DE1593520C3 - 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung - Google Patents
3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren HerstellungInfo
- Publication number
- DE1593520C3 DE1593520C3 DE1593520A DE1593520A DE1593520C3 DE 1593520 C3 DE1593520 C3 DE 1593520C3 DE 1593520 A DE1593520 A DE 1593520A DE 1593520 A DE1593520 A DE 1593520A DE 1593520 C3 DE1593520 C3 DE 1593520C3
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- urea
- carbamoyloxy
- methyl
- methylphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Carbamoyloxyphenyl Chemical group 0.000 title claims description 72
- 235000013877 carbamide Nutrition 0.000 title claims description 63
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000003585 thioureas Chemical class 0.000 title claims description 5
- 230000002363 herbicidal effect Effects 0.000 title description 5
- 150000003672 ureas Chemical class 0.000 title description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 58
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 118
- 239000004202 carbamide Substances 0.000 description 91
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 30
- 239000004480 active ingredient Substances 0.000 description 22
- 241000196324 Embryophyta Species 0.000 description 12
- 240000006694 Stellaria media Species 0.000 description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 8
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 7
- 235000021536 Sugar beet Nutrition 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 240000004713 Pisum sativum Species 0.000 description 6
- 235000010582 Pisum sativum Nutrition 0.000 description 6
- 240000003705 Senecio vulgaris Species 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 235000016068 Berberis vulgaris Nutrition 0.000 description 5
- 241000335053 Beta vulgaris Species 0.000 description 5
- 230000004071 biological effect Effects 0.000 description 5
- 239000004009 herbicide Substances 0.000 description 5
- 241000409199 Packera Species 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 244000214240 Galinsoga parviflora Species 0.000 description 3
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- HQSQPMWCWCOTBH-UHFFFAOYSA-N 3-(3-hydroxyphenyl)-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(O)=C1 HQSQPMWCWCOTBH-UHFFFAOYSA-N 0.000 description 2
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 241000780602 Senecio Species 0.000 description 2
- DGPZICXHBKIWMD-UHFFFAOYSA-N [3-(diethylcarbamoylamino)phenyl] N-phenylcarbamate Chemical compound C(C)N(C(=O)NC1=CC(=CC=C1)OC(NC1=CC=CC=C1)=O)CC DGPZICXHBKIWMD-UHFFFAOYSA-N 0.000 description 2
- RLSDKINPLGBDJF-UHFFFAOYSA-N [3-(dimethylcarbamoylamino)phenyl] n-phenylcarbamate Chemical compound CN(C)C(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 RLSDKINPLGBDJF-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 230000006735 deficit Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- IPRCBIWIPMJXIK-UHFFFAOYSA-N (3-hydroxyphenyl)urea Chemical compound NC(=O)NC1=CC=CC(O)=C1 IPRCBIWIPMJXIK-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- YWMIKPPKZOVLKV-UHFFFAOYSA-N 1-(3-hydroxyphenyl)-1-methylurea Chemical compound NC(=O)N(C)C1=CC=CC(O)=C1 YWMIKPPKZOVLKV-UHFFFAOYSA-N 0.000 description 1
- JTMVFTMUBVVPOV-UHFFFAOYSA-N 1-(3-hydroxyphenyl)-3-methylthiourea Chemical compound CNC(=S)NC1=CC=CC(O)=C1 JTMVFTMUBVVPOV-UHFFFAOYSA-N 0.000 description 1
- SDSMTAZTEZQGCB-UHFFFAOYSA-N 1-ethyl-3-(3-hydroxyphenyl)urea Chemical compound CCNC(=O)NC1=CC=CC(O)=C1 SDSMTAZTEZQGCB-UHFFFAOYSA-N 0.000 description 1
- CPPGZWWUPFWALU-UHFFFAOYSA-N 1-isocyanato-3-methylbenzene Chemical compound CC1=CC=CC(N=C=O)=C1 CPPGZWWUPFWALU-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical compound CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- PWGRTTZIARQDEN-UHFFFAOYSA-N C(C)NC(=O)NC1=CC(=CC=C1)OC(N(C1=CC=CC=C1)C)=O Chemical compound C(C)NC(=O)NC1=CC(=CC=C1)OC(N(C1=CC=CC=C1)C)=O PWGRTTZIARQDEN-UHFFFAOYSA-N 0.000 description 1
