DE1543456A1 - Verfahren zur Herstellung von organischen Borverbindungen - Google Patents
Verfahren zur Herstellung von organischen BorverbindungenInfo
- Publication number
- DE1543456A1 DE1543456A1 DE19661543456 DE1543456A DE1543456A1 DE 1543456 A1 DE1543456 A1 DE 1543456A1 DE 19661543456 DE19661543456 DE 19661543456 DE 1543456 A DE1543456 A DE 1543456A DE 1543456 A1 DE1543456 A1 DE 1543456A1
- Authority
- DE
- Germany
- Prior art keywords
- boron
- compound
- ether
- reaction
- organic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001639 boron compounds Chemical class 0.000 title claims description 22
- 238000000034 method Methods 0.000 title claims description 21
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 43
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 229910052749 magnesium Inorganic materials 0.000 claims description 13
- 239000011777 magnesium Substances 0.000 claims description 13
- -1 boron halides Chemical class 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 10
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical class OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000004327 boric acid Substances 0.000 claims description 5
- 229910052796 boron Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- KUGSJJNCCNSRMM-UHFFFAOYSA-N ethoxyboronic acid Chemical class CCOB(O)O KUGSJJNCCNSRMM-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 9
- PPWPWBNSKBDSPK-UHFFFAOYSA-N [B].[C] Chemical compound [B].[C] PPWPWBNSKBDSPK-UHFFFAOYSA-N 0.000 description 5
- 235000010338 boric acid Nutrition 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 150000001350 alkyl halides Chemical class 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910052810 boron oxide Inorganic materials 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- MLSKXPOBNQFGHW-UHFFFAOYSA-N methoxy(dioxido)borane Chemical compound COB([O-])[O-] MLSKXPOBNQFGHW-UHFFFAOYSA-N 0.000 description 2
- 150000002895 organic esters Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical class BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 150000005524 benzylchlorides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000005619 boric acid group Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- BMFIQAXLYWLZAE-UHFFFAOYSA-N ethyl bromite Chemical compound C(C)OBr=O BMFIQAXLYWLZAE-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- YCCXQARVHOPWFJ-UHFFFAOYSA-M magnesium;ethane;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C YCCXQARVHOPWFJ-UHFFFAOYSA-M 0.000 description 1
- UYVXZUTYZGILQG-UHFFFAOYSA-N methoxyboronic acid Chemical class COB(O)O UYVXZUTYZGILQG-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F5/00—Compounds containing elements of Groups 3 or 13 of the Periodic Table
- C07F5/02—Boron compounds
- C07F5/027—Organoboranes and organoborohydrides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT360765 | 1965-02-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1543456A1 true DE1543456A1 (de) | 1969-05-22 |
Family
ID=11110545
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661543456 Pending DE1543456A1 (de) | 1965-02-22 | 1966-02-18 | Verfahren zur Herstellung von organischen Borverbindungen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3475496A (enEXAMPLES) |
| BE (1) | BE676824A (enEXAMPLES) |
| CH (1) | CH457425A (enEXAMPLES) |
| DE (1) | DE1543456A1 (enEXAMPLES) |
| ES (1) | ES323882A1 (enEXAMPLES) |
| GB (1) | GB1133933A (enEXAMPLES) |
| IL (1) | IL25177A (enEXAMPLES) |
| LU (1) | LU50486A1 (enEXAMPLES) |
| NL (1) | NL6601846A (enEXAMPLES) |
| SE (1) | SE325878B (enEXAMPLES) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4076756A (en) * | 1975-11-12 | 1978-02-28 | E. I. Du Pont De Nemours And Company | Process for the preparation of triarylborane |
| US4046815A (en) * | 1975-11-12 | 1977-09-06 | E. I. Du Pont De Nemours And Company | Process for the preparation of triarylborane |
| US4747931A (en) * | 1985-09-06 | 1988-05-31 | Betz Laboratories, Inc. | Composition and method for coke retardant during pyrolytic hydrocarbon processing |
| US5600004A (en) * | 1995-02-21 | 1997-02-04 | Albemarle Corporation | Process for preparing pentafluorophenyl compounds |
| US5693261A (en) * | 1995-02-21 | 1997-12-02 | Albemarle Corporation | Preparation of pentafluorophenyl compounds |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880243A (en) * | 1956-05-09 | 1959-03-31 | Olin Mathieson | Manufacture of trisubstituted boranes |
| US3090801A (en) * | 1956-07-06 | 1963-05-21 | American Potash & Chem Corp | Aryl polyboronic acids and esters and process for their preparation |
| US2925438A (en) * | 1957-02-01 | 1960-02-16 | Herbert C Brown | Method of converting unsaturated organic compounds to organoboron compounds |
| US2862952A (en) * | 1957-08-26 | 1958-12-02 | American Cyanamid Co | Method of preparing b-hydrocarbonsubstituted boron compounds |
| US2884441A (en) * | 1957-10-21 | 1959-04-28 | American Cyanamid Co | Method of preparing b-hydrocarbonsubstituted boron compounds |
| US2992267A (en) * | 1957-10-23 | 1961-07-11 | Studiengesellschaft Kohle Mbh | Processes for the production of alkyl boric acid esters and free alkyl boric acids |
| US3030406A (en) * | 1958-10-08 | 1962-04-17 | Robert M Washburn | Aliphatic boronic acids and esters |
| US3078311A (en) * | 1960-01-21 | 1963-02-19 | Herbert C Brown | Catalytic process for preparing organoboron compounds from diborane |
| NL6415119A (enEXAMPLES) * | 1964-01-02 | 1965-07-05 |
-
1966
- 1966-02-14 NL NL6601846A patent/NL6601846A/xx unknown
- 1966-02-15 IL IL25177A patent/IL25177A/xx unknown
- 1966-02-16 GB GB6859/66A patent/GB1133933A/en not_active Expired
- 1966-02-16 US US527762A patent/US3475496A/en not_active Expired - Lifetime
- 1966-02-18 LU LU50486A patent/LU50486A1/xx unknown
- 1966-02-18 DE DE19661543456 patent/DE1543456A1/de active Pending
- 1966-02-21 SE SE02178/66A patent/SE325878B/xx unknown
- 1966-02-21 BE BE676824D patent/BE676824A/xx unknown
- 1966-02-22 CH CH252666A patent/CH457425A/de unknown
- 1966-02-22 ES ES0323882A patent/ES323882A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH457425A (de) | 1968-06-15 |
| ES323882A1 (es) | 1967-01-16 |
| SE325878B (enEXAMPLES) | 1970-07-13 |
| NL6601846A (enEXAMPLES) | 1966-08-23 |
| US3475496A (en) | 1969-10-28 |
| IL25177A (en) | 1969-11-30 |
| GB1133933A (en) | 1968-11-20 |
| LU50486A1 (enEXAMPLES) | 1966-04-18 |
| BE676824A (enEXAMPLES) | 1966-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| DE1618254B1 (de) | Verfahren zur Herstellung von Bromverbindungen aus Alkoholen aus Brom | |
| DE495533C (de) | Verfahren zur Herstellung von Alkylverbindungen des Bleis | |
| EP0114394A2 (de) | Verfahren zur Herstellung von Polymerisaten der Vinylphosphonsäure in protischen Lösungsmitteln | |
| DE1543456A1 (de) | Verfahren zur Herstellung von organischen Borverbindungen | |
| DE2341743B2 (de) | Verfahren zur Herstellung einer Mischung aus Brenzkatechin und Hydrochinon | |
| DE2756377A1 (de) | Verfahren zur herstellung eines polyphenylenoxids durch oxidative kupplung | |
| DE1951032B2 (de) | Verfahren zur Herstellung von Cyanessigsäureestern | |
| AT256127B (de) | Verfahren zur Herstellung von organischen Borverbindungen | |
| DE2443179A1 (de) | Verfahren zur herstellung von perchlormethylbenzol | |
| DE1238028B (de) | Verfahren zur Durchfuehrung der kontinuierlichen Cyanaethylierung von ein- oder mehrwertigen Alkoholen oder Thiolen | |
| DE2623836A1 (de) | Verfahren zur herstellung von quadratsaeure | |
| AT264541B (de) | Verfahren zur Herstellung organischer, Bor-Kohlenstoffbindungen aufweisender Borderivate | |
| DE1593421C3 (de) | Verfahren zur Herstellung kationischer Esterverbindungen | |
| DE2364181B2 (de) | Verfahren zur Herstellung von aromatischen Dihydroxyverbindungen oder deren Monoäthern | |
| DE2518936C2 (de) | Verfahren zur Herstellung von Succinylobernsteinsäure-C↓1↓-bis C↓4↓-dialkyl-ester | |
| DE1060397B (de) | Verfahren zur Herstellung von metallorganischen Verbindungen des Nickels | |
| DE1232944B (de) | Verfahren zur Herstellung von meso-2, 3-Dibrombernsteinsaeure | |
| DE1940705C3 (de) | Verfahren zur Herstellung von Cyanacetylen aus Acrylnitril | |
| AT254853B (de) | Verfahren zur Halogenierung der kernständigen Methylgruppe(n) von Methylphenylacetaten | |
| DE1920690C (de) | Verfahren zur Herstellung von Biallyl verbindungen | |
| DE1294376B (de) | Verfahren zur Herstellung von quartaeren Phosphoniumhalogeniden | |
| DE69111280T2 (de) | Verfahren zur Herstellung von Methylphenyltrisiloxan. | |
| DE1110636B (de) | Verfahren zur Herstellung von Cyclopropankohlenwasserstoffen | |
| DE1568371C (de) | Verfahren zur kontinuierlichen Her stellung von 1,1 Dichlorathan |