DE1769097A1 - Thermoplastische Polyester enthaltende Formmassen - Google Patents
Thermoplastische Polyester enthaltende FormmassenInfo
- Publication number
- DE1769097A1 DE1769097A1 DE19681769097 DE1769097A DE1769097A1 DE 1769097 A1 DE1769097 A1 DE 1769097A1 DE 19681769097 DE19681769097 DE 19681769097 DE 1769097 A DE1769097 A DE 1769097A DE 1769097 A1 DE1769097 A1 DE 1769097A1
- Authority
- DE
- Germany
- Prior art keywords
- polyester
- compositions containing
- dicarboxylic acids
- molding compositions
- containing thermoplastic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 26
- 239000000203 mixture Substances 0.000 title description 2
- 238000000465 moulding Methods 0.000 title description 2
- 229920001169 thermoplastic Polymers 0.000 title description 2
- 239000004416 thermosoftening plastic Substances 0.000 title description 2
- -1 aromatic dicarboxylic acids Chemical class 0.000 claims description 13
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 150000002009 diols Chemical class 0.000 claims description 3
- 125000003700 epoxy group Chemical group 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 125000002993 cycloalkylene group Chemical group 0.000 claims 1
- 239000002245 particle Substances 0.000 claims 1
- 238000001746 injection moulding Methods 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 7
- 230000008025 crystallization Effects 0.000 description 7
- 239000008187 granular material Substances 0.000 description 6
- 239000004593 Epoxy Substances 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- DMCTVRQBJMBEDT-UHFFFAOYSA-N phenol;1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl.OC1=CC=CC=C1 DMCTVRQBJMBEDT-UHFFFAOYSA-N 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/15—Heterocyclic compounds having oxygen in the ring
- C08K5/151—Heterocyclic compounds having oxygen in the ring having one oxygen atom in the ring
- C08K5/1515—Three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Injection Moulding Of Plastics Or The Like (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681769097 DE1769097A1 (de) | 1968-04-03 | 1968-04-03 | Thermoplastische Polyester enthaltende Formmassen |
| NL6903736A NL6903736A (enExample) | 1968-04-03 | 1969-03-11 | |
| US807422A US3547872A (en) | 1968-04-03 | 1969-03-14 | Saturated polyesters containing cyclic epoxides and nucleating agents |
| GB04965/69A GB1253891A (en) | 1968-04-03 | 1969-03-21 | Thermoplastic moulding compositions containing polyesters |
| AT331669A AT289397B (de) | 1968-04-03 | 1969-04-03 | Thermoplastische, Polyester enthaltende Formmasse |
| BE730981D BE730981A (enExample) | 1968-04-03 | 1969-04-03 | |
| FR6910242A FR2005475A1 (enExample) | 1968-04-03 | 1969-04-03 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681769097 DE1769097A1 (de) | 1968-04-03 | 1968-04-03 | Thermoplastische Polyester enthaltende Formmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1769097A1 true DE1769097A1 (de) | 1971-10-21 |
Family
ID=5699986
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681769097 Pending DE1769097A1 (de) | 1968-04-03 | 1968-04-03 | Thermoplastische Polyester enthaltende Formmassen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3547872A (enExample) |
| AT (1) | AT289397B (enExample) |
| BE (1) | BE730981A (enExample) |
| DE (1) | DE1769097A1 (enExample) |
| FR (1) | FR2005475A1 (enExample) |
| GB (1) | GB1253891A (enExample) |
| NL (1) | NL6903736A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2303631A1 (de) * | 1972-02-28 | 1973-09-20 | Du Pont | Verfahren zur herstellung segmentierter thermoplastischer mischpolyester |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1769729A1 (de) * | 1968-07-04 | 1972-01-27 | Hoechst Ag | Thermoplastische Polyester enthaltende Formmasse |
| US3627867A (en) * | 1968-09-05 | 1971-12-14 | Du Pont | Process of melt-spinning high-molecular-weight ethylene terephthalate polymer |
| DE2124336C3 (de) * | 1971-05-17 | 1986-07-31 | Hoechst Ag, 6230 Frankfurt | Thermoplastische Polyesterformmassen |
| US4296021A (en) * | 1976-12-06 | 1981-10-20 | General Electric Company | Reinforced thermoplastic polyester compositions having improved high voltage breakdown resistance |