- WUQFVNVSGYTZTH-UHFFFAOYSA-N CN(C)C(NC1=CC(OC(NC(C=C2)=CC(Cl)=C2SC)=O)=CC=C1)=O Chemical compound CN(C)C(NC1=CC(OC(NC(C=C2)=CC(Cl)=C2SC)=O)=CC=C1)=O WUQFVNVSGYTZTH-UHFFFAOYSA-N 0.000 description 1
- COOBUPCJSODRPZ-UHFFFAOYSA-N CNC(=O)N(C1=CC(=CC=C1)OC(N(C1=CC=CC=C1)C)=O)C Chemical compound CNC(=O)N(C1=CC(=CC=C1)OC(N(C1=CC=CC=C1)C)=O)C COOBUPCJSODRPZ-UHFFFAOYSA-N 0.000 description 1
- TUTJEXCMMKJPLL-UHFFFAOYSA-N CNC(=S)NC1=CC(=CC=C1)OC(NC1=CC=CC=C1)=O Chemical compound CNC(=S)NC1=CC(=CC=C1)OC(NC1=CC=CC=C1)=O TUTJEXCMMKJPLL-UHFFFAOYSA-N 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 1
- XIROBOVMXZFNAS-UHFFFAOYSA-N [3-[dimethylcarbamoyl(methyl)amino]phenyl] N-phenylcarbamate Chemical compound CN(C(=O)N(C1=CC(=CC=C1)OC(NC1=CC=CC=C1)=O)C)C XIROBOVMXZFNAS-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- STUHQDIOZQUPGP-UHFFFAOYSA-N morpholin-4-ium-4-carboxylate Chemical compound OC(=O)N1CCOCC1 STUHQDIOZQUPGP-UHFFFAOYSA-N 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- SQVIPVJPCZNVQD-UHFFFAOYSA-N n-(3-hydroxyphenyl)morpholine-4-carboxamide Chemical compound OC1=CC=CC(NC(=O)N2CCOCC2)=C1 SQVIPVJPCZNVQD-UHFFFAOYSA-N 0.000 description 1
- DNTPOBUQPMRENX-UHFFFAOYSA-N n-methyl-n-(3-methylphenyl)carbamoyl chloride Chemical compound ClC(=O)N(C)C1=CC=CC(C)=C1 DNTPOBUQPMRENX-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESC039491 | 1966-09-05 | ||
| DESC040838 | 1967-06-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1593520A1 DE1593520A1 (de) | 1970-08-13 |
| DE1593520B2 DE1593520B2 (de) | 1973-12-13 |
| DE1593520C3 true DE1593520C3 (de) | 1974-07-11 |
Family
ID=25993407
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1593520A Expired DE1593520C3 (de) | 1966-09-05 | 1966-09-05 | 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3879441A (enExample) |
| JP (1) | JPS5133965B1 (enExample) |
| BE (1) | BE703477A (enExample) |
| BG (1) | BG16313A3 (enExample) |
| CH (1) | CH491598A (enExample) |
| CS (2) | CS168498B2 (enExample) |
| DE (1) | DE1593520C3 (enExample) |
| DK (1) | DK118074B (enExample) |
| ES (1) | ES344462A1 (enExample) |
| FI (1) | FI45102C (enExample) |
| GB (1) | GB1205029A (enExample) |
| IL (1) | IL28598A (enExample) |
| LU (1) | LU54163A1 (enExample) |
| NL (1) | NL157299B (enExample) |
| NO (1) | NO120813B (enExample) |
| SE (1) | SE328863B (enExample) |
| YU (1) | YU32367B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3979202A (en) * | 1970-05-26 | 1976-09-07 | Monsanto Company | Meta-bifunctional benzenes and herbicidal compositions |
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| US4013450A (en) * | 1970-10-02 | 1977-03-22 | Monsanto Company | Herbicidal ureido containing carbanilates |
| DE2730325A1 (de) * | 1977-07-01 | 1979-01-11 | Schering Ag | Carbanilsaeure-(3-ureido-phenyl)- ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| US5194661A (en) * | 1990-08-20 | 1993-03-16 | Ici Americas Inc. | Substituted benzyl carbamates and their use as herbicides |
| FR2767823B1 (fr) * | 1997-08-27 | 1999-10-15 | Oreal | Composes derives d'aminophenol et leur utilisation en cosmetique |
| EP1636201A1 (en) * | 2003-06-12 | 2006-03-22 | Novo Nordisk A/S | Para-substituted phenyl carbamates as inhibitors of hormone sensitive lipase |
| CN113651722A (zh) * | 2021-08-13 | 2021-11-16 | 浙江海昇药业股份有限公司 | 一种1-(3-羟基苯基)-1,3,3-三甲基脲的合成方法、中间体及其用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3434822A (en) * | 1964-03-23 | 1969-03-25 | Fmc Corp | M-ureidophenyl carbamates as herbicides |
| US3404975A (en) * | 1964-12-18 | 1968-10-08 | Fmc Corp | m-(carbamoyloxy)-carbanilates as herbicides |
-
1966
- 1966-09-05 DE DE1593520A patent/DE1593520C3/de not_active Expired
-
1967
- 1967-07-24 LU LU54163D patent/LU54163A1/xx unknown
- 1967-07-28 BG BG009009A patent/BG16313A3/bg unknown
- 1967-08-02 FI FI672102A patent/FI45102C/fi active
- 1967-08-23 DK DK427067AA patent/DK118074B/da unknown
- 1967-08-25 ES ES344462A patent/ES344462A1/es not_active Expired
- 1967-08-26 YU YU1683/67A patent/YU32367B/xx unknown
- 1967-08-30 SE SE12043/67A patent/SE328863B/xx unknown
- 1967-09-04 CH CH1235467A patent/CH491598A/de not_active IP Right Cessation
- 1967-09-04 CS CS2504*[A patent/CS168498B2/cs unknown
- 1967-09-04 IL IL28598A patent/IL28598A/en unknown
- 1967-09-04 NO NO169594A patent/NO120813B/no unknown
- 1967-09-04 CS CS6299A patent/CS168497B2/cs unknown
- 1967-09-04 GB GB40291/67A patent/GB1205029A/en not_active Expired
- 1967-09-04 NL NL6712096.A patent/NL157299B/xx unknown
- 1967-09-05 JP JP42056954A patent/JPS5133965B1/ja active Pending
- 1967-09-05 BE BE703477D patent/BE703477A/xx unknown
-
1970
- 1970-07-10 US US053988A patent/US3879441A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CS168497B2 (enExample) | 1976-06-29 |
| NL6712096A (enExample) | 1968-03-06 |
| NO120813B (enExample) | 1970-12-07 |
| LU54163A1 (enExample) | 1967-09-25 |
| BG16313A3 (bg) | 1972-08-20 |
| FI45102C (fi) | 1972-03-10 |
| YU32367B (en) | 1974-10-31 |
| CH491598A (de) | 1970-06-15 |
| JPS5133965B1 (enExample) | 1976-09-22 |
| DK118074B (da) | 1970-07-06 |
| US3879441A (en) | 1975-04-22 |
| DE1643026A1 (de) | 1971-04-15 |
| DE1643026B2 (de) | 1976-01-22 |
| CS168498B2 (enExample) | 1976-06-29 |
| GB1205029A (en) | 1970-09-09 |
| BE703477A (enExample) | 1968-03-05 |
| ES344462A1 (es) | 1968-10-01 |
| IL28598A (en) | 1972-10-29 |
| SE328863B (enExample) | 1970-09-28 |
| NL157299B (nl) | 1978-07-17 |
| DE1593520B2 (de) | 1973-12-13 |
| FI45102B (enExample) | 1971-11-30 |
| YU168367A (en) | 1974-04-30 |
| DE1593520A1 (de) | 1970-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1567151C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel | |
| DE2501648A1 (de) | Substituierte pyridinyloxy-(thio)- phenyl-alkanamide und -harnstoffe | |
| DE1905599C2 (de) | Verwendung von Harnstoffen als selektive Herbizide | |
| DE1518815C3 (de) | m-(UreidophenyI)-carbaminsäureester, deren Herstellung und diese enthaltende herbizide Mittel | |
| DE1593520C3 (de) | 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung | |
| DE2141468B2 (de) | l-(2-Benzothiazolyl)-l-äthyl-3methyl-harnstoff, Verfahren zu seiner Herstellung sowie seine Verwendung als Herbizid | |
| DE2928410A1 (de) | Acylharnstoffe, insektizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung | |
| DE2108975B2 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| DE1620448B2 (de) | Harnstoff- bzw. Thioharnstoffderivate des 3-Methylisothiazols | |
| DE2341079C2 (de) | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe | |
| DE1643026C3 (de) | 4-(N-Carbamoyloxy)-phenyl-harnstoffe und -thioharnstoffe, sowie diese enthaltende Mittel mit selektiver herbizider Wirkung | |
| DE2121957C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| DE2428070C2 (de) | Butyramide und Butyrate, ihre Herstellung und diese enthaltende aphizide Mittel | |
| DE1291733B (de) | Verfahren zur Herstellung von N-Aryl-harnstoffen | |
| DE2310648C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel | |
| DE1242936B (de) | Selektive Herbizide | |
| DE2310649C3 (de) | Diurethane sowie diese enthaltende selektive herbizide Mittel | |
| DE1081453B (de) | Verfahren zur Herstellung von selektiv herbizid wirksamen Harnstoffderivaten | |
| DE1567163C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie herbizide und algizide Mittel enthaltend diese Verbindungen | |
| DE2042110C3 (de) | Substituierte Phenylthionocarbamate, Verfahren zu ihrer Herstellung und solche Carbamate enthaltende herbizide Mittel | |
| DE2320362A1 (de) | Dichlorthiazolylharnstoffe, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1932827B2 (de) | Cycloaliphatische imidazolidin-2-on- 1-carbonsaeure-amide, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide | |
| DE1567165C3 (de) | Algizide Mittel auf Carbamat-Basis | |
| DE1643039C3 (de) | Bromacetylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende biocide Mittel | |
| AT330221B (de) | Verfahren zur erhohung des ernteertrages von nutzpflanzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |