DE1670694B2 - Verfahren zur herstellung von tetrahydroisochinolinen - Google Patents
Verfahren zur herstellung von tetrahydroisochinolinenInfo
- Publication number
- DE1670694B2 DE1670694B2 DE1966F0049122 DEF0049122A DE1670694B2 DE 1670694 B2 DE1670694 B2 DE 1670694B2 DE 1966F0049122 DE1966F0049122 DE 1966F0049122 DE F0049122 A DEF0049122 A DE F0049122A DE 1670694 B2 DE1670694 B2 DE 1670694B2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- phenyl
- benzyl
- amino
- propanol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title description 3
- 125000003039 tetrahydroisoquinolinyl group Chemical class C1(NCCC2=CC=CC=C12)* 0.000 claims description 2
- 229940111121 antirheumatic drug quinolines Drugs 0.000 claims 1
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 claims 1
- -1 aluminum halide Chemical class 0.000 description 48
- 239000002253 acid Substances 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- WGILVXQNSFDASI-UHFFFAOYSA-N 2-nitro-n-methylbenzylamine Chemical compound CNCC1=CC=CC=C1[N+]([O-])=O WGILVXQNSFDASI-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- BXCBUWKTXLWPSB-UHFFFAOYSA-N 1-(chloromethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CCl BXCBUWKTXLWPSB-UHFFFAOYSA-N 0.000 description 2
- JRVWCYFHWOGTFF-UHFFFAOYSA-N 2-methyl-4-phenyl-1h-isoquinolin-8-amine Chemical compound C=1N(C)CC2=C(N)C=CC=C2C=1C1=CC=CC=C1 JRVWCYFHWOGTFF-UHFFFAOYSA-N 0.000 description 2
- VAJVDSVGBWFCLW-UHFFFAOYSA-N 3-Phenyl-1-propanol Chemical compound OCCCC1=CC=CC=C1 VAJVDSVGBWFCLW-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KWGRBVOPPLSCSI-WPRPVWTQSA-N (-)-ephedrine Chemical compound CN[C@@H](C)[C@H](O)C1=CC=CC=C1 KWGRBVOPPLSCSI-WPRPVWTQSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- MVDVPOYBSSFMQI-UHFFFAOYSA-N 2,2-dimethyl-1-phenylbutan-1-one Chemical compound CCC(C)(C)C(=O)C1=CC=CC=C1 MVDVPOYBSSFMQI-UHFFFAOYSA-N 0.000 description 1
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 1
- SVJNECJVNWTYQG-UHFFFAOYSA-N 3,4-dimethylpentan-1-ol Chemical compound CC(C)C(C)CCO SVJNECJVNWTYQG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- PCWGTDULNUVNBN-UHFFFAOYSA-N 4-methylpentan-1-ol Chemical compound CC(C)CCCO PCWGTDULNUVNBN-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- ZVHAANQOQZVVFD-UHFFFAOYSA-N 5-methylhexan-1-ol Chemical compound CC(C)CCCCO ZVHAANQOQZVVFD-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BFWASPVPCFUDFT-UHFFFAOYSA-N CC(C(CC(C=CC=C1)=C1[N+]([O-])=O)(C1=CC=CC=C1)O)NC Chemical class CC(C(CC(C=CC=C1)=C1[N+]([O-])=O)(C1=CC=CC=C1)O)NC BFWASPVPCFUDFT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OKJIRPAQVSHGFK-UHFFFAOYSA-N N-acetylglycine Chemical compound CC(=O)NCC(O)=O OKJIRPAQVSHGFK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- XTEGVFVZDVNBPF-UHFFFAOYSA-L naphthalene-1,5-disulfonate(2-) Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1S([O-])(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-L 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000001519 thymoleptic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
- C07D217/16—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1966F0049122 DE1670694B2 (de) | 1966-05-05 | 1966-05-05 | Verfahren zur herstellung von tetrahydroisochinolinen |
| DE1670849A DE1670849C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von 8-Acylamino-1,23,4-tetrahydroisochinolinen |
| DE1670848A DE1670848C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| NO167980A NO121721B (enExample) | 1966-05-05 | 1967-05-03 | |