| US4352904A (en) * | 1978-02-28 | 1982-10-05 | E. I. Du Pont De Nemours And Company | Molding resins |
| USRE32334E (en) * | 1978-02-28 | 1987-01-20 | E. I. Du Pont De Nemours And Company | Molding resins |
| US4351758A (en) * | 1980-08-06 | 1982-09-28 | Celanese Corporation | Polyester blends |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4444931A (en) * | 1980-08-06 | 1984-04-24 | Celanese Corporation | Polyester blends |
| JP4426324B2 (ja) * | 2004-01-21 | 2010-03-03 | ダイセル化学工業株式会社 | 非エステル型エポキシ樹脂および樹脂組成物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL197028A (enExample) * | 1955-05-06 | |||
| NL275158A (enExample) * | 1961-03-02 | 1900-01-01 | ||
| NL128293C (enExample) * | 1962-11-03 | Basf Ag | ||
| US3372143A (en) * | 1963-05-31 | 1968-03-05 | Mitsubishi Rayon Co | Process for producing modified polyesters with epoxy ether compounds |
| GB1158348A (en) * | 1966-12-09 | 1969-07-16 | Ici Ltd | Mouldable Polyester Compositions. |
-
1968
- 1968-04-03 DE DE19681769097 patent/DE1769097A1/de active Pending
-
1969
- 1969-03-11 NL NL6903736A patent/NL6903736A/xx unknown
- 1969-03-14 US US807422A patent/US3547872A/en not_active Expired - Lifetime
- 1969-03-21 GB GB04965/69A patent/GB1253891A/en not_active Expired
- 1969-04-03 FR FR6910242A patent/FR2005475A1/fr not_active Withdrawn
- 1969-04-03 AT AT331669A patent/AT289397B/de not_active IP Right Cessation
- 1969-04-03 BE BE730981D patent/BE730981A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2303631A1 (de) * | 1972-02-28 | 1973-09-20 | Du Pont | Verfahren zur herstellung segmentierter thermoplastischer mischpolyester |
Also Published As
| Publication number | Publication date |
|---|---|
| BE730981A (enExample) | 1969-10-03 |
| NL6903736A (enExample) | 1969-10-07 |
| GB1253891A (en) | 1971-11-17 |
| FR2005475A1 (enExample) | 1969-12-12 |
| US3547872A (en) | 1970-12-15 |
| AT289397B (de) | 1971-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2303631C3 (de) | Verfahren zur Herstellung eines verbesserten segmentierten thermoplastischen Mischpolyester-Elastomeren | |
| CH417943A (de) | Verfahren zur Herstellung von formfesten Spritzgussartikeln aus Polyestern aromatischer Dicarbonsäuren | |
| DE1769097A1 (de) | Thermoplastische Polyester enthaltende Formmassen | |
| DE1694296B2 (de) | Herstellung von formstabilen und schlagfesten Spritzgußteilen aus PoIyäthylenterephthalat-Gemi sehen | |
| DE1769230A1 (de) | Thermoplastische Polyester enthaltende Formmassen | |
| DE2124336C3 (de) | Thermoplastische Polyesterformmassen | |
| DE1769729A1 (de) | Thermoplastische Polyester enthaltende Formmasse | |
| DE2400097A1 (de) | Verfahren zur steigerung der schmelzelastizitaet von hochmolekularen linearen polyesterharzen | |
| DE1694218A1 (de) | Thermoplastische Formmassen | |
| DE1769119A1 (de) | Thermoplastische Polyester enthaltende Formmasse | |
| DE1805921B2 (de) | Thermoplastische, zu transparenten Blaskörpern verarbeitbare Polyamid-Formmassen | |
| DE2133280A1 (de) | Verfahren zur Herstellung von anorganische Fuellstoffe enthaltenden Polyaethylenterephthalaten | |
| DE1694232A1 (de) | Titandioxydhaltige thermoplastische Polyesterformmassen | |
| DE1814148C3 (de) | Herstellung rasch kristallisierender Formmassen auf Basis gesättigter Polyester | |
| DE1945101A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE1694204A1 (de) | Thermoplastische Formmassen aus Polyestern | |
| DE1954588C3 (de) | Polyester-Spritzgußmassen | |
| DE1769713A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE2015162C3 (de) | Thermoplastische Formmassen auf Basis gesättigter Polyester | |
| DE1769224A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE1933969C3 (de) | Thermoplastische Formmassen auf Basis gesättigter Polyester | |
| DE1950252A1 (de) | Thermoplastische Polyesterformmassen | |
| DE2051233A1 (de) | Polyesterformmasse und Verfahren zu ihrer Herstellung | |
| DE2149649A1 (de) | Thermoplastische polyesterformmassen | |
| DE1934719A1 (de) | Verfahren zur Herstellung hochmolekularer Polyester fuer Spritzgusszwecke |