-10 | White Holdings Corp | Process for the preparation of 3-cyano-6-alkoxy-7-nitro-4-quinolines |
| MX2010003449A (es) | 2007-09-26 | 2010-04-27 | Astellas Pharma Inc | Derivado de quinolona. |
| HUP0900281A2 (hu) * | 2009-05-05 | 2011-01-28 | Univ Szegedi | Kinurénsav-származékok, eljárás a vegyületek elõállítására, a vegyületeket tartalmazó gyógyászati készítmények és alkalmazásuk fejfájás kezelésére |
| CN112624970B (zh) * | 2019-09-24 | 2022-10-28 | 南开大学 | 8位芳基取代喹啉氮氧化物在抗植物病毒及杀菌方面的应用 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB627297A (en) * | 1945-06-04 | 1949-08-05 | Charles Coale Price | Method for the preparation of heterocyclic compounds |
| US3046278A (en) * | 1960-10-24 | 1962-07-24 | Rohm & Haas | Process of cyanation |
-
1969
- 1969-03-14 GB GB1345269A patent/GB1207771A/en not_active Expired
- 1969-03-17 DE DE19691913466 patent/DE1913466A1/de active Pending
- 1969-03-18 FR FR6907724A patent/FR2004175A1/fr not_active Withdrawn
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2100798A1 (enExample) * | 1970-06-19 | 1972-03-24 | Ici Ltd | |
| EP0459140A3 (en) * | 1990-05-03 | 1992-05-20 | Basf Aktiengesellschaft | Cyanoquinolines as herbicides |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1207771A (en) | 1970-10-07 |
| FR2004175A1 (enExample) | 1969-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69114117T2 (de) | Neue Verwendung von Peptidderivat. | |
| DE1802961C3 (de) | Chromonverbindungen und deren pharmazeutisch vertragliche Salze und Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE3033157A1 (de) | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-naphthyridin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel | |
| DD155988A5 (de) | Verfahren zur herstellung von 2-acylaminomethyl-1,4-benzodiazepine und deren salze | |
| DE1913466A1 (de) | Antivirale Zusammensetzungen,die Chinolinderivate enthalten | |
| CH676712A5 (enExample) | ||
| DE2815724A1 (de) | Indolderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE2021100A1 (de) | Chinolinderivate | |
| DE2722162A1 (de) | Verfahren zur herstellung von phosphonigen saeuren | |
| EP0215354B1 (de) | Substituierte 2-Phenyl-hexahydro-1,2,4-triazin-3,5-dione, Verfahren zu ihrer Herstellung, sie enthaltende Mittel und ihre Verwendung | |
| DE2802493C2 (enExample) | ||
| DE2519394A1 (de) | Mittel zur behandlung von virusinfektionen | |
| DE1908548A1 (de) | Chinolinderivate | |
| EP1003724B1 (de) | Substituierte-chinolin-derivate mit antiviraler wirkung | |
| EP0470616B1 (de) | Substituierte Pyrimidin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Reagenzien | |
| DE2263100C2 (de) | 5,5-Dimethyl-8-(3-methyl-2-octyl)-10-[4-(piperidino)-butyryloxy]-2-(2-propinyl)-1,2,3,4-tetrahydro-5H-[1]-benzopyrano[3,4-d]pyridin, Verfahren zu dessen Herstellung und die Verbindung enthaltende Arzneimittel | |
| DE1949813A1 (de) | Substituierte Pyrazole | |
| DE2449270B2 (de) | 2- [3-(4-Diphenylmethyl-piperazino)-propyl] -s-triazolo [1,5 eckige Klammer zu pyridin, seine nicht toxischen Salze mit Säuren und ein Verfahren zu ihrer Herstellung | |
| DE2603399A1 (de) | Heterocyclische verbindungen | |
| DE2007345A1 (de) | Neue substituierte Hexahydroimidazochinoline und deren Säureanlagerungssalze | |
| DE3874465T2 (de) | 1,2,3,4-tetrahydroisochonoline als antiarrhythmische mittel. | |
| DE2854727A1 (de) | Polyfluorhydroxyisopropyl-substituierte bicyclische und tricyclische carbostyrile, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE1250828B (de) | Verfahren zur Herstellung des spasmolytisch wirksamen 6,7,3',4' - Tetraäthoxy -l-benzyliden-1,2,3,4tetrahydroisochinolins und seiner Salze | |
| DE3129718C2 (enExample) | ||
| DE69005318T2 (de) | 1,8-Benzonaphthyridinderivate, ihre Herstellung und diese enthaltende Zusammensetzungen. |