| AT607169A AT289804B (de) | 1966-05-05 | 1967-05-03 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinen und von deren Salzen |
| AT413967A AT281827B (de) | 1966-05-05 | 1967-05-03 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinen und von deren Salzen |
| SE06265/67A SE330170B (enExample) | 1966-05-05 | 1967-05-03 | |
| DK236067AA DK123598B (da) | 1966-05-05 | 1967-05-03 | Analogifremgangsmåde til fremstilling af tetrahydroisoquinoliner. |
| AT06072/69A AT282634B (de) | 1966-05-05 | 1967-05-03 | Verfahren zur herstellung von neuen tetrahydroisochinolinen und von deren salzen |
| BE698033D BE698033A (enExample) | 1966-05-05 | 1967-05-05 | |
| CH225270A CH487893A (de) | 1966-05-05 | 1967-05-05 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| GB21016/67A GB1164192A (en) | 1966-05-05 | 1967-05-05 | Tetrahydroisoquinolines and process for preparing them |
| FR105303A FR1524487A (fr) | 1966-05-05 | 1967-05-05 | Tétrahydro-isoquinoléines et leur préparation |
| NL6706322.A NL157899B (nl) | 1966-05-05 | 1967-05-05 | Werkwijze voor het bereiden van een geneesmiddel, een aldus verkregen gevormd geneesmiddel en werkijze voor het bereiden van een 4-fenyl-1,2,3,4-tetrahydro-isochinolinederivaat. |
| CH641467A CH487892A (de) | 1966-05-05 | 1967-05-05 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| CH225370A CH501628A (de) | 1966-05-05 | 1967-05-05 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| FR116865A FR6646M (enExample) | 1966-05-05 | 1967-08-04 | |
| FR116866A FR6496M (enExample) | 1966-05-05 | 1967-08-04 | |
| US867932A US3577424A (en) | 1966-05-05 | 1969-10-20 | 4-phenyl-8-amino tetrahydroisoquinolines |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1966F0049122 DE1670694B2 (de) | 1966-05-05 | 1966-05-05 | Verfahren zur herstellung von tetrahydroisochinolinen |
| DE1670848A DE1670848C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| DE1670849A DE1670849C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von 8-Acylamino-1,23,4-tetrahydroisochinolinen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1670694A1 DE1670694A1 (de) | 1970-12-03 |
| DE1670694B2 true DE1670694B2 (de) | 1976-07-22 |
Family
ID=27210480
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1966F0049122 Granted DE1670694B2 (de) | 1966-05-05 | 1966-05-05 | Verfahren zur herstellung von tetrahydroisochinolinen |
| DE1670848A Expired DE1670848C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| DE1670849A Expired DE1670849C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von 8-Acylamino-1,23,4-tetrahydroisochinolinen |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1670848A Expired DE1670848C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von Tetrahydroisochinolinen |
| DE1670849A Expired DE1670849C3 (de) | 1966-05-05 | 1967-04-15 | Verfahren zur Herstellung von 8-Acylamino-1,23,4-tetrahydroisochinolinen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3577424A (enExample) |
| AT (3) | AT289804B (enExample) |
| BE (1) | BE698033A (enExample) |
| CH (3) | CH487892A (enExample) |
| DE (3) | DE1670694B2 (enExample) |
| DK (1) | DK123598B (enExample) |
| FR (2) | FR6496M (enExample) |
| GB (1) | GB1164192A (enExample) |
| NL (1) | NL157899B (enExample) |
| NO (1) | NO121721B (enExample) |
| SE (1) | SE330170B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0140070A1 (de) * | 1983-09-21 | 1985-05-08 | Troponwerke GmbH & Co. KG | Neue Pyridoindolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4048180A (en) * | 1968-03-18 | 1977-09-13 | Imperial Chemical Industries Limited | Pyridyl-tetrahydropyrans and process for preparing same |
| US3666763A (en) * | 1970-01-06 | 1972-05-30 | Hoffmann La Roche | 4-phenyl isoquinolines and process for preparing same |
| CH527194A (de) * | 1970-01-06 | 1972-08-31 | Hoffmann La Roche | Verfahren zur Herstellung von Isochinolin-Derivaten |
| US3947456A (en) * | 1970-01-06 | 1976-03-30 | Hoffman-La Roche Inc. | Substituted 4-phenyl isoquinolines |
| FR2081572B1 (enExample) * | 1970-03-12 | 1973-04-06 | Rhone Poulenc Sa | |
| US4419517A (en) * | 1973-06-01 | 1983-12-06 | E. I. Du Pont De Nemours & Co. | 4a-Aryl-trans-decahydroisoquinolines |
| IL45823A (en) * | 1973-10-20 | 1977-10-31 | Hoechst Ag | Substituted 1-phenyl-4-alkyl(dialkyl or cyclic) aminoalkyl-1,4-dihydro-2h-isoquinoline-3-one derivatives |
| SE7509022L (sv) | 1974-09-09 | 1976-03-10 | Du Pont | Foreningar med analgetisk verkan |
| DE2723524A1 (de) * | 1977-05-25 | 1978-12-14 | Hoechst Ag | 8-amino-2-methyl-4-phenyl-1,2,3,4- tetrahydroisochinolin-8-n-glucuronid und verfahren zu seiner herstellung |
| DE2724610A1 (de) * | 1977-06-01 | 1978-12-14 | Hoechst Ag | 4-phenyl-8-amino-tetrahydroisochinoline |
| DE2724683A1 (de) * | 1977-06-01 | 1978-12-14 | Hoechst Ag | Antidepressiv wirksame pharmazeutische praeparate |
| US4340600A (en) * | 1980-05-22 | 1982-07-20 | Smithkline Corporation | Renal dilating methods and compositions using 4-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydroisoquinolines |
| US4375471A (en) * | 1981-02-19 | 1983-03-01 | Hoechst-Roussel Pharmaceuticals Inc. | 4-Aryloxy-1,2,3,4-tetrahydroisoquinolines |
| US4477670A (en) * | 1981-02-19 | 1984-10-16 | Hoechst-Roussel Pharmaceuticals Inc. | 4-Aryloxy-1,2,3,4-tetrahydroisoquinolines |
| BG33347A1 (en) * | 1981-06-10 | 1983-02-15 | Zabunova Cvetanova | Method for obtaining of n- (2- aminobenzyl)- 1- phenyl- 2- methylaminoethanol |
| HU186518B (en) * | 1982-06-04 | 1985-08-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing 8-bracket-amino-acyl-amino-bracket closed-4-aryl-2-methyl-1,2,3,4-tetrahydro-isoquinoline derivatives |
| BG39661A1 (en) * | 1984-04-13 | 1986-08-29 | Ivanova | Antiulcer means |
| GB8509834D0 (en) * | 1985-04-17 | 1985-05-22 | Beecham Group Plc | Compounds |
| US4876261A (en) * | 1987-03-27 | 1989-10-24 | Akihiro Tanaka | Substituted tetrahydroisoquinoline compounds and composition containing them |
| GB9816984D0 (en) * | 1998-08-05 | 1998-09-30 | Smithkline Beecham Plc | Novel compounds |
| GB9817424D0 (en) * | 1998-08-11 | 1998-10-07 | Smithkline Beecham Plc | Novel compounds |
| MXPA05011225A (es) * | 2003-04-18 | 2005-12-14 | Pharmacia & Upjohn Co Llc | Politerapias. |
| US9339500B2 (en) * | 2008-03-04 | 2016-05-17 | Intra-Cellular Therapies, Inc. | Methods of treating vasomotor symptoms |
-
1966
- 1966-05-05 DE DE1966F0049122 patent/DE1670694B2/de active Granted
-
1967
- 1967-04-15 DE DE1670848A patent/DE1670848C3/de not_active Expired
- 1967-04-15 DE DE1670849A patent/DE1670849C3/de not_active Expired
- 1967-05-03 AT AT607169A patent/AT289804B/de not_active IP Right Cessation
- 1967-05-03 SE SE06265/67A patent/SE330170B/xx unknown
- 1967-05-03 AT AT06072/69A patent/AT282634B/de not_active IP Right Cessation
- 1967-05-03 NO NO167980A patent/NO121721B/no unknown
- 1967-05-03 DK DK236067AA patent/DK123598B/da not_active IP Right Cessation
- 1967-05-03 AT AT413967A patent/AT281827B/de not_active IP Right Cessation
- 1967-05-05 CH CH641467A patent/CH487892A/de not_active IP Right Cessation
- 1967-05-05 BE BE698033D patent/BE698033A/xx not_active IP Right Cessation
- 1967-05-05 NL NL6706322.A patent/NL157899B/xx not_active IP Right Cessation
- 1967-05-05 CH CH225270A patent/CH487893A/de not_active IP Right Cessation
- 1967-05-05 CH CH225370A patent/CH501628A/de not_active IP Right Cessation
- 1967-05-05 GB GB21016/67A patent/GB1164192A/en not_active Expired
- 1967-08-04 FR FR116866A patent/FR6496M/fr not_active Expired
- 1967-08-04 FR FR116865A patent/FR6646M/fr not_active Expired
-
1969
- 1969-10-20 US US867932A patent/US3577424A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0140070A1 (de) * | 1983-09-21 | 1985-05-08 | Troponwerke GmbH & Co. KG | Neue Pyridoindolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| AT289804B (de) | 1971-05-10 |
| NL157899B (nl) | 1978-09-15 |
| DE1670848A1 (de) | 1971-04-08 |
| DE1670848B2 (de) | 1979-10-11 |
| GB1164192A (en) | 1969-09-17 |
| DE1670694A1 (de) | 1970-12-03 |
| DE1670849A1 (de) | 1971-02-25 |
| FR6496M (enExample) | 1968-11-25 |
| NL6706322A (enExample) | 1967-11-06 |
| CH487893A (de) | 1970-03-31 |
| FR6646M (enExample) | 1969-01-20 |
| US3577424A (en) | 1971-05-04 |
| DK123598B (da) | 1972-07-10 |
| DE1670848C3 (de) | 1980-06-19 |
| DE1670849B2 (de) | 1977-12-01 |
| NO121721B (enExample) | 1971-04-05 |
| CH501628A (de) | 1971-01-15 |
| CH487892A (de) | 1970-03-31 |
| AT281827B (de) | 1970-06-10 |
| SE330170B (enExample) | 1970-11-09 |
| AT282634B (de) | 1970-07-10 |
| DE1670849C3 (de) | 1978-07-20 |
| BE698033A (enExample) | 1967-11-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1670694B2 (de) | Verfahren zur herstellung von tetrahydroisochinolinen | |
| DE1795769C3 (de) | 6,7,8,9-Tetrahydro-2H-pyrido [Ua] pyrimidinderivate, deren Salze mit Säuren und quaternäre Methosalze, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| EP0136658B1 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| CH616923A5 (enExample) | ||
| DE1443599A1 (de) | Ungesaettigte Amine | |
| DE1670274A1 (de) | Neues Verfahren zur Herstellung von 2-Arylamino-1,3-diazacycloalkenen-(2) | |
| DE1595920B2 (de) | 4-(co-Piperazinoalkyl)-pyrazole, ihre Salze und Verfahren zu ihrer Herstellung | |
| DE1695656C3 (enExample) | ||
| EP0105210A2 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE1620016C3 (de) | 3-{Piperazinoalkyl)-pyrazole und Verfahren zu ihrer Herstellung | |
| DE2051962A1 (de) | Benzimidazo eckige Klammer auf l,2d eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu benzodiazepin 6 (5H) one und Verfahren zu deren Her stellung | |
| DE1670694C3 (de) | Verfahren zur Herstellung von Tetrahydrolsochino linen | |
| DE1927429C3 (de) | 4,6-Dihydro-pyrazolo [43-e] [1,4] diazepin-5-onverbindungen | |
| DE2548968A1 (de) | Neue amino-benzoesaeureamide | |
| DE1795829C3 (enExample) | ||
| DE1543496A1 (de) | Verfahren zur Herstellung von Phenoxyessigsaeureamiden | |
| DE1695003C (de) | 1,2,3,4 Tetrahydrochinoline und ein Verfahren zu ihrer Herstellung | |
| EP0086450B1 (de) | Substituierte Phenylpyrazolderivate, Verfahren zu ihrer Herstellung, Arzneimittel auf Basis dieser Verbindungen, sowie deren Verwendung | |
| DE1795830C3 (enExample) | ||
| DE1620171A1 (de) | Verfahren zur Herstellung von heterocyclischen Verbindungen | |
| DE911261C (de) | Verfahren zur Herstellung von Derivaten des Imidazols | |
| DE2261351A1 (de) | Pyrazolderivate und verfahren zu ihrer herstellung | |
| DE3121137A1 (de) | Neue pyridazino(4,5-b)indole, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen, zwischenprodukte und deren herstellung" | |
| DE1815450C (de) | Spiro(4,5)decanverbindungen | |
| DE1901167C3 (de) | Substituierte Indole, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |