DE1572122B1 - Verfahren zur Herstellung von Bildern - Google Patents
Verfahren zur Herstellung von BildernInfo
- Publication number
- DE1572122B1 DE1572122B1 DE19651572122 DE1572122A DE1572122B1 DE 1572122 B1 DE1572122 B1 DE 1572122B1 DE 19651572122 DE19651572122 DE 19651572122 DE 1572122 A DE1572122 A DE 1572122A DE 1572122 B1 DE1572122 B1 DE 1572122B1
- Authority
- DE
- Germany
- Prior art keywords
- layer
- support
- photopolymerizable
- thick
- transparent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 5
- 239000010410 layer Substances 0.000 claims description 128
- 239000000463 material Substances 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 29
- -1 polymethylene methacrylate Polymers 0.000 claims description 25
- 239000000758 substrate Substances 0.000 claims description 22
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 15
- 239000002245 particle Substances 0.000 claims description 14
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 14
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 10
- 239000000178 monomer Substances 0.000 claims description 9
- 230000003287 optical effect Effects 0.000 claims description 9
- 239000000853 adhesive Substances 0.000 claims description 7
- 230000001070 adhesive effect Effects 0.000 claims description 7
- 239000006229 carbon black Substances 0.000 claims description 7
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 7
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 7
- 239000011888 foil Substances 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 claims description 5
- 238000004873 anchoring Methods 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 5
- YYVYAPXYZVYDHN-UHFFFAOYSA-N 9,10-phenanthroquinone Chemical compound C1=CC=C2C(=O)C(=O)C3=CC=CC=C3C2=C1 YYVYAPXYZVYDHN-UHFFFAOYSA-N 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- 239000002202 Polyethylene glycol Substances 0.000 claims description 4
- 239000012790 adhesive layer Substances 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 229920001223 polyethylene glycol Polymers 0.000 claims description 4
- 238000000926 separation method Methods 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 125000004386 diacrylate group Chemical group 0.000 claims description 3
- 238000001035 drying Methods 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 238000013517 stratification Methods 0.000 claims description 2
- YTPSFXZMJKMUJE-UHFFFAOYSA-N 2-tert-butylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(C(C)(C)C)=CC=C3C(=O)C2=C1 YTPSFXZMJKMUJE-UHFFFAOYSA-N 0.000 claims 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 claims 2
- 229910004298 SiO 2 Inorganic materials 0.000 claims 1
- 229910000831 Steel Inorganic materials 0.000 claims 1
- 239000011889 copper foil Substances 0.000 claims 1
- JVICFMRAVNKDOE-UHFFFAOYSA-M ethyl violet Chemical compound [Cl-].C1=CC(N(CC)CC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)=C1C=CC(=[N+](CC)CC)C=C1 JVICFMRAVNKDOE-UHFFFAOYSA-M 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 239000004071 soot Substances 0.000 claims 1
- 239000010959 steel Substances 0.000 claims 1
- 238000003756 stirring Methods 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 description 8
- 230000033458 reproduction Effects 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 238000003475 lamination Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000011230 binding agent Substances 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 230000005855 radiation Effects 0.000 description 5
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- 238000007639 printing Methods 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 3
- 238000012549 training Methods 0.000 description 3
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 2
- OVOUKWFJRHALDD-UHFFFAOYSA-N 2-[2-(2-acetyloxyethoxy)ethoxy]ethyl acetate Chemical compound CC(=O)OCCOCCOCCOC(C)=O OVOUKWFJRHALDD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 238000012644 addition polymerization Methods 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000012719 thermal polymerization Methods 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- AWKXKNCCQLNZDB-UHFFFAOYSA-N 2-[2-(2-propanoyloxyethoxy)ethoxy]ethyl propanoate Chemical compound CCC(=O)OCCOCCOCCOC(=O)CC AWKXKNCCQLNZDB-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- CMEWLCATCRTSGF-UHFFFAOYSA-N N,N-dimethyl-4-nitrosoaniline Chemical compound CN(C)C1=CC=C(N=O)C=C1 CMEWLCATCRTSGF-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical class CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- HVVWZTWDBSEWIH-UHFFFAOYSA-N [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate Chemical compound C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C HVVWZTWDBSEWIH-UHFFFAOYSA-N 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-M diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)([O-])OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-M 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000007645 offset printing Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000011088 parchment paper Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229940068886 polyethylene glycol 300 Drugs 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 239000001054 red pigment Substances 0.000 description 1
- 230000027272 reproductive process Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-M succinate(1-) Chemical compound OC(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-M 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- DJZKNOVUNYPPEE-UHFFFAOYSA-N tetradecane-1,4,11,14-tetracarboxamide Chemical compound NC(=O)CCCC(C(N)=O)CCCCCCC(C(N)=O)CCCC(N)=O DJZKNOVUNYPPEE-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/26—Processing photosensitive materials; Apparatus therefor
- G03F7/34—Imagewise removal by selective transfer, e.g. peeling away
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Laminated Bodies (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37562964A | 1964-06-16 | 1964-06-16 | |
| US403938A US3353955A (en) | 1964-06-16 | 1964-10-14 | Stratum transfer process based on adhesive properties of photopolymerizable layer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1572122B1 true DE1572122B1 (de) | 1970-04-02 |
Family
ID=27007131
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651572122 Pending DE1572122B1 (de) | 1964-06-16 | 1965-06-14 | Verfahren zur Herstellung von Bildern |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3353955A (enExample) |
| BE (1) | BE665463A (enExample) |
| DE (1) | DE1572122B1 (enExample) |
| FR (1) | FR1448143A (enExample) |
| GB (1) | GB1090663A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2149056A1 (de) * | 1970-10-05 | 1972-04-06 | Du Pont | Verfahren zur Reproduktion von Bildern |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3678850A (en) * | 1966-05-02 | 1972-07-25 | Xerox Corp | Porous printing plate prepared from particulate photosensitive resinous material |
| GB1233543A (enExample) * | 1967-06-01 | 1971-05-26 | ||
| US3607264A (en) * | 1967-11-22 | 1971-09-21 | Du Pont | Image reproduction process involving photohardening and delamination |
| US3615435A (en) * | 1968-02-14 | 1971-10-26 | Du Pont | Photohardenable image reproduction element with integral pigmented layer and process for use |
| US3622320A (en) * | 1968-02-29 | 1971-11-23 | Mona Armstrong Allen | Thermographic processes and elements utilizing photocrosslinkable polyesters |
| US3650746A (en) * | 1969-06-16 | 1972-03-21 | Grace W R & Co | Dual image formation on separate supports of photocurable composition |
| US3891441A (en) * | 1969-08-01 | 1975-06-24 | Fuji Photo Film Co Ltd | Light-sensitive stencil printing material with porous support and cover sheets |
| US3660088A (en) * | 1970-09-16 | 1972-05-02 | Grace W R & Co | Photo-resist process |
| CA993709A (en) * | 1971-01-21 | 1976-07-27 | Leo Roos | Composite, mask-forming photohardenable elements |
| DE2123702C3 (de) * | 1971-05-13 | 1988-05-26 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung eines Reliefbildes |
| US3770438A (en) * | 1971-12-09 | 1973-11-06 | J Celeste | Photopolymerizable transfer elements |
| GB1441982A (en) * | 1973-01-18 | 1976-07-07 | Autotype Co Ltd | Dry transfer sheets |
| DE2441600C3 (de) * | 1973-08-31 | 1986-05-07 | Ford-Werke AG, 5000 Köln | Verfahren zur Herstellung eines abriebsbeständigen und korrosionsbeständigen, mehrfach überzogenen Gegenstandes |
| DE2623850C3 (de) * | 1975-06-03 | 1981-03-26 | E.I. Du Pont De Nemours & Co., Wilmington, Del. | Lichtempfindliche Materialien und Bildreproduktionsverfahren |
| DE2651864C3 (de) * | 1975-11-17 | 1987-09-10 | E.I. Du Pont De Nemours And Co., Wilmington, Del. | Photopolymerisierbares Aufzeichnungsmaterial |
| US4205989A (en) | 1976-04-14 | 1980-06-03 | Kimoto & Co., Ltd. | Dry system image producing element |
| JPS6020735B2 (ja) * | 1976-06-28 | 1985-05-23 | 富士写真フイルム株式会社 | 剥離現像可能な感光材料を用いる画像形成方法 |
| JPS6024461B2 (ja) * | 1976-11-22 | 1985-06-13 | 富士写真フイルム株式会社 | ステツプタブレツト |
| US4347300A (en) * | 1977-06-02 | 1982-08-31 | Polychrome Corporation | Imaging peel apart element employing two photohardenable layers |
| NO774518L (no) * | 1977-06-02 | 1978-12-05 | Polychrome Corp | Nye bildedannende systemer og produkter til bruk i disse |
| JPS5479032A (en) * | 1977-12-06 | 1979-06-23 | Fuji Photo Film Co Ltd | Image formation emthod |
| US4289841A (en) * | 1978-02-26 | 1981-09-15 | E. I. Du Pont De Nemours And Company | Dry-developing photosensitive dry film resist |
| BE878405A (fr) * | 1978-08-24 | 1979-12-17 | Letraset Internat Ltd | Materiels photosensibles |
| US4291114A (en) * | 1978-10-18 | 1981-09-22 | Minnesota Mining And Manufacturing Co. | Imageable, composite-dry transfer sheet and process of using same |
| WO1981000627A1 (en) * | 1979-08-17 | 1981-03-05 | Minnesota Mining & Mfg | Imageable,composite dry-transfer sheet |
| US4357413A (en) * | 1980-04-28 | 1982-11-02 | E. I. Du Pont De Nemours And Company | Dry-developing photosensitive dry film resist |
| US4286043A (en) * | 1980-05-21 | 1981-08-25 | E. I. Du Pont De Nemours And Company | Negative-working dry peel apart photopolymer element with polyvinylformal binder |
| US4478967A (en) * | 1980-08-11 | 1984-10-23 | Minnesota Mining And Manufacturing Company | Photolabile blocked surfactants and compositions containing the same |
| US4369244A (en) * | 1980-08-11 | 1983-01-18 | Minnesota Mining And Manufacturing Company | Imaging process and article employing photolabile, blocked surfactant |
| US4599273A (en) * | 1980-08-11 | 1986-07-08 | Minnesota Mining And Manufacturing Co. | Photolabile blocked surfactants and compositions containing the same |
| US4467022A (en) * | 1980-08-11 | 1984-08-21 | Minnesota Mining And Manufacturing Company | Imaging process and article employing photolabile, blocked surfactant |
| US4526405A (en) * | 1982-12-17 | 1985-07-02 | Graphic Resources, Inc. | Label structure |
| US4740600A (en) * | 1984-05-10 | 1988-04-26 | Minnesota Mining And Manufacturing Company | Photolabile blocked surfactants and compositions containing the same |
| EP0321161A3 (en) * | 1987-12-15 | 1990-11-14 | Canon Kabushiki Kaisha | Photosensitive material, and image formation process and image formation apparatus using same |
| DE3830914A1 (de) * | 1988-09-10 | 1990-03-22 | Hoechst Ag | Photopolymerisierbares gemisch, daraus hergestelltes aufzeichnungsmaterial und verfahren zur herstellung von kopien |
| EP0413863A1 (en) * | 1989-08-24 | 1991-02-27 | Toyo Ink Manufacturing Co., Ltd. | Image-forming process and image-forming material |
| US5175072A (en) * | 1990-07-26 | 1992-12-29 | Minnesota Mining And Manufacturing Company | Flexographic printing plate process |
| US5215859A (en) * | 1990-07-26 | 1993-06-01 | Minnesota Mining And Manufacturing Company | Backside ionizing irradiation in a flexographic printing plate process |
| US5087549A (en) * | 1990-10-19 | 1992-02-11 | E. I. Du Pont De Nemours And Company | Image reproduction process using a peel-apart photosensitive element |
| US5565303A (en) * | 1990-12-19 | 1996-10-15 | Shaw; Sonya Y. | Photosensitive printing plate developed by a peel-apart process |
| DE4336115A1 (de) * | 1993-10-22 | 1995-04-27 | Hoechst Ag | Lichtempfindliches Material und Verfahren zur Herstellung von Flachdruckplatten |
| DE4415607A1 (de) * | 1994-05-04 | 1995-11-09 | Hoechst Ag | Lichtempfindliches Material und Verfahren zur Herstellung von Flachdruckplatten |
| DE4434278A1 (de) * | 1994-09-26 | 1996-03-28 | Hoechst Ag | Verfahren zur Herstellung einer Flachdruckform |
| GB2304201B (en) * | 1995-08-04 | 1999-04-07 | Sony Corp | Methods of forming a fluorescent screen on the front panel of a cathode ray tube |
| US20060154180A1 (en) | 2005-01-07 | 2006-07-13 | Kannurpatti Anandkumar R | Imaging element for use as a recording element and process of using the imaging element |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL87862C (enExample) * | 1951-08-20 | |||
| NL132290C (enExample) * | 1959-09-11 | |||
| US3219445A (en) * | 1962-04-09 | 1965-11-23 | Technical Operations Inc | Photographic processes |
| NL273285A (enExample) * | 1961-01-09 |
-
1964
- 1964-10-14 US US403938A patent/US3353955A/en not_active Expired - Lifetime
-
1965
- 1965-06-14 DE DE19651572122 patent/DE1572122B1/de active Pending
- 1965-06-15 FR FR20857A patent/FR1448143A/fr not_active Expired
- 1965-06-15 GB GB25309/65A patent/GB1090663A/en not_active Expired
- 1965-06-15 BE BE665463D patent/BE665463A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2149056A1 (de) * | 1970-10-05 | 1972-04-06 | Du Pont | Verfahren zur Reproduktion von Bildern |
Also Published As
| Publication number | Publication date |
|---|---|
| BE665463A (enExample) | 1965-12-15 |
| GB1090663A (en) | 1967-11-15 |
| FR1448143A (fr) | 1966-08-05 |
| US3353955A (en) | 1967-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1906668C3 (de) | Fotografisches Aufzeichnungsmaterial für Bildreproduktionen und Verfahren zu seiner Herstellung sowie ein Reproduktionsverfahren | |
| DE2004214C3 (de) | Verfahren zur Herstellung von mehrfarbigen Bildern | |
| DE2215090C3 (de) | Fotopolymerisierbares Aufzeichnungsmaterial | |
| DE1225048B (de) | Photopolymerisierbares Aufzeichnungsmaterial und Verfahren zum Herstellen von Bildern | |
| US3353955A (en) | Stratum transfer process based on adhesive properties of photopolymerizable layer | |
| DE3023247C2 (de) | Lichtempfindliches Aufzeichnungsmaterial | |
| DE1171267B (de) | Verfahren zur Herstellung von uebertrag-baren Bildern, sowie hierfuer geeignetes, photo-graphisches Material | |
| DE1809926A1 (de) | Verfahren zur Bildwiedergabe | |
| DE1904058A1 (de) | Verfahren zur Reproduktion von Bildern | |
| DE1267547B (de) | Photopolymerisierbare Schicht | |
| DE2243182B2 (de) | Fotopolymerisierbares Aufzeichnungsmaterial | |
| DE2149056C3 (de) | Verfahren zur Reproduktion von Bildern | |
| DE3340210C2 (de) | Lichtempfindliches Material und Verfahren zur Herstellung eines Bildes | |
| DE2522656A1 (de) | Farbpruefverfahren durch uebertragen von teilfarbenbildern | |
| DE1422942A1 (de) | Reproduktionsverfahren und Vorrichtung zu seiner Durchfuehrung | |
| DE1285876B (de) | Fotopolymerisierbares Aufzeichnungsmaterial | |
| DE3020978A1 (de) | Verfahren zur herstellung eines mehrfarben-pruefbildes | |
| DE2631837C2 (de) | Lichtempfindliches Gemisch, dessen Verwendung zur Herstellung von Flexodruckformen und eine Flexodruckplatte | |
| DE2623850C3 (de) | Lichtempfindliche Materialien und Bildreproduktionsverfahren | |
| DE1572122C (de) | Verfahren zur Herstellung von Bildern | |
| DE2945564C2 (enExample) | ||
| DE69227043T2 (de) | Verfahren zur herstellung von lichtempfindlichem elastomeren mit verbessertem belichtungsspielraum | |
| DE2949462C2 (de) | Verfahren zur Herstellung von farbigen Bildern | |
| DE1422942C (de) | Verfahren zur Herstellung von BiI dem und Vorrichtung zu seiner Durchfuh rung | |
| DE1904058C (de) | Verfahren zur Reproduktion von BiI dem |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 |